primera subida

.idea/.gitignore

@@ -0,0 +1,3 @@
+# Default ignored files
+/shelf/
+/workspace.xml

.idea/PVPlant.iml

@@ -0,0 +1,8 @@
+<?xml version="1.0" encoding="UTF-8"?>
+<module type="PYTHON_MODULE" version="4">
+  <component name="NewModuleRootManager">
+    <content url="file://$MODULE_DIR$" />
+    <orderEntry type="inheritedJdk" />
+    <orderEntry type="sourceFolder" forTests="false" />
+  </component>
+</module>

.idea/inspectionProfiles/Project_Default.xml

@@ -0,0 +1,12 @@
+<component name="InspectionProjectProfileManager">
+  <profile version="1.0">
+    <option name="myName" value="Project Default" />
+    <inspection_tool class="PyPep8NamingInspection" enabled="true" level="WEAK WARNING" enabled_by_default="true">
+      <option name="ignoredErrors">
+        <list>
+          <option value="N802" />
+        </list>
+      </option>
+    </inspection_tool>
+  </profile>
+</component>

.idea/inspectionProfiles/profiles_settings.xml

@@ -0,0 +1,6 @@
+<component name="InspectionProjectProfileManager">
+  <settings>
+    <option name="USE_PROJECT_PROFILE" value="false" />
+    <version value="1.0" />
+  </settings>
+</component>

.idea/misc.xml

@@ -0,0 +1,7 @@
+<?xml version="1.0" encoding="UTF-8"?>
+<project version="4">
+  <component name="Black">
+    <option name="sdkName" value="Python 3.10" />
+  </component>
+  <component name="ProjectRootManager" version="2" project-jdk-name="Python 3.10" project-jdk-type="Python SDK" />
+</project>

.idea/modules.xml

@@ -0,0 +1,8 @@
+<?xml version="1.0" encoding="UTF-8"?>
+<project version="4">
+  <component name="ProjectModuleManager">
+    <modules>
+      <module fileurl="file://$PROJECT_DIR$/.idea/PVPlant.iml" filepath="$PROJECT_DIR$/.idea/PVPlant.iml" />
+    </modules>
+  </component>
+</project>

.idea/vcs.xml

@@ -0,0 +1,6 @@
+<?xml version="1.0" encoding="UTF-8"?>
+<project version="4">
+  <component name="VcsDirectoryMappings">
+    <mapping directory="" vcs="Git" />
+  </component>
+</project>

Civil/Trench/TrenchOperators.py

@@ -0,0 +1,201 @@
+
+def getcenter(lEdges, r):
+    import math
+    rndEdges = lEdges[0:2]
+    rndEdges = Part.__sortEdges__(rndEdges)
+
+    lVertexes = rndEdges[0].Vertexes + [rndEdges[1].Vertexes[-1]]
+    U1 = lVertexes[0].Point.sub(lVertexes[1].Point)
+    U1.normalize()
+    U2 = lVertexes[2].Point.sub(lVertexes[1].Point)
+    U2.normalize()
+
+    alpha = U1.getAngle(U2)
+    # Edges have same direction
+    '''if (round(alpha, 0) == 0) or (round(alpha - math.pi, 0) == 0):
+        pt1 = FreeCAD.Vector(U1)
+        x = pt1.x
+        pt1.x = pt1.y
+        pt1.y = -x
+        return rndEdges
+        pointsDirection = lineSelected.discretize(Number=500)  # discretize the path line first selection
+        v = pointsDirection[0].sub(pointsDirection[1])  # avec vecteurs 1 et 2 (direction debut ligne)
+        r = App.Rotation(App.Vector(0, 0, 1), v)'''
+
+    dToCenter = r / math.sin(alpha / 2.0)
+    # dToTangent = (dToCenter ** 2 - r ** 2) ** 0.5
+    dirVect = U2.add(U1)
+    dirVect.normalize()
+    dirVect.scale(dToCenter, dToCenter, dToCenter)
+    pt1 = lVertexes[1].Point.add(dirVect)
+    pt2 = -1 * pt1
+    pt2.z = pt1.z
+    print(pt1, " - ", pt2)
+    return [pt1, pt2]
+
+# from DRAFT
+def split_wire(wire, newPoint, edgeIndex):
+    import Draft
+    wire1Points = []
+    wire2Points = []
+    print("New Point: ", newPoint)
+    print("edgeIndex: ", edgeIndex)
+    for index, point in enumerate(wire.Points):
+        print("index: ", index, " - point: ", point)
+        if index == edgeIndex:
+            wire1Points.append(point)
+            wire1Points.append(wire.Placement.inverse().multVec(newPoint))
+            wire2Points.append(newPoint)
+            # wire2Points.append(wire.Placement.multVec(point))
+        elif index < edgeIndex:
+            wire1Points.append(point)
+        elif index > edgeIndex:
+            wire2Points.append(wire.Placement.multVec(point))
+    if len(wire1Points) == 1:
+        wire1Points.insert(0, wire.Points[0])
+    if len(wire2Points) == 1:
+        wire2Points.appen(wire.Points[-1])
+    wire.Points = wire1Points
+    wire2 = Draft.makeWire(wire2Points, placement=wire.Placement)
+    FreeCAD.ActiveDocument.recompute()
+    wires = [wire, wire2]
+    return sorted(wires, key=lambda obj: obj.Length, reverse=True)
+
+
+def SplitTrench(trench, point):
+    if not trench or not point:
+        return None
+
+    import Part
+    wire = trench.Base
+    vertex = Part.Vertex(point)
+
+    '''Find the minimum distance to another shape:
+
+    - distToShape(shape) -> (dist, vectors, infos) dist is the minimum distance, in mm (float value).
+        vectors is a list of pairs of App.Vector. Each pair corresponds to solution.
+
+    Example: 
+      [(Vector (2.0, -1.0, 2.0), Vector (2.0, 0.0, 2.0)), (Vector (2.0,-1.0, 2.0), Vector (2.0, -1.0, 3.0))] 
+        - First vector is a point on self, second vector is a point on s.
+      infos contains additional info on the solutions. It is a list of tuples: (topo1, index1, params1, topo2, index2, params2)
+        - topo1, topo2 are strings identifying type of BREP element: 'Vertex', 'Edge', or 'Face'.
+        - index1, index2 are indexes of the elements (zero-based).
+        - params1, params2 are parameters of internal space of the elements. For vertices, params is None. 
+          For edges, params is one float, u. For faces, params is a tuple (u,v).
+    (719762.0578530617, 
+    [(Vector (225057.375, 783988.625, 715062.875), Vector (306961.4605149741, 778138.3688035253, 0.0))], 
+    [('Vertex', 0, None, 'Edge', 0, 79697.52668425611)])
+    '''
+
+    (dist, vectors, infos) = vertex.distToShape(wire.Shape)
+    if not dist:
+        return None
+
+    Location = FreeCAD.Vector(vectors[0][1])
+    if not Location:
+        return None
+
+    Normal = None
+    edind = 0
+    if infos[0][3] == 'Vertex':
+        vec = Location.sub(point)
+        Normal = FreeCAD.Vector(vec[1], -vec[0], vec[2])
+        edind = int(infos[0][4]) - 1
+    elif infos[0][3] == 'Edge':
+        ed = wire.Shape.Edges[int(dist[2][0][4])]
+        Normal = ed.Vertexes[1].Point.sub(ed.Vertexes[0].Point)
+        edind = int(infos[0][4])
+
+    wires = split_wire(wire, Location, edind)
+    trench.Base = wires[0]
+    trench1 = makeTrench(wire[1])
+    return Location, [trench, trench1], node
+
+def JoinTrench(trench1, trench2):
+    if not trench1 or not trench2:
+        return None
+
+
+class CommandSplitTrench:  # V1:
+    """Gui command for the Line tool."""
+
+    def GetResources(self):
+        """Set icon, menu and tooltip."""
+        return {'Pixmap': str(os.path.join(DirIcons, "trench.svg")),
+                'MenuText': "Trench",
+                'Accel': "C, T",
+                'ToolTip': "Creates a Trench object from setup dialog."}
+
+    def IsActive(self):
+        return (not (FreeCAD.ActiveDocument is None) and
+                not (FreeCAD.ActiveDocument.getObject("Trench") is None))
+
+    def Activated(self):
+        """Execute when the command is called."""
+
+        sel = FreeCADGui.Selection.getSelection()
+        done = False
+
+        if len(sel) > 0:
+            import Draft
+            for obj in sel:
+                if Draft.getType(obj) == "Wire":
+                    FreeCAD.ActiveDocument.openTransaction("Create Trench")
+                    makeTrench(obj)
+                    FreeCAD.ActiveDocument.commitTransaction()
+                    FreeCAD.ActiveDocument.recompute()
+                    done = True
+                    break
+
+        if not done:
+            taskd = TrenchTaskPanel()
+            if taskd:
+                FreeCADGui.Control.showDialog(taskd)
+            else:
+                print(" No ha sido posible crear el formulario")
+
+
+class CommandJoinTrench:  # V1:
+    """Gui command for the Line tool."""
+
+    def GetResources(self):
+        """Set icon, menu and tooltip."""
+        return {'Pixmap': str(os.path.join(DirIcons, "trenchsplit.svg")),
+                'MenuText': "Semi-Automatic Trench Generator",
+                'Accel': "T, S",
+                'ToolTip': "Creates a Trench object from setup dialog."}
+
+    def IsActive(self):
+        return (not (FreeCAD.ActiveDocument is None) and
+                not (FreeCAD.ActiveDocument.getObject("Trench") is None))
+
+    def Activated(self):
+        """Execute when the command is called."""
+        semi = semiAutomaticTrench()
+
+
+if FreeCAD.GuiUp:
+    class CommandTrenchGroup:
+
+        def GetCommands(self):
+            return tuple(['PVPlantSplitTrench',
+                          'PVPlantJoinTrench',
+                          ])
+
+        def GetResources(self):
+            return {'MenuText': 'Trench operations',
+                    'ToolTip': 'Trench operations'
+                    }
+
+        def IsActive(self):
+            active = not (FreeCAD.ActiveDocument is None)
+            terrain = not (FreeCAD.ActiveDocument.getObject("Terrain") is None)
+            active = active and terrain
+            if terrain:
+                active = active and not (FreeCAD.ActiveDocument.getObject("Terrain").Mesh is None)
+            return active
+
+    FreeCADGui.addCommand('PVPlantTrench', CommandTrench())
+    FreeCADGui.addCommand('PVPlantSemiAutomaticTrench', CommandSemiAutomaticTrench())
+    FreeCADGui.addCommand('Trenches', CommandTrenchGroup())

CompositeListWidgetExample/CompositeListWidgetExample.pro

@@ -0,0 +1,23 @@
+#-------------------------------------------------
+#
+# Project created by QtCreator 2016-04-12T20:54:56
+#
+#-------------------------------------------------
+
+QT       += core gui
+
+greaterThan(QT_MAJOR_VERSION, 4): QT += widgets
+
+TARGET = CompositeListWidgetExample
+TEMPLATE = app
+
+
+SOURCES += main.cpp\
+        qmainwidget.cpp \
+    thewidgetitem.cpp
+
+HEADERS  += qmainwidget.h \
+    thewidgetitem.h
+
+FORMS    += qmainwidget.ui \
+    thewidgetitem.ui

CompositeListWidgetExample/README.md

@@ -0,0 +1,5 @@
+# Composite List Widget Example [Quick Qt 3]
+
+![img](https://cdn-images-1.medium.com/max/880/1*1Q6ypFyuBSfR4uccKeCdqg.png)
+
+

CompositeListWidgetExample/main.cpp

@@ -0,0 +1,10 @@
+#include "qmainwidget.h"
+#include <QApplication>
+
+int main(int argc, char *argv[])
+{
+    QApplication a(argc, argv);
+    QMainWidget w;
+    w.show();
+    return a.exec();
+}

CompositeListWidgetExample/qmainwidget.cpp

@@ -0,0 +1,38 @@
+#include "qmainwidget.h"
+#include "ui_qmainwidget.h"
+
+QMainWidget::QMainWidget(QWidget *parent) :
+    QWidget(parent),
+    ui(new Ui::QMainWidget)
+{
+    ui->setupUi(this);
+}
+
+QMainWidget::~QMainWidget()
+{
+    delete ui;
+}
+
+void QMainWidget::on_addBtn_clicked()
+{
+    //Creating a new list widget item whose parent is the listwidget itself
+    QListWidgetItem *listWidgetItem = new QListWidgetItem(ui->listWidget);
+
+    //Adding the item to the listwidget
+    ui->listWidget->addItem (listWidgetItem);
+
+    //Creating an object of the designed widget which is to be added to the listwidget
+    TheWidgetItem *theWidgetItem = new TheWidgetItem;
+
+    //Making sure that the listWidgetItem has the same size as the TheWidgetItem
+    listWidgetItem->setSizeHint (theWidgetItem->sizeHint ());
+
+    //Finally adding the itemWidget to the list
+    ui->listWidget->setItemWidget (listWidgetItem, theWidgetItem);
+}
+
+void QMainWidget::on_delBtn_clicked()
+{
+    //Delete selected item from the listWidget
+    delete ui->listWidget->currentItem ();
+}

CompositeListWidgetExample/qmainwidget.h

@@ -0,0 +1,34 @@
+#ifndef QMAINWIDGET_H
+#define QMAINWIDGET_H
+
+#include <QWidget>
+#include <QListWidget>
+#include <QListWidgetItem>
+#include "thewidgetitem.h"
+#include <QVector>
+#include <QDebug>
+
+namespace Ui {
+class QMainWidget;
+}
+
+class QMainWidget : public QWidget
+{
+    Q_OBJECT
+
+public:
+    explicit QMainWidget(QWidget *parent = 0);
+    ~QMainWidget();
+
+    QVector <TheWidgetItem*> itemVec;
+
+private slots:
+    void on_addBtn_clicked();
+
+    void on_delBtn_clicked();
+
+private:
+    Ui::QMainWidget *ui;
+};
+
+#endif // QMAINWIDGET_H

CompositeListWidgetExample/qmainwidget.ui

@@ -0,0 +1,47 @@
+<?xml version="1.0" encoding="UTF-8"?>
+<ui version="4.0">
+ <class>QMainWidget</class>
+ <widget class="QWidget" name="QMainWidget">
+  <property name="geometry">
+   <rect>
+    <x>0</x>
+    <y>0</y>
+    <width>459</width>
+    <height>329</height>
+   </rect>
+  </property>
+  <property name="windowTitle">
+   <string>QMainWidget</string>
+  </property>
+  <layout class="QGridLayout" name="gridLayout">
+   <item row="0" column="0">
+    <layout class="QVBoxLayout" name="verticalLayout">
+     <item>
+      <widget class="QListWidget" name="listWidget"/>
+     </item>
+     <item>
+      <layout class="QHBoxLayout" name="horizontalLayout">
+       <item>
+        <widget class="QPushButton" name="addBtn">
+         <property name="text">
+          <string>Add Widget Item</string>
+         </property>
+        </widget>
+       </item>
+       <item>
+        <widget class="QPushButton" name="delBtn">
+         <property name="text">
+          <string>Delete Selected Item</string>
+         </property>
+        </widget>
+       </item>
+      </layout>
+     </item>
+    </layout>
+   </item>
+  </layout>
+ </widget>
+ <layoutdefault spacing="6" margin="11"/>
+ <resources/>
+ <connections/>
+</ui>

CompositeListWidgetExample/thewidgetitem.cpp

@@ -0,0 +1,26 @@
+#include "thewidgetitem.h"
+#include "ui_thewidgetitem.h"
+
+TheWidgetItem::TheWidgetItem(QWidget *parent) :
+    QWidget(parent),
+    ui(new Ui::TheWidgetItem)
+{
+    ui->setupUi(this);
+}
+
+TheWidgetItem::~TheWidgetItem()
+{
+    delete ui;
+}
+
+void TheWidgetItem::on_pressThisBtn_clicked()
+{
+    //Getting text from lineEdit and setting it to the label
+    ui->label->setText (ui->lineEdit->text ());
+}
+
+void TheWidgetItem::on_horizontalSlider_valueChanged(int value)
+{
+    //Connecting slider with the progressbar
+    ui->progressBar->setValue (value);
+}

CompositeListWidgetExample/thewidgetitem.h

@@ -0,0 +1,32 @@
+#ifndef THEWIDGETITEM_H
+#define THEWIDGETITEM_H
+
+#include <QWidget>
+#include <QLineEdit>
+#include <QPushButton>
+#include <QSlider>
+#include <QProgressBar>
+#include <QLabel>
+
+namespace Ui {
+class TheWidgetItem;
+}
+
+class TheWidgetItem : public QWidget
+{
+    Q_OBJECT
+
+public:
+    explicit TheWidgetItem(QWidget *parent = 0);
+    ~TheWidgetItem();
+
+private slots:
+    void on_pressThisBtn_clicked();
+
+    void on_horizontalSlider_valueChanged(int value);
+
+private:
+    Ui::TheWidgetItem *ui;
+};
+
+#endif // THEWIDGETITEM_H

CompositeListWidgetExample/thewidgetitem.ui

@@ -0,0 +1,71 @@
+<?xml version="1.0" encoding="UTF-8"?>
+<ui version="4.0">
+ <class>TheWidgetItem</class>
+ <widget class="QWidget" name="TheWidgetItem">
+  <property name="geometry">
+   <rect>
+    <x>0</x>
+    <y>0</y>
+    <width>363</width>
+    <height>83</height>
+   </rect>
+  </property>
+  <property name="windowTitle">
+   <string>Form</string>
+  </property>
+  <layout class="QGridLayout" name="gridLayout">
+   <item row="0" column="0">
+    <layout class="QVBoxLayout" name="verticalLayout">
+     <item>
+      <layout class="QHBoxLayout" name="horizontalLayout_2">
+       <item>
+        <widget class="QLineEdit" name="lineEdit">
+         <property name="placeholderText">
+          <string>Write something</string>
+         </property>
+        </widget>
+       </item>
+       <item>
+        <widget class="QPushButton" name="pressThisBtn">
+         <property name="text">
+          <string>Press this</string>
+         </property>
+        </widget>
+       </item>
+       <item>
+        <widget class="QLabel" name="label">
+         <property name="text">
+          <string>Text from lineEdit</string>
+         </property>
+        </widget>
+       </item>
+      </layout>
+     </item>
+     <item>
+      <layout class="QHBoxLayout" name="horizontalLayout">
+       <item>
+        <widget class="QSlider" name="horizontalSlider">
+         <property name="maximum">
+          <number>100</number>
+         </property>
+         <property name="orientation">
+          <enum>Qt::Horizontal</enum>
+         </property>
+        </widget>
+       </item>
+       <item>
+        <widget class="QProgressBar" name="progressBar">
+         <property name="value">
+          <number>0</number>
+         </property>
+        </widget>
+       </item>
+      </layout>
+     </item>
+    </layout>
+   </item>
+  </layout>
+ </widget>
+ <resources/>
+ <connections/>
+</ui>

DEM/importLidar.py

@@ -0,0 +1,6 @@
+import numpy as np
+import laspy as lpinput_path="gdrive/My Drive/10-MEDIUM/DATA/Point Cloud Sample/"
+dataname="NZ19_Wellington.las"point_cloud=lp.file.File(input_path+dataname+".las", mode="r")
+
+points = np.vstack((point_cloud.x, point_cloud.y, point_cloud.z)).transpose()
+colors = np.vstack((point_cloud.red, point_cloud.green, point_cloud.blue)).transpose()

DataImport.ui

@@ -0,0 +1,103 @@
+<?xml version="1.0" encoding="UTF-8"?>
+<ui version="4.0">
+ <class>formDataImport</class>
+ <widget class="QWidget" name="formDataImport">
+  <property name="geometry">
+   <rect>
+    <x>0</x>
+    <y>0</y>
+    <width>497</width>
+    <height>396</height>
+   </rect>
+  </property>
+  <property name="windowTitle">
+   <string>Form</string>
+  </property>
+  <layout class="QGridLayout" name="gridLayout">
+   <item row="1" column="0" colspan="2">
+    <widget class="QFrame" name="frame">
+     <property name="frameShape">
+      <enum>QFrame::HLine</enum>
+     </property>
+     <property name="frameShadow">
+      <enum>QFrame::Raised</enum>
+     </property>
+     <property name="lineWidth">
+      <number>1</number>
+     </property>
+    </widget>
+   </item>
+   <item row="3" column="0">
+    <spacer name="verticalSpacer">
+     <property name="orientation">
+      <enum>Qt::Vertical</enum>
+     </property>
+     <property name="sizeHint" stdset="0">
+      <size>
+       <width>20</width>
+       <height>40</height>
+      </size>
+     </property>
+    </spacer>
+   </item>
+   <item row="0" column="0">
+    <widget class="QGroupBox" name="groupBox_2">
+     <property name="title">
+      <string>Importar datos desde:</string>
+     </property>
+     <layout class="QVBoxLayout" name="verticalLayout">
+      <item>
+       <widget class="QRadioButton" name="radioInternet">
+        <property name="text">
+         <string>Importar nube desde Google</string>
+        </property>
+       </widget>
+      </item>
+      <item>
+       <widget class="QRadioButton" name="radioFile">
+        <property name="text">
+         <string>Nube de puntos desde archivo</string>
+        </property>
+       </widget>
+      </item>
+      <item>
+       <widget class="QRadioButton" name="radioButton_3">
+        <property name="text">
+         <string>RadioButton</string>
+        </property>
+       </widget>
+      </item>
+     </layout>
+    </widget>
+   </item>
+   <item row="2" column="0">
+    <widget class="QGroupBox" name="groupBox">
+     <property name="title">
+      <string>Archivo:</string>
+     </property>
+     <layout class="QGridLayout" name="gridLayout_2">
+      <item row="0" column="0">
+       <widget class="QLabel" name="label_5">
+        <property name="text">
+         <string>Archivo:</string>
+        </property>
+       </widget>
+      </item>
+      <item row="0" column="1">
+       <widget class="QLineEdit" name="lineEdit_4"/>
+      </item>
+      <item row="0" column="2">
+       <widget class="QPushButton" name="buttonSel">
+        <property name="text">
+         <string>Sel</string>
+        </property>
+       </widget>
+      </item>
+     </layout>
+    </widget>
+   </item>
+  </layout>
+ </widget>
+ <resources/>
+ <connections/>
+</ui>

Electrical/Cable/PVPlantCable.py

@@ -0,0 +1,333 @@
+# /**********************************************************************
+# *                                                                     *
+# * Copyright (c) 2021 Javier Braña <javier.branagutierrez@gmail.com>  *
+# *                                                                     *
+# * This program is free software; you can redistribute it and/or modify*
+# * it under the terms of the GNU Lesser General Public License (LGPL)  *
+# * as published by the Free Software Foundation; either version 2 of   *
+# * the License, or (at your option) any later version.                 *
+# * for detail see the LICENCE text file.                               *
+# *                                                                     *
+# * This program is distributed in the hope that it will be useful,     *
+# * but WITHOUT ANY WARRANTY; without even the implied warranty of      *
+# * MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE.  See the       *
+# * GNU Library General Public License for more details.                *
+# *                                                                     *
+# * You should have received a copy of the GNU Library General Public   *
+# * License along with this program; if not, write to the Free Software *
+# * Foundation, Inc., 59 Temple Place, Suite 330, Boston, MA  02111-1307*
+# * USA                                                                 *
+# *                                                                     *
+# ***********************************************************************
+
+
+import ArchComponent
+import FreeCAD
+
+if FreeCAD.GuiUp:
+    import FreeCADGui, os
+    from PySide import QtCore
+    from PySide.QtCore import QT_TRANSLATE_NOOP
+else:
+    # \cond
+    def translate(ctxt, txt):
+        return txt
+
+
+    def QT_TRANSLATE_NOOP(ctxt, txt):
+        return txt
+    # \endcond
+
+try:
+    _fromUtf8 = QtCore.QString.fromUtf8
+except AttributeError:
+    def _fromUtf8(s):
+        return s
+
+import PVPlantResources
+
+
+def makeCable(base = None):
+    obj = FreeCAD.ActiveDocument.addObject("Part::FeaturePython", "Cable")
+    Cable(obj)
+    ViewProviderCable(obj.ViewObject)
+    if base:
+        obj.Base = base
+    return obj
+
+class Cable(ArchComponent.Component):
+    "A Base Frame Obcject - Class"
+
+    def __init__(self, obj):
+        ArchComponent.Component.__init__(self, obj)
+        self.setProperties(obj)
+
+    def setProperties(self, obj):
+        pl = obj.PropertiesList
+
+        # General:
+        if not ("Manufacturer" in pl):
+            obj.addProperty("App::PropertyString",
+                            "Manufacturer",
+                            "General",
+                            "Connection")
+
+        if not ("Factory" in pl):
+            obj.addProperty("App::PropertyString",
+                            "Factory",
+                            "General",
+                            "Connection ")
+
+        if not ("DesignStandard" in pl):
+            obj.addProperty("App::PropertyString",
+                            "DesignStandard",
+                            "General",
+                            "Connection ")
+
+        if not ("CableDesignation" in pl):
+            obj.addProperty("App::PropertyString",
+                            "CableDesignation",
+                            "General",
+                            "Connection ").CableDesignation="RH5Z1-OL"
+
+        if not ("MaximumVoltage" in pl):
+            obj.addProperty("App::PropertyElectricPotential",
+                            "MaximumVoltage",
+                            "General",
+                            "Connection ").MaximumVoltage="30kV"
+
+        if not ("MaxTemperatureForContinuousOperation" in pl):
+            obj.addProperty("App::PropertyInteger",
+                            "MaxTemperatureForContinuousOperation",
+                            "General",
+                            "Connection ").MaxTemperatureForContinuousOperation=95
+
+        if not ("MaxTemperatureDuringEmergencyConditions" in pl):
+            obj.addProperty("App::PropertyInteger",
+                            "MaxTemperatureDuringEmergencyConditions",
+                            "General",
+                            "Connection ").MaxTemperatureDuringEmergencyConditions=105
+
+        if not ("MaxTemperatureDuringShortCircuit" in pl):
+            obj.addProperty("App::PropertyInteger",
+                            "MaxTemperatureDuringShortCircuit",
+                            "General",
+                            "Connection ").MaxTemperatureDuringShortCircuit=250
+
+
+        # Conductor:
+        if not ("Material" in pl):
+            obj.addProperty("App::PropertyEnumeration",
+                            "Material",
+                            "Conductor",
+                            "Connection ").Material=["Copper", "Aluminium"]
+
+        if not ("Standard" in pl):
+            obj.addProperty("App::PropertyString",
+                            "Standard",
+                            "Conductor",
+                            "Connection ").Standard = "IEC 60228"
+
+        if not ("CrossSection" in pl):
+            obj.addProperty("App::PropertyArea",
+                            "CrossSection",
+                            "Conductor",
+                            "Connection ").CrossSection = 95
+
+        if not ("MaximumConductorDiameter" in pl):
+            obj.addProperty("App::PropertyLength",
+                            "MaximumConductorDiameter",
+                            "Conductor",
+                            "Connection ")
+
+        if not ("MinimumConductorDiameter" in pl):
+            obj.addProperty("App::PropertyLength",
+                            "MinimumConductorDiameter",
+                            "Conductor",
+                            "Connection ")
+
+        if not ("MaximumResistance" in pl):
+            obj.addProperty("App::PropertyInteger",
+                            "MaximumResistance",
+                            "Conductor",
+                            "Connection ")
+
+        # Insulation:
+        if not ("InsulationMaterial" in pl):
+            obj.addProperty("App::PropertyEnumeration",
+                            "InsulationMaterial",
+                            "Insulation",
+                            "Connection ").InsulationMaterial=["HEPR", "XLPE"]
+
+        if not ("InsulationStandard" in pl):
+            obj.addProperty("App::PropertyString",
+                            "InsulationStandard",
+                            "Insulation",
+                            "Connection ").InsulationStandard = "IEC 60502-2"
+
+        if not ("InsulationNominalThickness" in pl):
+            obj.addProperty("App::PropertyLength",
+                            "InsulationNominalThickness",
+                            "Insulation",
+                            "Sección").InsulationNominalThickness = 7.25
+
+        if not ("InsulationMinimumThickness" in pl):
+            obj.addProperty("App::PropertyLength",
+                            "InsulationMinimumThickness",
+                            "Insulation",
+                            "Sección").InsulationMinimumThickness = 6.43
+
+        if not ("InsulationResistance" in pl):
+            obj.addProperty("App::PropertyInteger",
+                            "InsulationResistance",
+                            "Insulation",
+                            "Sección").InsulationResistance = 3670000
+
+        # Outer semi-conductive layer:
+        if not ("OuterMaterial" in pl):
+            obj.addProperty("App::PropertyString",
+                            "OuterMaterial",
+                            "OuterLayer",
+                            "Connection ").OuterMaterial = "Semicon. compound"
+
+        if not ("OuterNominalThickness" in pl):
+            obj.addProperty("App::PropertyLength",
+                            "OuterNominalThickness",
+                            "OuterLayer",
+                            "Sección").OuterNominalThickness = 0.5
+
+        if not ("OuterMinimumThickness" in pl):
+            obj.addProperty("App::PropertyLength",
+                            "OuterMinimumThickness",
+                            "OuterLayer",
+                            "Sección").OuterMinimumThickness = 0.5
+
+        # algo
+        if not ("ExternalDiameter" in pl):
+            obj.addProperty("App::PropertyDistance",
+                            "ExternalDiameter",
+                            "Cable",
+                            QT_TRANSLATE_NOOP("App::Property", "Diameter")).ExternalDiameter = 6.6
+
+        if not ("Section" in pl):
+            obj.addProperty("App::PropertyArea",
+                            "Section",
+                            "Cable",
+                            QT_TRANSLATE_NOOP("App::Property", "Sección"))
+
+        if not ("Core" in pl):
+            obj.addProperty("App::PropertyEnumeration",
+                            "Core",
+                            "Cable",
+                            "Core").Core = ["1", "2", "3", ]
+
+        if not ("RadiusOfCurvature" in pl):
+            obj.addProperty("App::PropertyDistance",
+                            "RadiusOfCurvature",
+                            "Cable",
+                            QT_TRANSLATE_NOOP("App::Property", "Diameter")).RadiusOfCurvature = 100
+
+        self.Type = "Cable"
+
+        obj.Proxy = self
+        obj.IfcType = "Cable Segment"
+        obj.setEditorMode("IfcType", 1)
+
+    def onDocumentRestored(self, obj):
+        """Method run when the document is restored.
+        Re-adds the Arch component, and object properties."""
+
+        ArchComponent.Component.onDocumentRestored(self, obj)
+        self.setProperties(obj)
+        obj.Proxy = self
+
+    def onChanged(self, obj, prop):
+        ''' Do something when a property has changed '''
+
+    def getPoint(self, val):
+        if val.Proxy.Type == 'String':
+            return val.StringPoles[0]
+        elif val.Proxy.Type == 'StringBox':
+            input = val.Shape.SubShapes[2].SubShapes[0]
+            return input.CenterOfMass
+        else:
+            return val.Placement.Base
+
+    def execute(self, obj):
+        import Part, DraftGeomUtils
+        import Draft
+
+        if obj.Base:
+            w = obj.Base.Shape.SubShapes[1].SubShapes[0]
+            w = DraftGeomUtils.filletWire(w, 150)
+        else:
+            return
+
+        """if obj.Base:
+            # Si tiene ruta, dibujar ruteado
+            import PVPlantTrench as trench
+            if isinstance(obj.Base, trench.Trench):
+                w = obj.Base.Shape.SubShapes[0]
+            else:
+                w = obj.Base.Shape
+        elif obj.From and obj.Name:
+            '''line = Part.LineSegment()
+            line.StartPoint = getPoint(obj.From)
+            line.EndPoint = getPoint(obj.To)
+            w = Part.Wire(line.toShape())'''
+            w = Part.makePolygon([self.getPoint(obj.From), self.getPoint(obj.To)])
+        else:
+            return"""
+
+        r = obj.ExternalDiameter.Value / 2
+        p = Part.Wire([Part.Circle(FreeCAD.Vector(0, 0, 0),
+                                   FreeCAD.Vector(0, 1, 0),
+                                   r).toShape()])
+        c = obj.Offset
+        c.x -= r
+        c.z += r
+        v1 = w.Vertexes[1].Point - w.Vertexes[0].Point
+        v2 = DraftGeomUtils.getNormal(p)
+        p.Placement.Base = w.Vertexes[0].Point + c
+        p.Placement.Rotation = FreeCAD.Rotation(v2, v1)
+
+        obj.Shape = w.makePipeShell([p], True, False, 0)
+        obj.Distance = w.Length
+
+
+class ViewProviderCable(ArchComponent.ViewProviderComponent):
+    def __init__(self, vobj):
+        ArchComponent.ViewProviderComponent.__init__(self, vobj)
+
+    def getIcon(self):
+        return str(os.path.join(PVPlantResources.DirIcons, "cable.svg"))
+
+
+class CommandCable:
+    def GetResources(self):
+        return {'Pixmap': str(os.path.join(PVPlantResources.DirIcons, "cable.svg")),
+                'Accel': "E, C",
+                'MenuText': QT_TRANSLATE_NOOP("Placement", "Cable"),
+                'ToolTip': QT_TRANSLATE_NOOP("Placement", "Calcular el BOQ de la")}
+
+    def Activated(self):
+        import Draft
+        sel = FreeCADGui.Selection.getSelection()
+        wire = None
+        for obj in sel:
+            if Draft.getType(obj) == "Wire":
+                wire = obj
+                break
+
+        makeCable(wire)
+        FreeCAD.ActiveDocument.recompute()
+
+    def IsActive(self):
+        if FreeCAD.ActiveDocument:
+            return True
+        else:
+            return False
+
+
+if FreeCAD.GuiUp:
+    FreeCADGui.addCommand('PVPlantCable', CommandCable())

Electrical/Cable/PVPlantElectricalLine.py

@@ -0,0 +1,308 @@
+# /**********************************************************************
+# *                                                                     *
+# * Copyright (c) 2021 Javier Braña <javier.branagutierrez@gmail.com>  *
+# *                                                                     *
+# * This program is free software; you can redistribute it and/or modify*
+# * it under the terms of the GNU Lesser General Public License (LGPL)  *
+# * as published by the Free Software Foundation; either version 2 of   *
+# * the License, or (at your option) any later version.                 *
+# * for detail see the LICENCE text file.                               *
+# *                                                                     *
+# * This program is distributed in the hope that it will be useful,     *
+# * but WITHOUT ANY WARRANTY; without even the implied warranty of      *
+# * MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE.  See the       *
+# * GNU Library General Public License for more details.                *
+# *                                                                     *
+# * You should have received a copy of the GNU Library General Public   *
+# * License along with this program; if not, write to the Free Software *
+# * Foundation, Inc., 59 Temple Place, Suite 330, Boston, MA  02111-1307*
+# * USA                                                                 *
+# *                                                                     *
+# ***********************************************************************
+
+
+import ArchComponent
+import FreeCAD
+
+if FreeCAD.GuiUp:
+    import FreeCADGui, os
+    from PySide import QtCore
+    from PySide.QtCore import QT_TRANSLATE_NOOP
+else:
+    # \cond
+    def translate(ctxt, txt):
+        return txt
+
+
+    def QT_TRANSLATE_NOOP(ctxt, txt):
+        return txt
+    # \endcond
+
+try:
+    _fromUtf8 = QtCore.QString.fromUtf8
+except AttributeError:
+    def _fromUtf8(s):
+        return s
+
+import PVPlantResources
+__dir__ = os.path.join(PVPlantResources.__dir__, "Electrical", "Cable")
+
+
+def makeElectricalLine(base = None):
+    obj = FreeCAD.ActiveDocument.addObject("Part::FeaturePython", "ElectricalLine")
+    ElectricalLine(obj)
+    ViewProviderElectricalLine(obj.ViewObject)
+    if base:
+        obj.Base = base
+
+    '''try:
+        folder = FreeCAD.ActiveDocument.Trenches
+    except:
+        folder = FreeCAD.ActiveDocument.addObject("App::DocumentObjectGroup", 'Trenches')
+        folder.Label = "Trenches"
+    folder.addObject(obj)'''
+    return obj
+
+
+class ElectricalLine(ArchComponent.Component):
+
+    def __init__(self, obj):
+        ArchComponent.Component.__init__(self, obj)
+        self.setProperties(obj)
+
+    def setProperties(self, obj):
+        pl = obj.PropertiesList
+
+        if not ("Paths" in pl):
+            obj.addProperty("App::PropertyLinkSubList",
+                            "Paths",
+                            "General",
+                            "Connection")
+
+        if not ("offset" in pl):
+            obj.addProperty("App::PropertyVector",
+                            "offset",
+                            "General",
+                            "Connection")
+
+        if not ("From" in pl):
+            obj.addProperty("App::PropertyLink",
+                            "From",
+                            "Connections",
+                            QT_TRANSLATE_NOOP("App::Property", "Connection "))
+
+        if not ("To" in pl):
+            obj.addProperty("App::PropertyLink",
+                            "To",
+                            "Connections",
+                            QT_TRANSLATE_NOOP("App::Property", "Connection "))
+
+        if not ("Cable" in pl):
+            obj.addProperty("App::PropertyLink",
+                            "Cable",
+                            "Line",
+                            QT_TRANSLATE_NOOP("App::Property", "Connection "))
+
+        if not ("Phases" in pl):
+            obj.addProperty("App::PropertyEnumeration",
+                            "Phases",
+                            "Line",
+                            "Connection").Phases = ["2", "3"]
+            obj.Phases = "3"
+
+        if not ("LineType" in pl):
+            obj.addProperty("App::PropertyEnumeration",
+                            "LineType",
+                            "Line",
+                            "Connection").LineType = ["AC", "DC"]
+
+        if not ("Setup" in pl):
+            obj.addProperty("App::PropertyEnumeration",
+                            "Setup",
+                            "Line",
+                            "Connection").Setup = ["Trifoil", "Parallel"]
+
+        obj.Proxy = self
+        obj.IfcType = "Cable Segment"
+        obj.setEditorMode("IfcType", 1)
+
+    def onDocumentRestored(self, obj):
+        """Method run when the document is restored.
+        Re-adds the Arch component, and object properties."""
+
+        ArchComponent.Component.onDocumentRestored(self, obj)
+        self.setProperties(obj)
+
+    def updateOutputProperties(self, obj):
+        ''' '''
+
+    def onChanged(self, obj, prop):
+        '''Do something when a property has changed'''
+
+        if prop == "Cable":
+            ''' '''
+            if hasattr(obj.Cable, "Proxy") and (obj.Cable.Proxy.Type == "Cable"):
+                ''' '''
+            else:
+                obj.Cable = None
+
+        if prop == "LineType":
+            obj.Phases = "2" if obj.LineType == "DC" else "3"
+            obj.setEditorMode("Phases", obj.LineType == "DC")
+            self.updateOutputProperties(self, obj)
+
+    def execute(self, obj):
+        import Part, DraftGeomUtils
+
+        w = self.generatePath(obj)
+        if (not w) and (not obj.Cable):
+            return
+
+        r = obj.Cable.ExternalDiameter.Value / 2
+        sh = Part.makeCompound([])
+        cnt = int(obj.Phases)
+        if obj.Phases == "3" and obj.Setup == "Parallel":
+            offsets = [FreeCAD.Vector(-2 * r, 0, r),
+                       FreeCAD.Vector(2 * r, 0, r),
+                       FreeCAD.Vector(0, 0, r)]
+        else:
+            offsets = [FreeCAD.Vector(-r, 0, r),
+                       FreeCAD.Vector(r, 0, r),
+                       FreeCAD.Vector(0, 0, r * (1 + 3 ** 0.5))]
+
+        for i in range(cnt):
+            ph = Part.Wire([Part.Circle(offsets[i] + obj.offset,
+                                        FreeCAD.Vector(0, 1, 0),
+                                        r).toShape()])
+            v1 = w.Vertexes[1].Point - w.Vertexes[0].Point
+            if v1.y < 0:
+                v1 = -v1
+            v2 = DraftGeomUtils.getNormal(ph)
+            ph.Placement.Base = w.Vertexes[0].Point
+            ph.Placement.Rotation = FreeCAD.Rotation(v2, v1)
+            sh.add(w.makePipeShell([ph, ], True, False, 0))
+
+        obj.Shape = sh
+
+    def generatePath(self, obj):
+        import Utils.PVPlantFillets as fillets
+
+        result = None
+        # 1. sort
+        if not obj.Base:
+            return None
+
+        print(obj.Paths)
+
+        w = obj.Base.Shape.SubShapes[1].SubShapes[0]
+        w = fillets.filletWire(w, obj.Cable.RadiusOfCurvature)
+        return w
+
+
+class ViewProviderElectricalLine(ArchComponent.ViewProviderComponent):
+    def __init__(self, vobj):
+        ArchComponent.ViewProviderComponent.__init__(self, vobj)
+        self.Object = None
+        vobj.Proxy = self
+
+    def attach(self, vobj):
+        ''' Create Object visuals in 3D view. '''
+        self.Object = vobj.Object
+
+    def getIcon(self):
+        return str(os.path.join(PVPlantResources.DirIcons, "electricalline.png"))
+
+    def claimChildren(self):
+        """ Provides object grouping """
+        children = []
+        if self.Object.Cable:
+            children.append(self.Object.Cable)
+        return children
+
+
+class ElectricalLineTaskPanel:
+    def __init__(self, obj=None):
+        self.new = False
+        self.selection = None
+        self.selectionViewObject = None
+        self.obj = obj
+
+        if obj is None:
+            self.new = True
+
+        self.form = FreeCADGui.PySideUic.loadUi(os.path.join(__dir__, "PVPlantElectricalLine.ui"))
+        '''self.form.buttonAddLayer.clicked.connect(self.addLayer)
+        self.form.buttonDeleteLayer.clicked.connect(self.removeLayer)
+        self.form.buttonUp.clicked.connect(self.moveUp)
+        self.form.buttonDown.clicked.connect(self.moveDown)'''
+
+
+        #self.observer = SelectionObserver.SelObserver()
+        FreeCADGui.Selection.addObserver(self)
+
+    def addSelection(self, document, object, element, position):  # Selection
+        ''' '''
+        obj = FreeCAD.getDocument(document).getObject(object)
+        if hasattr(obj, "Proxy"):
+            if obj.Proxy.Type == "Trench":
+                self.selection = obj
+                self.selectionViewObject = obj.ViewObject.DisplayMode
+                obj.ViewObject.DisplayMode = "Wireframe"
+                self.TrechDialog = FreeCADGui.PySideUic.loadUi(os.path.join(__dir__, "PVPlantElectricalLineDialog.ui"))
+                self.TrechDialog.labelTitle.setText(obj.Name)
+                self.TrechDialog.spinBox.setMaximum(obj.Cables)
+                self.TrechDialog.buttonAccept.clicked.connect(self.addTrenchRoute)
+                self.TrechDialog.show()
+
+    def clearSelection(self, doc):
+        ''' '''
+        if self.selectionViewObject:
+            self.selection.ViewObject.DisplayMode = self.selectionViewObject
+            self.selectionViewObject = None
+        pass
+
+    def addTrenchRoute(self):
+        val = self.TrechDialog.spinBox.value
+        FreeCADGui.Selection.clearSelection()
+        self.TrechDialog.close()
+
+    def accept(self):
+        FreeCAD.ActiveDocument.openTransaction("Create Electrical Line")
+        makeElectricalLine()
+        FreeCAD.ActiveDocument.commitTransaction()
+        FreeCAD.ActiveDocument.recompute()
+        self.closeForm()
+        return True
+
+    def reject(self):
+        self.closeForm()
+        return False
+
+    def closeForm(self):
+        FreeCADGui.Selection.removeObserver(self)
+        FreeCADGui.Control.closeDialog()
+
+
+class CommandElectricalLine:
+    def GetResources(self):
+        return {'Pixmap': str(os.path.join(PVPlantResources.DirIcons, "electricalline.png")),
+                'Accel': "E, L",
+                'MenuText': "Línea eléctrica",
+                'ToolTip': "Crea una línea electríca en AC o DC.\n Selecciona la configuración de cable."}
+
+    def Activated(self):
+        TaskPanel = ElectricalLineTaskPanel()
+        FreeCADGui.Control.showDialog(TaskPanel)
+
+    def IsActive(self):
+        if FreeCAD.ActiveDocument:
+            return True
+        else:
+            return False
+
+        active = not (FreeCAD.ActiveDocument is None)
+
+
+if FreeCAD.GuiUp:
+    FreeCADGui.addCommand('PVPlanElectricalLine', CommandElectricalLine())
+

Electrical/Cable/PVPlantElectricalLine.ui

@@ -0,0 +1,218 @@
+<?xml version="1.0" encoding="UTF-8"?>
+<ui version="4.0">
+ <class>formRack</class>
+ <widget class="QDialog" name="formRack">
+  <property name="geometry">
+   <rect>
+    <x>0</x>
+    <y>0</y>
+    <width>332</width>
+    <height>157</height>
+   </rect>
+  </property>
+  <property name="windowTitle">
+   <string>Fixed Frame:</string>
+  </property>
+  <layout class="QVBoxLayout" name="verticalLayout">
+   <item>
+    <widget class="QGroupBox" name="groupBox">
+     <property name="sizePolicy">
+      <sizepolicy hsizetype="Preferred" vsizetype="Fixed">
+       <horstretch>0</horstretch>
+       <verstretch>0</verstretch>
+      </sizepolicy>
+     </property>
+     <property name="title">
+      <string>Dimensions</string>
+     </property>
+     <layout class="QGridLayout" name="gridLayout">
+      <property name="leftMargin">
+       <number>5</number>
+      </property>
+      <property name="topMargin">
+       <number>5</number>
+      </property>
+      <property name="rightMargin">
+       <number>5</number>
+      </property>
+      <property name="bottomMargin">
+       <number>5</number>
+      </property>
+      <property name="horizontalSpacing">
+       <number>5</number>
+      </property>
+      <property name="verticalSpacing">
+       <number>2</number>
+      </property>
+      <item row="0" column="0">
+       <widget class="QLabel" name="label_9">
+        <property name="text">
+         <string>Heigth (m)</string>
+        </property>
+       </widget>
+      </item>
+      <item row="0" column="1">
+       <widget class="QDoubleSpinBox" name="editModuleHeight">
+        <property name="sizePolicy">
+         <sizepolicy hsizetype="Fixed" vsizetype="Fixed">
+          <horstretch>0</horstretch>
+          <verstretch>0</verstretch>
+         </sizepolicy>
+        </property>
+        <property name="minimumSize">
+         <size>
+          <width>140</width>
+          <height>0</height>
+         </size>
+        </property>
+        <property name="alignment">
+         <set>Qt::AlignRight|Qt::AlignTrailing|Qt::AlignVCenter</set>
+        </property>
+        <property name="buttonSymbols">
+         <enum>QAbstractSpinBox::NoButtons</enum>
+        </property>
+        <property name="decimals">
+         <number>3</number>
+        </property>
+        <property name="maximum">
+         <double>10000.000000000000000</double>
+        </property>
+        <property name="singleStep">
+         <double>0.010000000000000</double>
+        </property>
+        <property name="value">
+         <double>1000.000000000000000</double>
+        </property>
+       </widget>
+      </item>
+      <item row="1" column="1">
+       <widget class="QDoubleSpinBox" name="editModuleLenght">
+        <property name="sizePolicy">
+         <sizepolicy hsizetype="Fixed" vsizetype="Fixed">
+          <horstretch>0</horstretch>
+          <verstretch>0</verstretch>
+         </sizepolicy>
+        </property>
+        <property name="minimumSize">
+         <size>
+          <width>140</width>
+          <height>0</height>
+         </size>
+        </property>
+        <property name="alignment">
+         <set>Qt::AlignRight|Qt::AlignTrailing|Qt::AlignVCenter</set>
+        </property>
+        <property name="buttonSymbols">
+         <enum>QAbstractSpinBox::NoButtons</enum>
+        </property>
+        <property name="decimals">
+         <number>3</number>
+        </property>
+        <property name="maximum">
+         <double>10000.000000000000000</double>
+        </property>
+        <property name="singleStep">
+         <double>0.010000000000000</double>
+        </property>
+        <property name="value">
+         <double>2000.000000000000000</double>
+        </property>
+       </widget>
+      </item>
+      <item row="2" column="0">
+       <widget class="QLabel" name="label_11">
+        <property name="text">
+         <string>Anchura (m)</string>
+        </property>
+       </widget>
+      </item>
+      <item row="3" column="0">
+       <widget class="QLabel" name="label">
+        <property name="text">
+         <string>TextLabel</string>
+        </property>
+       </widget>
+      </item>
+      <item row="1" column="0">
+       <widget class="QLabel" name="label_10">
+        <property name="text">
+         <string>Largura (m)</string>
+        </property>
+       </widget>
+      </item>
+      <item row="2" column="1">
+       <widget class="QDoubleSpinBox" name="editModuleWidth">
+        <property name="sizePolicy">
+         <sizepolicy hsizetype="Fixed" vsizetype="Fixed">
+          <horstretch>0</horstretch>
+          <verstretch>0</verstretch>
+         </sizepolicy>
+        </property>
+        <property name="minimumSize">
+         <size>
+          <width>140</width>
+          <height>0</height>
+         </size>
+        </property>
+        <property name="alignment">
+         <set>Qt::AlignRight|Qt::AlignTrailing|Qt::AlignVCenter</set>
+        </property>
+        <property name="buttonSymbols">
+         <enum>QAbstractSpinBox::NoButtons</enum>
+        </property>
+        <property name="decimals">
+         <number>3</number>
+        </property>
+        <property name="maximum">
+         <double>10000.000000000000000</double>
+        </property>
+        <property name="singleStep">
+         <double>0.010000000000000</double>
+        </property>
+        <property name="value">
+         <double>1000.000000000000000</double>
+        </property>
+       </widget>
+      </item>
+      <item row="3" column="1">
+       <widget class="QDoubleSpinBox" name="editModuleWidth_2">
+        <property name="sizePolicy">
+         <sizepolicy hsizetype="Fixed" vsizetype="Fixed">
+          <horstretch>0</horstretch>
+          <verstretch>0</verstretch>
+         </sizepolicy>
+        </property>
+        <property name="minimumSize">
+         <size>
+          <width>140</width>
+          <height>0</height>
+         </size>
+        </property>
+        <property name="alignment">
+         <set>Qt::AlignRight|Qt::AlignTrailing|Qt::AlignVCenter</set>
+        </property>
+        <property name="buttonSymbols">
+         <enum>QAbstractSpinBox::NoButtons</enum>
+        </property>
+        <property name="decimals">
+         <number>3</number>
+        </property>
+        <property name="maximum">
+         <double>10000.000000000000000</double>
+        </property>
+        <property name="singleStep">
+         <double>0.010000000000000</double>
+        </property>
+        <property name="value">
+         <double>1000.000000000000000</double>
+        </property>
+       </widget>
+      </item>
+     </layout>
+    </widget>
+   </item>
+  </layout>
+ </widget>
+ <resources/>
+ <connections/>
+</ui>

Electrical/Cable/PVPlantElectricalLineDialog.ui

@@ -0,0 +1,71 @@
+<?xml version="1.0" encoding="UTF-8"?>
+<ui version="4.0">
+ <class>formTrechPathSelector</class>
+ <widget class="QDialog" name="formTrechPathSelector">
+  <property name="geometry">
+   <rect>
+    <x>0</x>
+    <y>0</y>
+    <width>178</width>
+    <height>79</height>
+   </rect>
+  </property>
+  <property name="sizePolicy">
+   <sizepolicy hsizetype="Fixed" vsizetype="Fixed">
+    <horstretch>0</horstretch>
+    <verstretch>0</verstretch>
+   </sizepolicy>
+  </property>
+  <property name="windowTitle">
+   <string>Fixed Frame:</string>
+  </property>
+  <layout class="QGridLayout" name="gridLayout">
+   <item row="1" column="0">
+    <widget class="QLabel" name="label_2">
+     <property name="text">
+      <string>Seleccionar ruta</string>
+     </property>
+    </widget>
+   </item>
+   <item row="0" column="0" colspan="2">
+    <widget class="QLabel" name="labelTitle">
+     <property name="minimumSize">
+      <size>
+       <width>0</width>
+       <height>20</height>
+      </size>
+     </property>
+     <property name="styleSheet">
+      <string notr="true">background-color: rgb(180, 180, 180);
+border-color: rgb(129, 129, 129);</string>
+     </property>
+     <property name="text">
+      <string>TextLabel</string>
+     </property>
+     <property name="alignment">
+      <set>Qt::AlignCenter</set>
+     </property>
+    </widget>
+   </item>
+   <item row="1" column="1">
+    <widget class="QSpinBox" name="spinBox">
+     <property name="alignment">
+      <set>Qt::AlignRight|Qt::AlignTrailing|Qt::AlignVCenter</set>
+     </property>
+     <property name="minimum">
+      <number>1</number>
+     </property>
+    </widget>
+   </item>
+   <item row="2" column="0" colspan="2">
+    <widget class="QPushButton" name="buttonAccept">
+     <property name="text">
+      <string>Aceptar</string>
+     </property>
+    </widget>
+   </item>
+  </layout>
+ </widget>
+ <resources/>
+ <connections/>
+</ui>

Electrical/CombinerBox/PVPlantStringBox.py

@@ -0,0 +1,373 @@
+# /**********************************************************************
+# *                                                                     *
+# * Copyright (c) 2021 Javier Braña <javier.branagutierrez@gmail.com>  *
+# *                                                                     *
+# * This program is free software; you can redistribute it and/or modify*
+# * it under the terms of the GNU Lesser General Public License (LGPL)  *
+# * as published by the Free Software Foundation; either version 2 of   *
+# * the License, or (at your option) any later version.                 *
+# * for detail see the LICENCE text file.                               *
+# *                                                                     *
+# * This program is distributed in the hope that it will be useful,     *
+# * but WITHOUT ANY WARRANTY; without even the implied warranty of      *
+# * MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE.  See the       *
+# * GNU Library General Public License for more details.                *
+# *                                                                     *
+# * You should have received a copy of the GNU Library General Public   *
+# * License along with this program; if not, write to the Free Software *
+# * Foundation, Inc., 59 Temple Place, Suite 330, Boston, MA  02111-1307*
+# * USA                                                                 *
+# *                                                                     *
+# ***********************************************************************
+
+import ArchComponent
+import FreeCAD
+import Part
+
+if FreeCAD.GuiUp:
+    import FreeCADGui, os
+    from PySide import QtCore
+    from PySide.QtCore import QT_TRANSLATE_NOOP
+    from pivy import coin
+else:
+    # \cond
+    def translate(ctxt, txt):
+        return txt
+
+    def QT_TRANSLATE_NOOP(ctxt, txt):
+        return txt
+    # \endcond
+
+try:
+    _fromUtf8 = QtCore.QString.fromUtf8
+except AttributeError:
+    def _fromUtf8(s):
+        return s
+
+import PVPlantResources
+
+def makeStringbox():
+    obj = FreeCAD.ActiveDocument.addObject("Part::FeaturePython", "StringBox")
+    _StringBox(obj)
+    _ViewProviderStringBox(obj.ViewObject)
+    FreeCAD.ActiveDocument.recompute()
+    #FreeCADGui.ActiveDocument.ActiveView.fitAll()
+    return obj
+
+class _StringBox(ArchComponent.Component):
+
+    def __init__(self, obj):
+        # Definición de Variables:
+        ArchComponent.Component.__init__(self, obj)
+        self.obj = obj
+        self.setProperties(obj)
+        self.Type = "StringBox"
+
+        # Does a IfcType exist?
+        obj.IfcType = "Electric Distribution Board"
+        obj.setEditorMode("IfcType", 1)
+        # obj.MoveWithHost = False
+
+    def setProperties(self, obj):
+        # Definicion de Propiedades:
+        '''[
+        'App::PropertyBool',
+        'App::PropertyBoolList',
+        'App::PropertyFloat',
+        'App::PropertyFloatList',
+        'App::PropertyFloatConstraint',
+        'App::PropertyPrecision',
+        'App::PropertyQuantity',
+        'App::PropertyQuantityConstraint',
+        'App::PropertyAngle',
+        'App::PropertyDistance',
+        'App::PropertyLength',
+        'App::PropertyArea',
+        'App::PropertyVolume',
+        'App::PropertyFrequency',
+        'App::PropertySpeed',
+        'App::PropertyAcceleration',
+        'App::PropertyForce',
+        'App::PropertyPressure',
+        'App::PropertyVacuumPermittivity',
+        'App::PropertyInteger',
+        'App::PropertyIntegerConstraint',
+        'App::PropertyPercent',
+        'App::PropertyEnumeration',
+        'App::PropertyIntegerList',
+        'App::PropertyIntegerSet',
+        'App::PropertyMap',
+        'App::PropertyString',
+        'App::PropertyPersistentObject',
+        'App::PropertyUUID',
+        'App::PropertyFont',
+        'App::PropertyStringList',
+        'App::PropertyLink',
+        'App::PropertyLinkChild',
+        'App::PropertyLinkGlobal',
+        'App::PropertyLinkHidden',
+        'App::PropertyLinkSub',
+        'App::PropertyLinkSubChild',
+        'App::PropertyLinkSubGlobal',
+        'App::PropertyLinkSubHidden',
+        'App::PropertyLinkList',
+        'App::PropertyLinkListChild',
+        'App::PropertyLinkListGlobal',
+        'App::PropertyLinkListHidden',
+        'App::PropertyLinkSubList',
+        'App::PropertyLinkSubListChild',
+        'App::PropertyLinkSubListGlobal',
+        'App::PropertyLinkSubListHidden',
+        'App::PropertyXLink',
+        'App::PropertyXLinkSub',
+        'App::PropertyXLinkSubList',
+        'App::PropertyXLinkList',
+        'App::PropertyMatrix',
+        'App::PropertyVector',
+        'App::PropertyVectorDistance',
+        'App::PropertyPosition',
+        'App::PropertyDirection',
+        'App::PropertyVectorList',
+        'App::PropertyPlacement',
+        'App::PropertyPlacementList',
+        'App::PropertyPlacementLink',
+        'App::PropertyColor',
+        'App::PropertyColorList',
+        'App::PropertyMaterial',
+        'App::PropertyMaterialList',
+        'App::PropertyPath',
+        'App::PropertyFile',
+        'App::PropertyFileIncluded',
+        'App::PropertyPythonObject',
+        'App::PropertyExpressionEngine',
+        'Part::PropertyPartShape',
+        'Part::PropertyGeometryList',
+        'Part::PropertyShapeHistory',
+        'Part::PropertyFilletEdges',
+        'Mesh::PropertyNormalList',
+        'Mesh::PropertyCurvatureList',
+        'Mesh::PropertyMeshKernel',
+        'Sketcher::PropertyConstraintList'
+        ]'''
+
+        pl = obj.PropertiesList
+        if not "InputsFromStrings" in pl:
+            obj.addProperty("App::PropertyQuantity",
+                            "InputsFromStrings",
+                            "Connections",
+                            QT_TRANSLATE_NOOP("App::Property", "Connection ")).InputsFromStrings = 12
+
+        if not ("PositiveInputs" in pl):
+            obj.addProperty("App::PropertyVectorList",
+                            "PositiveInputs",
+                            "Connections",
+                            QT_TRANSLATE_NOOP("App::Property", "The height of this object")
+                            ).PositiveInputs = []
+            obj.setEditorMode("PositiveInputs", 1)
+
+        if not ("NegativeInputs" in pl):
+            obj.addProperty("App::PropertyVectorList",
+                            "NegativeInputs",
+                            "Connections",
+                            QT_TRANSLATE_NOOP("App::Property", "The height of this object")
+                            ).NegativeInputs = []
+            obj.setEditorMode("NegativeInputs", 1)
+
+        if not "InputCables" in pl:
+            obj.addProperty("App::PropertyLinkList",
+                            "InputCables",
+                            "Connections",
+                            QT_TRANSLATE_NOOP("App::Property", "InputCables"))
+
+        # Outputs
+        '''
+        if not "Outputs" in pl:
+            obj.addProperty("App::PropertyQuantity",
+                            "Outputs",
+                            "Connections",
+                            QT_TRANSLATE_NOOP("App::Property", "Connection ")).Outputs = 1
+        '''
+
+        if not ("PositiveOut" in pl):
+            obj.addProperty("Part::PropertyPartShape",
+                            "PositiveOut",
+                            "Connections",
+                            QT_TRANSLATE_NOOP("App::Property", "The height of this object")
+                            )
+            obj.setEditorMode("PositiveOut", 1)
+
+        if not ("NegativeOut" in pl):
+            obj.addProperty("Part::PropertyPartShape",
+                            "NegativeOut",
+                            "Connections",
+                            QT_TRANSLATE_NOOP("App::Property", "The height of this object")
+                            )
+            obj.setEditorMode("NegativeOut", 1)
+
+        # Size:
+        if not "Width" in pl:
+            obj.addProperty("App::PropertyLength",
+                            "Width",
+                            "Box",
+                            QT_TRANSLATE_NOOP("App::Property", "Connection ")).Width = 330
+
+        if not "Length" in pl:
+            obj.addProperty("App::PropertyLength",
+                            "Length",
+                            "Box",
+                            QT_TRANSLATE_NOOP("App::Property", "Connection ")).Length = 848
+
+        if not "Height" in pl:
+            obj.addProperty("App::PropertyLength",
+                            "Height",
+                            "Box",
+                            QT_TRANSLATE_NOOP("App::Property", "Connection ")).Height = 615
+
+
+    def onDocumentRestored(self, obj):
+        """Method run when the document is restored.
+        Re-adds the Arch component, and Arch wall properties."""
+
+        ArchComponent.Component.onDocumentRestored(self, obj)
+        self.setProperties(obj)
+        obj.Proxy = self
+
+    def onChanged(self, obj, prop):
+        '''Do something when a property has changed'''
+
+        if prop == "InputsFromStrings":
+            for i in range(int(obj.getPropertyByName(prop).Value)):
+                obj.removeProperty("PositiveInput" + str(i+1))
+                obj.removeProperty("NegativeInput" + str(i + 1))
+
+
+    def execute(self, obj):
+        # obj.Shape: compound
+        # |- body: compound
+        # |-- body: solid
+        # |-- door: solid
+        # |-- inputs: solids
+        # |-- outputs: solids
+        # |- inputs references: compound
+        # |-- positives: compound
+        # |--- positive: point of vertex
+
+        solids = []
+        pts = []
+
+        def getdownFace(object):
+            downface = object.Faces[0]
+            for face in object.Faces:
+                if face.CenterOfMass.z < downface.CenterOfMass.z:
+                    downface = face
+            return downface
+
+        def drawInputs(numrows, offsetx, type, cpd):
+            numInputs = int(obj.InputsFromStrings.Value)
+            nperrow = int(round(numInputs / numrows, 0))
+            gap = 45
+            diameter = 20
+            points = []
+            cnt = 0
+            for r in range(numrows):
+                xx = -obj.Length.Value / 2 + offsetx + gap / 2 * (r % 2)
+                yy = -diameter + gap * r
+                for i in range(min(numInputs, nperrow)):
+                    cyl = Part.makeCylinder(10, 20, FreeCAD.Vector(xx + gap * i, yy, -20))
+                    solids.append(cyl)
+                    points.append(getdownFace(cyl).CenterOfMass)
+                    cnt += 1
+                    inname = ("PositiveIn" if type == 0 else "NegativeIn") + str(cnt)
+                    obj.addProperty("Part::PropertyPartShape",
+                                    inname,
+                                    "Inputs",
+                                    QT_TRANSLATE_NOOP("App::Property", "The height of this object")
+                                    )
+                    obj.setEditorMode(inname, 1)
+                    setattr(obj, inname, getdownFace(cyl))
+                    cpd.add(cyl)
+                numInputs -= nperrow
+            return points
+
+        box = Part.makeBox(obj.Length.Value, obj.Width.Value, obj.Height.Value)
+        box.Placement.Base.x -= obj.Length.Value / 2
+        box.Placement.Base.y -= obj.Width.Value / 2
+
+        # Output:
+        cpd_out = Part.makeCompound([])
+        outp = Part.makeCylinder(65/2, 20, FreeCAD.Vector(0, 0, -20))
+        #out.Placement.Base.x += 50
+        #out.Placement.Base.y += 65/2
+        solids.append(outp)
+        cpd_out.add(outp)
+        obj.PositiveOut = getdownFace(outp)
+
+        outn = outp.copy()
+        outn.Placement.Base.x += 65 + 10
+        solids.append(outn)
+        cpd_out.add(outn)
+        obj.NegativeOut = getdownFace(outn)
+
+        # Inputs:
+        cpd_Pos_Inputs = Part.makeCompound([])
+        cpd_Neg_Inputs = Part.makeCompound([])
+        obj.PositiveInputs = drawInputs(2,  80, 0, cpd_Pos_Inputs).copy()
+        obj.NegativeInputs = drawInputs(4, 650, 1, cpd_Neg_Inputs).copy()
+
+        pts.append(getdownFace(box).CenterOfMass)
+        pts.append(getdownFace(outn).CenterOfMass)
+        pts.append(getdownFace(outp).CenterOfMass)
+
+        obj.Shape = Part.makeCompound([box, cpd_out, cpd_Pos_Inputs, cpd_Neg_Inputs])
+
+class _ViewProviderStringBox(ArchComponent.ViewProviderComponent):
+    "A View Provider for the Pipe object"
+
+    def __init__(self, vobj):
+        ArchComponent.ViewProviderComponent.__init__(self, vobj)
+
+    def getIcon(self):
+        return str(os.path.join(PVPlantResources.DirIcons, "StringBox.svg"))
+
+    def attach(self, vobj):
+        self.Object = vobj.Object
+        sep = coin.SoSeparator()
+        self.coords = coin.SoCoordinate3()
+        sep.addChild(self.coords)
+        self.coords.point.deleteValues(0)
+        symbol = coin.SoMarkerSet()
+        symbol.markerIndex = FreeCADGui.getMarkerIndex("", 5)
+        sep.addChild(symbol)
+        rn = vobj.RootNode
+        rn.addChild(sep)
+        ArchComponent.ViewProviderComponent.attach(self, vobj)
+
+    def updateData(self, obj, prop):
+
+        if prop == "PositiveInputs":
+            if obj.PositiveInputs:
+                self.coords.point.setNum(len(obj.PositiveInputs))
+                self.coords.point.setValues([[p.x, p.y, p.z] for p in obj.PositiveInputs])
+            else:
+                self.coords.point.deleteValues(0)
+
+
+class _CommandBoxEnclosure:
+
+    def GetResources(self):
+        return {'Pixmap': str(os.path.join(PVPlantResources.DirIcons, "StringBox.svg")),
+                'Accel': "C, E",
+                'MenuText': QT_TRANSLATE_NOOP("Placement", "Movimiento de tierras"),
+                'ToolTip': QT_TRANSLATE_NOOP("Placement", "Calcular el movimiento de tierras")}
+
+    def Activated(self):
+        makeStringbox()
+
+    def IsActive(self):
+        if FreeCAD.ActiveDocument:
+            return True
+        else:
+            return False
+
+if FreeCAD.GuiUp:
+    FreeCADGui.addCommand('PVPlantStringBox', _CommandBoxEnclosure())

Electrical/Conduit.py

@@ -0,0 +1,550 @@
+# -*- coding: utf-8 -*-
+#***************************************************************************
+#*   Copyright (c) 2016 Yorik van Havre <yorik@uncreated.net>              *
+#*                                                                         *
+#*   This program is free software; you can redistribute it and/or modify  *
+#*   it under the terms of the GNU Lesser General Public License (LGPL)    *
+#*   as published by the Free Software Foundation; either version 2 of     *
+#*   the License, or (at your option) any later version.                   *
+#*   for detail see the LICENCE text file.                                 *
+#*                                                                         *
+#*   This program is distributed in the hope that it will be useful,       *
+#*   but WITHOUT ANY WARRANTY; without even the implied warranty of        *
+#*   MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE.  See the         *
+#*   GNU Library General Public License for more details.                  *
+#*                                                                         *
+#*   You should have received a copy of the GNU Library General Public     *
+#*   License along with this program; if not, write to the Free Software   *
+#*   Foundation, Inc., 59 Temple Place, Suite 330, Boston, MA  02111-1307  *
+#*   USA                                                                   *
+#*                                                                         *
+#***************************************************************************
+
+import ArchComponent
+import FreeCAD
+
+if FreeCAD.GuiUp:
+    import FreeCADGui
+    from draftutils.translate import translate
+    from PySide.QtCore import QT_TRANSLATE_NOOP
+else:
+    # \cond
+    def translate(ctxt,txt):
+        return txt
+    def QT_TRANSLATE_NOOP(ctxt,txt):
+        return txt
+    # \endcond
+
+## @package ArchPipe
+#  \ingroup ARCH
+#  \brief The Pipe object and tools
+#
+#  This module provides tools to build Pipe and Pipe connector objects.
+#  Pipes are tubular objects extruded along a base line.
+
+__title__  = "Arch Pipe tools"
+__author__ = "Yorik van Havre"
+__url__    = "https://www.freecadweb.org"
+
+
+def makePipe(baseobj=None, diameter=0, length=0, placement=None, name="Pipe"):
+
+    "makePipe([baseobj,diamerter,length,placement,name]): creates an pipe object from the given base object"
+
+    if not FreeCAD.ActiveDocument:
+        FreeCAD.Console.PrintError("No active document. Aborting\n")
+        return
+    obj= FreeCAD.ActiveDocument.addObject("Part::FeaturePython", name)
+    obj.Label = name
+    Pipe(obj)
+
+    if FreeCAD.GuiUp:
+        ViewProviderPipe(obj.ViewObject)
+        if baseobj:
+            baseobj.ViewObject.hide()
+
+    if baseobj:
+        obj.Base = baseobj
+    else:
+        if length:
+            obj.Length = length
+
+    if diameter:
+        obj.Diameter = diameter
+
+    if placement:
+        obj.Placement = placement
+
+    return obj
+
+def makePipeConnector(pipes,radius=0,name="Connector"):
+
+    "makePipeConnector(pipes,[radius,name]): creates a connector between the given pipes"
+
+    if not FreeCAD.ActiveDocument:
+        FreeCAD.Console.PrintError("No active document. Aborting\n")
+        return
+    obj= FreeCAD.ActiveDocument.addObject("Part::FeaturePython",name)
+    obj.Label = name
+    _ArchPipeConnector(obj)
+    obj.Pipes = pipes
+    if not radius:
+        radius = pipes[0].Diameter
+    obj.Radius = radius
+    if FreeCAD.GuiUp:
+        _ViewProviderPipe(obj.ViewObject)
+    return obj
+
+class Pipe(ArchComponent.Component):
+    "the Arch Pipe object"
+
+    def __init__(self,obj):
+
+        ArchComponent.Component.__init__(self,obj)
+        self.setProperties(obj)
+
+    def setProperties(self,obj):
+
+        pl = obj.PropertiesList
+        if not "Diameter" in pl:
+            obj.addProperty("App::PropertyLength",
+                            "Diameter",
+                            "Conduit",
+                            QT_TRANSLATE_NOOP("App::Property","The diameter of this pipe, if not based on a profile")).Diameter = 60
+
+        if not "Length" in pl:
+            obj.addProperty("App::PropertyLength",
+                            "Length",
+                            "Conduit",
+                            QT_TRANSLATE_NOOP("App::Property","The length of this pipe, if not based on an edge"))
+
+        if not "Profile" in pl:
+            obj.addProperty("App::PropertyLink",
+                            "Profile",
+                            "Conduit",
+                            QT_TRANSLATE_NOOP("App::Property","An optional closed profile to base this pipe on"))
+
+        if not "Start" in pl:
+            obj.addProperty("App::PropertyLength",
+                            "Start",
+                            "Conduit",
+                            QT_TRANSLATE_NOOP("App::Property","Offset from the start point"))
+
+
+        if not "Offset" in pl:
+            obj.addProperty("App::PropertyVector",
+                            "Offset",
+                            "Conduit",
+                            QT_TRANSLATE_NOOP("App::Property","Offset from the start point xy"))
+
+
+        if not "WallThickness" in pl:
+            obj.addProperty("App::PropertyLength",
+                            "WallThickness",
+                            "Conduit",
+                            QT_TRANSLATE_NOOP("App::Property","The wall thickness of this pipe, if not based on a profile")).WallThickness = 2
+
+        self.Type = "Conduit"
+        # IfcPipeSegment is new in IFC4
+        from ArchIFC import IfcTypes
+        if "Cable Carrier Segment" in IfcTypes:
+            obj.IfcType = "Cable Carrier Segment"
+            obj.PredefinedType = "CONDUITSEGMENT"
+            obj.setEditorMode("IfcType", 1)
+            obj.setEditorMode("PredefinedType", 1)
+        else:
+            # IFC2x3 does not know a Pipe Segment
+            obj.IfcType = "Undefined"
+
+    def onDocumentRestored(self,obj):
+        ArchComponent.Component.onDocumentRestored(self,obj)
+        self.setProperties(obj)
+
+    def execute(self,obj):
+        import Part, DraftGeomUtils, math
+        pl = obj.Placement
+
+        w = self.getWire(obj)
+        if not w:
+            FreeCAD.Console.PrintError(translate("Arch","Unable to build the base path")+"\n")
+            return
+
+        if obj.Start.Value:
+            # new:
+            d = obj.Start.Value
+            for i, e in enumerate(w.Edges):
+                if e.Length < d:
+                    d -= e.Length
+                else:
+                    v = e.Vertexes[-1].Point.sub(e.Vertexes[0].Point).normalize()
+                    v.multiply(d)
+                    p = e.Vertexes[0].Point.add(v)
+                    pts = [ver.Point for ver in w.Vertexes]
+                    pts = [p] + pts[i + 1:]
+                    w = Part.makePolygon(pts)
+                    break
+
+        if obj.Length.Value == 0:
+            obj.Length.Value = w.Length
+        elif obj.Length.Value > 0:
+            d = obj.Length.Value
+            for i, e in enumerate(w.Edges):
+                if e.Length < d:
+                    d -= e.Length
+                else:
+                    v = e.Vertexes[-1].Point.sub(e.Vertexes[0].Point).normalize()
+                    v.multiply(d)
+                    p = e.Vertexes[0].Point.add(v)
+                    pts = [ver.Point for ver in w.Vertexes]
+                    pts = pts[:i + 1] + [p]
+                    w = Part.makePolygon(pts)
+                    break
+        pla = FreeCAD.Vector(w.Vertexes[int(len(w.Vertexes)/2)].Point)
+        w.Placement.Base -= pla
+        p = self.getProfile(obj)
+        if not p:
+            FreeCAD.Console.PrintError(translate("Arch", "Unable to build the profile") + "\n")
+            return
+
+        # move and rotate the profile to the first point
+        if hasattr(p,"CenterOfMass"):
+            c = p.CenterOfMass
+        else:
+            c = p.BoundBox.Center
+
+        delta = w.Vertexes[0].Point - c + FreeCAD.Vector(obj.Offset.y, obj.Offset.x, 0)
+        p.translate(delta)
+        import Draft
+        if Draft.getType(obj.Base) == "BezCurve":
+            v1 = obj.Base.Placement.multVec(obj.Base.Points[1])-w.Vertexes[0].Point
+        else:
+            v1 = w.Vertexes[1].Point-w.Vertexes[0].Point
+        v2 = DraftGeomUtils.getNormal(p)
+        rot = FreeCAD.Rotation(v2,v1)
+        p.rotate(w.Vertexes[0].Point,rot.Axis,math.degrees(rot.Angle))
+        shapes = []
+        try:
+            if p.Faces:
+                for f in p.Faces:
+                    sh = w.makePipeShell([f.OuterWire],True,False,2)
+                    for shw in f.Wires:
+                        if shw.hashCode() != f.OuterWire.hashCode():
+                            sh2 = w.makePipeShell([shw],True,False,2)
+                            sh = sh.cut(sh2)
+                    sh.Placement.Base += pla
+                    shapes.append(sh)
+            elif p.Wires:
+                for pw in p.Wires:
+                    sh = w.makePipeShell([pw],True,False,2)
+                    sh.Placement.Base += pla
+                    shapes.append(sh)
+        except Exception:
+            FreeCAD.Console.PrintError(translate("Arch","Unable to build the pipe")+"\n")
+        else:
+            if len(shapes) == 0:
+                return
+            elif len(shapes) == 1:
+                sh = shapes[0]
+            else:
+                sh = Part.makeCompound(shapes)
+            obj.Shape = sh
+            if not obj.Base:
+                obj.Placement = pl
+
+    def getWire(self,obj):
+        import Part
+        if obj.Base:
+            if not hasattr(obj.Base,'Shape'):
+                FreeCAD.Console.PrintError(translate("Arch","The base object is not a Part")+"\n")
+                return
+            if len(obj.Base.Shape.Wires) != 1:
+                FreeCAD.Console.PrintError(translate("Arch","Too many wires in the base shape")+"\n")
+                return
+            if obj.Base.Shape.Wires[0].isClosed():
+                FreeCAD.Console.PrintError(translate("Arch","The base wire is closed")+"\n")
+                return
+            w = obj.Base.Shape.Wires[0]
+        else:
+            if obj.Length.Value == 0:
+                return
+            w = Part.Wire([Part.LineSegment(FreeCAD.Vector(0,0,0),FreeCAD.Vector(0,0,obj.Length.Value)).toShape()])
+        return w
+
+    def getProfile(self,obj):
+
+        import Part
+        if obj.Profile:
+            if not obj.Profile.getLinkedObject().isDerivedFrom("Part::Part2DObject"):
+                FreeCAD.Console.PrintError(translate("Arch","The profile is not a 2D Part")+"\n")
+                return
+            if not obj.Profile.Shape.Wires[0].isClosed():
+                FreeCAD.Console.PrintError(translate("Arch","The profile is not closed")+"\n")
+                return
+            p = obj.Profile.Shape.Wires[0]
+        else:
+            if obj.Diameter.Value == 0:
+                return
+            p = Part.Wire([Part.Circle(FreeCAD.Vector(0,0,0),FreeCAD.Vector(0,0,1),obj.Diameter.Value/2).toShape()])
+            if obj.WallThickness.Value and (obj.WallThickness.Value < obj.Diameter.Value/2):
+                p2 = Part.Wire([Part.Circle(FreeCAD.Vector(0,0,0),FreeCAD.Vector(0,0,1),(obj.Diameter.Value/2-obj.WallThickness.Value)).toShape()])
+                p = Part.Face(p)
+                p2 = Part.Face(p2)
+                p = p.cut(p2)
+        return p
+
+class ViewProviderPipe(ArchComponent.ViewProviderComponent):
+
+
+    "A View Provider for the Pipe object"
+
+    def __init__(self,vobj):
+
+        ArchComponent.ViewProviderComponent.__init__(self,vobj)
+        vobj.ShapeColor = (255, 50, 50)
+
+    def getIcon(self):
+
+        return ":/icons/Arch_Pipe_Tree.svg"
+
+class CommandConduit:
+    "the Arch Pipe command definition"
+
+    def GetResources(self):
+
+        return {'Pixmap'  : 'Arch_Pipe',
+                'MenuText': QT_TRANSLATE_NOOP("Arch_Pipe","Pipe"),
+                'Accel': "P, I",
+                'ToolTip': QT_TRANSLATE_NOOP("Arch_Pipe","Creates a pipe object from a given Wire or Line")}
+
+    def IsActive(self):
+        return not FreeCAD.ActiveDocument is None
+
+    def Activated(self):
+        s = FreeCADGui.Selection.getSelection()
+        if s:
+            for obj in s:
+                if hasattr(obj,'Shape'):
+                    if len(obj.Shape.Wires) == 1:
+                        FreeCAD.ActiveDocument.openTransaction("Create Conduit")
+                        makePipe(obj, name="Conduit")
+                        FreeCAD.ActiveDocument.commitTransaction()
+        else:
+            FreeCAD.ActiveDocument.openTransaction("Create Conduit")
+            makePipe(name="Conduit")
+            FreeCAD.ActiveDocument.commitTransaction()
+        FreeCAD.ActiveDocument.recompute()
+
+class _CommandPipeConnector:
+    "the Arch Pipe command definition"
+
+    def GetResources(self):
+
+        return {'Pixmap'  : 'Arch_PipeConnector',
+                'MenuText': QT_TRANSLATE_NOOP("Arch_PipeConnector","Connector"),
+                'Accel': "P, C",
+                'ToolTip': QT_TRANSLATE_NOOP("Arch_PipeConnector","Creates a connector between 2 or 3 selected pipes")}
+
+    def IsActive(self):
+
+        return not FreeCAD.ActiveDocument is None
+
+    def Activated(self):
+
+        import Draft
+        s = FreeCADGui.Selection.getSelection()
+        if not (len(s) in [2,3]):
+            FreeCAD.Console.PrintError(translate("Arch","Please select exactly 2 or 3 Pipe objects")+"\n")
+            return
+        o = "["
+        for obj in s:
+            if Draft.getType(obj) != "Pipe":
+                FreeCAD.Console.PrintError(translate("Arch","Please select only Pipe objects")+"\n")
+                return
+            o += "FreeCAD.ActiveDocument."+obj.Name+","
+        o += "]"
+        FreeCAD.ActiveDocument.openTransaction(translate("Arch","Create Connector"))
+        FreeCADGui.addModule("Arch")
+        FreeCADGui.doCommand("obj = Arch.makePipeConnector("+o+")")
+        FreeCADGui.addModule("Draft")
+        FreeCADGui.doCommand("Draft.autogroup(obj)")
+        FreeCAD.ActiveDocument.commitTransaction()
+        FreeCAD.ActiveDocument.recompute()
+
+class _ArchPipeConnector(ArchComponent.Component):
+
+
+    "the Arch Pipe Connector object"
+
+    def __init__(self,obj):
+
+        ArchComponent.Component.__init__(self,obj)
+        self.setProperties(obj)
+        obj.IfcType = "Pipe Fitting"
+
+    def setProperties(self,obj):
+
+        pl = obj.PropertiesList
+        if not "Radius" in pl:
+            obj.addProperty("App::PropertyLength",      "Radius",        "PipeConnector", QT_TRANSLATE_NOOP("App::Property","The curvature radius of this connector"))
+        if not "Pipes" in pl:
+            obj.addProperty("App::PropertyLinkList",    "Pipes",         "PipeConnector", QT_TRANSLATE_NOOP("App::Property","The pipes linked by this connector"))
+        if not "ConnectorType" in pl:
+            obj.addProperty("App::PropertyEnumeration", "ConnectorType", "PipeConnector", QT_TRANSLATE_NOOP("App::Property","The type of this connector"))
+            obj.ConnectorType = ["Corner","Tee"]
+            obj.setEditorMode("ConnectorType",1)
+        self.Type = "PipeConnector"
+
+    def onDocumentRestored(self,obj):
+
+        ArchComponent.Component.onDocumentRestored(self,obj)
+        self.setProperties(obj)
+
+    def execute(self,obj):
+
+        tol = 1 # tolerance for alignment. This is only visual, we can keep it low...
+        ptol = 0.001 # tolerance for coincident points
+
+        import math,Part,DraftGeomUtils,ArchCommands
+        if len(obj.Pipes) < 2:
+            return
+        if len(obj.Pipes) > 3:
+            FreeCAD.Console.PrintWarning(translate("Arch","Only the 3 first wires will be connected")+"\n")
+        if obj.Radius.Value == 0:
+            return
+        wires = []
+        order = []
+        for o in obj.Pipes:
+            wires.append(o.Proxy.getWire(o))
+        if wires[0].Vertexes[0].Point.sub(wires[1].Vertexes[0].Point).Length <= ptol:
+            order = ["start","start"]
+            point = wires[0].Vertexes[0].Point
+        elif wires[0].Vertexes[0].Point.sub(wires[1].Vertexes[-1].Point).Length <= ptol:
+            order = ["start","end"]
+            point = wires[0].Vertexes[0].Point
+        elif wires[0].Vertexes[-1].Point.sub(wires[1].Vertexes[-1].Point).Length <= ptol:
+            order = ["end","end"]
+            point = wires[0].Vertexes[-1].Point
+        elif wires[0].Vertexes[-1].Point.sub(wires[1].Vertexes[0].Point).Length <= ptol:
+            order = ["end","start"]
+            point = wires[0].Vertexes[-1].Point
+        else:
+            FreeCAD.Console.PrintError(translate("Arch","Common vertex not found")+"\n")
+            return
+        if order[0] == "start":
+            v1 = wires[0].Vertexes[1].Point.sub(wires[0].Vertexes[0].Point).normalize()
+        else:
+            v1 = wires[0].Vertexes[-2].Point.sub(wires[0].Vertexes[-1].Point).normalize()
+        if order[1] == "start":
+            v2 = wires[1].Vertexes[1].Point.sub(wires[1].Vertexes[0].Point).normalize()
+        else:
+            v2 = wires[1].Vertexes[-2].Point.sub(wires[1].Vertexes[-1].Point).normalize()
+        p = obj.Pipes[0].Proxy.getProfile(obj.Pipes[0])
+        # If the pipe has a non-zero WallThickness p is a shape instead of a wire:
+        if p.ShapeType != "Wire":
+            p = p.Wires
+        p = Part.Face(p)
+        if len(obj.Pipes) == 2:
+            if obj.ConnectorType != "Corner":
+                obj.ConnectorType = "Corner"
+            if round(v1.getAngle(v2),tol) in [0,round(math.pi,tol)]:
+                FreeCAD.Console.PrintError(translate("Arch","Pipes are already aligned")+"\n")
+                return
+            normal = v2.cross(v1)
+            offset = math.tan(math.pi/2-v1.getAngle(v2)/2)*obj.Radius.Value
+            v1.multiply(offset)
+            v2.multiply(offset)
+            self.setOffset(obj.Pipes[0],order[0],offset)
+            self.setOffset(obj.Pipes[1],order[1],offset)
+            # find center
+            perp = v1.cross(normal).normalize()
+            perp.multiply(obj.Radius.Value)
+            center = point.add(v1).add(perp)
+            # move and rotate the profile to the first point
+            delta = point.add(v1)-p.CenterOfMass
+            p.translate(delta)
+            vp = DraftGeomUtils.getNormal(p)
+            rot = FreeCAD.Rotation(vp,v1)
+            p.rotate(p.CenterOfMass,rot.Axis,math.degrees(rot.Angle))
+            sh = p.revolve(center,normal,math.degrees(math.pi-v1.getAngle(v2)))
+            #sh = Part.makeCompound([sh]+[Part.Vertex(point),Part.Vertex(point.add(v1)),Part.Vertex(center),Part.Vertex(point.add(v2))])
+        else:
+            if obj.ConnectorType != "Tee":
+                obj.ConnectorType = "Tee"
+            if wires[2].Vertexes[0].Point == point:
+                order.append("start")
+            elif wires[0].Vertexes[-1].Point == point:
+                order.append("end")
+            else:
+                FreeCAD.Console.PrintError(translate("Arch","Common vertex not found")+"\n")
+            if order[2] == "start":
+                v3 = wires[2].Vertexes[1].Point.sub(wires[2].Vertexes[0].Point).normalize()
+            else:
+                v3 = wires[2].Vertexes[-2].Point.sub(wires[2].Vertexes[-1].Point).normalize()
+            if round(v1.getAngle(v2),tol) in [0,round(math.pi,tol)]:
+                pair = [v1,v2,v3]
+            elif round(v1.getAngle(v3),tol) in [0,round(math.pi,tol)]:
+                pair = [v1,v3,v2]
+            elif round(v2.getAngle(v3),tol) in [0,round(math.pi,tol)]:
+                pair = [v2,v3,v1]
+            else:
+                FreeCAD.Console.PrintError(translate("Arch","At least 2 pipes must align")+"\n")
+                return
+            offset = obj.Radius.Value
+            v1.multiply(offset)
+            v2.multiply(offset)
+            v3.multiply(offset)
+            self.setOffset(obj.Pipes[0],order[0],offset)
+            self.setOffset(obj.Pipes[1],order[1],offset)
+            self.setOffset(obj.Pipes[2],order[2],offset)
+            normal = pair[0].cross(pair[2])
+            # move and rotate the profile to the first point
+            delta = point.add(pair[0])-p.CenterOfMass
+            p.translate(delta)
+            vp = DraftGeomUtils.getNormal(p)
+            rot = FreeCAD.Rotation(vp,pair[0])
+            p.rotate(p.CenterOfMass,rot.Axis,math.degrees(rot.Angle))
+            t1 = p.extrude(pair[1].multiply(2))
+            # move and rotate the profile to the second point
+            delta = point.add(pair[2])-p.CenterOfMass
+            p.translate(delta)
+            vp = DraftGeomUtils.getNormal(p)
+            rot = FreeCAD.Rotation(vp,pair[2])
+            p.rotate(p.CenterOfMass,rot.Axis,math.degrees(rot.Angle))
+            t2 = p.extrude(pair[2].negative().multiply(2))
+            # create a cut plane
+            cp = Part.makePolygon([point,point.add(pair[0]),point.add(normal),point])
+            cp = Part.Face(cp)
+            if cp.normalAt(0,0).getAngle(pair[2]) < math.pi/2:
+                cp.reverse()
+            cf, cv, invcv = ArchCommands.getCutVolume(cp,t2)
+            t2 = t2.cut(cv)
+            sh = t1.fuse(t2)
+        obj.Shape = sh
+
+    def setOffset(self,pipe,pos,offset):
+
+        if pos == "start":
+            if pipe.OffsetStart != offset:
+                pipe.OffsetStart = offset
+                pipe.Proxy.execute(pipe)
+        else:
+            if pipe.OffsetEnd != offset:
+                pipe.OffsetEnd = offset
+                pipe.Proxy.execute(pipe)
+
+if FreeCAD.GuiUp:
+    FreeCADGui.addCommand('Conduit', CommandConduit())
+    FreeCADGui.addCommand('Arch_PipeConnector',_CommandPipeConnector())
+
+    class _ArchPipeGroupCommand:
+
+        def GetCommands(self):
+            return tuple(['Arch_Pipe','Arch_PipeConnector'])
+        def GetResources(self):
+            return { 'MenuText': QT_TRANSLATE_NOOP("Arch_PipeTools",'Pipe tools'),
+                     'ToolTip': QT_TRANSLATE_NOOP("Arch_PipeTools",'Pipe tools')
+                   }
+        def IsActive(self):
+            return not FreeCAD.ActiveDocument is None
+
+    FreeCADGui.addCommand('Arch_PipeTools', _ArchPipeGroupCommand())

Electrical/Inverter/PVPlantInverter.py

@@ -0,0 +1,398 @@
+# /**********************************************************************
+# *                                                                     *
+# * Copyright (c) 2021 Javier Braña <javier.branagutierrez@gmail.com>  *
+# *                                                                     *
+# * This program is free software; you can redistribute it and/or modify*
+# * it under the terms of the GNU Lesser General Public License (LGPL)  *
+# * as published by the Free Software Foundation; either version 2 of   *
+# * the License, or (at your option) any later version.                 *
+# * for detail see the LICENCE text file.                               *
+# *                                                                     *
+# * This program is distributed in the hope that it will be useful,     *
+# * but WITHOUT ANY WARRANTY; without even the implied warranty of      *
+# * MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE.  See the       *
+# * GNU Library General Public License for more details.                *
+# *                                                                     *
+# * You should have received a copy of the GNU Library General Public   *
+# * License along with this program; if not, write to the Free Software *
+# * Foundation, Inc., 59 Temple Place, Suite 330, Boston, MA  02111-1307*
+# * USA                                                                 *
+# *                                                                     *
+# ***********************************************************************
+
+import FreeCAD
+import ArchComponent
+import os
+import zipfile
+import re
+
+if FreeCAD.GuiUp:
+    import FreeCADGui
+    from DraftTools import translate
+else:
+    # \cond
+    def translate(ctxt,txt):
+        return txt
+    def QT_TRANSLATE_NOOP(ctxt,txt):
+        return txt
+    # \endcond
+
+import os
+from PVPlantResources import DirIcons as DirIcons
+
+__title__ = "PVPlant Areas"
+__author__ = "Javier Braña"
+__url__ = "http://www.sogos-solar.com"
+
+import PVPlantResources
+from PVPlantResources import DirIcons as DirIcons
+Dir3dObjects = os.path.join(PVPlantResources.DirResources, "3dObjects")
+
+
+def makeStringInverter():
+    obj = FreeCAD.ActiveDocument.addObject("Part::FeaturePython", "StringInverter")
+    InverterBase(obj)
+    ViewProviderStringInverter(obj.ViewObject)
+
+    try:
+        folder = FreeCAD.ActiveDocument.StringInverters
+    except:
+        folder = FreeCAD.ActiveDocument.addObject("App::DocumentObjectGroup", 'StringInverters')
+        folder.Label = "StringInverters"
+    folder.addObject(obj)
+    return obj
+
+
+class InverterBase(ArchComponent.Component):
+    def __init__(self, obj):
+        ''' Initialize the Area object '''
+        ArchComponent.Component.__init__(self, obj)
+
+        self.oldMPPTs = 0
+
+        self.Type = None
+        self.obj = None
+        self.setProperties(obj)
+
+    def setProperties(self, obj):
+        pl = obj.PropertiesList
+
+        if not "File" in pl:
+            obj.addProperty("App::PropertyFile",
+                            "File",
+                            "Inverter",
+                            "The base file this component is built upon")
+
+        if not ("MPPTs" in pl):
+            obj.addProperty("App::PropertyQuantity",
+                            "MPPTs",
+                            "Inverter",
+                            "Points that define the area"
+                            ).MPPTs = 0
+
+        if not ("Generator" in pl):
+            obj.addProperty("App::PropertyEnumeration",
+                            "Generator",
+                            "Inverter",
+                            "Points that define the area"
+                            ).Generator = ["Generic", "Library"]
+            obj.Generator = "Generic"
+
+        if not ("Type" in pl):
+            obj.addProperty("App::PropertyString",
+                            "Type",
+                            "Base",
+                            "Points that define the area"
+                            ).Type = "InverterBase"
+            obj.setEditorMode("Type", 1)
+
+        self.Type = obj.Type
+        obj.Proxy = self
+
+    def onDocumentRestored(self, obj):
+        """ Method run when the document is restored """
+        self.setProperties(obj)
+
+    def onBeforeChange(self, obj, prop):
+
+        if prop == "MPPTs":
+            self.oldMPPTs = int(obj.MPPTs)
+
+    def onChanged(self, obj, prop):
+        ''' '''
+
+        if prop == "Generator":
+            if obj.Generator == "Generic":
+                obj.setEditorMode("MPPTs", 0)
+            else:
+                obj.setEditorMode("MPPTs", 1)
+
+        if prop == "MPPTs":
+            ''' '''
+            if self.oldMPPTs > obj.MPPTs:
+                ''' borrar sobrantes '''
+                obj.removeProperty()
+
+            elif self.oldMPPTs < obj.MPPTs:
+                ''' crear los faltantes '''
+                for i in range(self.oldMPPTs, int(obj.MPPTs)):
+                    ''' '''
+                    print(i)
+            else:
+                pass
+
+        if (prop == "File") and obj.File:
+            ''' '''
+
+    def execute(self, obj):
+        ''' '''
+        # obj.Shape: compound
+        # |- body: compound
+        # |-- inverter: solid
+        # |-- door: solid
+        # |-- holder: solid
+
+        # |- connectors: compound
+        # |-- DC: compound
+        # |--- MPPT 1..x: compound
+        # |---- positive: compound
+        # |----- connector 1..y: ??
+        # |---- negative 1..y: compound
+        # |----- connector 1..y: ??
+        # |-- AC: compound
+        # |--- R,S,T,: ??
+        # |-- Communication
+
+        pl = obj.Placement
+        filename = self.getFile(obj)
+        if filename:
+            parts = self.getPartsList(obj)
+            if parts:
+                zdoc = zipfile.ZipFile(filename)
+                if zdoc:
+                    f = zdoc.open(parts[list(parts.keys())[-1]][1])
+                    shapedata = f.read()
+                    f.close()
+                    shapedata = shapedata.decode("utf8")
+                    shape = self.cleanShape(shapedata, obj, parts[list(parts.keys())[-1]][2])
+                    obj.Shape = shape
+                    if not pl.isIdentity():
+                        obj.Placement = pl
+                    obj.MPPTs = len(shape.SubShapes[1].SubShapes[0].SubShapes)
+
+    def cleanShape(self, shapedata, obj, materials):
+        "cleans the imported shape"
+
+        import Part
+        shape = Part.Shape()
+        shape.importBrepFromString(shapedata)
+        '''if obj.FuseArch and materials:
+            # separate lone edges
+            shapes = []
+            for edge in shape.Edges:
+                found = False
+                for solid in shape.Solids:
+                    for soledge in solid.Edges:
+                        if edge.hashCode() == soledge.hashCode():
+                            found = True
+                            break
+                    if found:
+                        break
+                if found:
+                    break
+            else:
+                shapes.append(edge)
+            print("solids:",len(shape.Solids),"mattable:",materials)
+            for key,solindexes in materials.items():
+                if key == "Undefined":
+                    # do not join objects with no defined material
+                    for solindex in [int(i) for i in solindexes.split(",")]:
+                        shapes.append(shape.Solids[solindex])
+                else:
+                    fusion = None
+                    for solindex in [int(i) for i in solindexes.split(",")]:
+                        if not fusion:
+                            fusion = shape.Solids[solindex]
+                        else:
+                            fusion = fusion.fuse(shape.Solids[solindex])
+                    if fusion:
+                        shapes.append(fusion)
+            shape = Part.makeCompound(shapes)
+            try:
+                shape = shape.removeSplitter()
+            except Exception:
+                print(obj.Label,": error removing splitter")'''
+        return shape
+
+    def getFile(self, obj, filename=None):
+        "gets a valid file, if possible"
+
+        if not filename:
+            filename = obj.File
+        if not filename:
+            return None
+        if not filename.lower().endswith(".fcstd"):
+            return None
+        if not os.path.exists(filename):
+            # search for the file in the current directory if not found
+            basename = os.path.basename(filename)
+            currentdir = os.path.dirname(obj.Document.FileName)
+            altfile = os.path.join(currentdir,basename)
+            if altfile == obj.Document.FileName:
+                return None
+            elif os.path.exists(altfile):
+                return altfile
+            else:
+                # search for subpaths in current folder
+                altfile = None
+                subdirs = self.splitall(os.path.dirname(filename))
+                for i in range(len(subdirs)):
+                    subpath = [currentdir]+subdirs[-i:]+[basename]
+                    altfile = os.path.join(*subpath)
+                    if os.path.exists(altfile):
+                        return altfile
+                return None
+        return filename
+
+    def getPartsList(self, obj, filename=None):
+
+        "returns a list of Part-based objects in a FCStd file"
+
+        parts = {}
+        materials = {}
+        filename = self.getFile(obj,filename)
+        if not filename:
+            return parts
+        zdoc = zipfile.ZipFile(filename)
+        with zdoc.open("Document.xml") as docf:
+            name = None
+            label = None
+            part = None
+            materials = {}
+            writemode = False
+            for line in docf:
+                line = line.decode("utf8")
+                if "<Object name=" in line:
+                    n = re.findall('name=\"(.*?)\"',line)
+                    if n:
+                        name = n[0]
+                elif "<Property name=\"Label\"" in line:
+                    writemode = True
+                elif writemode and "<String value=" in line:
+                    n = re.findall('value=\"(.*?)\"',line)
+                    if n:
+                        label = n[0]
+                        writemode = False
+                elif "<Property name=\"Shape\" type=\"Part::PropertyPartShape\"" in line:
+                    writemode = True
+                elif writemode and "<Part file=" in line:
+                    n = re.findall('file=\"(.*?)\"',line)
+                    if n:
+                        part = n[0]
+                        writemode = False
+                elif "<Property name=\"MaterialsTable\" type=\"App::PropertyMap\"" in line:
+                    writemode = True
+                elif writemode and "<Item key=" in line:
+                    n = re.findall('key=\"(.*?)\"',line)
+                    v = re.findall('value=\"(.*?)\"',line)
+                    if n and v:
+                        materials[n[0]] = v[0]
+                elif writemode and "</Map>" in line:
+                    writemode = False
+                elif "</Object>" in line:
+                    if name and label and part:
+                        parts[name] = [label,part,materials]
+                    name = None
+                    label = None
+                    part = None
+                    materials = {}
+                    writemode = False
+        return parts
+
+    def getColors(self,obj):
+
+        "returns the DiffuseColor of the referenced object"
+
+        filename = self.getFile(obj)
+        if not filename:
+            return None
+        part = obj.Part
+        if not obj.Part:
+            return None
+        zdoc = zipfile.ZipFile(filename)
+        if not "GuiDocument.xml" in zdoc.namelist():
+            return None
+        colorfile = None
+        with zdoc.open("GuiDocument.xml") as docf:
+            writemode1 = False
+            writemode2 = False
+            for line in docf:
+                line = line.decode("utf8")
+                if ("<ViewProvider name=" in line) and (part in line):
+                    writemode1 = True
+                elif writemode1 and ("<Property name=\"DiffuseColor\"" in line):
+                    writemode1 = False
+                    writemode2 = True
+                elif writemode2 and ("<ColorList file=" in line):
+                    n = re.findall('file=\"(.*?)\"',line)
+                    if n:
+                        colorfile = n[0]
+                        break
+        if not colorfile:
+            return None
+        if not colorfile in zdoc.namelist():
+            return None
+        colors = []
+        cf = zdoc.open(colorfile)
+        buf = cf.read()
+        cf.close()
+        for i in range(1,int(len(buf)/4)):
+            colors.append((buf[i*4+3]/255.0,buf[i*4+2]/255.0,buf[i*4+1]/255.0,buf[i*4]/255.0))
+        if colors:
+            return colors
+        return None
+
+    def splitall(self,path):
+
+        "splits a path between its components"
+
+        allparts = []
+        while 1:
+            parts = os.path.split(path)
+            if parts[0] == path:  # sentinel for absolute paths
+                allparts.insert(0, parts[0])
+                break
+            elif parts[1] == path: # sentinel for relative paths
+                allparts.insert(0, parts[1])
+                break
+            else:
+                path = parts[0]
+                allparts.insert(0, parts[1])
+        return allparts
+
+class ViewProviderStringInverter(ArchComponent.ViewProviderComponent):
+    def __init__(self, vobj):
+        ArchComponent.ViewProviderComponent.__init__(self, vobj)
+
+    def getIcon(self):
+        return str(os.path.join(PVPlantResources.DirIcons, "Inverter.svg"))
+
+
+class CommandStringInverter:
+
+    def GetResources(self):
+        return {'Pixmap': str(os.path.join(PVPlantResources.DirIcons, "Inverter.svg")),
+                'Accel': "E, I",
+                'MenuText': "String Inverter",
+                'ToolTip': "String Placement",}
+
+    def Activated(self):
+        sinverter = makeStringInverter()
+
+    def IsActive(self):
+        active = not (FreeCAD.ActiveDocument is None)
+        return active
+
+if FreeCAD.GuiUp:
+    FreeCADGui.addCommand('StringInverter', CommandStringInverter())
+

Export/PVPlantBOQCivil.py

@@ -0,0 +1,80 @@
+# /**********************************************************************
+# *                                                                     *
+# * Copyright (c) 2021 Javier Braña <javier.branagutierrez@gmail.com>  *
+# *                                                                     *
+# * This program is free software; you can redistribute it and/or modify*
+# * it under the terms of the GNU Lesser General Public License (LGPL)  *
+# * as published by the Free Software Foundation; either version 2 of   *
+# * the License, or (at your option) any later version.                 *
+# * for detail see the LICENCE text file.                               *
+# *                                                                     *
+# * This program is distributed in the hope that it will be useful,     *
+# * but WITHOUT ANY WARRANTY; without even the implied warranty of      *
+# * MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE.  See the       *
+# * GNU Library General Public License for more details.                *
+# *                                                                     *
+# * You should have received a copy of the GNU Library General Public   *
+# * License along with this program; if not, write to the Free Software *
+# * Foundation, Inc., 59 Temple Place, Suite 330, Boston, MA  02111-1307*
+# * USA                                                                 *
+# *                                                                     *
+# ***********************************************************************
+
+import FreeCAD, Draft
+import PVPlantSite
+
+if FreeCAD.GuiUp:
+    import FreeCADGui
+    from DraftTools import translate
+    from PySide.QtCore import QT_TRANSLATE_NOOP
+    import draftguitools.gui_trackers as DraftTrackers
+
+    import Part
+    import pivy
+    from pivy import coin
+    import os
+else:
+    # \cond
+    def translate(ctxt, txt):
+        return txt
+
+
+    def QT_TRANSLATE_NOOP(ctxt, txt):
+        return txt
+    # \endcond
+
+__title__ = "PVPlant Trench"
+__author__ = "Javier Braña"
+__url__ = "http://www.sogos-solar.com"
+
+from PVPlantResources import DirIcons as DirIcons
+from PVPlantResources import DirDocuments as DirDocuments
+import openpyxl
+
+
+def makeBOQCivil():
+    ''' create a excel '''
+
+
+
+
+
+class _CommandBOQCivil:
+
+    def GetResources(self):
+        return {'Pixmap': str(os.path.join(DirIcons, "boqc.svg")),
+                'Accel': "R, C",
+                'MenuText': "BOQ Civil",
+                'ToolTip': ""}
+
+    def Activated(self):
+        makeBOQCivil()
+
+    def IsActive(self):
+        if FreeCAD.ActiveDocument:
+            return True
+        else:
+            return False
+
+if FreeCAD.GuiUp:
+    FreeCADGui.addCommand('BOQCivil', _CommandBOQCivil())

Export/PVPlantBOQElectrical.py

@@ -0,0 +1,104 @@
+# /**********************************************************************
+# *                                                                     *
+# * Copyright (c) 2021 Javier Braña <javier.branagutierrez@gmail.com>  *
+# *                                                                     *
+# * This program is free software; you can redistribute it and/or modify*
+# * it under the terms of the GNU Lesser General Public License (LGPL)  *
+# * as published by the Free Software Foundation; either version 2 of   *
+# * the License, or (at your option) any later version.                 *
+# * for detail see the LICENCE text file.                               *
+# *                                                                     *
+# * This program is distributed in the hope that it will be useful,     *
+# * but WITHOUT ANY WARRANTY; without even the implied warranty of      *
+# * MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE.  See the       *
+# * GNU Library General Public License for more details.                *
+# *                                                                     *
+# * You should have received a copy of the GNU Library General Public   *
+# * License along with this program; if not, write to the Free Software *
+# * Foundation, Inc., 59 Temple Place, Suite 330, Boston, MA  02111-1307*
+# * USA                                                                 *
+# *                                                                     *
+# ***********************************************************************
+
+import FreeCAD, Draft
+import copy
+
+if FreeCAD.GuiUp:
+    import FreeCADGui
+    from DraftTools import translate
+    from PySide.QtCore import QT_TRANSLATE_NOOP
+    import draftguitools.gui_trackers as DraftTrackers
+
+    import Part
+    import pivy
+    from pivy import coin
+    import os
+else:
+    # \cond
+    def translate(ctxt, txt):
+        return txt
+
+
+    def QT_TRANSLATE_NOOP(ctxt, txt):
+        return txt
+    # \endcond
+
+__title__ = "PVPlant Trench"
+__author__ = "Javier Braña"
+__url__ = "http://www.sogos-solar.com"
+
+from PVPlantResources import DirIcons as DirIcons
+
+
+def makeBOQElectrical():
+    ''' create a excel '''
+    print("makeBOQElectrical")
+    import sys
+    sys.path.append(r"/")
+    funct = 0
+    if funct == 0:
+        print(" ------- Prueba generar layout en excel:  ")
+        # export layout to Excel:
+        from Export import layoutToExcel
+        layoutToExcel.generateLayout()
+        return
+    else:
+        print(" ------- Prueba dibujar contorno de los objetos seleccionados:  ")
+        import numpy as np
+        import MeshTools.MeshGetBoundary as mgb
+        # contorno:
+        maxdist = 6000
+        if FreeCADGui.Selection.hasSelection():
+            sel = FreeCADGui.Selection.getSelection()
+            pts = []
+            for obj in sel:
+                for panel in obj.Shape.SubShapes[0].SubShapes[0].SubShapes:
+                    zm = panel.BoundBox.ZMax
+                    for i in range(8):
+                        pt = panel.BoundBox.getPoint(i)
+                        if pt.z == zm:
+                            pts.append(pt)
+            import PVPlantCreateTerrainMesh
+            m = PVPlantCreateTerrainMesh.Triangulate(np.array(pts), MaxlengthLE=maxdist, use3d=False)
+            b = mgb.get_boundary(m)
+            Part.show(b)
+
+class _CommandBOQElectrical:
+    def GetResources(self):
+        return {'Pixmap': str(os.path.join(DirIcons, "boqe.svg")),
+                'Accel': "R, E",
+                'MenuText': "BOQ Electrical",
+                'ToolTip': ""}
+
+    def Activated(self):
+        makeBOQElectrical()
+
+    def IsActive(self):
+        if FreeCAD.ActiveDocument:
+            return True
+        else:
+            return False
+
+
+if FreeCAD.GuiUp:
+    FreeCADGui.addCommand('BOQElectrical', _CommandBOQElectrical())

Export/PVPlantBOQMechanical.py

@@ -0,0 +1,344 @@
+# /**********************************************************************
+# *                                                                     *
+# * Copyright (c) 2021 Javier Braña <javier.branagutierrez@gmail.com>  *
+# *                                                                     *
+# * This program is free software; you can redistribute it and/or modify*
+# * it under the terms of the GNU Lesser General Public License (LGPL)  *
+# * as published by the Free Software Foundation; either version 2 of   *
+# * the License, or (at your option) any later version.                 *
+# * for detail see the LICENCE text file.                               *
+# *                                                                     *
+# * This program is distributed in the hope that it will be useful,     *
+# * but WITHOUT ANY WARRANTY; without even the implied warranty of      *
+# * MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE.  See the       *
+# * GNU Library General Public License for more details.                *
+# *                                                                     *
+# * You should have received a copy of the GNU Library General Public   *
+# * License along with this program; if not, write to the Free Software *
+# * Foundation, Inc., 59 Temple Place, Suite 330, Boston, MA  02111-1307*
+# * USA                                                                 *
+# *                                                                     *
+# ***********************************************************************
+
+
+import FreeCAD
+
+if FreeCAD.GuiUp:
+    import FreeCADGui, os
+    from PySide import QtCore
+    from PySide.QtCore import QT_TRANSLATE_NOOP
+else:
+    # \cond
+    def translate(ctxt, txt):
+        return txt
+    def QT_TRANSLATE_NOOP(ctxt, txt):
+        return txt
+    # \endcond
+
+try:
+    _fromUtf8 = QtCore.QString.fromUtf8
+except AttributeError:
+    def _fromUtf8(s):
+        return s
+
+import openpyxl
+from openpyxl.styles import Alignment, Border, Side, PatternFill, Font
+import PVPlantResources
+import PVPlantSite
+
+# Estilos:
+thin = Side(border_style="thin", color="7DA4B8")
+double = Side(border_style="double", color="ff0000")
+border_thin = Border(top=thin, left=thin, right=thin, bottom=thin)
+border_fat = Border(top=thin, left=thin, right=thin, bottom=thin)
+# fill = PatternFill("solid", fgColor="DDDDDD")
+# fill = GradientFill(stop=("000000", "FFFFFF"))
+
+scale = 0.001 # milimeters to meter
+
+def style_range(ws, cell_range, border=Border(), fill=None, font=None, alignment=None):
+    """
+    Apply styles to a range of cells as if they were a single cell.
+
+    :param ws:  Excel worksheet instance
+    :param range: An excel range to style (e.g. A1:F20)
+    :param border: An openpyxl Border
+    :param fill: An openpyxl PatternFill or GradientFill
+    :param font: An openpyxl Font object
+    """
+
+    top = Border(top=border.top)
+    left = Border(left=border.left)
+    right = Border(right=border.right)
+    bottom = Border(bottom=border.bottom)
+
+    first_cell = ws[cell_range.split(":")[0]]
+    if alignment:
+        first_cell.alignment = alignment
+
+    rows = ws[cell_range]
+    if font:
+        first_cell.font = font
+
+    for cell in rows[0]:
+        cell.border = cell.border + top
+    for cell in rows[-1]:
+        cell.border = cell.border + bottom
+
+    for row in rows:
+        l = row[0]
+        r = row[-1]
+        l.border = l.border + left
+        r.border = r.border + right
+        if fill:
+            for c in row:
+                c.fill = fill
+
+def spreadsheetBOQFrames(sheet, sel):
+    sheet['A1'] = 'Index'
+    sheet['B1'] = 'Frame'
+    sheet['C1'] = 'Frame Type'
+    sheet['D1'] = 'X'
+    sheet['E1'] = 'Y'
+    sheet['F1'] = 'Z'
+    sheet['G1'] = 'Angle N-S'
+    sheet['H1'] = 'Angle L-W'
+    sheet['I1'] = 'Nº Poles'
+
+    sheet.column_dimensions['A'].width = 8
+    sheet.column_dimensions['B'].width = 30
+    sheet.column_dimensions['C'].width = 20
+    sheet.column_dimensions['D'].width = 20
+    sheet.column_dimensions['E'].width = 20
+    sheet.column_dimensions['F'].width = 20
+    sheet.column_dimensions['G'].width = 15
+    sheet.column_dimensions['H'].width = 15
+    sheet.column_dimensions['I'].width = 15
+    sheet.row_dimensions[1].height = 40
+
+    style_range(sheet, 'A1:I1',
+                border=Border(top=thin, left=thin, right=thin, bottom=thin),
+                fill=PatternFill("solid", fgColor="7DA4B8"),
+                font=Font(name='Quicksand', size=10, b=True, color="FFFFFF"),
+                alignment=Alignment(horizontal="center", vertical="center"))
+
+    for ind in range(0, len(sel)):
+        row = ind + 2
+        sheet['A{0}'.format(row)] = ind + 1
+        sheet['B{0}'.format(row)] = sel[ind].Label
+        sheet['C{0}'.format(row)] = sel[ind].Setup.Label
+        sheet['D{0}'.format(row)] = sel[ind].Placement.Base.x * scale
+        sheet['E{0}'.format(row)] = sel[ind].Placement.Base.y * scale
+        sheet['R{0}'.format(row)] = sel[ind].Placement.Base.z * scale
+        sheet['G{0}'.format(row)] = sel[ind].Placement.Rotation.toEuler()[0]
+        sheet['H{0}'.format(row)] = sel[ind].Placement.Rotation.toEuler()[1]
+        sheet['I{0}'.format(row)] = sel[ind].Setup.NumberPole.Value
+        style_range(sheet, 'A' + str(row) + ':I' + str(row),
+                    border=Border(top=thin, left=thin, right=thin, bottom=thin),
+                    font=Font(name='Quicksand', size=10),
+                    alignment=Alignment(horizontal="center", vertical="center"))
+
+def spreadsheetBOQPoles(sheet, sel):
+    import MeshPart as mp
+    from Mechanical.Frame import PVPlantFrame
+
+    # Data:
+    terrain = PVPlantSite.get().Terrain.Mesh  # Shape
+
+    # Headers:
+    sheet['A1'] = 'Frame'
+    sheet['B1'] = 'Pole'
+    sheet['C1'] = 'Pole Type'
+    sheet['D1'] = 'X'
+    sheet['E1'] = 'Y'
+    sheet['F1'] = 'Z frame attach'
+    sheet['G1'] = 'Z aerial head'
+    sheet['H1'] = 'Pole length'
+    sheet['I1'] = 'Pole aerial length'
+    sheet['J1'] = 'Pole terrain enter length'
+
+    sheet.column_dimensions['A'].width = 30
+    sheet.column_dimensions['B'].width = 8
+    sheet.column_dimensions['C'].width = 20
+    sheet.column_dimensions['D'].width = 20
+    sheet.column_dimensions['E'].width = 20
+    sheet.column_dimensions['F'].width = 20
+    sheet.column_dimensions['G'].width = 20
+    sheet.column_dimensions['H'].width = 20
+    sheet.column_dimensions['I'].width = 20
+    sheet.column_dimensions['J'].width = 20
+    sheet.row_dimensions[1].height = 40
+    style_range(sheet, 'A1:J1',
+                border=Border(top=thin, left=thin, right=thin, bottom=thin),
+                fill=PatternFill("solid", fgColor="7DA4B8"),
+                font=Font(name='Quicksand', size=11, b=True, color="FFFFFF"),
+                alignment=Alignment(horizontal="center", vertical="center"))
+    sheet['A2'] = ""
+    sheet.row_dimensions[2].height = 5
+
+    data = {"Frame": [],
+            #"FrameType": [],
+            "Pole": [],
+            "PoleType": [],
+            "PoleLength": [],
+            "Center": [],
+            "Head": []}
+
+    cnt = 0
+    for frame_ind, frame in enumerate(sel):
+        poles = frame.Shape.SubShapes[1].SubShapes[0].SubShapes
+        numpoles = int(frame.Setup.NumberPole.Value)
+        seq = frame.Setup.PoleSequence
+        if len(seq) < numpoles:
+            seq = PVPlantFrame.getarray(frame.Setup.PoleSequence, numpoles)
+        for pole_ind in range(numpoles):
+            pole = poles[pole_ind]
+            poletype = frame.Setup.PoleType[seq[pole_ind]]
+            data["Frame"].append(frame.Label)
+            #data["FrameType"].append(frame.Setup.Label)
+            data["Pole"].append(pole_ind + 1)
+            data["PoleType"].append(poletype.Label)
+            data["PoleLength"].append(int(poletype.Height))
+            data["Center"].append(pole.BoundBox.Center)
+            data["Head"].append(pole.BoundBox.ZMax)
+            cnt += 1
+
+    pts = mp.projectPointsOnMesh(data["Center"], terrain, FreeCAD.Vector(0, 0, 1))
+    #if cnt == len(pts):
+    data["Soil"] = pts
+
+    row = 3
+    group_from = row
+    f = data["Frame"][0]
+    for i in range(0, len(data["Frame"])):
+        if f != data["Frame"][i]:
+            style_range(sheet, 'A' + str(group_from) + ':F' + str(row - 1),
+                        border=Border(top=thin, left=thin, right=thin, bottom=thin),
+                        font=Font(name='Quicksand', size=11, ),
+                        alignment=Alignment(horizontal="center", vertical="center"))
+            sheet.merge_cells('A' + str(group_from) + ':A' + str(row - 1))
+            style_range(sheet, 'A' + str(group_from) + ':A' + str(row - 1),
+                        border=Border(top=thin, left=thin, right=thin, bottom=thin),
+                        font=Font(name='Quicksand', size=11, ),
+                        alignment=Alignment(horizontal="center", vertical="center"))
+            #sheet['A{0}'.format(row)] = ""
+            sheet.row_dimensions[row].height = 5
+            row += 1
+            f = data["Frame"][i]
+            group_from = row
+
+        sheet['A{0}'.format(row)] = data['Frame'][i]
+        sheet['B{0}'.format(row)] = data['Pole'][i]
+        sheet['C{0}'.format(row)] = data['PoleType'][i]
+        sheet['D{0}'.format(row)] = round(data['Center'][i].x, 0) * scale
+        sheet['D{0}'.format(row)].number_format = "0.000"
+        sheet['E{0}'.format(row)] = round(data['Center'][i].y, 0) * scale
+        sheet['E{0}'.format(row)].number_format = "0.000"
+        try:
+            sheet['F{0}'.format(row)] = round(data['Soil'][i].z, 0) * scale
+            sheet['F{0}'.format(row)].number_format = "0.000"
+        except:
+            pass
+        sheet['G{0}'.format(row)] = round(data['Head'][i]) * scale
+        sheet['G{0}'.format(row)].number_format = "0.000"
+        sheet['H{0}'.format(row)] = data["PoleLength"][i] * scale
+        sheet['H{0}'.format(row)].number_format = "0.000"
+        sheet['I{0}'.format(row)] = '=G{0}-F{0}'.format(row)
+        sheet['I{0}'.format(row)].number_format = "0.000"
+        sheet['J{0}'.format(row)] = '=H{0}-I{0}'.format(row)
+        sheet['J{0}'.format(row)].number_format = "0.000"
+
+        style_range(sheet, 'A' + str(row) + ':J' + str(row),
+                    border=Border(top=thin, left=thin, right=thin, bottom=thin),
+                    font=Font(name='Quicksand', size=11,),
+                    alignment=Alignment(horizontal="center", vertical="center"))
+        row += 1
+
+def spreadsheetBOQPanelCollision(sheet, sel):
+    # Headers:
+    sheet['A1'] = 'Frame'
+    sheet['B1'] = 'Nombre'
+    sheet['C1'] = 'X'
+    sheet['D1'] = 'Y'
+    sheet['E1'] = 'Z'
+    sheet['G1'] = 'Ángulo E-O'
+    sheet['H1'] = 'Nº Hincas'
+
+    sheet.column_dimensions['A'].width = 30
+    sheet.column_dimensions['B'].width = 8
+    sheet.column_dimensions['C'].width = 20
+    sheet.column_dimensions['D'].width = 20
+    sheet.column_dimensions['E'].width = 20
+    sheet.column_dimensions['F'].width = 20
+    sheet.column_dimensions['G'].width = 20
+    sheet.column_dimensions['H'].width = 20
+    sheet.column_dimensions['I'].width = 20
+    sheet.row_dimensions[1].height = 40
+    style_range(sheet, 'A1:I1',
+                border=Border(top=thin, left=thin, right=thin, bottom=thin),
+                fill=PatternFill("solid", fgColor="7DA4B8"),
+                font=Font(name='Quicksand', size=11, b=True, color="FFFFFF"),
+                alignment=Alignment(horizontal="center", vertical="center"))
+    sheet['A2'] = ""
+    sheet.row_dimensions[2].height = 5
+
+    # Data:
+    for frame_ind in range(0, len(sel)):
+        frame = sel[frame_ind]
+        sheet['A{0}'.format(ind + 2)] = ind
+        sheet['B{0}'.format(ind + 2)] = sel[ind].Label
+        sheet['C{0}'.format(ind + 2)] = sel[ind].Placement.Base.x * scale
+        sheet['D{0}'.format(ind + 2)] = sel[ind].Placement.Base.y * scale
+        sheet['E{0}'.format(ind + 2)] = sel[ind].Placement.Base.z * scale
+        sheet['F{0}'.format(ind + 2)] = sel[ind].Placement.Rotation.toEuler()[0]
+        sheet['G{0}'.format(ind + 2)] = sel[ind].Placement.Rotation.toEuler()[1]
+        sheet['H{0}'.format(ind + 2)] = sel[ind].NumberPole.Value
+
+class _CommandBOQMechanical:
+    def GetResources(self):
+        return {'Pixmap': str(os.path.join(PVPlantResources.DirIcons, "boqm.svg")),
+                'Accel': "R, M",
+                'MenuText': QT_TRANSLATE_NOOP("Placement", "BOQ Mecánico"),
+                'ToolTip': QT_TRANSLATE_NOOP("Placement", "Calcular el BOQ de la")}
+
+    def Activated(self):
+        # make file global:
+        #sel = FreeCAD.ActiveDocument.findObjects(Name="Tracker")
+        sel = []
+        for obj in FreeCAD.ActiveDocument.Objects:
+            '''if not hasattr(obj, "Proxy"):
+                continue
+            if issubclass(obj.Proxy.__class__, PVPlantRack.Frame):
+                objects.append(obj)'''
+            if obj.Name.startswith("Tracker") and not obj.Name.startswith("TrackerSetup"):
+                sel.append(obj)
+        sel = sorted(sel, key=lambda x: x.Label)
+        if len(sel) > 0:
+            path = os.path.dirname(FreeCAD.ActiveDocument.FileName)
+            filename = os.path.join(path, "BOQMechanical.xlsx")
+            mywb = openpyxl.Workbook()
+            sheet = mywb.active
+            sheet.title = 'Frames information'
+            spreadsheetBOQFrames(sheet, sel)
+
+            sheet = mywb.create_sheet("Poles information")
+            spreadsheetBOQPoles(sheet, sel)
+            mywb.save(filename)
+
+            print("Se ha generado el BOQMechanical: ")
+            print(filename)
+            '''import sys
+            path = r'C:\Program Files (x86)\IronPython 2.7\Lib'
+            sys.path.append(path)'''
+
+            import subprocess
+            subprocess.Popen('explorer ' + path)
+
+    def IsActive(self):
+        if FreeCAD.ActiveDocument:
+            return True
+        else:
+            return False
+
+if FreeCAD.GuiUp:
+    FreeCADGui.addCommand('BOQMechanical', _CommandBOQMechanical())

Export/exportDXF.py

@@ -0,0 +1,466 @@
+import math
+import FreeCAD
+from Utils.PVPlantUtils import findObjects
+
+if FreeCAD.GuiUp:
+    import FreeCADGui
+    from PySide import QtCore, QtGui
+    from PySide.QtCore import QT_TRANSLATE_NOOP
+
+    import os
+else:
+    # \cond
+    def translate(ctxt, txt):
+        return txt
+
+
+    def QT_TRANSLATE_NOOP(ctxt, txt):
+        return txt
+    # \endcond
+
+__title__ = "PVPlant Export to DXF"
+__author__ = "Javier Braña"
+__url__ = "http://www.sogos-solar.com"
+
+import PVPlantResources
+from PVPlantResources import DirIcons as DirIcons
+
+field = {"name": "", "width": 0, "heigth": 0}
+
+
+class exportDXF:
+
+    def __init__(self, filename):
+        ''' '''
+        self.doc = None
+        self.msp = None
+        self.filename = filename
+
+        '''
+        doc.linetypes.add("GRENZE2",
+                          # linetype definition in acad.lin:
+                          # A,.25,-.1,[BOX,ltypeshp.shx,x=-.1,s=.1],-.1,1
+                          # replacing BOX by shape index 132 (got index from an AutoCAD file),
+                          # ezdxf can't get shape index from ltypeshp.shx
+                          pattern="A,.25,-.1,[132,ltypeshp.shx,x=-.1,s=.1],-.1,1",
+                          description="Grenze eckig ----[]-----[]----[]-----[]----[]--",
+                          length=1.45,  # required for complex line types
+        })
+        
+        doc.linetypes.add("GRENZE2",
+                        # linetype definition in acad.lin:
+                        # A,.25,-.1,[BOX,ltypeshp.shx,x=-.1,s=.1],-.1,1
+                        # replacing BOX by shape index 132 (got index from an AutoCAD file),
+                        # ezdxf can't get shape index from ltypeshp.shx
+                        pattern = "A,.25,-.1,[132,ltypeshp.shx,x=-.1,s=.1],-.1,1",
+                        description = "Límite1 ----0-----0----0-----0----0-----0--",
+                        length = 1.45,  # required for complex line types
+         })
+         '''
+
+    def createFile(self, version='R2018'):
+        import ezdxf
+        from ezdxf.tools.standards import linetypes
+
+        # 1. Create a new document
+        self.doc = ezdxf.new(version)
+        # 2. Setup document:
+        self.doc.header["$INSUNITS"] = 6
+        self.doc.header['$MEASUREMENT'] = 1
+        self.doc.header['$LUNITS'] = 2
+        self.doc.header['$AUNITS'] = 0
+
+        # 3. Add new entities to the modelspace:
+        self.msp = self.doc.modelspace()
+
+        print("linetypes: ", self.doc.linetypes)
+        for name, desc, pattern in linetypes():
+            if name not in self.doc.linetypes:
+                self.doc.linetypes.add(name=name,
+                                       pattern=pattern,
+                                       description=desc,
+                                       )
+
+
+        self.doc.linetypes.add(name="FENCELINE1",
+                               pattern="A,.25,-.1,[132,ltypeshp.shx,x=-.1,s=.1],-.1,1",
+                               description="Límite1 ----0-----0----0-----0----0-----0--",
+                               length=1.45)  # required for complex line types
+
+    def save(self):
+        from os.path import exists
+        file_exists = exists(self.filename)
+        self.doc.saveas(self.filename)
+        self.doc.save()
+
+    def createLayer(self, layerName="newLayer", layerColor=(0,0,0), layerLineType='CONTINUOUS'):
+        layer = self.doc.layers.add(name=layerName,  linetype=layerLineType)
+        layer.rgb = layerColor
+        return layer
+
+    def createBlock(self, blockName='newBlock'):
+        # Create a block
+        block = self.doc.blocks.new(name=blockName)
+        return block
+
+    def insertBlock(self, name, point=(0.0, 0.0), rotation=0.0, xscale=0.0, yscale=0.0):
+        if name == "":
+            return None
+
+        return self.msp.add_blockref(name, point, dxfattribs={
+            'xscale': xscale,
+            'yscale': yscale,
+            'rotation': rotation
+        })
+
+    def createPolyline(self, wire):
+        data = getWire(wire.Shape)
+        lwp = self.msp.add_lwpolyline(data)
+        return lwp
+
+
+def getWire(wire, nospline=False, width=.0):
+    """Return a list of DXF ready points and bulges from a wire.
+
+    It builds a list of points from the edges of a `wire`.
+    If the edges are circular arcs, the "bulge" of that edge is calculated,
+    for other cases, the bulge is considered zero.
+
+    Parameters
+    ----------
+    wire : Part::TopoShape ('Wire')
+        A shape representing a wire.
+
+    nospline : bool, optional
+        It defaults to `False`.
+        If it is `True`, the edges of the wire are not considered as
+        being one of `'BSplineCurve'`, `'BezierCurve'`, or `'Ellipse'`,
+        and a simple point is added to the list.
+        Otherwise, `getSplineSegs(edge)` is used to extract
+        the points and add them to the list.
+
+    Returns
+    -------
+    list of tuples
+        It returns a list of tuples ``[(...), (...), ...]``
+        where each tuple indicates a point with additional information
+        besides the coordinates.
+        Two types of tuples may be returned.
+
+    [(float, float, float, None, None, float), ...]
+        When `lw` is `True` (`'lwpolyline'`)
+        the first three values represent the coordinates of the point,
+        the next two are `None`, and the last value is the bulge.
+
+    [((float, float, float), None, [None, None], float), ...]
+        When `lw` is `False` (`'polyline'`)
+        the first element is a tuple of three values that indicate
+        the coordinates of the point, the next element is `None`,
+        the next element is a list of two `None` values,
+        and the last element is the value of the bulge.
+
+    See also
+    --------
+    calcBulge
+    """
+    import Part
+    import DraftGeomUtils
+    import math
+
+    def fmt(vec, b=0.0):
+        return (vec.x * 0.001, vec.y * 0.001, width, width, b)
+
+    points = []
+    edges = Part.__sortEdges__(wire.Edges)
+    for edge in edges:
+        v1 = edge.Vertexes[0].Point
+        if DraftGeomUtils.geomType(edge) == "Circle":
+            # polyline bulge -> negative makes the arc go clockwise
+            angle = edge.LastParameter - edge.FirstParameter
+            bul = math.tan(angle / 4)
+            if edge.Curve.Axis.dot(FreeCAD.Vector(0, 0, 1)) < 0:
+                bul = -bul
+            points.append(fmt(v1, bul))
+        elif (DraftGeomUtils.geomType(edge) in ["BSplineCurve",
+                                                "BezierCurve",
+                                                "Ellipse"]) and (not nospline):
+            spline = getSplineSegs(edge)
+            spline.pop()
+            for p in spline:
+                points.append(fmt(p))
+        else:
+            points.append(fmt(v1))
+
+    v = edges[-1].Vertexes[-1].Point
+    points.append(fmt(v))
+
+    return points
+
+
+def getArcData(edge):
+    """Return center, radius, start, and end angles of a circle-based edge.
+
+    Parameters
+    ----------
+    edge : Part::TopoShape ('Edge')
+        An edge representing a circular arc, either open or closed.
+
+    Returns
+    -------
+    (tuple, float, float, float)
+        It returns a tuple of four values; the first value is a tuple
+        with the coordinates of the center `(x, y, z)`;
+        the other three represent the magnitude of the radius,
+        and the start and end angles in degrees that define the arc.
+
+    (tuple, float, 0, 0)
+        If the number of vertices in the `edge` is only one, only the center
+        point exists, so it's a full circumference; in this case, both
+        angles are zero.
+    """
+    ce = edge.Curve.Center
+    radius = edge.Curve.Radius
+    if len(edge.Vertexes) == 1:
+        # closed circle
+        return DraftVecUtils.tup(ce), radius, 0, 0
+    else:
+        # new method: recalculate ourselves as we cannot trust edge.Curve.Axis
+        # or XAxis
+        p1 = edge.Vertexes[0].Point
+        p2 = edge.Vertexes[-1].Point
+        v1 = p1.sub(ce)
+        v2 = p2.sub(ce)
+        # print(v1.cross(v2))
+        # print(edge.Curve.Axis)
+        # print(p1)
+        # print(p2)
+        # we can use Z check since arcs getting here will ALWAYS be in XY plane
+        # Z can be 0 if the arc is 180 deg
+        # if (v1.cross(v2).z >= 0) or (edge.Curve.Axis.z > 0):
+        # Calculates the angles of the first and last points
+        # in the circular arc, with respect to the global X axis.
+        if edge.Curve.Axis.z > 0:
+            # clockwise
+            ang1 = -DraftVecUtils.angle(v1)
+            ang2 = -DraftVecUtils.angle(v2)
+        else:
+            # counterclockwise
+            ang2 = -DraftVecUtils.angle(v1)
+            ang1 = -DraftVecUtils.angle(v2)
+
+        # obsolete method - fails a lot
+        # if round(edge.Curve.Axis.dot(Vector(0, 0, 1))) == 1:
+        #    ang1, ang2 = edge.ParameterRange
+        # else:
+        #    ang2, ang1 = edge.ParameterRange
+        # if edge.Curve.XAxis != Vector(1, 0, 0):
+        #    ang1 -= DraftVecUtils.angle(edge.Curve.XAxis)
+        #    ang2 -= DraftVecUtils.angle(edge.Curve.XAxis)
+
+        return (DraftVecUtils.tup(ce), radius,
+                math.degrees(ang1), math.degrees(ang2))
+
+
+class _PVPlantExportDXF(QtGui.QWidget):
+    '''The editmode TaskPanel to select what you want to export'''
+
+    def __init__(self):
+        # super(_PVPlantExportDXF, self).__init__()
+        QtGui.QWidget.__init__(self)
+
+        import os
+        # self.form:
+        self.form = FreeCADGui.PySideUic.loadUi(
+            os.path.join(os.path.dirname(os.path.realpath(__file__)), "exportDXF.ui"))
+        # setWindowIcon(QtGui.QIcon(os.path.join(PVPlantResources.DirIcons, "convert.svg")))
+        # self.form.buttonTo.clicked.connect(self.addTo)
+
+        self.layout = QtGui.QHBoxLayout(self)
+        self.layout.setContentsMargins(4, 4, 4, 4)
+        self.layout.addWidget(self.form)
+
+        self.form.buttonAcept.clicked.connect(self.onAceptClick)
+
+        path = os.path.join(os.path.dirname(FreeCAD.ActiveDocument.FileName), "outputs", "autocad")
+        if not os.path.exists(path):
+            os.makedirs(path)
+        self.filename = os.path.join(path, FreeCAD.ActiveDocument.Name) + ".dxf"
+
+    def createLayers(self):
+        ''' '''
+        self.exporter.createLayer("Areas_Boundary", layerColor=(0, 125, 125), layerLineType="FENCELINE1")
+        self.exporter.createLayer("Areas_Exclusion", layerColor=(255, 0, 0))
+        self.exporter.createLayer("Areas_Offsets", layerColor=(128, 128, 255))
+
+        self.exporter.createLayer("Internal_Roads", layerColor=(128, 128, 128))
+        self.exporter.createLayer("Internal_Roads_Axis", layerColor=(255, 255, 255), layerLineType="DASHEDX2")
+
+
+    def writeArea(self):
+        for area in FreeCAD.ActiveDocument.Boundary.Group:
+            pol = self.exporter.createPolyline(area)
+            pol.dxf.layer = "Areas_Boundary"
+
+        for area in FreeCAD.ActiveDocument.Exclusion.Group:
+            pol = self.exporter.createPolyline(area)
+            pol.dxf.layer = "Areas_Exclusion"
+
+        for area in FreeCAD.ActiveDocument.Offsets.Group:
+            self.exporter.createPolyline(area)
+            pol.dxf.layer = "Areas_Offsets"
+
+    def writeFrameSetups(self):
+        import Part
+        # 1. Profiles:
+        profilelist = list()
+        for ts in FreeCAD.ActiveDocument.Site.Frames:
+            for poletype in ts.PoleType:
+                if not (poletype in profilelist):
+                    profilelist.append(poletype)
+                    block = self.exporter.createBlock(poletype.Label)
+                    w = poletype.Base.Shape.Wires[0]
+                    w.Placement.Base = FreeCAD.Vector(w.Placement.Base).sub(w.BoundBox.Center)
+                    block.add_lwpolyline(getWire(w))
+
+                    block.add_circle((0, 0), 0.2, dxfattribs={'color': 2})
+                    p = math.sin(math.radians(45)) * 0.2
+
+                    block.add_line((-p, -p), (p, p), dxfattribs={"layer": "MyLines"})
+                    block.add_line((-p, p), (p, -p), dxfattribs={"layer": "MyLines"})
+
+        # 2. Frames
+        for ts in FreeCAD.ActiveDocument.Site.Frames:
+            w = max(ts.Shape.SubShapes[0].SubShapes[0].SubShapes[0].Faces, key=lambda x: x.Area)
+            pts = [w.BoundBox.getPoint(i) for i in range(4)]
+            pts.append(FreeCAD.Vector(pts[0]))
+            w = Part.makePolygon(pts)
+            w.Placement.Base = w.Placement.Base.sub(w.BoundBox.Center)
+            mblockname = "Trina_TSM-DEG21C-20-6XXWp Vertex"
+            mblock = self.exporter.createBlock(mblockname)
+            mblock.add_lwpolyline(getWire(w))
+
+            rblock = self.exporter.createBlock(ts.Label)
+            w = max(ts.Shape.SubShapes[0].SubShapes[1].SubShapes[0].Faces, key=lambda x: x.Placement.Base.z).Wires[0]
+            w.Placement.Base = w.Placement.Base.sub(w.BoundBox.Center)
+            rblock.add_lwpolyline(getWire(w))
+            for module in ts.Shape.SubShapes[0].SubShapes[0].SubShapes:
+                point = FreeCAD.Vector(module.BoundBox.Center) * 0.001
+                point = point[:2]
+                rblock.add_blockref(mblockname, point, dxfattribs={
+                    'xscale': .0,
+                    'yscale': .0,
+                    'rotation': 0})
+            for ind in range(int(ts.NumberPole.Value)):
+                point = ts.Shape.SubShapes[1].SubShapes[0].SubShapes[ind].Placement.Base * 0.001
+                point = point[:2]
+                name = ts.PoleType[ts.PoleSequence[ind]].Label
+                rblock.add_blockref(name, point, dxfattribs={
+                    'xscale': .0,
+                    'yscale': .0,
+                    'rotation': 0})
+
+    def writeFrames(self):
+        objects = findObjects('Tracker')
+        for frame in objects:
+            if hasattr(frame, "Setup"):
+                point = frame.Placement.Base * 0.001
+                point = point[:2]
+                self.exporter.insertBlock(frame.Setup.Label, point=point, rotation=frame.AngleZ)
+
+    def writeRoads(self):
+        objects = findObjects("Road")
+        #rblock = self.exporter.createBlock("Internal_roads")
+        for road in objects:
+            base = self.exporter.createPolyline(road.Base)
+            base.dxf.const_width = road.Width.Value * 0.001
+            base.dxf.layer = "Internal_Roads"
+
+            axis = self.exporter.createPolyline(road.Base)
+            axis.dxf.const_width = .2
+            axis.dxf.layer = "Internal_Roads_Axis"
+            #my_lines = doc.layers.get('MyLines')
+
+    def writeTrenches(self):
+        objects = findObjects("Trench")
+        # rblock = self.exporter.createBlock("Internal_roads")
+        for obj in objects:
+            base = self.exporter.createPolyline(obj.Base)
+            base.dxf.const_width = obj.Width.Value * 0.001
+            base.dxf.layer = "Trench"
+
+    def setup_layout4(self, doc):
+        layout2 = doc.layouts.new("scale 1-1")
+        # The default paperspace scale is 1:1
+        # 1 mm printed is 1 drawing unit in paperspace
+        # For most use cases this is the preferred scaling and important fact:
+        # the paperspace scaling has no influence on the VIEWPORT scaling - this is
+        # a total different topic, see example "viewports_in_paperspace.py"
+
+        layout2.page_setup(size=(297, 210),
+                           margins=(10, 10, 10, 10),
+                           units="mm",
+                           scale=(1, 1),
+                           #offset=(50, 50),
+                           )
+        layout2.add_viewport(
+            # center of viewport in paperspace units
+            center=(100, 100),
+            # viewport size in paperspace units
+            size=(50, 50),
+            # modelspace point to show in center of viewport in WCS
+            view_center_point=(60, 40),
+            # how much modelspace area to show in viewport in drawing units
+            view_height=20,
+            #status=2,
+        )
+        lower_left, upper_right = layout2.get_paper_limits()
+        x1, y1 = lower_left
+        x2, y2 = upper_right
+        center = lower_left.lerp(upper_right)
+
+        # Add DXF entities to the "Layout1" in paperspace coordinates:
+        layout2.add_line((x1, center.y), (x2, center.y))  # horizontal center line
+        layout2.add_line((center.x, y1), (center.x, y2))  # vertical center line
+        layout2.add_circle((0, 0), radius=5)  # plot origin
+
+    def onAceptClick(self):
+        self.exporter = exportDXF(self.filename)
+        if self.exporter:
+            self.exporter.createFile()
+            self.createLayers()
+            self.writeArea()
+            self.writeFrameSetups()
+            self.writeFrames()
+            self.writeRoads()
+            self.writeTrenches()
+            self.setup_layout4(self.exporter.doc)
+
+        self.exporter.save()
+        print(self.filename)
+
+        self.close()
+
+
+class _CommandExportDXF:
+    def GetResources(self):
+        return {'Pixmap': str(os.path.join(DirIcons, "dxf.svg")),
+                'Accel': "E, A",
+                'MenuText': "Export to DXF",
+                'ToolTip': QT_TRANSLATE_NOOP("Placement", "Export choosed layers to dxf")}
+
+    def Activated(self):
+        taskd = _PVPlantExportDXF()
+        taskd.setParent(FreeCADGui.getMainWindow())
+        taskd.setWindowFlags(QtCore.Qt.Dialog or QtCore.Qt.Dialog)
+        taskd.setWindowModality(QtCore.Qt.WindowModal)
+        taskd.show()
+
+    def IsActive(self):
+        if FreeCAD.ActiveDocument:
+            return True
+        else:
+            return False
+
+
+if FreeCAD.GuiUp:
+    FreeCADGui.addCommand('exportDXF', _CommandExportDXF())

Export/exportDXF.ui

@@ -0,0 +1,77 @@
+<?xml version="1.0" encoding="UTF-8"?>
+<ui version="4.0">
+ <class>formPVSyst</class>
+ <widget class="QDialog" name="formPVSyst">
+  <property name="geometry">
+   <rect>
+    <x>0</x>
+    <y>0</y>
+    <width>715</width>
+    <height>520</height>
+   </rect>
+  </property>
+  <property name="windowTitle">
+   <string>Export to PVSyst</string>
+  </property>
+  <layout class="QVBoxLayout" name="verticalLayout">
+   <property name="leftMargin">
+    <number>5</number>
+   </property>
+   <property name="topMargin">
+    <number>5</number>
+   </property>
+   <property name="rightMargin">
+    <number>5</number>
+   </property>
+   <property name="bottomMargin">
+    <number>5</number>
+   </property>
+   <item>
+    <widget class="QTabWidget" name="tabWidget">
+     <property name="currentIndex">
+      <number>0</number>
+     </property>
+     <widget class="QWidget" name="tab">
+      <attribute name="title">
+       <string>Tab 1</string>
+      </attribute>
+     </widget>
+     <widget class="QWidget" name="tab_2">
+      <attribute name="title">
+       <string>Tab 2</string>
+      </attribute>
+     </widget>
+    </widget>
+   </item>
+   <item>
+    <widget class="QWidget" name="widget" native="true">
+     <layout class="QHBoxLayout" name="horizontalLayout">
+      <item>
+       <widget class="QPushButton" name="buttonAcept">
+        <property name="text">
+         <string>Aceptar</string>
+        </property>
+        <property name="icon">
+         <iconset theme="Accept">
+          <normaloff>../../../../../.designer/backup</normaloff>../../../../../.designer/backup</iconset>
+        </property>
+        <property name="default">
+         <bool>true</bool>
+        </property>
+       </widget>
+      </item>
+      <item>
+       <widget class="QPushButton" name="buttonCancel">
+        <property name="text">
+         <string>Cancelar</string>
+        </property>
+       </widget>
+      </item>
+     </layout>
+    </widget>
+   </item>
+  </layout>
+ </widget>
+ <resources/>
+ <connections/>
+</ui>

Export/exportGeoJson.py

@@ -0,0 +1,15 @@
+import geojson
+from geojson import Point, Feature, FeatureCollection, dump
+
+point = Point((-115.81, 37.24))
+
+features = []
+features.append(Feature(geometry=point, properties={"country": "Spain"}))
+
+# add more features...
+# features.append(...)
+
+feature_collection = FeatureCollection(features)
+
+with open('myfile.geojson', 'w') as f:
+   dump(feature_collection, f)

Export/exportPF.py

@@ -0,0 +1,470 @@
+
+
+import sys
+import os
+
+path_PF = r"C:\Program Files\DIgSILENT\PowerFactory 2021 SP2\Python\3.10"
+os.environ['PATH'] = path_PF + ";" + os.environ['PATH']
+os.add_dll_directory(path_PF)
+sys.path.append(path_PF)
+
+import powerfactory as pf
+
+app = pf.GetApplication()
+
+print(app)
+
+user = app.GetCurrentuser()
+project = app.ActivateProject('Nine-bus System') # Nombre del proyecto
+prj = app.GetActiveProject()
+
+
+
+
+import sys
+import os
+
+path = r'C:\Program Files\DIgSILENT\PowerFactory 2021 SP2\Python\3.10'
+os.environ['PATH'] += (";" + path)
+sys.path.append(path)
+
+import powerfactory as pf
+
+app = pf.GetApplication()
+if app is None:
+    raise Exception('getting Powerfactory application failed')
+
+# app.Show()
+
+user = app.GetCurrentUser()
+projects = user.GetContents('*.IntPrj', 0)
+names = [pro.GetAttribute("loc_name") for pro in projects]
+
+res = app.ActivateProject("ProyectoPrueba")
+if res == 1:  # no existe y hay crearlo
+    proj = app.CreateProject("ProyectoPrueba", "GridNueva")
+else:
+    proj = app.GetActiveProject()
+
+#########
+# MODEL #
+#########
+# Network model
+netmod = app.GetProjectFolder('netmod')
+# Network data
+netdata = app.GetProjectFolder('netdat')
+# Diagrams
+diag_fold = app.GetProjectFolder('dia')
+# Variations
+var_fold = app.GetProjectFolder('scheme')
+
+###########
+# LIBRARY #
+###########
+# Equipment library
+equip = app.GetProjectFolder('equip')
+# lines_fold = equip.GetContents('Lines')[0][0]
+# User defined models
+main_lib = equip.GetParent()
+# udm = main_lib.GetContents('User Defined Models*')[0][0]
+# Script library
+script_lib = app.GetProjectFolder('script')
+# Template library
+templ_lib = app.GetProjectFolder('templ')
+# Operational library
+oplib = app.GetProjectFolder('oplib')
+# Characteristics
+# opchar = oplib.GetContents('Characteristics')[0][0]
+# Thermal ratings
+therm_fold = app.GetProjectFolder('therm')
+# MVAr limit curves
+mvar_fold = app.GetProjectFolder('mvar')
+
+##############
+# STUDY CASE #
+##############
+# Study cases
+op_scen = app.GetProjectFolder('scen')
+# Operational scenarios
+sc_fold = app.GetProjectFolder('study')
+
+# Diagramas:
+schemas = diag_fold.GetContents('*.IntGrfnet', 0)
+sch = None
+for obj in schemas:
+    if obj.loc_name == "miEsquema":
+        sch = obj
+        break
+
+if sch is None:
+    sch = diag_fold.CreateObject("IntGrfnet", "miEsquema")
+
+# redes:
+print(netdata)
+grids = netdata.GetContents('*.ElmNet', 0)
+grid = grids[0]
+ln = grid.GetContents('*.ElmLne', 0)[0]
+print(ln)
+# print(ln.type_id)
+print(f"Terminal 1 de la línea {ln.loc_name}: {ln.bus1}")
+print(f"Terminal 2 de la línea {ln.loc_name}: {ln.bus2}")
+
+
+def createCable(name):
+    ''''''
+    cable = equip.CreateObject("TypCab", name)
+    cable.uline
+    cable.typCon = "cmp"  # Forma (cmp: Macizo, hol: orificio, seg: sermento)
+    cable.diaCon = 5.0  # diámetro externo (double) (mm)
+
+    # Capas condutoras: conductor, funda, blindaje
+    cable.cHasEl = [1, 1, 1]  # Existe
+    cable.materialCond = []  # Material ()
+    cable.crho = []  # Resistividad 20ºC (double) (uOhm*cm)
+    cable.my = []  # Premeabilidad relativa (double)
+    cable.cThEl = []  # Espesor (dobule) (mm)
+    cable.Cf = []  # Factor de Relleno (double) (%)
+    cable.rpha = []  # Resistenca DC 20ºC Ohm/km
+
+    # Capas de aislamiento: Aislamiento, Funda Exterior, Cubierta
+    cable.cHasIns = [0, 0, 0]  # Existe
+    cable.materialIns = []  # Material
+    cable.ctand = []  # Factor de Pérdidas Dieléctricas
+    cable.cepsr = []  # Permeavilidad relativa
+    cable.thlns = []  # Espesor (mm)
+
+    # Capas semicoductoras: Nucleo, Aislamiento
+    cable.cHasSc = []  # Existe
+    cable.thSc = []  # Espesor (mm)
+    cable.cAdvSc = []  # Avanzado
+    cable.rhoSc = []  # Resistividad uOhm*cm
+    cable.mySc = []  # Permeabilidad relativa
+    cable.epsrSC = []  # Premitividad relativa
+
+    cable.manuf = ""  # fabricante
+
+    # 1 Flujo de carga
+    cable.tmax = 90.0  # Máx. temperatura (ºC)
+
+    # 2. Cortocircuito VDE/IEC
+    cable.rtemp = 80.0  # temperatura final máxima (ºC)
+    cable.Ithr = 0.0  # Corriente de corta duración 1s (kA)
+
+    # 3. Análisis de Cables
+    cable.tmax_screen = 70.0  # max. temparatura operación (ºC)
+    cable.eps_emiss = 0.9  # coeficiente de emisión en la superficie
+    cable.iopt_treated = True  # Secado e impregnado
+    cable.tshc = 1.0  # Cálculo de cortocircuito adiabático - Duración de la falla (s)
+
+    return cable
+
+
+def createLine(name):
+    elmlne = p.CreateObject("ElmPvsys", name)
+    elmlne.type_id = ""  # Tipo
+    elmlne.bus1 = ""  # terminal i
+    elmlne.bus2 = ""  # terminal j
+    elmlne.nlnum = 1  # líneas en paralelo
+    elmlne.dline = 0.8  # longitud de la línea (double) (km)
+    elmlne.fline = 1.0  # factor de reduccion (double)
+    elmlne.inAir = 0  # Medio (0: Tierra, 1: Aérea)
+    elmlne.i_dist = 0  # Modelo de la línea (0: Parámetros Concentrados, 1: Parámetros Distribuidos)
+
+    return elmlne
+
+
+def createPVPanel(name):
+    typpvpanel = equip.CreateObject("TypPvPanel", name)
+    typpvpanel.Ppk = 500.0  # Potencia Pico MPP (double) (W)
+    typpvpanel.Umpp = 80.0  # Tensión nominal MPP (double) (V)
+    typpvpanel.Impp = 6.0  # Corriente nominal MPP (double) (A)
+    typpvpanel.Uoc = 90.0  # Tensión de Circuito Abierto (double) (V)
+    typpvpanel.Isc = 7.0  # Corriente de cortocircuito (double) (A)
+    typpvpanel.material = 0  # Material: 0:mono-SI, 1:poli-Si, 2:samor-SI, 3: CIS, 4:CdTe, 5: otro
+    typpvpanel.usetval = 1  # Usar valores típicos
+    typpvpanel.cT = -0.4  # Coeficiente de tenperatura P (double) (%/Cº)
+    typpvpanel.noct = 45.0  # SINTC (double) (Cº)
+
+    typpvpanel.manuf = ""  # Fabricante
+    typpypanel.chr_name = ""  # Nombre característico
+    typpypanel.appr_status = 1  # Estado: 0: No aprobado, 1: aprobado
+
+    return typpvpanel
+
+
+def createPV(name):
+    elmpvsys = grid.CreateObject("ElmPvsys", name)
+    elmpvsys.typ_id = None
+    elmpvsys.bus1 = None  # terminal ()
+    elmpvsys.mode_pgi = 0  # modelo (0:Entrada de potencia Activa, 1: Cálculo solar)
+    elmpvsys.phtech = 0  # tecnología (0: 3F, 1: 3F-T, 2:1F F-T, 3:1F F-N)
+    elmpvsys.ngnum = 1  # Inversores en paralelo (int)
+    elmpvsys.npnum = 1  # Paneles por incersro (int)
+    elmpvsys.sgn = 1.0  # Potencia aparente (double) (kVA)
+    elmpvsys.cosn = 0.8  # Factor de Potencia nominal (double)
+    # elmpvsys.
+    return elmpvsys
+
+
+def createBarra(name, uknom=33.0):
+    typbar = equip.CreateObject("TypBar", name)
+    typbar.uknow = uknom
+
+    # 1. Cortocircuito VDE/IEC
+    typbar.Ithlim = 0  # Corriente Nominal de Corto tiempo (kA)
+    typbar.Tkr = 1  # tiempo Corriente Nominal de Corto tiempo (s)
+    typbar.Iplim = 0  # Corriente Pico de cortocircuito (kA)
+
+    return typbar
+
+
+def createTerminal(name):
+    elmterm = grid.CreateObject("ElmTerm", name)
+    elmterm.systype = 0  # Tipo de sistema (0: AC, 1: DC, 2: AC/BI)
+    elmterm.iUsage = 0  # Uso (0:Busbar, 1:Junction, Node 2: Internal node)
+    elmterm.phtech = "ABC"  # Tecnología de Fases: ABC, ABC-N, BI, BI-N, 2F, 2F-N, 1F, 1F-N, N
+    elmterm.uknom = 33.0  # Tensión Nominal Línea-Línea (double)
+    elmterm.iEarth = False  # Aterrizado (bool)
+    # Load Flow:
+    # 1. Control de tensión:
+    elmterm.vtarget = 1.0  # Tensión destino (double) (p.u.)
+    elmterm.Vtarget = 0.0  # Tensión destino (double) (kV)
+    elmterm.dvmax = 0.0  # Max delta V (double) (%)
+    elmterm.dvmin = 0.0  # Min delta V (double) (%)
+    elmterm.ivpriority = -1  # prioriddad
+    # 2. Límite de tensión del estado estable
+    elmterm.vmax = 1.05  # Límite superior de tensión (p.u.)
+    elmterm.vmin = 0.0  # Límite inferior de tensión (p.u.)
+    # 3. Límites del cambio del paso de tensión
+    elmterm.vstep_change = True  # Límites del cambio del paso de tensión (bool)
+    elmterm.vstep_n1 = 6.0  # n-1 (%)
+    elmterm.vstep_n2 = 12.0  # n-2 (%)
+    elmterm.vstep_bus = 12.0  # falla de barra (%)
+    # Análisis de Arco Eléctrico:
+    elmterm.iAccessLoc = False  # Ubicación Accesible (bool)
+    elmterm.isSoftConstr = False  # Restrinción blanda (bool)
+
+    crearCelda()
+
+    return elmterm
+
+
+def createCubic(parent, name):
+    stacubic = parent.CreateObject("StaCubic", name)
+    stacubic.cterm = parent
+    # stacubic.obj_id =
+    # stacubic.plntObjs =
+    return stacubic
+
+
+def createSwitch(name):
+    staswitch = ""
+
+
+def createTransformer(name):
+
+
+#
+
+def createTransformerType(name):
+    typTr3 = equip.CreateObject("TypTr3", name)
+    typTr3.nt3ph = 3  # Tecnología (2: Monofásico, 3: trifásico)
+
+    # Potencia Nominal:
+    typTr3.strn3_h = 1.0  # Lado AT (double) (MVA)
+    typTr3.strn3_m = 1.0  # Lado MT (double) (MVA)
+    typTr3.strn3_l = 1.0  # Lado BT (double) (MVA)
+
+    # Tensión nominal:
+    typTr3.utrn3_h = 0.0  # Lado AT (double) (kV)
+    typTr3.utrn3_m = 0.0  # Lado MT (double) (kV)
+    typTr3.utrn3_l = 0.0  # Lado BT (double) (kV)
+
+    # Grupo Vectorial:
+    typTr3.tr3cn_h = "YN"  # Lado AT (Y, YN, Z, ZN, D)
+    typTr3.nt3ag_h = 0.0  # Lado AT - Ángulo de desfase (double) (*30deg)
+    typTr3.tr3cn_m = "YN"  # Lado MT (Y, YN, Z, ZN, D)
+    typTr3.nt3ag_m = 0.0  # Lado MT - Ángulo de desfase (double) (*30deg)
+    typTr3.tr3cn_l = "YN"  # Lado BT (Y, YN, Z, ZN, D)
+    typTr3.nt3ag_l = 0.0  # Lado BT - Ángulo de desfase (double) (*30deg)
+
+    # Impedancia de secuencia positiva
+    # Tensión de Cortocircuito uk:
+    typTr3.uktr3_h = 3.0  # AT-MT (double) (%)
+    typTr3.uktr3_m = 3.0  # MT-BT (double) (%)
+    typTr3.uktr3_l = 3.0  # BT-AT (double) (%)
+
+    # Pérdidas en el Cobre
+    typTr3.pcut3_h = 0.0  # AT-MT (double) (kW)
+    typTr3.pcut3_m = 0.0  # MT-BT (double) (kW)
+    typTr3.pcut3_l = 0.0  # BT-AT (double) (kW)
+
+    # Impedancia de secuencia cero
+    # Tensión de Cortocircuito uk0:
+    typTr3.uk0hm = 3.0  # AT-MT (double) (%)
+    typTr3.uk0ml = 3.0  # MT-BT (double) (%)
+    typTr3.uk0hl = 3.0  # BT-AT (double) (%)
+
+    # Pérdidas en el Cobre
+    typTr3.ur0hm = 0.0  # AT-MT (double) (kW)
+    typTr3.ur0ml = 0.0  # MT-BT (double) (kW)
+    typTr3.ur0hl = 0.0  # BT-AT (double) (kW)
+
+
+# print(dir(app))
+# print(dir(app.CreateProject))
+
+
+cable = equip.GetContents('*.TypCab', 0)[0]
+print(dir(cable))
+print(cable.cHasEl)
+print(cable.materialCond)
+print(cable.tab_con)
+
+'''
+Run a load flow
+
+#define project name and study case    
+projName = '_TSI_Nine-bus System'
+study_case = '01_Study_Case.IntCase'
+
+#activate project
+project = app.ActivateProject(projName)
+proj = app.GetActiveProject()
+
+#get the study case folder and activate project
+oFolder_studycase = app.GetProjectFolder('study')
+oCase = oFolder_studycase.GetContents(study_case)[0]
+oCase.Activate()
+
+#get load flow object and execute
+oLoadflow=app.GetFromStudyCase('ComLdf') #get load flow object
+oLoadflow.Execute() #execute load flow
+'''
+
+'''
+Print the results for generators, lines, and buses
+
+
+#get the generators and their active/reactive power and loading
+Generators = app.GetCalcRelevantObjects('*.ElmSym')
+for gen in Generators: #loop through list
+    name = getattr(gen, 'loc_name') # get name of the generator
+    actPower = getattr(gen,'c:p') #get active power
+    reacPower = getattr(gen,'c:q') #get reactive power
+    genloading = getattr(gen,'c:loading') #get loading
+    #print results
+    print('%s: P = %.2f MW, Q = %.2f MVAr, loading = %.0f percent' %(name,actPower,reacPower,genloading))
+
+print('-----------------------------------------')
+
+#get the lines and print their loading
+Lines=app.GetCalcRelevantObjects('*.ElmLne')
+for line in Lines: #loop through list
+    name = getattr(line, 'loc_name') # get name of the line
+    value = getattr(line, 'c:loading') #get value for the loading
+    #print results
+    print('Loading of the line: %s = %.2f percent' %(name,value))
+
+print('-----------------------------------------')
+
+#get the buses and print their voltage
+Buses=app.GetCalcRelevantObjects('*.ElmTerm')
+for bus in Buses: #loop through list
+    name = getattr(bus, 'loc_name') # get name of the bus
+    amp = getattr(bus, 'm:u1') #get voltage magnitude
+    phase = getattr(bus, 'm:phiu') #get voltage angle
+    #print results
+    print('Voltage at %s = %.2f pu %.2f deg' %(name,amp,phase))
+'''
+
+'''
+Run an RMS simulation
+
+#define project name and study case    
+projName = '_TSI_nine_bus_system'
+study_case = '01_Study_Case.IntCase'
+
+#activate project
+project = app.ActivateProject(projName)
+proj = app.GetActiveProject()
+
+#get the study case folder and activate project
+oFolder_studycase = app.GetProjectFolder('study')
+oCase = oFolder_studycase.GetContents(study_case)[0]
+oCase.Activate()
+
+# calculate initial conditions
+oInit = app.GetFromStudyCase('ComInc') #get initial condition calculation object
+oInit.Execute()
+
+#run RMS-simulation
+oRms = app.GetFromStudyCase('ComSim') #get RMS-simulation object
+oRms.Execute()
+'''
+
+'''
+Retrieve RMS results from PowerFactory in Python
+
+import numpy as np
+import pandas as pd
+
+def getResults():    
+    #get result file
+    elmRes = app.GetFromStudyCase('*.ElmRes')    
+    app.ResLoadData(elmRes)
+
+    #Get number of rows and columns
+    NrRow = app.ResGetValueCount(elmRes,0)
+
+    #get objects of interest
+    oSG1 = app.GetCalcRelevantObjects('G1.ElmSym')[0]
+    oBus1 = app.GetCalcRelevantObjects('Bus 1.ElmTerm')[0]
+    oLine4_5 = app.GetCalcRelevantObjects('Line 4-5.ElmLne')[0]
+
+    #Get index of variable of interest
+    ColIndex_time = app.ResGetIndex(elmRes,elmRes,'b:tnow')
+    ColIndex_ut = app.ResGetIndex(elmRes,oSG1,'s:ut')
+    ColIndex_P = app.ResGetIndex(elmRes,oSG1,'s:P1')
+    ColIndex_Q = app.ResGetIndex(elmRes,oSG1,'s:Q1')
+    ColIndex_speed = app.ResGetIndex(elmRes,oSG1,'s:xspeed')
+    ColIndex_u_bus1 = app.ResGetIndex(elmRes,oBus1,'m:u')
+    ColIndex_loading_line_4_5 = app.ResGetIndex(elmRes,oLine4_5,'c:loading')
+
+    #pre-allocate result variables
+    result_time = np.zeros((NrRow,))
+    result_ut = np.zeros((NrRow))
+    result_P = np.zeros((NrRow))
+    result_Q = np.zeros((NrRow))    
+    result_speed = np.zeros((NrRow))    
+    result_u_bus1 = np.zeros((NrRow))    
+    result_loading_line_4_5 = np.zeros((NrRow))    
+
+    #get results for each time step
+    for i in range(NrRow):    
+        result_time[i] = app.ResGetData(elmRes,i,ColIndex_time)[1]
+        result_ut[i] = app.ResGetData(elmRes,i,ColIndex_ut)[1]
+        result_P[i] = app.ResGetData(elmRes,i,ColIndex_P)[1]
+        result_Q[i] = app.ResGetData(elmRes,i,ColIndex_Q)[1]       
+        result_speed[i] = app.ResGetData(elmRes,i,ColIndex_speed)[1]       
+        result_u_bus1[i] = app.ResGetData(elmRes,i,ColIndex_u_bus1)[1]       
+        result_loading_line_4_5[i] = app.ResGetData(elmRes,i,ColIndex_loading_line_4_5)[1]       
+
+    results = pd.DataFrame()
+    results['time'] = result_time
+    results['P'] = result_P
+    results['Q'] = result_Q
+    results['ut'] = result_ut
+    results['speed'] = result_speed
+    results['u_bus1'] = result_u_bus1
+    results['loading_line_4_5'] = result_loading_line_4_5
+    return results
+
+#query results
+RES = getResults()
+'''
+
+## Graphical objects:
+
+
+

Export/exportPVSyst.py

@@ -0,0 +1,864 @@
+# /**********************************************************************
+# *                                                                     *
+# * Copyright (c) 2021 Javier Braña <javier.branagutierrez@gmail.com>  *
+# *                                                                     *
+# * This program is free software; you can redistribute it and/or modify*
+# * it under the terms of the GNU Lesser General Public License (LGPL)  *
+# * as published by the Free Software Foundation; either version 2 of   *
+# * the License, or (at your option) any later version.                 *
+# * for detail see the LICENCE text file.                               *
+# *                                                                     *
+# * This program is distributed in the hope that it will be useful,     *
+# * but WITHOUT ANY WARRANTY; without even the implied warranty of      *
+# * MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE.  See the       *
+# * GNU Library General Public License for more details.                *
+# *                                                                     *
+# * You should have received a copy of the GNU Library General Public   *
+# * License along with this program; if not, write to the Free Software *
+# * Foundation, Inc., 59 Temple Place, Suite 330, Boston, MA  02111-1307*
+# * USA                                                                 *
+# *                                                                     *
+# ***********************************************************************
+
+import Arch
+import Draft
+import FreeCAD
+import Mesh
+import MeshPart
+import Part
+import numpy
+import os
+
+if FreeCAD.GuiUp:
+    import FreeCADGui
+    from PySide import QtCore
+    from PySide.QtCore import QT_TRANSLATE_NOOP
+    from DraftTools import translate
+else:
+    def translate(ctxt, txt):
+        return txt
+
+try:
+    _fromUtf8 = QtCore.QString.fromUtf8
+except AttributeError:
+    def _fromUtf8(s):
+        return s
+
+from PVPlantResources import DirIcons as DirIcons
+
+## @package importDAE
+#  \ingroup ARCH
+#  \brief DAE (Collada) file format importer and exporter
+#
+#  This module provides tools to import and export Collada (.dae) files.
+
+__title__ = "FreeCAD Collada importer"
+__author__ = "Yorik van Havre"
+__url__ = "http://www.freecadweb.org"
+
+try:
+    # Python 2 forward compatibility
+    range = xrange
+except NameError:
+    pass
+
+
+def checkCollada():
+    "checks if collada if available"
+
+    global collada
+    COLLADA = None
+    try:
+        import collada
+    except ImportError:
+        FreeCAD.Console.PrintError(translate("Arch", "pycollada not found, collada support is disabled.") + "\n")
+        return False
+    else:
+        return True
+
+
+# from ARCH:
+def triangulate(shape):
+    "triangulates the given face"
+
+    p = FreeCAD.ParamGet("User parameter:BaseApp/Preferences/Mod/Arch")
+    mesher = p.GetInt("ColladaMesher", 0)
+    tessellation = p.GetFloat("ColladaTessellation", 1.0)
+    grading = p.GetFloat("ColladaGrading", 0.3)
+    segsperedge = p.GetInt("ColladaSegsPerEdge", 1)
+    segsperradius = p.GetInt("ColladaSegsPerRadius", 2)
+    secondorder = p.GetBool("ColladaSecondOrder", False)
+    optimize = p.GetBool("ColladaOptimize", True)
+    allowquads = p.GetBool("ColladaAllowQuads", False)
+
+    if mesher == 0:
+        return shape.tessellate(tessellation)
+    elif mesher == 1:
+        return MeshPart.meshFromShape(Shape=shape, MaxLength=tessellation).Topology
+    else:
+        return MeshPart.meshFromShape(Shape=shape, GrowthRate=grading, SegPerEdge=segsperedge,
+                                      SegPerRadius=segsperradius, SecondOrder=secondorder, Optimize=optimize,
+                                      AllowQuad=allowquads).Topology
+
+def export(exportList, filename, tessellation=1, colors=None):
+    """export(exportList,filename,tessellation=1,colors=None) -- exports FreeCAD contents to a DAE file.
+    colors is an optional dictionary of objName:shapeColorTuple or objName:diffuseColorList elements
+    to be used in non-GUI mode if you want to be able to export colors. Tessellation is used when breaking
+    curved surfaces into triangles."""
+
+    if not checkCollada(): return
+
+    p = FreeCAD.ParamGet("User parameter:BaseApp/Preferences/Mod/Arch")
+    scale = p.GetFloat("ColladaScalingFactor", 1.0)
+    scale = scale * 0.001  # from millimeters (FreeCAD) to meters (Collada)
+    p = FreeCAD.ParamGet("User parameter:BaseApp/Preferences/View")
+    c = p.GetUnsigned("DefaultShapeColor", 4294967295)
+    defaultcolor = (float((c >> 24) & 0xFF) / 255.0, float((c >> 16) & 0xFF) / 255.0, float((c >> 8) & 0xFF) / 255.0)
+    colmesh = collada.Collada()
+    colmesh.assetInfo.upaxis = collada.asset.UP_AXIS.Z_UP
+
+    # authoring info
+    cont = collada.asset.Contributor()
+    try:
+        author = FreeCAD.ActiveDocument.CreatedBy
+    except UnicodeEncodeError:
+        author = FreeCAD.ActiveDocument.CreatedBy.encode("utf8")
+    author = author.replace("<", "")
+    author = author.replace(">", "")
+    cont.author = author
+    ver = FreeCAD.Version()
+    appli = "PVPlant for FreeCAD" + ver[0] + "." + ver[1] + " build" + ver[2] + "\n"
+    cont.authoring_tool = appli
+
+    colmesh.assetInfo.contributors.append(cont)
+    colmesh.assetInfo.unitname = "meter"
+    colmesh.assetInfo.unitmeter = 1.0
+
+    defaultmat = None
+    objind = 0
+    scenenodes = []
+
+    # TODO: cambiar lo de objeclist. Buscar los elementos que se necesitan exportar
+    objectlist = Draft.get_group_contents(exportList, walls=True, addgroups=True)
+    objectlist = Arch.pruneIncluded(objectlist)
+    for obj in objectlist:
+        findex = numpy.array([])
+        m = None
+        if obj.isDerivedFrom("Part::Feature"):
+            print("exporting object ", obj.Name, obj.Shape)
+            new_shape = obj.Shape.copy()
+            new_shape.Placement = obj.getGlobalPlacement()
+            m = Mesh.Mesh(triangulate(new_shape))
+        elif obj.isDerivedFrom("Mesh::Feature"):
+            print("exporting object ", obj.Name, obj.Mesh)
+            m = obj.Mesh
+        elif obj.isDerivedFrom("App::Part"):
+            for child in obj.OutList:
+                objectlist.append(child)
+            continue
+        else:
+            continue
+
+        if m:
+            Topology = m.Topology
+            Facets = m.Facets
+
+            # vertex indices
+            vindex = numpy.empty(len(Topology[0]) * 3)
+            for i in range(len(Topology[0])):
+                v = Topology[0][i]
+                vindex[list(range(i * 3, i * 3 + 3))] = (v.x * scale, v.y * scale, v.z * scale)
+
+            # normals
+            nindex = numpy.empty(len(Facets) * 3)
+            for i in range(len(Facets)):
+                n = Facets[i].Normal
+                nindex[list(range(i * 3, i * 3 + 3))] = (n.x, n.y, n.z)
+
+            # face indices
+            findex = numpy.empty(len(Topology[1]) * 6, numpy.int64)
+            for i in range(len(Topology[1])):
+                f = Topology[1][i]
+                findex[list(range(i * 6, i * 6 + 6))] = (f[0], i, f[1], i, f[2], i)
+
+        print(len(vindex), " vert indices, ", len(nindex), " norm indices, ", len(findex), " face indices.")
+        vert_src = collada.source.FloatSource("cubeverts-array" + str(objind), vindex, ('X', 'Y', 'Z'))
+        normal_src = collada.source.FloatSource("cubenormals-array" + str(objind), nindex, ('X', 'Y', 'Z'))
+        geom = collada.geometry.Geometry(colmesh, "geometry" + str(objind), obj.Name, [vert_src, normal_src])
+        input_list = collada.source.InputList()
+        input_list.addInput(0, 'VERTEX', "#cubeverts-array" + str(objind))
+        input_list.addInput(1, 'NORMAL', "#cubenormals-array" + str(objind))
+        matnode = None
+        matref = "materialref"
+        if hasattr(obj, "Material"):
+            if obj.Material:
+                if hasattr(obj.Material, "Material"):
+                    if "DiffuseColor" in obj.Material.Material:
+                        kd = tuple([float(k) for k in obj.Material.Material["DiffuseColor"].strip("()").split(",")])
+                        effect = collada.material.Effect("effect_" + obj.Material.Name, [], "phong", diffuse=kd,
+                                                         specular=(1, 1, 1))
+                        mat = collada.material.Material("mat_" + obj.Material.Name, obj.Material.Name, effect)
+                        colmesh.effects.append(effect)
+                        colmesh.materials.append(mat)
+                        matref = "ref_" + obj.Material.Name
+                        matnode = collada.scene.MaterialNode(matref, mat, inputs=[])
+
+        if not matnode:
+            if colors:
+                if obj.Name in colors:
+                    color = colors[obj.Name]
+                    if color:
+                        if isinstance(color[0], tuple):
+                            # this is a diffusecolor. For now, use the first color - #TODO: Support per-face colors
+                            color = color[0]
+                        # print("found color for obj",obj.Name,":",color)
+                        kd = color[:3]
+                        effect = collada.material.Effect("effect_" + obj.Name, [], "phong", diffuse=kd,
+                                                         specular=(1, 1, 1))
+                        mat = collada.material.Material("mat_" + obj.Name, obj.Name, effect)
+                        colmesh.effects.append(effect)
+                        colmesh.materials.append(mat)
+                        matref = "ref_" + obj.Name
+                        matnode = collada.scene.MaterialNode(matref, mat, inputs=[])
+            elif FreeCAD.GuiUp:
+                if hasattr(obj.ViewObject, "ShapeColor"):
+                    kd = obj.ViewObject.ShapeColor[:3]
+                    effect = collada.material.Effect("effect_" + obj.Name, [], "phong", diffuse=kd, specular=(1, 1, 1))
+                    mat = collada.material.Material("mat_" + obj.Name, obj.Name, effect)
+                    colmesh.effects.append(effect)
+                    colmesh.materials.append(mat)
+                    matref = "ref_" + obj.Name
+                    matnode = collada.scene.MaterialNode(matref, mat, inputs=[])
+
+        if not matnode:
+            if not defaultmat:
+                effect = collada.material.Effect("effect_default", [], "phong", diffuse=defaultcolor,
+                                                 specular=(1, 1, 1))
+                defaultmat = collada.material.Material("mat_default", "default_material", effect)
+                colmesh.effects.append(effect)
+                colmesh.materials.append(defaultmat)
+            matnode = collada.scene.MaterialNode(matref, defaultmat, inputs=[])
+
+        triset = geom.createTriangleSet(findex, input_list, matref)
+        geom.primitives.append(triset)
+        colmesh.geometries.append(geom)
+        geomnode = collada.scene.GeometryNode(geom, [matnode])
+        node = collada.scene.Node("node" + str(objind), children=[geomnode])
+        scenenodes.append(node)
+        objind += 1
+
+    myscene = collada.scene.Scene("PVScene", scenenodes)
+    colmesh.scenes.append(myscene)
+    colmesh.scene = myscene
+    colmesh.write(filename)
+
+    FreeCAD.Console.PrintMessage(translate("Arch", "file %s successfully created.") % filename)
+
+def exportToDAE(path):
+    filename = path + ".dae"
+
+def exportToPVC(path, exportTerrain = False):
+    filename = path + ".pvc"
+    scale = 0.001  # from millimeters (FreeCAD) to meters (Collada)
+
+    from xml.etree.ElementTree import Element, SubElement
+    import datetime
+
+    generated_on = str(datetime.datetime.now())
+
+    site = None
+    tmp = FreeCAD.ActiveDocument.getObjectsByLabel('Site')
+    for obj in tmp:
+        if obj.Name.startswith("Site"):
+            site = obj
+            break
+    terrain = None
+    center = None
+    if not(site.Terrain is None):
+        terrain = site.Terrain.Mesh
+        center = terrain.BoundBox.Center
+    else:
+        center = FreeCAD.Vector()
+
+    try:
+        author = FreeCAD.ActiveDocument.CreatedBy
+    except UnicodeEncodeError:
+        author = FreeCAD.ActiveDocument.CreatedBy.encode("utf8")
+
+    author = author.replace("<", "")
+    author = author.replace(">", "")
+    ver = FreeCAD.Version()
+    appli = "PVPlant for FreeCAD" + ver[0] + "." + ver[1] + " build" + ver[2] + "\n"
+
+    # xml: Configure one attribute with set()
+    root = Element('COLLADA')
+    root.set('xmlns:xsd', 'http://www.w3.org/2001/XMLSchema')
+    root.set('xmlns:xsi', 'http://www.w3.org/2001/XMLSchema-instance')
+    root.set('version', '1.4.1')
+    root.set('xmlns', 'http://www.collada.org/2005/11/COLLADASchema')
+    #root.append(Comment('Generated by ElementTree_csv_to_xml.py for PyMOTW'))
+
+    # xml: 1. Asset:
+    asset = SubElement(root, 'asset')
+    asset_contributor = SubElement(asset, 'contributor')
+    asset_contributor_autor = SubElement(asset_contributor, 'autor')
+    #asset_contributor_autor.text = author
+    asset_contributor_authoring_tool = SubElement(asset_contributor, 'authoring_tool')
+    #asset_contributor_authoring_tool.text = appli
+    asset_contributor_comments = SubElement(asset_contributor, 'comments')
+    asset_keywords = SubElement(asset, 'keywords')
+    asset_revision = SubElement(asset, 'revision')
+    asset_subject = SubElement(asset, 'subject')
+    asset_tittle = SubElement(asset, 'title')
+    #asset_tittle.text = FreeCAD.ActiveDocument.Name
+    asset_unit = SubElement(asset, 'unit')
+    asset_unit.set('meter', '0.001')
+    asset_unit.set('name', 'millimeter')
+
+    # xml: 2. library_materials:
+    library_materials = SubElement(root, 'library_materials')
+    buf = ['Frames', 'Tree_trunk', 'Tree_crown', 'Topography_mesh']
+
+    for i in range(0, len(buf)):
+        material = SubElement(library_materials, 'material')
+        material.set('id', 'Material{0}'.format(i))
+        material.set('name', buf[i])
+        material_effect = SubElement(material, 'instance_effect')
+        material_effect.set('url', '#Material{0}-fx'.format(i))
+
+    # xml: 3. library_effects:
+    library_effects = SubElement(root, 'library_effects')
+    buf = ['0.250000 0.500000 0.000000 1.000000',
+           '0.500000 0.375000 0.250000 1.000000',
+           '0.250000 1.000000 0.000000 1.000000',
+           '0.250000 1.000000 0.000000 1.000000']
+
+    for i in range(0, len(buf)):
+        effect = SubElement(library_effects, 'effect')
+        effect.set('id', 'Material{0}-fx'.format(i))
+        effect.set('name', 'Material{0}'.format(i))
+        profile_COMMON = SubElement(effect, 'profile_COMMON')
+        library_effects_effect_technique = SubElement(profile_COMMON, 'technique')
+        library_effects_effect_technique.set('sid', 'standard')
+        library_effects_effect_technique_lambert = SubElement(library_effects_effect_technique, 'lambert')
+        library_effects_effect_technique_lambert_emission = SubElement(library_effects_effect_technique_lambert,
+                                                                       'emission')
+        library_effects_effect_technique_lambert_emission_color = SubElement(
+            library_effects_effect_technique_lambert_emission, 'color')
+        library_effects_effect_technique_lambert_emission_color.set('sid', 'emission')
+        library_effects_effect_technique_lambert_emission_color.text = '0.000000 0.000000 0.000000 1.000000'
+        ambient = SubElement(library_effects_effect_technique_lambert, 'ambient')
+        ambient_color = SubElement(ambient, 'color')
+        ambient_color.set('sid', 'ambient')
+        ambient_color.text = '0.200000 0.200000 0.200000 1.000000'
+        diffuse = SubElement(library_effects_effect_technique_lambert, 'diffuse')
+        diffuse_color = SubElement(diffuse, 'color')
+        diffuse_color.set('sid', 'diffuse')
+        diffuse_color.text = buf[i]
+        transparent = SubElement(library_effects_effect_technique_lambert, 'transparent')
+        transparent.set('opaque', 'RGB_ZERO')
+        transparent_color = SubElement(transparent, 'color')
+        transparent_color.set('sid', 'transparent')
+        transparent_color.text = '0.000000 0.000000 0.000000 1.000000'
+        transparency = SubElement(library_effects_effect_technique_lambert, 'transparency')
+        transparency_value = SubElement(transparency, 'float')
+        transparency_value.set('sid', 'transparency')
+        transparency_value.text = '0'
+
+    # xml: 4. library_geometries:
+    library_geometries = SubElement(root, 'library_geometries')
+    def add_geometry(objtype, vindex, findex, objind = 0, centers = None):
+
+        isFrame = False
+        if objtype == 0:
+            geometryName = 'Frame'
+            referenceSTR = 'frame'
+            isFrame = True
+        elif objtype == 1:
+            geometryName = 'ShadowMesh'  ## --> ???
+            referenceSTR = 'ShadowMesh'  ## --> ???
+        elif objtype == 2:
+            geometryName = 'TerrainMesh'
+            referenceSTR = 'TerrainMesh'
+
+        geometry = SubElement(library_geometries, 'geometry')
+        geometry.set('id', geometryName + '{0}'.format(objind))
+        mesh = SubElement(geometry, 'mesh')
+
+        source = SubElement(mesh, 'source')
+        source.set('id', referenceSTR + '{0}MeshSource'.format(objind))
+        float_array = SubElement(source, 'float_array')
+        float_array.set('id', referenceSTR + '{0}FloatArray'.format(objind))
+        float_array.set('count', '{0}'.format(len(vindex)))
+        float_array.text = ""  # vindex
+        for ver in vindex:
+            if len(float_array.text) > 0:
+                float_array.text += ' '
+            float_array.text += '{0:.6f}'.format(ver)
+
+        technique_common = SubElement(source, 'technique_common')
+        accessor = SubElement(technique_common, 'accessor')
+        accessor.set('count', '{0}'.format(len(vindex)))
+        accessor.set('source', '#' + referenceSTR + '{0}FloatArray'.format(objind))
+        accessor.set('stride', '3')
+        param = SubElement(accessor, 'param')
+        param.set('name', 'X')
+        param.set('type', 'float')
+        param = SubElement(accessor, 'param')
+        param.set('name', 'Y')
+        param.set('type', 'float')
+        param = SubElement(accessor, 'param')
+        param.set('name', 'Z')
+        param.set('type', 'float')
+
+        vertices = SubElement(mesh, 'vertices')
+        vertices.set('id', referenceSTR + '{0}VerticesSource'.format(objind))
+        input = SubElement(vertices, "input")
+        input.set('semantic', 'POSITION')
+        input.set('source', '#' + referenceSTR + '{0}MeshSource'.format(objind))
+
+        triangles = SubElement(mesh, 'triangles')
+        triangles.set('count', '0')
+        triangles.set('material', 'Material0')
+        input = SubElement(triangles, "input")
+        input.set('offset', '0')
+        input.set('semantic', 'VERTEX')
+        input.set('source', '#' + referenceSTR + '{0}VerticesSource'.format(objind))
+        p = SubElement(triangles, "p")
+        p.text = ''
+        for f in findex:
+            if len(p.text) > 0:
+                p.text += ' '
+            p.text += '{0}'.format(f)
+
+        if isFrame:
+            frame = SubElement(mesh, 'tracker_parameters' if isTracker else 'frame_parameters')
+            module_width = SubElement(frame, "module_width")
+            module_width.text = '{0}'.format(int(obj.Setup.ModuleWidth.Value))
+            module_height = SubElement(frame, "module_height")
+            module_height.text = '{0}'.format(int(obj.Setup.ModuleHeight.Value))
+            module_x_spacing = SubElement(frame, "module_x_spacing")
+            module_x_spacing.text = '{0}'.format(int(obj.Setup.ModuleColGap.Value))
+            module_y_spacing = SubElement(frame, "module_y_spacing")
+            module_y_spacing.text = '{0}'.format(int(obj.Setup.ModuleRowGap.Value))
+            module_manufacturer = SubElement(frame, "module_manufacturer")
+            module_manufacturer.text = 'generic'
+            module_name = SubElement(frame, "module_name")
+            module_name.text = 'generic'
+            if isTracker:
+                tracker_type = SubElement(frame, 'tracker_type')
+                tracker_type.text = 'single_axis_trackers'
+                axis = SubElement(frame, 'axis_vertices')
+                for ind in range(0, len(centers)):
+                    array = SubElement(axis, 'float_array')
+                    array.set('id', 'tracker{0}AxisFloatArray1'.format(ind))
+                    array.set('count', '3')
+                    array.text = '{0:.6f} {1:.6f} {2:.6f}'.format(centers[i].x, centers[i].y, centers[i].z)
+
+                min_phi = SubElement(frame, 'min_phi')
+                min_phi.text = '{0}'.format(int(obj.Setup.MinPhi.Value))
+                max_phi = SubElement(frame, 'max_phi')
+                max_phi.text = '{0}'.format(int(obj.Setup.MaxPhi.Value))
+                min_theta = SubElement(frame, 'min_theta')
+                min_theta.text = '{0}'.format(0)
+                max_theta = SubElement(frame, 'max_theta')
+                max_theta.text = '{0}'.format(0)
+
+        # xml: 5. library_visual_scenes:
+        instance_geometry = SubElement(node, 'instance_geometry')
+        instance_geometry.set('url', geometryName + '{0}'.format(objind))
+
+        bind_material = SubElement(instance_geometry, 'bind_material')
+        technique_common = SubElement(bind_material, 'technique_common')
+        instance_material = SubElement(technique_common, 'instance_material')
+        instance_material.set('symbol', 'Material0')
+        instance_material.set('target', '#Material0')
+        instance_material = SubElement(technique_common, 'instance_material')
+        instance_material.set('symbol', 'Material1')
+        instance_material.set('target', '#Material1')
+        instance_material = SubElement(technique_common, 'instance_material')
+        instance_material.set('symbol', 'Material2')
+        instance_material.set('target', '#Material2')
+
+    # xml: 5. library_visual_scenes:
+    library_visual_scenes = SubElement(root, 'library_visual_scenes')
+    visual_scene = SubElement(library_visual_scenes, 'visual_scene')
+    visual_scene.set('id', '')
+    visual_scene.set('name', '')
+
+    node = SubElement(visual_scene, 'node')
+    node.set('id', 'Fbx_Root')
+    node.set('name', 'Fbx_Root')
+    node.set('sid', 'Fbx_Root')
+    matrix = SubElement(node, 'matrix')
+    matrix.set('sid', 'matrix')
+    matrix.text = '1.000000 0.000000 0.000000 0.000000 0.000000 0.000000 -1.000000 0.000000 0.000000 1.000000 0.000000 0.000000 0.000000 0.000000 0.000000 1.000000'
+    node = SubElement(node, 'node')
+    node.set('id', 'PVcase52')
+    node.set('name', 'PVcase52')
+    node.set('sid', 'PVcase52')
+    matrix = SubElement(node, 'matrix')
+    matrix.set('sid', 'matrix')
+    matrix.text = '1.000000 0.000000 0.000000 0.000000 0.000000 1.000000 0.000000 0.000000 0.000000 0.000000 1.000000 0.000000 0.000000 0.000000 0.000000 1.000000'
+
+    extra = SubElement(visual_scene, 'extra')
+    technique = SubElement(extra, 'technique')
+    technique.set('profile', 'MAX3D')
+    frame_rate = SubElement(technique, 'frame_rate')
+    frame_rate.text = '30.000000'
+    technique = SubElement(extra, 'technique')
+    technique.set('profile', 'FCOLLADA')
+    start_time = SubElement(technique, 'start_time')
+    start_time.text = '0.000000'
+    end_time = SubElement(technique, 'end_time')
+    end_time.text = '1.000000'
+
+    # xml: 6. scene:
+    scene = SubElement(root, 'scene')
+    instance = SubElement(scene, 'instance_visual_scene')
+    instance.set('url', '#')
+
+    full_list_of_objects = FreeCAD.ActiveDocument.Objects
+
+    # CASO 1 - FRAMES:
+    frameType = site.Frames
+    frame_setup = {"type": [],
+                   "footprint": []}
+    for obj in frameType:
+        frame_setup["type"] = obj
+        frame_setup["footprint"] = ""
+
+    objind = 0
+    # TODO: revisar
+    for type in frameType:
+        isTracker = "tracker" in type.Proxy.Type.lower()
+        #TODO: Sólo para los proyectos de NAcho. Borrar
+        isTracker = False
+
+        objectlist = FreeCAD.ActiveDocument.findObjects(Name="Tracker")
+        tmp = []
+        for obj in objectlist:
+            if obj.Name.startswith("TrackerSetup"):
+                continue
+            else:
+                tmp.append(obj)
+        objectlist = tmp.copy()
+
+        for obj in objectlist:
+            if obj.Setup == type:
+                findex = numpy.array([])
+
+                modules = obj.Setup.Shape.SubShapes[0].SubShapes[0]
+                pts = []
+                for i in range(4):
+                    pts.append(modules.BoundBox.getPoint(i))
+
+                # temp -----
+                if obj.Tilt.Value != 0:
+                    zz = int(pts[0].z) - (obj.Setup.MainBeamHeight.Value / 2 + obj.Setup.BeamHeight.Value)
+                    for p in pts:
+                        p.z -= zz
+                    new_shape = Part.Face(Part.makePolygon(pts))
+                    new_shape.Placement.Rotation.setEulerAngles("XYZ", obj.Tilt.Value, 0, 0)
+                    pts = []
+                    for ver in new_shape.Vertexes:
+                        p = ver.Point
+                        p.z += zz
+                        pts.append(p)
+                # end temp -----
+
+                new_shape = Part.Face(Part.makePolygon(pts))
+                new_shape.Placement = obj.Placement.copy()
+                m = Mesh.Mesh(triangulate(new_shape))
+                centers = []
+
+                if isTracker:
+                    minLengths = []
+                    for ed in new_shape.Edges:
+                        minLengths.append(ed.Length)
+                    minLength = min(minLengths)
+                    for ed in new_shape.Edges:
+                        if ed.Length == minLength:
+                            centers.append(ed.CenterOfMass)
+                if m:
+                    Topology = m.Topology
+
+                    # 1. vertex indices
+                    vindex = numpy.empty(len(Topology[0]) * 3)
+                    for i in range(len(Topology[0])):
+                        v = Topology[0][i]
+                        vindex[list(range(i * 3, i * 3 + 3))] = (-(v.x - center.x) * scale, (v.z - center.z) * scale,
+                                                                 (v.y - center.y) * scale)
+
+                    # 2. face indices
+                    findex = numpy.empty(len(Topology[1]) * 3, numpy.int64)
+                    for i in range(len(Topology[1])):
+                        f = Topology[1][i]
+                        findex[list(range(i * 3, i * 3 + 3))] = (f[0], f[1], f[2])
+
+                    add_geometry(0, vindex, findex, objind, centers if isTracker else None)
+                    objind += 1
+
+    # CASE 2: Shadow objects
+    #objectlist = FreeCAD.ActiveDocument.findObjects(Label = "Tree")  # TODO: Cambiar label por name
+    objectlist=[]
+    for obj in FreeCAD.ActiveDocument.Objects:
+        if obj.Name.startswith("Tracker"):
+            continue
+        else:
+            objectlist.append(obj)
+    objind = 0
+
+    for obj in objectlist:
+        findex = numpy.array([])
+        m = None
+        if obj.isDerivedFrom("Part::Feature"):
+            new_shape = obj.Shape.copy()
+            new_shape.Placement = obj.getGlobalPlacement()
+            m = Mesh.Mesh(triangulate(new_shape))
+        elif obj.isDerivedFrom("Mesh::Feature"):
+            m = obj.Mesh
+        elif obj.isDerivedFrom("App::Part"):
+            for child in obj.OutList:
+                objectlist.append(child)
+            continue
+        else:
+            continue
+
+        if m:
+            Topology = m.Topology
+            # vertex indices
+            vindex = numpy.empty(len(Topology[0]) * 3)
+            for i in range(len(Topology[0])):
+                v = Topology[0][i]
+                vindex[list(range(i * 3, i * 3 + 3))] = (-(v.x - center.x) * scale, (v.z - center.z) * scale,
+                                                         (v.y - center.y) * scale)
+
+            # face indices
+            findex = numpy.empty(len(Topology[1]) * 3, numpy.int64)
+            for i in range(len(Topology[1])):
+                f = Topology[1][i]
+                findex[list(range(i * 3, i * 3 + 3))] = (f[0], f[1], f[2])
+
+            add_geometry(1, vindex, findex, objind)
+            objind += 1
+
+
+    # CASE 3: Terrain
+    # TODO: ver si se puede partir en varias mesh para que trabaje más rápido
+    if exportTerrain:
+        m = terrain
+        if m:
+            Topology = m.Topology
+            # Facets = m.Facets
+
+            # vertex indices
+            vindex = numpy.empty(len(Topology[0]) * 3)
+            for i in range(len(Topology[0])):
+                v = Topology[0][i]
+                vindex[list(range(i * 3, i * 3 + 3))] = (-v.x * scale, v.z * scale, v.y * scale)
+
+            # face indices
+            findex = numpy.empty(len(Topology[1]) * 3, numpy.int64)
+            for i in range(len(Topology[1])):
+                f = Topology[1][i]
+                findex[list(range(i * 3, i * 3 + 3))] = (f[0], f[1], f[2])
+
+            add_geometry(2, vindex, findex)
+
+        # xml: 5. library_visual_scenes: ¿¿¿¿¿???????
+        '''
+        instance_geometry = SubElement(node, 'instance_geometry')
+        instance_geometry.set('url', 'TerrainMesh{0}'.format(0))
+
+        bind_material = SubElement(instance_geometry, 'bind_material')
+        technique_common = SubElement(bind_material, 'technique_common')
+        instance_material = SubElement(technique_common, 'instance_material')
+        instance_material.set('symbol', 'Material0')
+        instance_material.set('target', '#Material0')
+        instance_material = SubElement(technique_common, 'instance_material')
+        instance_material.set('symbol', 'Material1')
+        instance_material.set('target', '#Material1')
+        instance_material = SubElement(technique_common, 'instance_material')
+        instance_material.set('symbol', 'Material2')
+        instance_material.set('target', '#Material2')
+        '''
+
+    extra = SubElement(node, 'extra')
+    technique = SubElement(extra, 'technique')
+    technique.set('profile', 'FCOLLADA')
+    visibility = SubElement(technique, 'visibility')
+    visibility.text = '1.000000'
+
+
+    # save the file:
+    st = prettify(root)
+    #print(st)
+    f = open(filename, "w")
+    f.write(st)
+    f.close()
+    FreeCAD.Console.PrintMessage("Se ha generado correctamente el archivo PVC: ", filename)
+    return True
+
+def prettify(elem):
+    """ Return a pretty-printed XML string for the Element. """
+
+    from xml.etree import ElementTree
+    from xml.dom import minidom
+
+    rough_string = ElementTree.tostring(elem, 'utf-8')
+    reparsed = minidom.parseString(rough_string)
+    return reparsed.toprettyxml(indent="  ")
+
+def exportToH2P(path):  # sólo válido para mesas
+    filename = path + ".h2p"
+    f2 = '{:.2f}'
+    f3 = '{:.3f}'
+
+    st = 'START\n'
+    # TODO: hacer un bucle para cada tipo-tamaño de estructura.
+    #       posible solucción: un primer bucle para identificar los tipos-tamaños de estructura
+    #FreeCAD.ActiveDocument.findObjects
+    #FreeCAD.ActiveDocument.Objects
+
+    objects = FreeCAD.ActiveDocument.findObjects(Name="Tracker")
+    grouptype = []
+    #for obj in objects:
+    grouptype.append(objects[0])
+
+    for type in grouptype:
+        st += 'TABLE\n' \
+              '10\n'
+        st += f3.format(type.Width.Value) + ',' + f3.format(type.Length.Value) + ','  + \
+              f3.format(0)  + ',' + f3.format(0)  + ',' + f3.format(0)  + ',' + f3.format(0) + "\n"
+              #'#{ f3 %pvsyst.ilb.to_mm },#{f3 %pvsyst.irb.to_mm},#{f3 %pvsyst.itb.to_mm},' \
+              #'#{f3 %pvsyst.ibb.to_mm}\n'
+        st += '20\n'
+        st += str(int(type.ModulesCols.Value)) + ',' + str(int(type.ModulesRows.Value)) + ',' + \
+              str(type.ModuleColGap.Value) + ',' + str(type.ModuleRowGap.Value) + ',' + '30\n'
+        st += '30\n'
+        st += '1,' + f3.format(type.ModuleWidth.Value) + ',' + f3.format(type.ModuleHeight.Value) + ',' + \
+              f3.format(type.ModuleThick.Value) + ',' + f2.format(450) + '\n' #f2.format(type.ModulePower.Value) + '\n'
+
+        # cornerdown = find_component_sizes(group.cdef)[1]
+        # pvorigin = Geom::Point3d.new(cornerdown.x, cornerdown.y, 0)
+        # group.instances.each{ | ins | str += pvsyst_insert(ins, pvorigin)}
+
+        for obj in objects:
+            if obj.CloneOf == type:
+                st += H2PInsert(obj)
+
+    ## TODO: Bucle para buscar objetos que den sombra y el terreno. Todos llaman a H2PMesh
+    mesh = FreeCAD.ActiveDocument.getObjectsByLabel('Surface')[0].Mesh
+    st += H2PMesh(mesh, False)
+    st += "END\n"
+
+    # save the file:
+    f = open(filename, "w")
+    f.write(st)
+    f.close()
+    FreeCAD.Console.PrintMessage("Se ha generado el archivo PVC: ", filename)
+    return True
+
+def H2PInsert(obj):
+    f3 = '{:.3f}'
+    f2 = '{:.2f}'
+    scale = 0.001  ## ver como se puede hacer para que sea general. Pasar de mm a m
+
+    st = 'INSERT\n' \
+         '10\n'
+    st += f3.format(obj.Placement.Base.x * scale) + ',' + f3.format(obj.Placement.Base.y * scale) + ',' + \
+          f3.format((obj.Placement.Base.z + obj.PoleLength.Value - obj.RammingDeep.Value + 1000) * scale) + '\n'
+    st += '50\n'
+    st += f2.format(-obj.Placement.Rotation.toEuler()[0]) + '\n'
+    st += '55\n'
+    st += f2.format(obj.Placement.Rotation.toEuler()[1]) + '\n'
+    st += '56\n'
+    st += f2.format(obj.Placement.Rotation.toEuler()[2]) + '\n'
+
+    return st
+
+def H2PMesh(mesh, type):
+    scale = 0.001  ## ver como se puede hacer para que sea general. Pasar de mm a m
+
+    f3 = '{:.3f}'
+    st = ''
+    if type:
+        st = 'ShadowObject\nFence\n'
+    else:
+        st = 'DGM\n'
+
+    for face in mesh.Facets:
+        p1 = face.Points[0]
+        p2 = face.Points[1]
+        p3 = face.Points[2]
+
+        st += f3.format(p1[0] * scale) + "," + f3.format(p1[1] * scale) + "," + f3.format(p1[2] * scale) + ";"
+        st += f3.format(p2[0] * scale) + "," + f3.format(p2[1] * scale) + "," + f3.format(p2[2] * scale) + ";"
+        st += f3.format(p3[0] * scale) + "," + f3.format(p3[1] * scale) + "," + f3.format(p3[2] * scale) + "\n"
+
+    return st
+
+class _PVSystTaskPanel:
+
+    def __init__(self):
+        self.form = FreeCADGui.PySideUic.loadUi(os.path.dirname(__file__) + "/exportPVSyst.ui")
+        self.form = self.form
+
+    def show(self):
+        # self.form.setWindowModality(Qt.WindowModal)
+        self.form.show()
+
+    def accept(self):
+        import datetime
+        x = datetime.datetime.now()
+        date = x.strftime("%y%m%d%H%M%S")
+        overwrite = True
+
+        path = os.path.join(os.path.dirname(FreeCAD.ActiveDocument.FileName), "outputs", "PVSyst")
+        if not os.path.exists(path):
+            os.makedirs(path)
+
+        name = FreeCAD.ActiveDocument.Label
+        if not overwrite:
+            name = date + "-" + name
+        filename = os.path.join(path, name)
+
+        #if self.form.cbDAE.isChecked():
+        #    exportToDAE(filename)
+
+        if self.form.cbPVC.isChecked():
+            exportToPVC(filename, self.form.cbTerrain.isChecked())
+
+        if self.form.cbH2P.isChecked():
+            exportToH2P(filename)
+
+        FreeCADGui.Control.closeDialog()
+        return True
+
+    def reject(self):
+        FreeCADGui.Control.closeDialog()
+        return True
+
+class _CommandExportToPVSyst:
+    "Export to PVSyst"
+
+    def GetResources(self):
+        return {'Pixmap': str(os.path.join(DirIcons, "PVsyst.png")),
+                'Accel': "E, P",
+                'MenuText': QT_TRANSLATE_NOOP("Outputs", "Export to PVSyst"),
+                'ToolTip': QT_TRANSLATE_NOOP("Outputs", "Exportar a PVSyst")}
+
+    def Activated(self):
+        taskd = _PVSystTaskPanel()
+        # taskd.show()
+        FreeCADGui.Control.showDialog(taskd)
+
+    def IsActive(self):
+        if FreeCAD.ActiveDocument:
+            return True
+        else:
+            return False
+
+if FreeCAD.GuiUp:
+    FreeCADGui.addCommand('ExportToPVSyst', _CommandExportToPVSyst())

Export/exportPVSyst.ui

@@ -0,0 +1,84 @@
+<?xml version="1.0" encoding="UTF-8"?>
+<ui version="4.0">
+ <class>formPVSyst</class>
+ <widget class="QDialog" name="formPVSyst">
+  <property name="geometry">
+   <rect>
+    <x>0</x>
+    <y>0</y>
+    <width>301</width>
+    <height>123</height>
+   </rect>
+  </property>
+  <property name="windowTitle">
+   <string>Export to PVSyst</string>
+  </property>
+  <layout class="QVBoxLayout" name="verticalLayout">
+   <property name="leftMargin">
+    <number>5</number>
+   </property>
+   <property name="topMargin">
+    <number>5</number>
+   </property>
+   <property name="rightMargin">
+    <number>5</number>
+   </property>
+   <property name="bottomMargin">
+    <number>5</number>
+   </property>
+   <item>
+    <widget class="QGroupBox" name="groupBox">
+     <property name="sizePolicy">
+      <sizepolicy hsizetype="Preferred" vsizetype="Fixed">
+       <horstretch>0</horstretch>
+       <verstretch>0</verstretch>
+      </sizepolicy>
+     </property>
+     <property name="title">
+      <string>Export format:</string>
+     </property>
+     <layout class="QVBoxLayout" name="verticalLayout_2">
+      <property name="leftMargin">
+       <number>5</number>
+      </property>
+      <property name="topMargin">
+       <number>5</number>
+      </property>
+      <property name="rightMargin">
+       <number>5</number>
+      </property>
+      <property name="bottomMargin">
+       <number>5</number>
+      </property>
+      <item>
+       <widget class="QCheckBox" name="cbH2P">
+        <property name="text">
+         <string>Helios 3D (H2P) - PVSyst 6.0 or higher</string>
+        </property>
+       </widget>
+      </item>
+      <item>
+       <widget class="QCheckBox" name="cbPVC">
+        <property name="text">
+         <string>PVCase (PVC) - PVSyst 7.0 or higher</string>
+        </property>
+        <property name="checked">
+         <bool>true</bool>
+        </property>
+       </widget>
+      </item>
+     </layout>
+    </widget>
+   </item>
+   <item>
+    <widget class="QCheckBox" name="cbTerrain">
+     <property name="text">
+      <string>Exportar terreno</string>
+     </property>
+    </widget>
+   </item>
+  </layout>
+ </widget>
+ <resources/>
+ <connections/>
+</ui>

Export/layoutToExcel.py

@@ -0,0 +1,159 @@
+# /**********************************************************************
+# *                                                                     *
+# * Copyright (c) 2021 Javier Braña <javier.branagutierrez@gmail.com>  *
+# *                                                                     *
+# * This program is free software; you can redistribute it and/or modify*
+# * it under the terms of the GNU Lesser General Public License (LGPL)  *
+# * as published by the Free Software Foundation; either version 2 of   *
+# * the License, or (at your option) any later version.                 *
+# * for detail see the LICENCE text file.                               *
+# *                                                                     *
+# * This program is distributed in the hope that it will be useful,     *
+# * but WITHOUT ANY WARRANTY; without even the implied warranty of      *
+# * MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE.  See the       *
+# * GNU Library General Public License for more details.                *
+# *                                                                     *
+# * You should have received a copy of the GNU Library General Public   *
+# * License along with this program; if not, write to the Free Software *
+# * Foundation, Inc., 59 Temple Place, Suite 330, Boston, MA  02111-1307*
+# * USA                                                                 *
+# *                                                                     *
+# ***********************************************************************
+
+import FreeCAD, Draft
+import PVPlantSite
+import copy
+
+if FreeCAD.GuiUp:
+    from DraftTools import translate
+    from PySide.QtCore import QT_TRANSLATE_NOOP
+
+    import Part
+    import pivy
+    from pivy import coin
+    import os
+else:
+    # \cond
+    def translate(ctxt, txt):
+        return txt
+
+
+    def QT_TRANSLATE_NOOP(ctxt, txt):
+        return txt
+    # \endcond
+
+__title__ = "PVPlant Trench"
+__author__ = "Javier Braña"
+__url__ = "http://www.sogos-solar.com"
+
+from PVPlantResources import DirIcons as DirIcons
+from PVPlantResources import DirDocuments as DirDocuments
+
+
+'''import os
+import platform
+import subprocess
+
+def open_file(path):
+    if platform.system() == "Windows":
+        os.startfile(path)
+    elif platform.system() == "Darwin":
+        subprocess.Popen(["open", path])
+    else:
+        subprocess.Popen(["xdg-open", path])'''
+
+
+from PVPlantPlacement import getCols
+
+def generateLayout(numcells = 3, gapc = 3):
+    # TODO: hacerlo por zonas
+
+    objects = []
+    for obj in FreeCAD.ActiveDocument.Objects:
+        if not hasattr(obj, "Proxy"):
+            continue
+        '''if issubclass(obj.Proxy.__class__, PVPlantRack.Frame):
+            objects.append(obj)'''
+        if obj.Name.startswith("Tracker") and not obj.Name.startswith("TrackerSetup"):
+            objects.append(obj)
+
+    if len(objects) == 0:
+        FreeCAD.Console.PrintError("No hay trackes" + "\n")
+        return False
+
+    columns = getCols(objects.copy())
+
+    MaxY = max(objects, key=lambda obj: obj.Placement.Base.y).Placement.Base.y
+    long_max = max(objects, key=lambda obj: obj.Setup.Length.Value).Setup.Length.Value
+    num_pole_max = max(objects, key=lambda obj: obj.Setup.NumberPole.Value).Setup.NumberPole.Value
+    num_module_max = max(objects, key=lambda obj: obj.Setup.ModuleColumns.Value).Setup.ModuleColumns.Value
+    # TODO: calcular la serparación entre trackers.
+    gapy = 500
+
+    import openpyxl
+    path = os.path.dirname(FreeCAD.ActiveDocument.FileName)
+    filename = os.path.join(path, "layout.xlsx")
+    mywb = openpyxl.Workbook()
+
+    # 1. Hincas
+    sheet = mywb.active
+    sheet.title = 'Poles'
+    m = -(numcells * num_pole_max + gapc) / (long_max + gapy)
+    line = lambda x: int(m * (x - MaxY))
+    drawLayout(sheet, columns, line, 0)
+
+    # 2. Paneles
+    sheet = mywb.create_sheet("Modules")
+    m = -(numcells * num_module_max + gapc) / (long_max + gapy)
+    line = lambda x: int(m * (x - MaxY) + 1)
+    #drawLayout(sheet, columns, line, 1)
+
+    mywb.save(filename)
+    print("Se ha generado el lyout en excel satisfactoriamente en: ")
+    print(filename)
+    os.startfile(path)
+
+    #from os import startfile
+    #startfile("archivo.txt")
+
+    return True
+
+def drawLayout(sheet, cols, line, cnt = 0, numcell = 3, gap = 3):
+    from openpyxl.styles import Alignment, Border, Side, PatternFill, GradientFill, Font
+    thin = Side(border_style="thin", color="000000")
+
+    for i, col in enumerate(cols):
+        colnum = i * 3 + 1
+        for g, group in enumerate(col):
+            rownum = int(line(group[0].Placement.Base.y)) + 1
+            if rownum < 1:
+                continue
+            for frame in group:
+                num = int(frame.Setup.NumberPole.Value if cnt == 0 else frame.Setup.ModuleColumns.Value)
+                sheet.merge_cells(start_row=rownum, start_column=colnum,
+                                  end_row=rownum, end_column=colnum + 1)
+                titlecell = sheet.cell(row=rownum, column=colnum)
+                titlecell.value = frame.Label
+                titlecell.border = Border(top=thin, left=thin, right=thin, bottom=thin)
+                titlecell.font = Font(b=True, color="FF0000")
+                titlecell.alignment = Alignment(horizontal="center", vertical="center")
+                rownum += 1
+                for ind in range(num):
+                    sheet.merge_cells(start_row=rownum, start_column=colnum,
+                                      end_row=rownum + numcell - 1, end_column=colnum)
+                    polecell = sheet.cell(row=rownum, column=colnum)
+                    polecell.value = ind + 1
+                    polecell.alignment = Alignment(horizontal="center", vertical="center")
+
+                    sheet.merge_cells(start_row=rownum, start_column=colnum + 1,
+                                      end_row=rownum + numcell - 1, end_column=colnum + 1)
+                    polecell = sheet.cell(row=rownum, column=colnum + 1)
+                    polecell.value = "Celda-" + str(ind + 1)
+                    polecell.value = frame.Label
+                    polecell.border = Border(top=thin, left=thin, right=thin, bottom=thin)
+                    polecell.font = Font(b=True, color="FF0000")
+                    polecell.alignment = Alignment(horizontal="center", vertical="center")
+
+                    rownum += numcell
+                rownum += 1
+

GraphProfile.py

@@ -0,0 +1,264 @@
+# /**********************************************************************
+# *                                                                     *
+# * Copyright (c) 2021 Javier Braña <javier.branagutierrez@gmail.com>  *
+# *                                                                     *
+# * This program is free software; you can redistribute it and/or modify*
+# * it under the terms of the GNU Lesser General Public License (LGPL)  *
+# * as published by the Free Software Foundation; either version 2 of   *
+# * the License, or (at your option) any later version.                 *
+# * for detail see the LICENCE text file.                               *
+# *                                                                     *
+# * This program is distributed in the hope that it will be useful,     *
+# * but WITHOUT ANY WARRANTY; without even the implied warranty of      *
+# * MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE.  See the       *
+# * GNU Library General Public License for more details.                *
+# *                                                                     *
+# * You should have received a copy of the GNU Library General Public   *
+# * License along with this program; if not, write to the Free Software *
+# * Foundation, Inc., 59 Temple Place, Suite 330, Boston, MA  02111-1307*
+# * USA                                                                 *
+# *                                                                     *
+# ***********************************************************************
+
+import FreeCAD
+import Part
+
+import PVPlantResources
+from PVPlantResources import DirIcons as DirIcons
+
+if FreeCAD.GuiUp:
+    import FreeCADGui
+    from DraftTools import translate
+    from PySide.QtCore import QT_TRANSLATE_NOOP
+    import draftguitools.gui_trackers as DraftTrackers
+
+    import pivy
+    import os
+else:
+    # \cond
+    def translate(ctxt, txt):
+        return txt
+
+
+    def QT_TRANSLATE_NOOP(ctxt, txt):
+        return txt
+    # \endcond
+
+__title__ = "Graph Terrain Profile"
+__author__ = "Javier Braña"
+__url__ = "http://www.sogos-solar.com"
+
+
+def makeGraphProfile(path = None):
+    obj = FreeCAD.ActiveDocument.addObject("Part::FeaturePython", "GraphProfile")
+    _GraphProfile(obj)
+    _ViewProviderGraphProfile(obj.ViewObject)
+
+    if path:
+        obj.Path = path
+
+    return obj
+
+class _GraphProfile:
+    def __init__(self, obj):
+        self.setCommonProperties(obj)
+
+    def setCommonProperties(self, obj):
+        pl = obj.PropertiesList
+
+        if not ("Path" in pl):
+            obj.addProperty("App::PropertyLink",
+                            "Path",
+                            "Setup",
+                            QT_TRANSLATE_NOOP("App::Property", "")
+                            )
+            #obj.setEditorMode("NumberOfStrings", 1)
+
+        if not ("AdjustToContent" in pl):
+            obj.addProperty("App::PropertyBool",
+                            "AdjustToContent",
+                            "Setup",
+                            QT_TRANSLATE_NOOP("App::Property", "")
+                            ).AdjustToContent = True
+
+        if not ("PKMinorDistance" in pl):
+            obj.addProperty("App::PropertyDistance",
+                            "PKMinorDistance",
+                            "Setup",
+                            QT_TRANSLATE_NOOP("App::Property", "")
+                            ).PKMinorDistance = 20000
+
+        if not ("YAxisStep" in pl):
+            obj.addProperty("App::PropertyDistance",
+                            "YAxisStep",
+                            "Setup",
+                            QT_TRANSLATE_NOOP("App::Property", "")
+                            ).YAxisStep = 5000
+
+        if not ("Points" in pl):
+            obj.addProperty("App::PropertyVectorList",
+                            "Points",
+                            "Setup",
+                            QT_TRANSLATE_NOOP("App::Property", "")
+                            )
+            obj.setEditorMode("Points", 1)
+
+        self.Type = "GraphProfile"
+        obj.Proxy = self
+
+    def onDocumentRestored(self, obj):
+        self.setProperties(obj)
+
+    def onChanged(self, obj, prop):
+        '''Do something when a property has changed'''
+
+
+        if prop == "Path":
+            if obj.getPropertyByName(prop):
+                from Utils import PVPlantUtils
+                profile = PVPlantUtils.FlattenWire(PVPlantUtils.makeProfileFromTerrain(obj.Path))
+                obj.Points = PVPlantUtils.getPointsFromVertexes(profile.Vertexes)
+            else:
+                obj.Points.clear()
+        print("Graph: onChanged")
+
+    def execute(self, obj):
+        if (obj.Path is None) or (obj.Points is None):
+            return
+
+        profile = Part.makePolygon(obj.Points)
+        xx_max = profile.BoundBox.XMax
+        yy_min = profile.BoundBox.YMin
+        yy_max = profile.BoundBox.YMax
+        yy_length = yy_max
+        yy_axis_minus = int(yy_min / 10) * 10 - obj.YAxisStep.Value
+
+        # 1. Make Axis:
+        x_axis = Part.makePolygon([FreeCAD.Vector(0, 0, 0), FreeCAD.Vector(xx_max, 0, 0)])
+        y_axis = None
+        if obj.AdjustToContent:
+            yy_length -= yy_min
+            y_axis = Part.makePolygon([FreeCAD.Vector(0, 0, 0), FreeCAD.Vector(0, (yy_max - yy_min) * 1.1, 0)])
+            profile.Placement.Base.y = profile.Placement.Base.y - yy_min + obj.YAxisStep.Value
+        else:
+            y_axis = Part.makePolygon([FreeCAD.Vector(0, 0, 0), FreeCAD.Vector(0, yy_max, 0)])
+
+        shapes = []
+
+        # 2. grid
+        cnt = 0
+        while cnt <= xx_max:
+            line = y_axis.copy()
+            line.Placement.Base = y_axis.Placement.Base + FreeCAD.Vector(cnt, 0, 0)
+            shapes.append(line)
+            cnt += obj.PKMinorDistance.Value
+
+        cnt = 0
+        while cnt <= yy_length:
+            line = x_axis.copy()
+            line.Placement.Base = x_axis.Placement.Base + FreeCAD.Vector(0, cnt, 0)
+            shapes.append(line)
+            cnt += obj.YAxisStep.Value
+
+        shapes.append(profile)
+
+        # Shape:
+        obj.Shape = Part.makeCompound(shapes)
+
+
+
+class _ViewProviderGraphProfile:
+    def __init__(self, vobj):
+        '''
+        Set view properties.
+        '''
+        self.Object = vobj.Object
+        vobj.Proxy = self
+
+    def attach(self, vobj):
+        '''
+        Create Object visuals in 3D view.
+        '''
+        self.Object = vobj.Object
+        return
+
+    def getIcon(self):
+        '''
+        Return object treeview icon.
+        '''
+
+        return str(os.path.join(DirIcons, "stringsetup.svg"))
+    '''
+    def claimChildren(self):
+        """
+        Provides object grouping
+        """
+        return self.Object.Group
+    '''
+
+    def setEdit(self, vobj, mode=0):
+        """
+        Enable edit
+        """
+        return True
+
+    def unsetEdit(self, vobj, mode=0):
+        """
+        Disable edit
+        """
+        return False
+
+    def doubleClicked(self, vobj):
+        """
+        Detect double click
+        """
+        pass
+
+    def setupContextMenu(self, obj, menu):
+        """
+        Context menu construction
+        """
+        pass
+
+    def edit(self):
+        """
+        Edit callback
+        """
+        pass
+
+    def __getstate__(self):
+        """
+        Save variables to file.
+        """
+        return None
+
+    def __setstate__(self,state):
+        """
+        Get variables from file.
+        """
+        return None
+
+class _CommandGraphProfile:
+
+    def GetResources(self):
+        return {'Pixmap': str(os.path.join(PVPlantResources.DirIcons, "Profile.svg")),
+                'Accel': "C, P",
+                'MenuText': QT_TRANSLATE_NOOP("Placement", "Terrain Profile Graph"),
+                'ToolTip': QT_TRANSLATE_NOOP("Placement", "")}
+
+    def Activated(self):
+        path = None
+        sel = FreeCADGui.Selection.getSelection()
+        if len(sel)>0:
+            path = sel[0]
+        obj = makeGraphProfile(path)
+
+    def IsActive(self):
+        if FreeCAD.ActiveDocument:
+            return True
+        else:
+            return False
+
+if FreeCAD.GuiUp:
+    FreeCADGui.addCommand('GraphTerrainProfile', _CommandGraphProfile())
+

Importer/importDXF.py

@@ -0,0 +1,143 @@
+
+import FreeCAD
+
+if FreeCAD.GuiUp:
+    import FreeCADGui
+    from PySide import QtGui
+    from PySide.QtCore import QT_TRANSLATE_NOOP
+
+    import os
+else:
+    # \cond
+    def translate(ctxt, txt):
+        return txt
+
+
+    def QT_TRANSLATE_NOOP(ctxt, txt):
+        return txt
+    # \endcond
+
+__title__ = "PVPlant Export to DXF"
+__author__ = "Javier Braña"
+__url__ = "http://www.sogos-solar.com"
+
+import PVPlantResources
+from PVPlantResources import DirIcons as DirIcons
+
+
+def importDXF(filename):
+    print("---------- import to dxf ----------")
+
+    if filename == "":
+        return
+
+    import sys
+    import ezdxf
+
+    doc = None
+    try:
+        doc = ezdxf.readfile(filename)
+    except IOError:
+        print(f"Not a DXF file or a generic I/O error.")
+        sys.exit(1)
+    except ezdxf.DXFStructureError:
+        print(f"Invalid or corrupted DXF file.")
+        sys.exit(2)
+
+    # iteration
+    for layer in doc.layers:
+        print(layer.dxf.name)
+
+        #if layer.dxf.name != "0":
+        #    layer.off()  # switch all layers off except layer "0"
+
+    # check for existing layer definition
+    if "MyLines" in doc.layers:
+        layer = doc.layers.get("MyLines")
+
+    layer_count = len(doc.layers)  # total count of layer definitions
+
+
+class _PVPlantImportDXF:
+    '''The editmode TaskPanel to select what you want to export'''
+
+    def __init__(self):
+        self.doc = None
+
+        # self.form:
+        self.form = FreeCADGui.PySideUic.loadUi(os.path.join(PVPlantResources.__dir__, "importDXF.ui"))
+        self.form.setWindowIcon(QtGui.QIcon(os.path.join(PVPlantResources.DirIcons, "dxf.svg")))
+        self.form.buttonOpen.clicked.connect(self.openFile)
+        self.form.listLayer.currentItemChanged.connect(self.onLayerSelect)
+
+    def openFile(self):
+        ''' '''
+        "getOpenFileName(parent: typing.Union[PySide2.QtWidgets.QWidget, NoneType] = None," \
+        "caption: str = ''," \
+        "dir: str = ''," \
+        "filter: str = ''," \
+        "options: PySide2.QtWidgets.QFileDialog.Options = Default(QFileDialog.Options)) -> typing.Tuple[str, str]"
+        filename, trash = QtGui.QFileDialog().getOpenFileName(None, 'Select File', os.getcwd(), 'Autocad dxf (*.dxf)')
+        if filename == "":
+            return
+
+        import sys
+        import ezdxf
+
+        try:
+            self.doc = ezdxf.readfile(filename)
+        except IOError:
+            print(f"Not a DXF file or a generic I/O error.")
+            sys.exit(1)
+        except ezdxf.DXFStructureError:
+            print(f"Invalid or corrupted DXF file.")
+            sys.exit(2)
+
+        # iteration
+        self.form.listLayer.clear()
+        for layer in self.doc.layers:
+            self.form.listLayer.addItem(layer.dxf.name)
+
+        msp = self.doc.modelspace()
+        for e in msp:
+            print(e.dxftype())
+            #self.form.listObjects.addItem(e.dxftype())
+
+    def onLayerSelect(self, item):
+        ''' '''
+        print(item.text())
+        self.form.listLayer.clear()
+        if self.doc:
+            msp = self.doc.modelspace()
+            '''
+            layer = self.doc.layers.get(item.text())
+            for obj in layer.entities_in_redraw_order(reverse=False):
+                self.form.listObjects.addItem(obj)
+            '''
+            for obj in msp.query('*[layer=="'+item.text()+'"]'):
+                #self.form.listObjects.addItem(obj)
+                print(obj)
+
+    def accept(self):
+        ''' '''
+
+class CommandImportDXF:
+
+    def GetResources(self):
+        return {'Pixmap': str(os.path.join(DirIcons, "dxf.svg")),
+                'Accel': "E, X",
+                'MenuText': "Importer to DXF",
+                'ToolTip': QT_TRANSLATE_NOOP("Placement", "Importer choosed layers to dxf")}
+
+    def Activated(self):
+        taskd = _PVPlantImportDXF()
+        FreeCADGui.Control.showDialog(taskd)
+
+    def IsActive(self):
+        if FreeCAD.ActiveDocument:
+            return True
+        else:
+            return False
+
+if FreeCAD.GuiUp:
+    FreeCADGui.addCommand('importDXF', CommandImportDXF())

Importer/importDXF.ui

@@ -0,0 +1,75 @@
+<?xml version="1.0" encoding="UTF-8"?>
+<ui version="4.0">
+ <class>formPVSyst</class>
+ <widget class="QDialog" name="formPVSyst">
+  <property name="geometry">
+   <rect>
+    <x>0</x>
+    <y>0</y>
+    <width>421</width>
+    <height>471</height>
+   </rect>
+  </property>
+  <property name="windowTitle">
+   <string>Export to PVSyst</string>
+  </property>
+  <layout class="QVBoxLayout" name="verticalLayout">
+   <property name="leftMargin">
+    <number>5</number>
+   </property>
+   <property name="topMargin">
+    <number>5</number>
+   </property>
+   <property name="rightMargin">
+    <number>5</number>
+   </property>
+   <property name="bottomMargin">
+    <number>5</number>
+   </property>
+   <item>
+    <widget class="QWidget" name="widget" native="true">
+     <layout class="QHBoxLayout" name="horizontalLayout">
+      <item>
+       <widget class="QLineEdit" name="lineEdit"/>
+      </item>
+      <item>
+       <widget class="QPushButton" name="buttonOpen">
+        <property name="maximumSize">
+         <size>
+          <width>24</width>
+          <height>16777215</height>
+         </size>
+        </property>
+        <property name="text">
+         <string>...</string>
+        </property>
+       </widget>
+      </item>
+     </layout>
+    </widget>
+   </item>
+   <item>
+    <widget class="QListWidget" name="listLayer"/>
+   </item>
+   <item>
+    <widget class="QListWidget" name="listObjects"/>
+   </item>
+   <item>
+    <widget class="QPushButton" name="pushOpenFile">
+     <property name="text">
+      <string>Aceptar</string>
+     </property>
+     <property name="icon">
+      <iconset theme="Accept">
+       <normaloff>.</normaloff>.</iconset>
+     </property>
+     <property name="default">
+      <bool>true</bool>
+     </property>
+    </widget>
+   </item>
+  </layout>
+ </widget>
+ <resources/>
+ <connections/>
+</ui>

Init.py

@@ -0,0 +1,92 @@
+# -*- coding: utf-8 -*-
+#****************************************************************************
+#*                                                                          *
+#*  Kicad STEPUP (TM) (3D kicad board and models to STEP) for FreeCAD       *
+#*  3D exporter for FreeCAD                                                 *
+#*  Kicad STEPUP TOOLS (TM) (3D kicad board and models to STEP) for FreeCAD *
+#*  Copyright (c) 2015                                                      *
+#*  Maurice easyw@katamail.com                                              *
+#*                                                                          *
+#*  Kicad STEPUP (TM) is a TradeMark and cannot be freely useable           *
+#*                                                                          *
+
+#FreeCAD.addImportType("Kicad pcb board/mod File Type (*.kicad_pcb *.kicad_mod)","kicadStepUptools") 
+
+
+FreeCAD.addImportType("Industry Foundation Classes (*.ifc)","importIFC")
+FreeCAD.addExportType("Industry Foundation Classes (*.ifc)","importIFC")
+FreeCAD.addImportType("Wavefront OBJ - Arch module (*.obj)","importOBJ")
+FreeCAD.addExportType("Wavefront OBJ - Arch module (*.obj)","importOBJ")
+FreeCAD.addExportType("WebGL file (*.html)","importWebGL")
+FreeCAD.addExportType("JavaScript Object Notation (*.json)","importJSON")
+FreeCAD.addImportType("Collada (*.dae)","importDAE")
+FreeCAD.addExportType("Collada (*.dae)","importDAE")
+FreeCAD.addImportType("3D Studio mesh (*.3ds)","import3DS")
+FreeCAD.addImportType("SweetHome3D XML export (*.zip)","importSH3D")
+
+import os
+
+__path__ = __import__('pkgutil').extend_path(__path__, __name__)
+
+ICONPATH = os.path.join(os.path.dirname(__file__), "resources")
+
+zone_list = ["Z1", "Z2", "Z3", "Z4", "Z5", "Z6", "Z7", "Z8", "Z9", "Z10", "Z11", "Z12",
+    "Z13", "Z14", "Z15", "Z16", "Z17", "Z18", "Z19", "Z20", "Z21", "Z22", "Z23", "Z24",
+    "Z25", "Z26", "Z27", "Z28", "Z29", "Z30", "Z31", "Z32", "Z33", "Z34", "Z35", "Z36",
+    "Z37", "Z38", "Z39", "Z40", "Z41", "Z42", "Z43", "Z44", "Z45", "Z46", "Z47", "Z48",
+    "Z49", "Z50", "Z51", "Z52", "Z53", "Z54", "Z55", "Z56", "Z57", "Z58", "Z59", "Z60"]
+
+marker_dict = {
+    'NONE': -1, 'BACKSLASH_5_5': 4, 'BACKSLASH_7_7': 34,
+    'BACKSLASH_9_9': 64, 'BAR_5_5': 5, 'BAR_7_7': 35, 'BAR_9_9': 65,
+    'CAUTION_FILLED_5_5': 28, 'CAUTION_FILLED_7_7': 58, 'CAUTION_FILLED_9_9': 88,
+    'CAUTION_LINE_5_5': 18, 'CAUTION_LINE_7_7': 48, 'CAUTION_LINE_9_9': 78,
+    'CIRCLE_FILLED_5_5': 20, 'CIRCLE_FILLED_7_7': 50, 'CIRCLE_FILLED_9_9': 80,
+    'CIRCLE_LINE_5_5': 10, 'CIRCLE_LINE_7_7': 40, 'CIRCLE_LINE_9_9': 70,
+    'CROSS_5_5': 0, 'CROSS_7_7': 30, 'CROSS_9_9': 60, 'DIAMOND_FILLED_5_5': 22,
+    'DIAMOND_FILLED_7_7': 52, 'DIAMOND_FILLED_9_9': 82, 'DIAMOND_LINE_5_5': 12,
+    'DIAMOND_LINE_7_7': 42, 'DIAMOND_LINE_9_9': 72, 'EXTENSION': 512,
+    'FIRST_INSTANCE': 0, 'HOURGLASS_FILLED_5_5': 25, 'HOURGLASS_FILLED_7_7': 55,
+    'HOURGLASS_FILLED_9_9': 85, 'HOURGLASS_LINE_5_5': 15, 'HOURGLASS_LINE_7_7': 45,
+    'HOURGLASS_LINE_9_9': 75, 'LIGHTNING_5_5': 8, 'LIGHTNING_7_7': 38,
+    'LIGHTNING_9_9': 68, 'LINES': 7, 'LINE_STRIP': 8, 'MINUS_5_5': 2,
+    'MINUS_7_7': 32, 'MINUS_9_9': 62, 'NUM_MARKERS': 90, 'OTHER_INSTANCE': 2,
+    'PINE_TREE_FILLED_5_5': 27, 'PINE_TREE_FILLED_7_7': 57, 'PINE_TREE_FILLED_9_9': 87,
+    'PINE_TREE_LINE_5_5': 17, 'PINE_TREE_LINE_7_7': 47, 'PINE_TREE_LINE_9_9': 77,
+    'PLUS_5_5': 1, 'PLUS_7_7': 31, 'PLUS_9_9': 61, 'POINTS': 6, 'POLYGON': 3,
+    'PROTO_INSTANCE': 1, 'QUADS': 4, 'QUAD_STRIP': 5, 'RHOMBUS_FILLED_5_5': 24,
+    'RHOMBUS_FILLED_7_7': 54, 'RHOMBUS_FILLED_9_9': 84, 'RHOMBUS_LINE_5_5': 14,
+    'RHOMBUS_LINE_7_7': 44, 'RHOMBUS_LINE_9_9': 74, 'SATELLITE_FILLED_5_5': 26,
+    'SATELLITE_FILLED_7_7': 56, 'SATELLITE_FILLED_9_9': 86, 'SATELLITE_LINE_5_5': 16,
+    'SATELLITE_LINE_7_7': 46, 'SATELLITE_LINE_9_9': 76, 'SHIP_FILLED_5_5': 29,
+    'SHIP_FILLED_7_7': 59, 'SHIP_FILLED_9_9': 89, 'SHIP_LINE_5_5': 19,
+    'SHIP_LINE_7_7': 49, 'SHIP_LINE_9_9': 79, 'SLASH_5_5': 3, 'SLASH_7_7': 33,
+    'SLASH_9_9': 63, 'SQUARE_FILLED_5_5': 21, 'SQUARE_FILLED_7_7': 51,
+    'SQUARE_FILLED_9_9': 81, 'SQUARE_LINE_5_5': 11, 'SQUARE_LINE_7_7': 41,
+    'SQUARE_LINE_9_9': 71, 'STAR_5_5': 6, 'STAR_7_7': 36, 'STAR_9_9': 66,
+    'TRIANGLES': 2, 'TRIANGLE_FAN': 1, 'TRIANGLE_FILLED_5_5': 23,
+    'TRIANGLE_FILLED_7_7': 53, 'TRIANGLE_FILLED_9_9': 83, 'TRIANGLE_LINE_5_5': 13,
+    'TRIANGLE_LINE_7_7': 43, 'TRIANGLE_LINE_9_9': 73, 'TRIANGLE_STRIP': 0,
+    'VRML1': 1, 'VRML2': 2, 'WELL_5_5': 9, 'WELL_7_7': 39, 'WELL_9_9': 69,
+    'Y_5_5': 7, 'Y_7_7': 37, 'Y_9_9': 67}
+
+line_patterns = {
+    "Continues      _______________________________": 0xFFFF,
+    "Border         __ . __ __ . __ __ . __ __ . __": 0x3CF2,
+    "Border (.5x)   __.__.__.__.__.__.__.__.__.__._": 0x3939,
+    "Border (2x)    ____  ____  .  ____  ____  .  _": 0xFDFA,
+    "Center         ____ _ ____ _ ____ _ ____ _ ___": 0xFF3C,
+    "Center (.5x)   ___ _ ___ _ ___ _ ___ _ ___ _ _": 0xFC78,
+    "Center (2x)    ________  __  ________  __  ___": 0xFFDE,
+    "Dash dot       __ . __ . __ . __ . __ . __ . _": 0xE4E4,
+    "Dash dot (.5x) _._._._._._._._._._._._._._._._": 0xEBAE,
+    "Dash dot (2x)  ____  .  ____  .  ____  .  ____": 0xFF08,
+    "Dashed         __ __ __ __ __ __ __ __ __ __ _": 0x739C,
+    "Dashed (.5x)   _ _ _ _ _ _ _ _ _ _ _ _ _ _ _ _": 0xDB6E,
+    "Dashed (2x)    ____  ____  ____  ____  ____  _": 0xFFE0,
+    "Divide         ____ . . ____ . . ____ . . ____": 0xFF24,
+    "Divide (.5x)   __..__..__..__..__..__..__..__.": 0xEAEA,
+    "Divide (2x)    ________  .  .  ________  .  . ": 0xFFEA,
+    "Dot            . . . . . . . . . . . . . . . .": 0x4924,
+    "Dot (.5x)      ...............................": 0x5555,
+    "Dot (2x)       .  .  .  .  .  .  .  .  .  .  .": 0x8888}

InitGui.py

@@ -0,0 +1,247 @@
+# /**********************************************************************
+# *                                                                     *
+# * Copyright (c) 2021 Javier Braña <javier.branagutierrez@gmail.com>  *
+# *                                                                     *
+# * This program is free software; you can redistribute it and/or modify*
+# * it under the terms of the GNU Lesser General Public License (LGPL)  *
+# * as published by the Free Software Foundation; either version 2 of   *
+# * the License, or (at your option) any later version.                 *
+# * for detail see the LICENCE text file.                               *
+# *                                                                     *
+# * This program is distributed in the hope that it will be useful,     *
+# * but WITHOUT ANY WARRANTY; without even the implied warranty of      *
+# * MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE.  See the       *
+# * GNU Library General Public License for more details.                *
+# *                                                                     *
+# * You should have received a copy of the GNU Library General Public   *
+# * License along with this program; if not, write to the Free Software *
+# * Foundation, Inc., 59 Temple Place, Suite 330, Boston, MA  02111-1307*
+# * USA                                                                 *
+# *                                                                     *
+# ***********************************************************************
+
+__title__="FreeCAD Fotovoltaic Power Plant Toolkit"
+__author__ = "Javier Braña"
+__url__ = "sn"
+
+
+
+class PVPlantWorkbench (Workbench):
+    import os
+    from PVPlantResources import DirIcons as DirIcons
+
+    MenuText = "PVPlant"
+    ToolTip = "Workbench for PV design"
+    Icon = str(os.path.join(DirIcons, "icon.svg"))
+
+    def Initialize(self):
+        import sys
+        sys.path.append(r"C:\Users\javie\AppData\Roaming\FreeCAD\Mod")
+
+        # Mias
+        import PVPlantGeoreferencing, PVPlantPlacement, \
+            PVPlantTerrainAnalisys, PVPlantSite, PVPlantImportGrid, PVPlantFence,\
+            PVPlantFoundation, PVPlantCreateTerrainMesh, \
+            PVPlantTreeGenerator, PVPlantBuilding, PVPlantTrench, PVPlantEarthWorks, \
+            PVPlantStringing, \
+            PVPlantPad, PVPlantRoad, PVPlantTerrain, PVPlantManhole, \
+            GraphProfile, Utils.PVPlantTrace,\
+            reload
+        import PVPlantRackChecking
+
+        from Project.Area import PVPlantArea, PVPlantAreaUtils
+        from Project import ProjectSetup
+        from Export import exportPVSyst, PVPlantBOQMechanical, PVPlantBOQElectrical, PVPlantBOQCivil,\
+            exportDXF
+        from Importer import importDXF
+
+        from Mechanical.Frame import PVPlantFrame
+
+        from Electrical.Cable import PVPlantCable, PVPlantElectricalLine
+        from Electrical.CombinerBox import PVPlantStringBox
+        from Electrical.Inverter import PVPlantInverter
+
+        # A list of command names created in the line above
+        self.projectlist = ["Reload",
+                            "PVPlantSite",
+                            "PVPlantGeoreferencing",
+                            "ProjectSetup",
+                            #"ImportGrid",
+                            "Terrain",
+                            "PointsGroup",
+                            "PVPlantCreateTerrainMesh",
+                            "PVPlantAreas",
+                            "SplitArea",
+                            "TerrainAnalisys",
+                            "Trenches",
+                            "PVPlantEarthworks",
+                            "PVPlantPad",
+                            "PVPlantRoad",
+                            "PVPlantManhole",
+                            #"PVPlantFoundation"
+                            "GraphTerrainProfile",
+                            "Trace",
+                            ]
+        self.framelist = [
+                     "RackType",
+                     "PVPlantRackCheck",
+                     "Separator",
+                     "PVPlantPlacement",
+                     "PVPlantAdjustToTerrain",
+                     "PVPlantConvertTo",
+                     "PVArea"
+                     ]
+
+        self.objectlist = [
+                    "PVPlantTree",
+                    "PVPlantBuilding",
+                    "PVPlantFenceGroup",
+                    ]
+
+        self.inportExportlist = ["BOQCivil",
+                      "BOQMechanical",
+                      "BOQElectrical",
+                      "Separator",
+                      "exportDXF",
+                      #"importDXF",
+                      "ExportToPVSyst",
+                    ]
+
+        self.electricalList = ["PVPlantStringBox",
+                               "PVPlantCable",
+                               "PVPlanElectricalLine",
+                               "Conduit",
+                               "Stringing",
+                               "Separator",
+                               "StringInverter",
+                              ]
+
+        self.roads = ["PVPlantRoad",
+
+                     ]
+
+        self.pads =  ["PVPlantPad",
+                      "Separator"
+                     ]
+
+        # Toolbar
+        self.appendToolbar("Civil", self.projectlist)  # creates a new toolbar with your commands
+        self.appendToolbar("PVPlant", self.framelist)  # creates a new toolbar with your commands
+        self.appendToolbar("Shadow", self.objectlist)  # creates a new toolbar with your commands
+        self.appendToolbar("Outputs", self.inportExportlist)  # creates a new toolbar with your commands
+        self.appendToolbar("Electrical", self.electricalList)  # creates a new toolbar with your commands
+
+        # Menu
+        self.appendMenu("&Civil", self.projectlist)  # creates a new menu
+        self.appendMenu("&PVPlant", self.framelist)  # creates a new menu
+        self.appendMenu("&Shadow", self.objectlist)  # creates a new menu
+        self.appendMenu("&Outputs", self.inportExportlist)  # creates a new menu
+        self.appendMenu("&Electrical", self.electricalList)  # creates a new menu
+
+        # Draft tools
+        from DraftTools import translate
+        self.drafttools = ["Draft_Line","Draft_Wire","Draft_Circle","Draft_Arc","Draft_Ellipse",
+                        "Draft_Polygon","Draft_Rectangle", "Draft_Text",
+                        "Draft_Dimension", "Draft_BSpline","Draft_Point",
+                        "Draft_Facebinder","Draft_BezCurve","Draft_Label"]
+        self.draftmodtools = ["Draft_Move","Draft_Rotate","Draft_Offset",
+                        "Draft_Trimex", "Draft_Upgrade", "Draft_Downgrade", "Draft_Scale",
+                        "Draft_Shape2DView","Draft_Draft2Sketch","Draft_Array",
+                        "Draft_Clone"]
+        self.draftextratools = ["Draft_WireToBSpline","Draft_ShapeString",
+                                "Draft_PathArray","Draft_Mirror","Draft_Stretch"]
+        self.draftcontexttools = ["Draft_ApplyStyle","Draft_ToggleDisplayMode","Draft_AddToGroup","Draft_AutoGroup",
+                            "Draft_SelectGroup","Draft_SelectPlane",
+                            "Draft_ShowSnapBar","Draft_ToggleGrid",]
+        self.draftutils = ["Draft_Heal","Draft_FlipDimension",
+                           "Draft_ToggleConstructionMode","Draft_ToggleContinueMode","Draft_Edit",
+                           "Draft_Slope","Draft_AddConstruction"]
+        self.snapList = ['Draft_Snap_Lock','Draft_Snap_Midpoint','Draft_Snap_Perpendicular',
+                         'Draft_Snap_Grid','Draft_Snap_Intersection','Draft_Snap_Parallel',
+                         'Draft_Snap_Endpoint','Draft_Snap_Angle','Draft_Snap_Center',
+                         'Draft_Snap_Extension','Draft_Snap_Near','Draft_Snap_Ortho','Draft_Snap_Special',
+                         'Draft_Snap_Dimensions','Draft_Snap_WorkingPlane']
+
+
+        def QT_TRANSLATE_NOOP(scope, text): return text
+        self.appendToolbar(QT_TRANSLATE_NOOP("Workbench", "Draft tools"), self.drafttools)
+        self.appendToolbar(QT_TRANSLATE_NOOP("Workbench", "Draft mod tools"), self.draftmodtools)
+        self.appendMenu(QT_TRANSLATE_NOOP("arch", "&Draft"), self.drafttools + self.draftmodtools + self.draftextratools)
+        self.appendMenu([QT_TRANSLATE_NOOP("arch", "&Draft"), QT_TRANSLATE_NOOP("arch", "Utilities")], self.draftutils + self.draftcontexttools)
+        self.appendMenu([QT_TRANSLATE_NOOP("arch", "&Draft"), QT_TRANSLATE_NOOP("arch", "Snapping")], self.snapList)
+
+        import Part
+        self.measureTools = ["Part_Measure_Linear",
+                             "Part_Measure_Angular",
+                             "Separator",
+                             "Part_Measure_Refresh",
+                             "Part_Measure_Clear_All",
+                             "Part_Measure_Toggle_All",
+                             "Part_Measure_Toggle_3D",
+                             "Part_Measure_Toggle_Delta"
+                             ]
+        self.appendToolbar("Medir", self.measureTools)
+        self.appendMenu("&Medir", self.measureTools)
+
+        self.observer = None
+
+        from widgets import CountSelection
+
+    def Activated(self):
+        "This function is executed when the workbench is activated"
+        import SelectionObserver
+        import FreeCADGui
+
+        self.observer = SelectionObserver.SelObserver()
+        FreeCADGui.Selection.addObserver(self.observer)  # installe la fonction en mode resident
+        return
+
+    def Deactivated(self):
+        "This function is executed when the workbench is deactivated"
+        FreeCADGui.Selection.removeObserver(self.observer)
+        return
+
+    def ContextMenu(self, recipient):
+        "This is executed whenever the user right-clicks on screen"
+        # "recipient" will be either "view" or "tree"
+
+        #if FreeCAD.activeDraftCommand is None:
+        if recipient.lower() == "view":
+            print("Menus en la 'View'")
+            #if FreeCAD.activeDraftCommand is None:
+            presel = FreeCADGui.Selection.getPreselection()
+            print(presel.SubElementNames, " - ", presel.PickedPoints)
+            if not presel is None:
+                if presel.Object.Proxy.Type == "Road":
+                    self.appendContextMenu("Road", self.roads)
+                elif presel.Object.Proxy.Type == "Pad":
+                    self.appendContextMenu("Pad", self.pads)
+
+        '''
+        self.contextMenu = QtGui.QMenu()
+        menu_item_remove_selected = self.contextMenu.addAction("Remove selected geometry")
+        menu_item_remove_all = self.contextMenu.addAction("Clear list")
+        if not self.references:
+            menu_item_remove_selected.setDisabled(True)
+            menu_item_remove_all.setDisabled(True)
+        self.connect(
+            menu_item_remove_selected,
+            QtCore.SIGNAL("triggered()"),
+            self.remove_selected_reference
+        )
+        self.connect(
+            menu_item_remove_all,
+            QtCore.SIGNAL("triggered()"),
+            self.remove_all_references
+        )
+        parentPosition = self.list_References.mapToGlobal(QtCore.QPoint(0, 0))
+        self.contextMenu.move(parentPosition + QPos)
+        self.contextMenu.show()
+        '''
+
+    def GetClassName(self): 
+        # this function is mandatory if this is a full python workbench
+        return "Gui::PythonWorkbench"
+
+
+Gui.addWorkbench(PVPlantWorkbench())

Mechanical/Frame/PVPlantFrame.ui

@@ -0,0 +1,877 @@
+<?xml version="1.0" encoding="UTF-8"?>
+<ui version="4.0">
+ <class>formRack</class>
+ <widget class="QDialog" name="formRack">
+  <property name="geometry">
+   <rect>
+    <x>0</x>
+    <y>0</y>
+    <width>476</width>
+    <height>1032</height>
+   </rect>
+  </property>
+  <property name="windowTitle">
+   <string>Fixed Frame:</string>
+  </property>
+  <layout class="QVBoxLayout" name="verticalLayout">
+   <property name="leftMargin">
+    <number>5</number>
+   </property>
+   <property name="topMargin">
+    <number>5</number>
+   </property>
+   <property name="rightMargin">
+    <number>5</number>
+   </property>
+   <property name="bottomMargin">
+    <number>5</number>
+   </property>
+   <item>
+    <widget class="QGroupBox" name="groupBox">
+     <property name="sizePolicy">
+      <sizepolicy hsizetype="Preferred" vsizetype="Fixed">
+       <horstretch>0</horstretch>
+       <verstretch>0</verstretch>
+      </sizepolicy>
+     </property>
+     <property name="title">
+      <string>Módulos:</string>
+     </property>
+     <layout class="QGridLayout" name="gridLayout">
+      <property name="leftMargin">
+       <number>5</number>
+      </property>
+      <property name="topMargin">
+       <number>5</number>
+      </property>
+      <property name="rightMargin">
+       <number>5</number>
+      </property>
+      <property name="bottomMargin">
+       <number>5</number>
+      </property>
+      <property name="horizontalSpacing">
+       <number>5</number>
+      </property>
+      <property name="verticalSpacing">
+       <number>2</number>
+      </property>
+      <item row="0" column="0">
+       <widget class="QLabel" name="label_9">
+        <property name="text">
+         <string>Altura (m)</string>
+        </property>
+       </widget>
+      </item>
+      <item row="0" column="1">
+       <widget class="QDoubleSpinBox" name="editModuleHeight">
+        <property name="sizePolicy">
+         <sizepolicy hsizetype="Fixed" vsizetype="Fixed">
+          <horstretch>0</horstretch>
+          <verstretch>0</verstretch>
+         </sizepolicy>
+        </property>
+        <property name="minimumSize">
+         <size>
+          <width>140</width>
+          <height>0</height>
+         </size>
+        </property>
+        <property name="alignment">
+         <set>Qt::AlignRight|Qt::AlignTrailing|Qt::AlignVCenter</set>
+        </property>
+        <property name="buttonSymbols">
+         <enum>QAbstractSpinBox::NoButtons</enum>
+        </property>
+        <property name="decimals">
+         <number>3</number>
+        </property>
+        <property name="maximum">
+         <double>5.000000000000000</double>
+        </property>
+        <property name="singleStep">
+         <double>0.010000000000000</double>
+        </property>
+        <property name="value">
+         <double>1.990000000000000</double>
+        </property>
+       </widget>
+      </item>
+      <item row="1" column="0">
+       <widget class="QLabel" name="label_10">
+        <property name="text">
+         <string>Largura (m)</string>
+        </property>
+       </widget>
+      </item>
+      <item row="1" column="1">
+       <widget class="QDoubleSpinBox" name="editModuleLenght">
+        <property name="sizePolicy">
+         <sizepolicy hsizetype="Fixed" vsizetype="Fixed">
+          <horstretch>0</horstretch>
+          <verstretch>0</verstretch>
+         </sizepolicy>
+        </property>
+        <property name="minimumSize">
+         <size>
+          <width>140</width>
+          <height>0</height>
+         </size>
+        </property>
+        <property name="alignment">
+         <set>Qt::AlignRight|Qt::AlignTrailing|Qt::AlignVCenter</set>
+        </property>
+        <property name="buttonSymbols">
+         <enum>QAbstractSpinBox::NoButtons</enum>
+        </property>
+        <property name="decimals">
+         <number>3</number>
+        </property>
+        <property name="maximum">
+         <double>5.000000000000000</double>
+        </property>
+        <property name="singleStep">
+         <double>0.010000000000000</double>
+        </property>
+        <property name="value">
+         <double>0.960000000000000</double>
+        </property>
+       </widget>
+      </item>
+      <item row="2" column="0">
+       <widget class="QLabel" name="label_11">
+        <property name="text">
+         <string>Anchura (m)</string>
+        </property>
+       </widget>
+      </item>
+      <item row="2" column="1">
+       <widget class="QDoubleSpinBox" name="editModuleWidth">
+        <property name="sizePolicy">
+         <sizepolicy hsizetype="Fixed" vsizetype="Fixed">
+          <horstretch>0</horstretch>
+          <verstretch>0</verstretch>
+         </sizepolicy>
+        </property>
+        <property name="minimumSize">
+         <size>
+          <width>140</width>
+          <height>0</height>
+         </size>
+        </property>
+        <property name="alignment">
+         <set>Qt::AlignRight|Qt::AlignTrailing|Qt::AlignVCenter</set>
+        </property>
+        <property name="buttonSymbols">
+         <enum>QAbstractSpinBox::NoButtons</enum>
+        </property>
+        <property name="decimals">
+         <number>3</number>
+        </property>
+        <property name="maximum">
+         <double>0.100000000000000</double>
+        </property>
+        <property name="singleStep">
+         <double>0.010000000000000</double>
+        </property>
+        <property name="value">
+         <double>0.030000000000000</double>
+        </property>
+       </widget>
+      </item>
+      <item row="3" column="0">
+       <widget class="QLabel" name="label_12">
+        <property name="text">
+         <string>Potencia (wp)</string>
+        </property>
+       </widget>
+      </item>
+      <item row="3" column="1">
+       <widget class="QSpinBox" name="editModulePower">
+        <property name="sizePolicy">
+         <sizepolicy hsizetype="Fixed" vsizetype="Fixed">
+          <horstretch>0</horstretch>
+          <verstretch>0</verstretch>
+         </sizepolicy>
+        </property>
+        <property name="minimumSize">
+         <size>
+          <width>140</width>
+          <height>0</height>
+         </size>
+        </property>
+        <property name="alignment">
+         <set>Qt::AlignRight|Qt::AlignTrailing|Qt::AlignVCenter</set>
+        </property>
+        <property name="buttonSymbols">
+         <enum>QAbstractSpinBox::NoButtons</enum>
+        </property>
+        <property name="minimum">
+         <number>150</number>
+        </property>
+        <property name="maximum">
+         <number>1000</number>
+        </property>
+        <property name="singleStep">
+         <number>5</number>
+        </property>
+        <property name="value">
+         <number>350</number>
+        </property>
+       </widget>
+      </item>
+     </layout>
+    </widget>
+   </item>
+   <item>
+    <widget class="QGroupBox" name="groupBox_2">
+     <property name="title">
+      <string>Estructura</string>
+     </property>
+     <layout class="QGridLayout" name="gridLayout_3">
+      <item row="3" column="0">
+       <widget class="QLabel" name="label_2">
+        <property name="text">
+         <string>Columnas (un)</string>
+        </property>
+       </widget>
+      </item>
+      <item row="6" column="1">
+       <widget class="QDoubleSpinBox" name="editFrontHeight">
+        <property name="sizePolicy">
+         <sizepolicy hsizetype="Fixed" vsizetype="Fixed">
+          <horstretch>0</horstretch>
+          <verstretch>0</verstretch>
+         </sizepolicy>
+        </property>
+        <property name="minimumSize">
+         <size>
+          <width>140</width>
+          <height>0</height>
+         </size>
+        </property>
+        <property name="alignment">
+         <set>Qt::AlignRight|Qt::AlignTrailing|Qt::AlignVCenter</set>
+        </property>
+        <property name="buttonSymbols">
+         <enum>QAbstractSpinBox::NoButtons</enum>
+        </property>
+        <property name="maximum">
+         <double>5.000000000000000</double>
+        </property>
+        <property name="singleStep">
+         <double>0.100000000000000</double>
+        </property>
+        <property name="value">
+         <double>0.800000000000000</double>
+        </property>
+       </widget>
+      </item>
+      <item row="1" column="0">
+       <widget class="QLabel" name="label_5">
+        <property name="text">
+         <string>Orientación del módulo</string>
+        </property>
+       </widget>
+      </item>
+      <item row="5" column="1">
+       <widget class="QDoubleSpinBox" name="editVerticalGap">
+        <property name="sizePolicy">
+         <sizepolicy hsizetype="Fixed" vsizetype="Fixed">
+          <horstretch>0</horstretch>
+          <verstretch>0</verstretch>
+         </sizepolicy>
+        </property>
+        <property name="minimumSize">
+         <size>
+          <width>140</width>
+          <height>0</height>
+         </size>
+        </property>
+        <property name="alignment">
+         <set>Qt::AlignRight|Qt::AlignTrailing|Qt::AlignVCenter</set>
+        </property>
+        <property name="buttonSymbols">
+         <enum>QAbstractSpinBox::NoButtons</enum>
+        </property>
+        <property name="maximum">
+         <double>0.900000000000000</double>
+        </property>
+        <property name="singleStep">
+         <double>0.010000000000000</double>
+        </property>
+        <property name="value">
+         <double>0.020000000000000</double>
+        </property>
+       </widget>
+      </item>
+      <item row="2" column="1">
+       <widget class="QSpinBox" name="editRows">
+        <property name="sizePolicy">
+         <sizepolicy hsizetype="Fixed" vsizetype="Fixed">
+          <horstretch>0</horstretch>
+          <verstretch>0</verstretch>
+         </sizepolicy>
+        </property>
+        <property name="minimumSize">
+         <size>
+          <width>140</width>
+          <height>0</height>
+         </size>
+        </property>
+        <property name="alignment">
+         <set>Qt::AlignRight|Qt::AlignTrailing|Qt::AlignVCenter</set>
+        </property>
+        <property name="buttonSymbols">
+         <enum>QAbstractSpinBox::NoButtons</enum>
+        </property>
+        <property name="minimum">
+         <number>1</number>
+        </property>
+       </widget>
+      </item>
+      <item row="0" column="1">
+       <widget class="QComboBox" name="comboFrameType">
+        <property name="sizePolicy">
+         <sizepolicy hsizetype="Fixed" vsizetype="Fixed">
+          <horstretch>0</horstretch>
+          <verstretch>0</verstretch>
+         </sizepolicy>
+        </property>
+        <property name="minimumSize">
+         <size>
+          <width>140</width>
+          <height>0</height>
+         </size>
+        </property>
+        <item>
+         <property name="text">
+          <string>Fija</string>
+         </property>
+        </item>
+        <item>
+         <property name="text">
+          <string>Tracker 1 Eje</string>
+         </property>
+        </item>
+       </widget>
+      </item>
+      <item row="7" column="1">
+       <widget class="QDoubleSpinBox" name="editLeftOffset">
+        <property name="sizePolicy">
+         <sizepolicy hsizetype="Fixed" vsizetype="Fixed">
+          <horstretch>0</horstretch>
+          <verstretch>0</verstretch>
+         </sizepolicy>
+        </property>
+        <property name="minimumSize">
+         <size>
+          <width>140</width>
+          <height>0</height>
+         </size>
+        </property>
+        <property name="alignment">
+         <set>Qt::AlignRight|Qt::AlignTrailing|Qt::AlignVCenter</set>
+        </property>
+        <property name="buttonSymbols">
+         <enum>QAbstractSpinBox::NoButtons</enum>
+        </property>
+        <property name="maximum">
+         <double>0.900000000000000</double>
+        </property>
+        <property name="singleStep">
+         <double>0.010000000000000</double>
+        </property>
+        <property name="value">
+         <double>0.050000000000000</double>
+        </property>
+       </widget>
+      </item>
+      <item row="12" column="0">
+       <widget class="QLabel" name="label_18">
+        <property name="text">
+         <string>Offset borde derecha (m)</string>
+        </property>
+       </widget>
+      </item>
+      <item row="14" column="0">
+       <widget class="QLabel" name="label_3">
+        <property name="text">
+         <string>Ángulo de inclinación (º)</string>
+        </property>
+       </widget>
+      </item>
+      <item row="12" column="1">
+       <widget class="QDoubleSpinBox" name="editRightOffset">
+        <property name="sizePolicy">
+         <sizepolicy hsizetype="Fixed" vsizetype="Fixed">
+          <horstretch>0</horstretch>
+          <verstretch>0</verstretch>
+         </sizepolicy>
+        </property>
+        <property name="minimumSize">
+         <size>
+          <width>140</width>
+          <height>0</height>
+         </size>
+        </property>
+        <property name="alignment">
+         <set>Qt::AlignRight|Qt::AlignTrailing|Qt::AlignVCenter</set>
+        </property>
+        <property name="buttonSymbols">
+         <enum>QAbstractSpinBox::NoButtons</enum>
+        </property>
+        <property name="maximum">
+         <double>0.900000000000000</double>
+        </property>
+        <property name="singleStep">
+         <double>0.010000000000000</double>
+        </property>
+        <property name="value">
+         <double>0.050000000000000</double>
+        </property>
+       </widget>
+      </item>
+      <item row="14" column="1">
+       <widget class="QSpinBox" name="editTilt">
+        <property name="sizePolicy">
+         <sizepolicy hsizetype="Fixed" vsizetype="Fixed">
+          <horstretch>0</horstretch>
+          <verstretch>0</verstretch>
+         </sizepolicy>
+        </property>
+        <property name="minimumSize">
+         <size>
+          <width>140</width>
+          <height>0</height>
+         </size>
+        </property>
+        <property name="alignment">
+         <set>Qt::AlignRight|Qt::AlignTrailing|Qt::AlignVCenter</set>
+        </property>
+        <property name="buttonSymbols">
+         <enum>QAbstractSpinBox::NoButtons</enum>
+        </property>
+        <property name="minimum">
+         <number>1</number>
+        </property>
+        <property name="maximum">
+         <number>60</number>
+        </property>
+       </widget>
+      </item>
+      <item row="15" column="1">
+       <widget class="QSpinBox" name="editInclination">
+        <property name="sizePolicy">
+         <sizepolicy hsizetype="Fixed" vsizetype="Fixed">
+          <horstretch>0</horstretch>
+          <verstretch>0</verstretch>
+         </sizepolicy>
+        </property>
+        <property name="minimumSize">
+         <size>
+          <width>140</width>
+          <height>0</height>
+         </size>
+        </property>
+        <property name="alignment">
+         <set>Qt::AlignRight|Qt::AlignTrailing|Qt::AlignVCenter</set>
+        </property>
+        <property name="buttonSymbols">
+         <enum>QAbstractSpinBox::NoButtons</enum>
+        </property>
+        <property name="minimum">
+         <number>1</number>
+        </property>
+        <property name="maximum">
+         <number>60</number>
+        </property>
+       </widget>
+      </item>
+      <item row="2" column="0">
+       <widget class="QLabel" name="label">
+        <property name="text">
+         <string>Filas (un)</string>
+        </property>
+       </widget>
+      </item>
+      <item row="6" column="0">
+       <widget class="QLabel" name="label_8">
+        <property name="text">
+         <string>Distancia al suelo en el frente (m)</string>
+        </property>
+       </widget>
+      </item>
+      <item row="3" column="1">
+       <widget class="QSpinBox" name="editCols">
+        <property name="sizePolicy">
+         <sizepolicy hsizetype="Fixed" vsizetype="Fixed">
+          <horstretch>0</horstretch>
+          <verstretch>0</verstretch>
+         </sizepolicy>
+        </property>
+        <property name="minimumSize">
+         <size>
+          <width>140</width>
+          <height>0</height>
+         </size>
+        </property>
+        <property name="alignment">
+         <set>Qt::AlignRight|Qt::AlignTrailing|Qt::AlignVCenter</set>
+        </property>
+        <property name="buttonSymbols">
+         <enum>QAbstractSpinBox::NoButtons</enum>
+        </property>
+        <property name="minimum">
+         <number>20</number>
+        </property>
+       </widget>
+      </item>
+      <item row="5" column="0">
+       <widget class="QLabel" name="labelVerticalGap">
+        <property name="text">
+         <string>Separación vertical entre módulos (m)</string>
+        </property>
+       </widget>
+      </item>
+      <item row="1" column="1">
+       <widget class="QComboBox" name="comboModuleOrientation">
+        <property name="sizePolicy">
+         <sizepolicy hsizetype="Fixed" vsizetype="Fixed">
+          <horstretch>0</horstretch>
+          <verstretch>0</verstretch>
+         </sizepolicy>
+        </property>
+        <property name="minimumSize">
+         <size>
+          <width>140</width>
+          <height>0</height>
+         </size>
+        </property>
+        <item>
+         <property name="text">
+          <string>Landscape</string>
+         </property>
+        </item>
+        <item>
+         <property name="text">
+          <string>Portrait</string>
+         </property>
+        </item>
+       </widget>
+      </item>
+      <item row="4" column="0">
+       <widget class="QLabel" name="label_4">
+        <property name="text">
+         <string>Separación horizontal entre módulos (m)</string>
+        </property>
+       </widget>
+      </item>
+      <item row="15" column="0">
+       <widget class="QLabel" name="label_7">
+        <property name="text">
+         <string>Ängulo máximo de inclinación longitudinal (ª)</string>
+        </property>
+       </widget>
+      </item>
+      <item row="4" column="1">
+       <widget class="QDoubleSpinBox" name="editHorizontalGap">
+        <property name="sizePolicy">
+         <sizepolicy hsizetype="Fixed" vsizetype="Fixed">
+          <horstretch>0</horstretch>
+          <verstretch>0</verstretch>
+         </sizepolicy>
+        </property>
+        <property name="minimumSize">
+         <size>
+          <width>140</width>
+          <height>0</height>
+         </size>
+        </property>
+        <property name="alignment">
+         <set>Qt::AlignRight|Qt::AlignTrailing|Qt::AlignVCenter</set>
+        </property>
+        <property name="buttonSymbols">
+         <enum>QAbstractSpinBox::NoButtons</enum>
+        </property>
+        <property name="maximum">
+         <double>0.900000000000000</double>
+        </property>
+        <property name="singleStep">
+         <double>0.010000000000000</double>
+        </property>
+        <property name="value">
+         <double>0.020000000000000</double>
+        </property>
+       </widget>
+      </item>
+      <item row="0" column="0">
+       <widget class="QLabel" name="label_6">
+        <property name="text">
+         <string>Tipo de estructura</string>
+        </property>
+       </widget>
+      </item>
+      <item row="7" column="0">
+       <widget class="QLabel" name="label_17">
+        <property name="text">
+         <string>Offset borde izquierda (m)</string>
+        </property>
+       </widget>
+      </item>
+      <item row="16" column="0" colspan="2">
+       <widget class="QWidget" name="widgetTracker" native="true">
+        <layout class="QGridLayout" name="gridLayout_4">
+         <property name="leftMargin">
+          <number>0</number>
+         </property>
+         <property name="topMargin">
+          <number>0</number>
+         </property>
+         <property name="rightMargin">
+          <number>0</number>
+         </property>
+         <property name="bottomMargin">
+          <number>0</number>
+         </property>
+         <property name="spacing">
+          <number>5</number>
+         </property>
+         <item row="2" column="0">
+          <widget class="QLabel" name="labelVerticalGap_2">
+           <property name="text">
+            <string>Separación entre uniones (m)</string>
+           </property>
+          </widget>
+         </item>
+         <item row="0" column="0">
+          <widget class="QCheckBox" name="checkBox">
+           <property name="text">
+            <string>Separación Motor (m)</string>
+           </property>
+          </widget>
+         </item>
+         <item row="1" column="1">
+          <widget class="QSpinBox" name="editInternalGapNumber">
+           <property name="sizePolicy">
+            <sizepolicy hsizetype="Fixed" vsizetype="Fixed">
+             <horstretch>0</horstretch>
+             <verstretch>0</verstretch>
+            </sizepolicy>
+           </property>
+           <property name="minimumSize">
+            <size>
+             <width>140</width>
+             <height>0</height>
+            </size>
+           </property>
+           <property name="alignment">
+            <set>Qt::AlignRight|Qt::AlignTrailing|Qt::AlignVCenter</set>
+           </property>
+           <property name="buttonSymbols">
+            <enum>QAbstractSpinBox::NoButtons</enum>
+           </property>
+           <property name="minimum">
+            <number>0</number>
+           </property>
+           <property name="maximum">
+            <number>6</number>
+           </property>
+           <property name="value">
+            <number>0</number>
+           </property>
+          </widget>
+         </item>
+         <item row="1" column="0">
+          <widget class="QLabel" name="label_19">
+           <property name="text">
+            <string>Número de uniones</string>
+           </property>
+          </widget>
+         </item>
+         <item row="2" column="1">
+          <widget class="QDoubleSpinBox" name="editInternalGap">
+           <property name="sizePolicy">
+            <sizepolicy hsizetype="Fixed" vsizetype="Fixed">
+             <horstretch>0</horstretch>
+             <verstretch>0</verstretch>
+            </sizepolicy>
+           </property>
+           <property name="minimumSize">
+            <size>
+             <width>140</width>
+             <height>0</height>
+            </size>
+           </property>
+           <property name="alignment">
+            <set>Qt::AlignRight|Qt::AlignTrailing|Qt::AlignVCenter</set>
+           </property>
+           <property name="buttonSymbols">
+            <enum>QAbstractSpinBox::NoButtons</enum>
+           </property>
+           <property name="maximum">
+            <double>0.900000000000000</double>
+           </property>
+           <property name="singleStep">
+            <double>0.010000000000000</double>
+           </property>
+           <property name="value">
+            <double>0.020000000000000</double>
+           </property>
+          </widget>
+         </item>
+         <item row="0" column="1">
+          <widget class="QDoubleSpinBox" name="editMotorGap">
+           <property name="sizePolicy">
+            <sizepolicy hsizetype="Fixed" vsizetype="Fixed">
+             <horstretch>0</horstretch>
+             <verstretch>0</verstretch>
+            </sizepolicy>
+           </property>
+           <property name="minimumSize">
+            <size>
+             <width>140</width>
+             <height>0</height>
+            </size>
+           </property>
+           <property name="alignment">
+            <set>Qt::AlignRight|Qt::AlignTrailing|Qt::AlignVCenter</set>
+           </property>
+           <property name="buttonSymbols">
+            <enum>QAbstractSpinBox::NoButtons</enum>
+           </property>
+           <property name="maximum">
+            <double>0.900000000000000</double>
+           </property>
+           <property name="singleStep">
+            <double>0.010000000000000</double>
+           </property>
+           <property name="value">
+            <double>0.020000000000000</double>
+           </property>
+          </widget>
+         </item>
+        </layout>
+       </widget>
+      </item>
+     </layout>
+    </widget>
+   </item>
+   <item>
+    <widget class="QGroupBox" name="groupBox_3">
+     <property name="title">
+      <string>Resultado</string>
+     </property>
+     <layout class="QGridLayout" name="gridLayout_2">
+      <item row="0" column="0">
+       <widget class="QLabel" name="label_13">
+        <property name="text">
+         <string>Total de módulos</string>
+        </property>
+       </widget>
+      </item>
+      <item row="0" column="1">
+       <widget class="QLineEdit" name="editTotalModules">
+        <property name="sizePolicy">
+         <sizepolicy hsizetype="Fixed" vsizetype="Fixed">
+          <horstretch>0</horstretch>
+          <verstretch>0</verstretch>
+         </sizepolicy>
+        </property>
+        <property name="minimumSize">
+         <size>
+          <width>140</width>
+          <height>0</height>
+         </size>
+        </property>
+        <property name="readOnly">
+         <bool>true</bool>
+        </property>
+       </widget>
+      </item>
+      <item row="1" column="0">
+       <widget class="QLabel" name="label_14">
+        <property name="text">
+         <string>Potencia total (wp)</string>
+        </property>
+       </widget>
+      </item>
+      <item row="1" column="1">
+       <widget class="QLineEdit" name="editTotalPower">
+        <property name="sizePolicy">
+         <sizepolicy hsizetype="Fixed" vsizetype="Fixed">
+          <horstretch>0</horstretch>
+          <verstretch>0</verstretch>
+         </sizepolicy>
+        </property>
+        <property name="minimumSize">
+         <size>
+          <width>140</width>
+          <height>0</height>
+         </size>
+        </property>
+        <property name="readOnly">
+         <bool>true</bool>
+        </property>
+       </widget>
+      </item>
+      <item row="2" column="0">
+       <widget class="QLabel" name="label_15">
+        <property name="text">
+         <string>Longitud (m)</string>
+        </property>
+       </widget>
+      </item>
+      <item row="2" column="1">
+       <widget class="QLineEdit" name="editTotalLength">
+        <property name="sizePolicy">
+         <sizepolicy hsizetype="Fixed" vsizetype="Fixed">
+          <horstretch>0</horstretch>
+          <verstretch>0</verstretch>
+         </sizepolicy>
+        </property>
+        <property name="minimumSize">
+         <size>
+          <width>140</width>
+          <height>0</height>
+         </size>
+        </property>
+        <property name="readOnly">
+         <bool>true</bool>
+        </property>
+       </widget>
+      </item>
+      <item row="3" column="0">
+       <widget class="QLabel" name="label_16">
+        <property name="text">
+         <string>Anchura (m)</string>
+        </property>
+       </widget>
+      </item>
+      <item row="3" column="1">
+       <widget class="QLineEdit" name="editTotalWidth">
+        <property name="sizePolicy">
+         <sizepolicy hsizetype="Fixed" vsizetype="Fixed">
+          <horstretch>0</horstretch>
+          <verstretch>0</verstretch>
+         </sizepolicy>
+        </property>
+        <property name="minimumSize">
+         <size>
+          <width>140</width>
+          <height>0</height>
+         </size>
+        </property>
+        <property name="readOnly">
+         <bool>true</bool>
+        </property>
+       </widget>
+      </item>
+     </layout>
+    </widget>
+   </item>
+  </layout>
+ </widget>
+ <resources/>
+ <connections/>
+</ui>

MeshTools/MeshGetBoundary.py

@@ -0,0 +1,31 @@
+def get_boundary(mesh):  # From trails
+    """ Create triangulation boundary """
+    import Part
+    import itertools as itools
+    from collections import Counter
+    from ast import literal_eval
+
+    facet_pidx = mesh.Topology[1]
+    edges = itools.chain(*(itools.permutations(pidx, 2) for pidx in facet_pidx))
+    count = Counter((str(edge) for edge in edges))
+    double_boundary = list((literal_eval(k) for k, v in count.items() if v == 1))
+
+    boundary = double_boundary[:1]
+    for candidate in double_boundary[1:]:
+        if candidate in boundary or candidate[::-1] in boundary:
+            pass
+        else:
+            boundary.append(candidate)
+
+    def mkEdge(p1, p2):
+        return Part.makeLine((p1.x, p1.y, p1.z), (p2.x, p2.y, p2.z))
+
+    points = mesh.Points
+    edges = []
+    for p1, p2 in boundary:
+        edges.append(mkEdge(points[p1], points[p2]))
+
+    wires = []
+    for opening in Part.sortEdges(edges):
+        wires.append(Part.Wire(opening))
+    return Part.makeCompound(wires)

MeshTools/Triangulation.py

@@ -0,0 +1,92 @@
+import FreeCAD
+import math
+
+
+def Triangulate(points, MaxlengthLE = 8000, MaxAngleLE = math.pi, use3d=True):
+    import numpy as np
+    from scipy.spatial import Delaunay
+    from stl import mesh as stlmesh
+    import Mesh
+
+    if points.__class__ is list:
+        points = np.array(points)
+
+    tri = Delaunay(points[:, :2])
+    faces = tri.simplices
+    wireframe = stlmesh.Mesh(np.zeros(faces.shape[0], dtype=stlmesh.Mesh.dtype))
+
+    for i, f in enumerate(faces):
+        if MaxLength(points[f[0]], points[f[1]], points[f[2]], MaxlengthLE) and \
+           MaxAngle(points[f[0]], points[f[1]], points[f[2]], MaxAngleLE):
+            for j in range(3):
+                wireframe.vectors[i][j] = points[f[j], :]
+                if not use3d:
+                    wireframe.vectors[i][j][2] = 0
+
+    MeshObject = Mesh.Mesh(wireframe.vectors.tolist())
+    if len(MeshObject.Facets) == 0:
+        return None
+    MeshObject.harmonizeNormals()
+    if MeshObject.Facets[0].Normal.z < 0:
+        MeshObject.flipNormals()
+    return MeshObject
+
+
+def MaxLength(P1, P2, P3, MaxlengthLE):
+    """ Calculation of the 2D length between triangle edges """
+    p1 = FreeCAD.Vector(P1[0], P1[1], 0)
+    p2 = FreeCAD.Vector(P2[0], P2[1], 0)
+    p3 = FreeCAD.Vector(P3[0], P3[1], 0)
+
+    List = [[p1, p2], [p2, p3], [p3, p1]]
+    for i, j in List:
+        vec = i.sub(j)
+        if vec.Length > MaxlengthLE:
+            return False
+    return True
+
+
+def MaxAngle(P1, P2, P3, MaxAngleLE):
+    """ Calculation of the 2D angle between triangle edges """
+    p1 = FreeCAD.Vector(P1[0], P1[1], 0)
+    p2 = FreeCAD.Vector(P2[0], P2[1], 0)
+    p3 = FreeCAD.Vector(P3[0], P3[1], 0)
+    List = [[p1, p2, p3], [p2, p3, p1], [p3, p1, p2]]
+    for j, k, l in List:
+        vec1 = j.sub(k)
+        vec2 = l.sub(k)
+        radian = vec1.getAngle(vec2)
+        if radian > MaxAngleLE:
+            return False
+    return True
+
+
+# prueba para ver si es mejor:
+def Open3DTriangle(point_cloud):
+    import numpy as np
+    import open3d as o3d
+
+    '''
+    input_path = "your_path_to_file/"
+    output_path = "your_path_to_output_folder/"
+    dataname = "sample.xyz"
+    point_cloud = np.loadtxt(input_path + dataname, skiprows=1)
+    '''
+
+    pcd = o3d.geometry.PointCloud()
+    pcd.points = o3d.utility.Vector3dVector(point_cloud)
+
+    pcd.normals = o3d.utility.Vector3dVector(np.zeros((1, 3)))
+    pcd.estimate_normals()
+    pcd.orient_normals_consistent_tangent_plane(100)
+
+    mesh, densities = o3d.geometry.TriangleMesh.create_from_point_cloud_poisson(pcd,
+                                                                             depth=8,
+                                                                             width=0,
+                                                                             scale=1.1,
+                                                                             linear_fit=False,
+                                                                             n_threads=8)
+    o3d.visualization.draw_geometries([mesh])
+    #bbox = pcd.get_axis_aligned_bounding_box()
+    #p_mesh_crop = mesh.crop(bbox)
+    return mesh

PVPLantPlacement-old.py

@@ -0,0 +1,554 @@
+import ArchComponent
+import FreeCAD
+
+if FreeCAD.GuiUp:
+    import FreeCADGui
+    from PySide import QtCore, QtGui
+    from PySide.QtCore import QT_TRANSLATE_NOOP
+else:
+    # \cond
+    def translate(ctxt, txt):
+        return txt
+
+
+    def QT_TRANSLATE_NOOP(ctxt, txt):
+        return txt
+    # \endcond
+
+try:
+    _fromUtf8 = QtCore.QString.fromUtf8
+except AttributeError:
+    def _fromUtf8(s):
+        return s
+
+import threading
+
+
+def makePlacement(baseobj=None, diameter=0, length=0, placement=None, name="Placement"):
+    "makePipe([baseobj,diamerter,length,placement,name]): creates an pipe object from the given base object"
+
+    if not FreeCAD.ActiveDocument:
+        FreeCAD.Console.PrintError("No active document. Aborting\n")
+        return
+
+    obj = FreeCAD.ActiveDocument.addObject("Part::FeaturePython", name)
+    obj.Label = name
+    _PVPlantPlacement(obj)
+
+    if FreeCAD.GuiUp:
+        _ViewProviderPVPlantPlacement(obj.ViewObject)
+        if baseobj:
+            baseobj.ViewObject.hide()
+
+    return obj
+
+
+class _CommandPVPlantPlacement:
+    "the Arch Schedule command definition"
+
+    def GetResources(self):
+        return {'Pixmap': 'Placement',
+                'Accel': "P, S",
+                'MenuText': QT_TRANSLATE_NOOP("Placement", "Placement"),
+                'ToolTip': QT_TRANSLATE_NOOP("Placement", "Crear un campo fotovoltaico")}
+
+    def Activated(self):
+        taskd = _PVPlantPlacementTaskPanel()
+        FreeCADGui.Control.showDialog(taskd)
+
+    def IsActive(self):
+        if FreeCAD.ActiveDocument:
+            return True
+        else:
+            return False
+
+
+class _PVPlantPlacement(ArchComponent.Component):
+    "the PVPlantPlacement object"
+
+    def __init__(self, obj):
+
+        ArchComponent.Component.__init__(self, obj)
+        self.setProperties(obj)
+        # Does a IfcType exist?
+        # obj.IfcType = "Fence"
+        obj.MoveWithHost = False
+
+    def setProperties(self, obj):
+        ArchComponent.Component.setProperties(self, obj)
+
+        pl = obj.PropertiesList
+
+        if not "Section" in pl:
+            obj.addProperty("App::PropertyLink", "Land", "Placement", QT_TRANSLATE_NOOP(
+                "App::Property", "A single section of the fence"))
+
+        if not "Post" in pl:
+            obj.addProperty("App::PropertyLink", "Structure", "Placement", QT_TRANSLATE_NOOP(
+                "App::Property", "A single fence post"))
+
+        if not "Path" in pl:
+            obj.addProperty("App::PropertyLink", "Path", "Placement", QT_TRANSLATE_NOOP(
+                "App::Property", "The Path the fence should follow"))
+
+        if not "NumberOfSections" in pl:
+            obj.addProperty("App::PropertyInteger", "NumberOfSections", "Count", QT_TRANSLATE_NOOP(
+                "App::Property", "The number of sections the fence is built of"))
+            obj.setEditorMode("NumberOfSections", 1)
+
+        if not "NumberOfPosts" in pl:
+            obj.addProperty("App::PropertyInteger", "NumberOfPosts", "Count", QT_TRANSLATE_NOOP(
+                "App::Property", "The number of posts used to build the fence"))
+            obj.setEditorMode("NumberOfPosts", 1)
+
+        self.Type = "Fence"
+
+    def execute(self, obj):
+        # fills columns A, B and C of the spreadsheet
+        if not obj.Description:
+            return
+
+    def __getstate__(self):
+        return self.Type
+
+    def __setstate__(self, state):
+        if state:
+            self.Type = state
+
+
+class _ViewProviderPVPlantPlacement:
+    "A View Provider for PVPlantPlacement"
+
+    def __init__(self, vobj):
+        vobj.Proxy = self
+
+    def getIcon(self):
+        return ":/icons/Arch_Schedule.svg"
+
+    def attach(self, vobj):
+        self.Object = vobj.Object
+
+    def setEdit(self, vobj, mode):
+        # taskd = _ArchScheduleTaskPanel(vobj.Object)
+        # FreeCADGui.Control.showDialog(taskd)
+        return True
+
+    def doubleClicked(self, vobj):
+        # taskd = _ArchScheduleTaskPanel(vobj.Object)
+        # FreeCADGui.Control.showDialog(taskd)
+        return True
+
+    def unsetEdit(self, vobj, mode):
+        # FreeCADGui.Control.closeDialog()
+        return
+
+    def claimChildren(self):
+        # if hasattr(self,"Object"):
+        #    return [self.Object.Result]
+        return None
+
+    def __getstate__(self):
+        return None
+
+    def __setstate__(self, state):
+        return None
+
+    def getDisplayModes(self, vobj):
+        return ["Default"]
+
+    def getDefaultDisplayMode(self):
+        return "Default"
+
+    def setDisplayMode(self, mode):
+        return mode
+
+
+class _PVPlantPlacementTaskPanel:
+    '''The editmode TaskPanel for Schedules'''
+
+    def __init__(self, obj=None):
+        self.Terrain = None
+        self.Rack = None
+        self.Gap = 200
+        self.Pitch = 4500
+
+        # form:
+        self.form = QtGui.QWidget()
+        self.form.resize(800, 640)
+        self.form.setWindowTitle("Curvas de nivel")
+        self.form.setWindowIcon(QtGui.QIcon(":/icons/Arch_Schedule.svg"))
+        self.grid = QtGui.QGridLayout(self.form)
+
+        # parameters
+        self.labelTerrain = QtGui.QLabel()
+        self.labelTerrain.setText("Terreno:")
+        self.lineTerrain = QtGui.QLineEdit(self.form)
+        self.lineTerrain.setObjectName(_fromUtf8("lineTerrain"))
+        self.lineTerrain.readOnly = True
+        self.grid.addWidget(self.labelTerrain, self.grid.rowCount(), 0, 1, 1)
+        self.grid.addWidget(self.lineTerrain, self.grid.rowCount() - 1, 1, 1, 1)
+        self.buttonAddTerrain = QtGui.QPushButton('Sel')
+        self.grid.addWidget(self.buttonAddTerrain, self.grid.rowCount() - 1, 2, 1, 1)
+
+        self.labelRack = QtGui.QLabel()
+        self.labelRack.setText("Rack:")
+        self.lineRack = QtGui.QLineEdit(self.form)
+        self.lineRack.setObjectName(_fromUtf8("lineRack"))
+        self.lineRack.readOnly = True
+        self.grid.addWidget(self.labelRack, self.grid.rowCount(), 0, 1, 1)
+        self.grid.addWidget(self.lineRack, self.grid.rowCount() - 1, 1, 1, 1)
+        self.buttonAddRack = QtGui.QPushButton('Sel')
+        self.grid.addWidget(self.buttonAddRack, self.grid.rowCount() - 1, 2, 1, 1)
+
+        self.line1 = QtGui.QFrame()
+        self.line1.setFrameShape(QtGui.QFrame.HLine)
+        self.line1.setFrameShadow(QtGui.QFrame.Sunken)
+        self.grid.addWidget(self.line1, self.grid.rowCount(), 0, 1, -1)
+
+        self.labelTypeStructure = QtGui.QLabel()
+        self.labelTypeStructure.setText("Tipo de estructura:")
+        self.valueTypeStructure = QtGui.QComboBox()
+        self.valueTypeStructure.addItems(["Fixed", "Tracker 1 Axis"])
+        self.valueTypeStructure.setCurrentIndex(0)
+        self.grid.addWidget(self.labelTypeStructure, self.grid.rowCount(), 0, 1, 1)
+        self.grid.addWidget(self.valueTypeStructure, self.grid.rowCount() - 1, 1, 1, -1)
+
+        self.labelOrientation = QtGui.QLabel()
+        self.labelOrientation.setText("Orientacion:")
+        self.valueOrientation = QtGui.QComboBox()
+        self.valueOrientation.addItems(["Norte-Sur", "Este-Oeste"])
+        self.valueOrientation.setCurrentIndex(0)
+        self.grid.addWidget(self.labelOrientation, self.grid.rowCount(), 0, 1, 1)
+        self.grid.addWidget(self.valueOrientation, self.grid.rowCount() - 1, 1, 1, -1)
+
+        self.labelGap = QtGui.QLabel()
+        self.labelGap.setText("Espacio entre Columnas:")
+        self.valueGap = FreeCADGui.UiLoader().createWidget("Gui::InputField")
+        self.valueGap.setText(str(self.Gap) + " mm")
+        self.grid.addWidget(self.labelGap, self.grid.rowCount(), 0, 1, 1)
+        self.grid.addWidget(self.valueGap, self.grid.rowCount() - 1, 1, 1, -1)
+
+        self.labelPitch = QtGui.QLabel()
+        self.labelPitch.setText("Separacion entre Filas:")
+        self.valuePitch = FreeCADGui.UiLoader().createWidget("Gui::InputField")
+        self.valuePitch.setText(str(self.Pitch) + " mm")
+        self.grid.addWidget(self.labelPitch, self.grid.rowCount(), 0, 1, 1)
+        self.grid.addWidget(self.valuePitch, self.grid.rowCount() - 1, 1, 1, -1)
+
+        self.labelAlign = QtGui.QLabel()
+        self.labelAlign.setText("Método de alineación:")
+        self.valueAlign = QtGui.QComboBox()
+        self.valueAlign.addItems(["Si", "No"])
+        self.valueAlign.setCurrentIndex(0)
+        self.grid.addWidget(self.labelAlign, self.grid.rowCount(), 0, 1, 1)
+        self.grid.addWidget(self.valueAlign, self.grid.rowCount() - 1, 1, 1, -1)
+
+        self.line2 = QtGui.QFrame()
+        self.line2.setFrameShape(QtGui.QFrame.HLine)
+        self.line2.setFrameShadow(QtGui.QFrame.Sunken)
+        self.grid.addWidget(self.line2, self.grid.rowCount(), 0, 1, -1)
+
+        self.labelSideSlope = QtGui.QLabel()
+        self.labelSideSlope.setText("Maxima inclinacion longitudinal:")
+        self.valueSideSlope = FreeCADGui.UiLoader().createWidget("Gui::InputField")
+        self.valueSideSlope.setText("15")
+        self.grid.addWidget(self.labelSideSlope, self.grid.rowCount(), 0, 1, 1)
+        self.grid.addWidget(self.valueSideSlope, self.grid.rowCount() - 1, 1, 1, -1)
+
+        QtCore.QObject.connect(self.buttonAddTerrain, QtCore.SIGNAL("clicked()"), self.addTerrain)
+        QtCore.QObject.connect(self.buttonAddRack, QtCore.SIGNAL("clicked()"), self.addRack)
+        # QtCore.QObject.connect(self.form.buttonDel, QtCore.SIGNAL("clicked()"), self.remove)
+        # QtCore.QObject.connect(self.form.buttonClear, QtCore.SIGNAL("clicked()"), self.clear)
+        # QtCore.QObject.connect(self.form.buttonSelect, QtCore.SIGNAL("clicked()"), self.select)
+
+    def addTerrain(self):
+        sel = FreeCADGui.Selection.getSelection()
+        if len(sel) > 0:
+            self.Terrain = sel[0]
+            self.lineTerrain.setText(self.Terrain.Label)
+
+    def addRack(self):
+        sel = FreeCADGui.Selection.getSelection()
+        if len(sel) > 0:
+            self.Rack = sel[0]
+            self.lineRack.setText(self.Rack.Label)
+
+    def accept(self):
+        if self.Terrain is not None and self.Rack is not None:
+            self.Gap = FreeCAD.Units.Quantity(self.valueGap.text()).Value
+            self.Pitch = FreeCAD.Units.Quantity(self.valuePitch.text()).Value
+            self.placement()
+        return True
+
+    def placement(self):
+        if self.valueTypeStructure.currentIndex() == 0:  # Fixed
+            print("Rack")
+        else:
+            print("Tracker")
+            if self.Rack.Height < self.Rack.Length:
+                print("rotar")
+                aux = self.Rack.Length
+                self.Rack.Length = self.Rack.Height
+                self.Rack.Height = aux
+
+        self.Rack.Placement.Base.x = self.Terrain.Shape.BoundBox.XMin
+        self.Rack.Placement.Base.y = self.Terrain.Shape.BoundBox.YMin
+
+        DistColls = self.Rack.Length.Value + self.Gap
+        DistRows = self.Rack.Height.Value + self.Pitch
+        area = self.Rack.Shape.Faces[0].Area  # * 0.999999999
+
+        import Draft
+        rec = Draft.makeRectangle(length=self.Terrain.Shape.BoundBox.XLength, height=self.Rack.Height, face=True,
+                                  support=None)
+        rec.Placement.Base.x = self.Terrain.Shape.BoundBox.XMin
+        rec.Placement.Base.y = self.Terrain.Shape.BoundBox.YMin
+
+        try:
+            while rec.Shape.BoundBox.YMax <= self.Terrain.Shape.BoundBox.YMax:
+                common = self.Terrain.Shape.common(rec.Shape)
+                for shape in common.Faces:
+                    if shape.Area >= area:
+                        if False:
+                            minorPoint = FreeCAD.Vector(0, 0, 0)
+                            for spoint in shape.OuterWire.Vertexes:
+                                if minorPoint.y >= spoint.Point.y:
+                                    if minorPoint.x >= spoint.x:
+                                        minorPoint = spoint
+                                        self.Rack.Placement.Base = spoint
+                        else:
+                            # más rápido
+                            self.Rack.Placement.Base.x = shape.BoundBox.XMin
+                            self.Rack.Placement.Base.y = shape.BoundBox.YMin
+
+                        while self.Rack.Shape.BoundBox.XMax <= shape.BoundBox.XMax:
+                            verts = [v.Point for v in rackClone.Shape.OuterWire.OrderedVertexes]
+                            inside = True
+                            for vert in verts:
+                                if not shape.isInside(vert, 0, True):
+                                    inside = False
+                                    break
+
+                            if inside:
+                                raise
+                            else:
+                                # ajuste fino hasta encontrar el primer sitio:
+                                rackClone.Placement.Base.x += 100  # un metro
+
+                            '''old version
+                            common1 = shape.common(self.Rack.Shape)
+                            if common1.Area >= area:
+                                raise
+                            else:
+                                # ajuste fino hasta encontrar el primer sitio:
+                                self.Rack.Placement.Base.x += 500  # un metro
+                            del common1
+                            '''
+                # ajuste fino hasta encontrar el primer sitio:
+                rec.Placement.Base.y += 100
+                del common
+        except:
+            pass
+            #print("Found")
+
+        FreeCAD.ActiveDocument.removeObject(rec.Name)
+
+        from datetime import datetime
+        starttime = datetime.now()
+
+        if self.valueOrientation.currentIndex() == 0:
+            # Código para crear filas:
+            self.Rack.Placement.Base.x = self.Terrain.Shape.BoundBox.XMin
+            i = 1
+            yy = self.Rack.Placement.Base.y
+            while yy < self.Terrain.Shape.BoundBox.YMax:
+                CreateRow1(self.Rack.Placement.Base.x, yy, self.Rack, self.Terrain, DistColls, area, i)
+                i += 1
+                yy += DistRows
+        elif self.valueOrientation.currentIndex() == 2:
+            # Código para crear columnas:
+            while self.Rack.Placement.Base.x > self.Terrain.Shape.BoundBox.XMin:
+                self.Rack.Placement.Base.x -= DistColls
+        else:
+            xx = self.Rack.Placement.Base.x
+            while xx < self.Terrain.Shape.BoundBox.XMax:
+                CreateGrid(xx, self.Rack.Placement.Base.y, self.Rack, self.Terrain, DistRows, area)
+                xx += DistColls
+
+        FreeCAD.activeDocument().recompute()
+        print("Everything OK (", datetime.now() - starttime, ")")
+
+
+# Alinear solo filas. las columnas donde se pueda
+def CreateRow(XX, YY, rack, land, gap, area, rowNumber):
+    import Draft
+    rackClone = Draft.makeRectangle(length=rack.Length, height=rack.Height, face=True, support=None)
+    rackClone.Label = 'rackClone{a}'.format(a=rowNumber)
+    rackClone.Placement.Base.x = XX
+    rackClone.Placement.Base.y = YY
+
+    rec = Draft.makeRectangle(length=land.Shape.BoundBox.XLength, height=rack.Height, face=True, support=None)
+    rec.Placement.Base.x = land.Shape.BoundBox.XMin
+    rec.Placement.Base.y = YY
+    FreeCAD.activeDocument().recompute()
+
+    common = land.Shape.common(rec.Shape)
+    for shape in common.Faces:
+        if shape.Area >= area:
+            rackClone.Placement.Base.x = shape.BoundBox.XMin
+            rackClone.Placement.Base.y = shape.BoundBox.YMin
+            while rackClone.Shape.BoundBox.XMax <= shape.BoundBox.XMax:
+                common1 = shape.common(rackClone.Shape)
+                if common1.Area >= area:
+                    tmp = Draft.makeRectangle(length=rack.Length, height=rack.Height, placement=rackClone.Placement,
+                                              face=True, support=None)
+                    tmp.Label = 'R{:03}-000'.format(rowNumber)
+                    rackClone.Placement.Base.x += gap
+                else:
+                    # ajuste fino hasta encontrar el primer sitio:
+                    rackClone.Placement.Base.x += 500  # un metro
+                del common1
+    del common
+    FreeCAD.ActiveDocument.removeObject(rackClone.Name)
+    FreeCAD.ActiveDocument.removeObject(rec.Name)
+
+
+# Alinear solo filas. las columnas donde se pueda
+def CreateRow1(XX, YY, rack, land, gap, area, rowNumber):
+    import Draft
+    rackClone = Draft.makeRectangle(length=rack.Length, height=rack.Height, face=True, support=None)
+    rackClone.Label = 'rackClone{a}'.format(a=rowNumber)
+    rackClone.Placement.Base.x = XX
+    rackClone.Placement.Base.y = YY
+
+    rec = Draft.makeRectangle(length=land.Shape.BoundBox.XLength, height=rack.Height, face=True, support=None)
+    rec.Placement.Base.x = land.Shape.BoundBox.XMin
+    rec.Placement.Base.y = YY
+    FreeCAD.activeDocument().recompute()
+
+    common = land.Shape.common(rec.Shape)
+    for shape in common.Faces:
+        if shape.Area >= area:
+            if False:
+                minorPoint = FreeCAD.Vector(0, 0, 0)
+                for spoint in shape.OuterWire.Vertexes:
+                    if minorPoint.y >= spoint.Point.y:
+                        if minorPoint.x >= spoint.x:
+                            minorPoint = spoint
+                            rackClone.Placement.Base = spoint
+            else:
+                # más rápido
+                rackClone.Placement.Base.x = shape.BoundBox.XMin
+                rackClone.Placement.Base.y = shape.BoundBox.YMin
+
+            while rackClone.Shape.BoundBox.XMax <= shape.BoundBox.XMax:
+                verts = [v.Point for v in rackClone.Shape.OuterWire.OrderedVertexes]
+                inside = True
+                for vert in verts:
+                    if not shape.isInside(vert, 0, True):
+                        inside = False
+                        break
+                if inside:
+                    #tmp = rack.Shape.copy()
+                    #tmp.Placement = rack.Placement
+                    tmp = Draft.makeRectangle(length=rack.Length, height=rack.Height, placement=rackClone.Placement,
+                                              face=True, support=None)
+                    tmp.Label = 'R{:03}-000'.format(rowNumber)
+
+                    rackClone.Placement.Base.x += gap
+                else:
+                    # ajuste fino hasta encontrar el primer sitio:
+                    rackClone.Placement.Base.x += 500  # un metro
+    del common
+    FreeCAD.ActiveDocument.removeObject(rackClone.Name)
+    FreeCAD.ActiveDocument.removeObject(rec.Name)
+
+
+# Alinear columna y fila (grid perfecta)
+def CreateGrid(XX, YY, rack, land, gap, area):
+    print("CreateGrid")
+    import Draft
+    rackClone = Draft.makeRectangle(length=rack.Length, height=rack.Height, face=True, support=None)
+    rackClone.Label = 'rackClone{a}'.format(a=XX)
+    rackClone.Placement.Base.x = XX
+    rackClone.Placement.Base.y = YY
+
+    # if False:
+    while rackClone.Shape.BoundBox.YMax < land.Shape.BoundBox.YMax:
+        common = land.Shape.common(rackClone.Shape)
+
+        if common.Area >= area:
+            tmp = Draft.makeRectangle(length=rack.Length, height=rack.Height,
+                                      placement=rackClone.Placement, face=True, support=None)
+            tmp.Label = 'rackClone{a}'.format(a=XX)
+        rackClone.Placement.Base.y += gap
+        # else:
+        #    # ajuste fino hasta encontrar el primer sitio:
+        #    rackClone.Placement.Base.y += 1000
+    FreeCAD.ActiveDocument.removeObject(rackClone.Name)
+
+
+# Alinear solo filas. las columnas donde se pueda
+def CreateCol(XX, YY, rack, land, gap, area):
+    import Draft
+    rackClone = Draft.makeRectangle(length=rack.Length, height=rack.Height, face=True, support=None)
+    rackClone.Label = 'rackClone{a}'.format(a=XX)
+    rackClone.Placement.Base.x = XX
+    rackClone.Placement.Base.y = YY
+
+    while rackClone.Shape.BoundBox.YMax < land.Shape.BoundBox.YMax:
+        common = land.Shape.common(rackClone.Shape)
+
+        if common.Area >= area:
+            tmp = Draft.makeRectangle(length=rack.Length, height=rack.Height,
+                                      placement=rackClone.Placement, face=True, support=None)
+            tmp.Label = 'rackClone{a}'.format(a=XX)
+            rackClone.Placement.Base.y += gap
+        else:
+            # ajuste fino hasta encontrar el primer sitio:
+            rackClone.Placement.Base.y += 100
+
+    FreeCAD.ActiveDocument.removeObject(rackClone.Name)
+
+
+# TODO: Probar a usar hilos:
+class _CreateCol(threading.Thread):
+    def __init__(self, args=()):
+        super().__init__()
+        self.XX = args[0]
+        self.YY = args[1]
+        self.rack = args[2]
+        self.land = args[3]
+        self.gap = args[4]
+        self.area = args[5]
+
+    def run(self):
+        import Draft
+        # rackClone = Draft.makeRectangle(length=land.Shape.BoundBox.XLength, height=rack.Height,
+        #                          face=True, support=None)
+        # rackClone = FreeCAD.activeDocument().addObject('Part::Feature')
+        # rackClone.Shape = self.rack.Shape
+
+        rackClone = Draft.makeRectangle(length=self.rack.Length, height=self.rack.Height, face=True, support=None)
+        rackClone.Label = 'rackClone{a}'.format(a=self.XX)
+        rackClone.Placement.Base.x = self.XX
+        rackClone.Placement.Base.y = self.YY
+
+        # if False:
+        while rackClone.Shape.BoundBox.YMax < self.land.Shape.BoundBox.YMax:
+            common = self.land.Shape.common(rackClone.Shape)
+
+            if common.Area >= self.area:
+                rack = Draft.makeRectangle(length=self.rack.Length, height=self.rack.Height,
+                                           placement=rackClone.Placement, face=True, support=None)
+                rack.Label = 'rackClone{a}'.format(a=self.XX)
+            rackClone.Placement.Base.y += self.gap
+            # else:
+            #    # ajuste fino hasta encontrar el primer sitio:
+            #    rackClone.Placement.Base.y += 1000
+
+        # FreeCAD.ActiveDocument.removeObject(rackClone.Name)
+
+
+if FreeCAD.GuiUp:
+    FreeCADGui.addCommand('PVPlantPlacement', _CommandPVPlantPlacement())

PVPlantBuilding.py

@@ -0,0 +1,345 @@
+# /**********************************************************************
+# *                                                                     *
+# * Copyright (c) 2021 Javier Braña <javier.branagutierrez@gmail.com>  *
+# *                                                                     *
+# * This program is free software; you can redistribute it and/or modify*
+# * it under the terms of the GNU Lesser General Public License (LGPL)  *
+# * as published by the Free Software Foundation; either version 2 of   *
+# * the License, or (at your option) any later version.                 *
+# * for detail see the LICENCE text file.                               *
+# *                                                                     *
+# * This program is distributed in the hope that it will be useful,     *
+# * but WITHOUT ANY WARRANTY; without even the implied warranty of      *
+# * MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE.  See the       *
+# * GNU Library General Public License for more details.                *
+# *                                                                     *
+# * You should have received a copy of the GNU Library General Public   *
+# * License along with this program; if not, write to the Free Software *
+# * Foundation, Inc., 59 Temple Place, Suite 330, Boston, MA  02111-1307*
+# * USA                                                                 *
+# *                                                                     *
+# ***********************************************************************
+
+import ArchComponent
+import FreeCAD
+import Part
+
+if FreeCAD.GuiUp:
+    import FreeCADGui
+    from PySide import QtCore
+    import draftguitools.gui_trackers as DraftTrackers
+    import draftguitools.gui_tool_utils as gui_tool_utils
+else:
+    # \cond
+    def translate(ctxt, txt):
+        return txt
+    def QT_TRANSLATE_NOOP(ctxt, txt):
+        return txt
+    # \endcond
+
+try:
+    _fromUtf8 = QtCore.QString.fromUtf8
+except AttributeError:
+    def _fromUtf8(s):
+        return s
+
+import os
+import PVPlantResources
+from PVPlantResources import DirIcons as DirIcons
+
+
+def makeBuilding(name="Building"):
+    obj = FreeCAD.ActiveDocument.addObject("Part::FeaturePython", "Building")
+    obj.Label = name
+    _Building(obj)
+    _ViewProviderBuilding(obj.ViewObject)
+    FreeCAD.ActiveDocument.recompute()
+    return obj
+
+
+class _Building(ArchComponent.Component):
+    "A Building Obcject"
+
+    def __init__(self, obj):
+        # Definición de Variables:
+        ArchComponent.Component.__init__(self, obj)
+        self.rooftype = ""
+        self.setProperties(obj)
+
+    def setProperties(self, obj):
+        pl = obj.PropertiesList
+        # Dimensions: --------------------------------------------------------------------------------------------------
+        if not "RoofWall" in pl:
+            obj.addProperty("App::PropertyLength",
+                            "RoofWall",
+                            "Building",
+                            "The height of this object"
+                            ).RoofWall = 0
+
+        if not "RoofWallWidth" in pl:
+            obj.addProperty("App::PropertyLength",
+                            "RoofWallWidth",
+                            "Building",
+                            "The height of this object"
+                            ).RoofWallWidth = 300
+
+        if not "Height" in pl:
+            obj.addProperty("App::PropertyLength",
+                            "Height",
+                            "Building",
+                            "The height of this object"
+                            ).Height = 4000
+
+        if not "Width" in pl:
+            obj.addProperty("App::PropertyLength",
+                            "Width",
+                            "Building",
+                            "The width of this object"
+                            ).Width = 7000
+
+        if not "Length" in pl:
+            obj.addProperty("App::PropertyLength",
+                            "Length",
+                            "Building",
+                            "The height of this object"
+                            ).Length = 14000
+
+        if not "RoofHeight" in pl:
+            obj.addProperty("App::PropertyLength",
+                            "RoofHeight",
+                            "Building",
+                            "The height of this object"
+                            ).RoofHeight = 1500
+
+        if not "TopCenter" in pl:
+            obj.addProperty("App::PropertyPercent",
+                            "TopCenter",
+                            "Building",
+                            "The height of this object"
+                            ).TopCenter = 50
+
+        if not "TopLength" in pl:
+            obj.addProperty("App::PropertyPercent",
+                            "TopLength",
+                            "Building",
+                            "The height of this object"
+                            ).TopLength = 0
+
+        # outputs:
+        if not "InternalVolume" in pl:
+            obj.addProperty("App::PropertyVolume",
+                            "InternalVolume",
+                            "Outputs",
+                            "The height of this object"
+                            )
+
+        if not "ExternalVolume" in pl:
+            obj.addProperty("App::PropertyVolume",
+                            "ExternalVolume",
+                            "Outputs",
+                            "The height of this object"
+                            )
+
+        self.Type = "Building"
+        obj.Proxy = self
+
+    def onDocumentRestored(self, obj):
+        """Method run when the document is restored.
+        Re-adds the Arch component, and Arch wall properties."""
+        ArchComponent.Component.onDocumentRestored(self, obj)
+        self.setProperties(obj)
+
+    def onChanged(self, obj, prop):
+        '''Do something when a property has changed'''
+
+
+    def execute(self, obj):
+        w = obj.Width.Value
+        w_med = w / 2
+        l_med = obj.Length.Value / 2
+
+        p1 = FreeCAD.Vector(-l_med, -w_med, 0)
+        p2 = FreeCAD.Vector(-l_med, w_med, 0)
+        p3 = FreeCAD.Vector(-l_med, w_med, obj.Height.Value)
+        p4 = FreeCAD.Vector(-l_med, w * (obj.TopCenter - 50) / 100, obj.Height.Value + obj.RoofHeight.Value)
+        p5 = FreeCAD.Vector(-l_med, -w_med, obj.Height.Value)
+        profile = Part.Face(Part.makePolygon([p1, p2, p3, p4, p5, p1, ]))
+        shape = profile.extrude(FreeCAD.Vector(obj.Length.Value, 0, 0))
+
+        if obj.TopLength > 0:
+            p1 = FreeCAD.Vector(-l_med, w_med, obj.Height.Value)
+            p2 = FreeCAD.Vector(-l_med, w * (obj.TopCenter - 50) / 100, obj.Height.Value + obj.RoofHeight.Value)
+            p3 = FreeCAD.Vector(-l_med, -w_med, obj.Height.Value)
+            p4 = FreeCAD.Vector(-l_med + (obj.TopLength * obj.Length.Value / 200),
+                                w * (obj.TopCenter - 50) / 100, obj.Height.Value + obj.RoofHeight.Value)
+            f1 = Part.Face(Part.makePolygon([p1, p2, p3, p1, ]))
+            f2 = Part.Face(Part.makePolygon([p1, p4, p3, p1, ]))
+            f3 = Part.Face(Part.makePolygon([p1, p2, p4, p1, ]))
+            f4 = Part.Face(Part.makePolygon([p3, p4, p2, p3, ]))
+            tool = Part.makeSolid(Part.Shell([f1, f4, f2, f3]))
+            shape = shape.cut(tool)
+
+            p1 = FreeCAD.Vector(l_med, w_med, obj.Height.Value)
+            p2 = FreeCAD.Vector(l_med,
+                                w * (obj.TopCenter - 50) / 100,
+                                obj.Height.Value + obj.RoofHeight.Value)
+            p3 = FreeCAD.Vector(l_med, -w_med, obj.Height.Value)
+            p4 = FreeCAD.Vector(l_med - (obj.TopLength * obj.Length.Value / 200),
+                                w * (obj.TopCenter - 50) / 100,
+                                obj.Height.Value + obj.RoofHeight.Value)
+
+            f1 = Part.Face(Part.makePolygon([p1, p2, p3, p1, ]))
+            f2 = Part.Face(Part.makePolygon([p1, p4, p3, p1, ]))
+            f3 = Part.Face(Part.makePolygon([p1, p2, p4, p1, ]))
+            f4 = Part.Face(Part.makePolygon([p3, p4, p2, p3, ]))
+            tool = Part.makeSolid(Part.Shell([f1, f4, f2, f3]))
+            shape = shape.cut(tool)
+
+        if obj.RoofWall.Value > 0 and obj.RoofWallWidth.Value > 0:
+            offset = 2 * obj.RoofWallWidth.Value
+            box1 = Part.makeBox(obj.Length.Value, obj.Width.Value, obj.RoofWall.Value)
+            box2 = Part.makeBox(obj.Length.Value - offset, obj.Width.Value - offset, obj.RoofWall.Value)
+            box2.Placement.Base.x += obj.RoofWallWidth.Value
+            box2.Placement.Base.y += obj.RoofWallWidth.Value
+            box1 = box1.cut(box2)
+            box1.Placement.Base.x = -l_med
+            box1.Placement.Base.y = -w_med
+            box1.Placement.Base.z = obj.Height.Value
+            shape = shape.fuse(box1).removeSplitter()
+
+        obj.Shape = shape
+
+
+class _ViewProviderBuilding(ArchComponent.ViewProviderComponent):
+    "A View Provider for the Pipe object"
+
+    def __init__(self, vobj):
+        ArchComponent.ViewProviderComponent.__init__(self, vobj)
+
+    def getIcon(self):
+        return str(os.path.join(DirIcons, "house.svg"))
+
+    def setEdit(self, vobj, mode):
+        """Method called when the document requests the object to enter edit mode.
+
+        Edit mode is entered when a user double clicks on an object in the tree
+        view, or when they use the menu option [Edit -> Toggle Edit Mode].
+
+        Just display the standard Arch component task panel.
+
+        Parameters
+        ----------
+        mode: int or str
+            The edit mode the document has requested. Set to 0 when requested via
+            a double click or [Edit -> Toggle Edit Mode].
+
+        Returns
+        -------
+        bool
+            If edit mode was entered.
+        """
+
+        if (mode == 0) and hasattr(self, "Object"):
+            taskd = _BuildingTaskPanel(self.Object)
+            taskd.obj = self.Object
+            # taskd.update()
+            FreeCADGui.Control.showDialog(taskd)
+            return True
+
+        return False
+
+
+class _BuildingTaskPanel:
+    def __init__(self, obj=None):
+        self.new = False
+        if obj is None:
+            self.new = True
+            obj = makeBuilding()
+
+        self.obj = obj
+
+        self.form = FreeCADGui.PySideUic.loadUi(PVPlantResources.__dir__ + "/PVPlantBuilding.ui")
+
+        self.node = None
+        self.view = FreeCADGui.ActiveDocument.ActiveView
+        self.tracker = DraftTrackers.ghostTracker(obj)
+        self.tracker.on()
+        self.call = self.view.addEventCallback("SoEvent", self.action)
+
+    def action(self, arg):
+        """Handle the 3D scene events.
+
+        This is installed as an EventCallback in the Inventor view.
+
+        Parameters
+        ----------
+        arg: dict
+            Dictionary with strings that indicates the type of event received
+            from the 3D view.
+        """
+
+        if arg["Type"] == "SoKeyboardEvent" and arg["Key"] == "ESCAPE":
+            self.finish()
+
+        elif arg["Type"] == "SoLocation2Event":
+            point, ctrlPoint, info = gui_tool_utils.getPoint(self, arg)
+            if info:
+                self.tracker.move(FreeCAD.Vector(info["x"], info["y"], info["z"]))
+            else:
+                self.tracker.move(point)
+
+        elif (arg["Type"] == "SoMouseButtonEvent" and
+              arg["State"] == "DOWN" and
+              arg["Button"] == "BUTTON1"):
+
+            point, ctrlPoint, info = gui_tool_utils.getPoint(self, arg)
+            if info:
+                self.obj.Placement.Base = FreeCAD.Vector(info["x"], info["y"], info["z"])
+            else:
+                self.obj.Placement.Base = point
+            self.finish()
+
+    def finish(self):
+        self.accept()
+
+    def accept(self):
+        self.closeForm()
+        return True
+
+    def reject(self):
+        if self.new:
+            FreeCAD.ActiveDocument.removeObject(self.obj.Name)
+        self.closeForm()
+        return True
+
+    def closeForm(self):
+        self.tracker.finalize()
+        FreeCADGui.Control.closeDialog()
+        self.view.removeEventCallback("SoEvent", self.call)
+
+
+class _CommandBuilding:
+    "the Arch Building command definition"
+    def GetResources(self):
+        return {'Pixmap': str(os.path.join(DirIcons, "house.svg")),
+                'MenuText': "Building",
+                'Accel': "C, M",
+                'ToolTip': "Creates a Building object from setup dialog."}
+
+    def IsActive(self):
+        return not FreeCAD.ActiveDocument is None
+
+        if FreeCAD.ActiveDocument is not None:
+            if FreeCADGui.Selection.getCompleteSelection():
+                for ob in FreeCAD.ActiveDocument.Objects:
+                    if ob.Name[:4] == "Site":
+                        return True
+
+    def Activated(self):
+        TaskPanel = _BuildingTaskPanel()
+        FreeCADGui.Control.showDialog(TaskPanel)
+        return
+
+
+if FreeCAD.GuiUp:
+    FreeCADGui.addCommand('PVPlantBuilding', _CommandBuilding())

PVPlantBuilding.ui

@@ -0,0 +1,218 @@
+<?xml version="1.0" encoding="UTF-8"?>
+<ui version="4.0">
+ <class>formRack</class>
+ <widget class="QDialog" name="formRack">
+  <property name="geometry">
+   <rect>
+    <x>0</x>
+    <y>0</y>
+    <width>332</width>
+    <height>157</height>
+   </rect>
+  </property>
+  <property name="windowTitle">
+   <string>Fixed Frame:</string>
+  </property>
+  <layout class="QVBoxLayout" name="verticalLayout">
+   <item>
+    <widget class="QGroupBox" name="groupBox">
+     <property name="sizePolicy">
+      <sizepolicy hsizetype="Preferred" vsizetype="Fixed">
+       <horstretch>0</horstretch>
+       <verstretch>0</verstretch>
+      </sizepolicy>
+     </property>
+     <property name="title">
+      <string>Dimensions</string>
+     </property>
+     <layout class="QGridLayout" name="gridLayout">
+      <property name="leftMargin">
+       <number>5</number>
+      </property>
+      <property name="topMargin">
+       <number>5</number>
+      </property>
+      <property name="rightMargin">
+       <number>5</number>
+      </property>
+      <property name="bottomMargin">
+       <number>5</number>
+      </property>
+      <property name="horizontalSpacing">
+       <number>5</number>
+      </property>
+      <property name="verticalSpacing">
+       <number>2</number>
+      </property>
+      <item row="0" column="0">
+       <widget class="QLabel" name="label_9">
+        <property name="text">
+         <string>Heigth (m)</string>
+        </property>
+       </widget>
+      </item>
+      <item row="0" column="1">
+       <widget class="QDoubleSpinBox" name="editModuleHeight">
+        <property name="sizePolicy">
+         <sizepolicy hsizetype="Fixed" vsizetype="Fixed">
+          <horstretch>0</horstretch>
+          <verstretch>0</verstretch>
+         </sizepolicy>
+        </property>
+        <property name="minimumSize">
+         <size>
+          <width>140</width>
+          <height>0</height>
+         </size>
+        </property>
+        <property name="alignment">
+         <set>Qt::AlignRight|Qt::AlignTrailing|Qt::AlignVCenter</set>
+        </property>
+        <property name="buttonSymbols">
+         <enum>QAbstractSpinBox::NoButtons</enum>
+        </property>
+        <property name="decimals">
+         <number>3</number>
+        </property>
+        <property name="maximum">
+         <double>10000.000000000000000</double>
+        </property>
+        <property name="singleStep">
+         <double>0.010000000000000</double>
+        </property>
+        <property name="value">
+         <double>1000.000000000000000</double>
+        </property>
+       </widget>
+      </item>
+      <item row="1" column="1">
+       <widget class="QDoubleSpinBox" name="editModuleLenght">
+        <property name="sizePolicy">
+         <sizepolicy hsizetype="Fixed" vsizetype="Fixed">
+          <horstretch>0</horstretch>
+          <verstretch>0</verstretch>
+         </sizepolicy>
+        </property>
+        <property name="minimumSize">
+         <size>
+          <width>140</width>
+          <height>0</height>
+         </size>
+        </property>
+        <property name="alignment">
+         <set>Qt::AlignRight|Qt::AlignTrailing|Qt::AlignVCenter</set>
+        </property>
+        <property name="buttonSymbols">
+         <enum>QAbstractSpinBox::NoButtons</enum>
+        </property>
+        <property name="decimals">
+         <number>3</number>
+        </property>
+        <property name="maximum">
+         <double>10000.000000000000000</double>
+        </property>
+        <property name="singleStep">
+         <double>0.010000000000000</double>
+        </property>
+        <property name="value">
+         <double>2000.000000000000000</double>
+        </property>
+       </widget>
+      </item>
+      <item row="2" column="0">
+       <widget class="QLabel" name="label_11">
+        <property name="text">
+         <string>Anchura (m)</string>
+        </property>
+       </widget>
+      </item>
+      <item row="3" column="0">
+       <widget class="QLabel" name="label">
+        <property name="text">
+         <string>TextLabel</string>
+        </property>
+       </widget>
+      </item>
+      <item row="1" column="0">
+       <widget class="QLabel" name="label_10">
+        <property name="text">
+         <string>Largura (m)</string>
+        </property>
+       </widget>
+      </item>
+      <item row="2" column="1">
+       <widget class="QDoubleSpinBox" name="editModuleWidth">
+        <property name="sizePolicy">
+         <sizepolicy hsizetype="Fixed" vsizetype="Fixed">
+          <horstretch>0</horstretch>
+          <verstretch>0</verstretch>
+         </sizepolicy>
+        </property>
+        <property name="minimumSize">
+         <size>
+          <width>140</width>
+          <height>0</height>
+         </size>
+        </property>
+        <property name="alignment">
+         <set>Qt::AlignRight|Qt::AlignTrailing|Qt::AlignVCenter</set>
+        </property>
+        <property name="buttonSymbols">
+         <enum>QAbstractSpinBox::NoButtons</enum>
+        </property>
+        <property name="decimals">
+         <number>3</number>
+        </property>
+        <property name="maximum">
+         <double>10000.000000000000000</double>
+        </property>
+        <property name="singleStep">
+         <double>0.010000000000000</double>
+        </property>
+        <property name="value">
+         <double>1000.000000000000000</double>
+        </property>
+       </widget>
+      </item>
+      <item row="3" column="1">
+       <widget class="QDoubleSpinBox" name="editModuleWidth_2">
+        <property name="sizePolicy">
+         <sizepolicy hsizetype="Fixed" vsizetype="Fixed">
+          <horstretch>0</horstretch>
+          <verstretch>0</verstretch>
+         </sizepolicy>
+        </property>
+        <property name="minimumSize">
+         <size>
+          <width>140</width>
+          <height>0</height>
+         </size>
+        </property>
+        <property name="alignment">
+         <set>Qt::AlignRight|Qt::AlignTrailing|Qt::AlignVCenter</set>
+        </property>
+        <property name="buttonSymbols">
+         <enum>QAbstractSpinBox::NoButtons</enum>
+        </property>
+        <property name="decimals">
+         <number>3</number>
+        </property>
+        <property name="maximum">
+         <double>10000.000000000000000</double>
+        </property>
+        <property name="singleStep">
+         <double>0.010000000000000</double>
+        </property>
+        <property name="value">
+         <double>1000.000000000000000</double>
+        </property>
+       </widget>
+      </item>
+     </layout>
+    </widget>
+   </item>
+  </layout>
+ </widget>
+ <resources/>
+ <connections/>
+</ui>

PVPlantCCTV.py

@@ -0,0 +1,172 @@
+
+import FreeCAD
+import ArchComponent
+import PVPlantSite
+import Part
+
+if FreeCAD.GuiUp:
+    import FreeCADGui
+    from DraftTools import translate
+    from PySide.QtCore import QT_TRANSLATE_NOOP
+
+else:
+    # \cond
+    def translate(ctxt, txt):
+        return txt
+
+
+    def QT_TRANSLATE_NOOP(ctxt, txt):
+        return txt
+    # \endcond
+
+__title__ = "PVPlant Frames"
+__author__ = "Javier Braña"
+__url__ = "http://www.sogos-solar.com"
+
+import os
+import PVPlantResources
+from PVPlantResources import DirIcons as DirIcons
+
+def makePole(diameter=48, length=3000, placement=None, name="Post"):
+    "makePipe([baseobj,diamerter,length,placement,name]): creates an pipe object from the given base object"
+
+    if not FreeCAD.ActiveDocument:
+        FreeCAD.Console.PrintError("No active document. Aborting\n")
+        return
+
+    obj = FreeCAD.ActiveDocument.addObject("Part::FeaturePython", name)
+    obj.Label = name
+    Poles(obj)
+
+    if FreeCAD.GuiUp:
+        ViewProviderPost(obj.ViewObject)
+
+    if placement:
+        obj.Placement = placement
+    return obj
+
+class Poles(ArchComponent.Component):
+    "A Base Frame Obcject - Class"
+
+    def __init__(self, obj):
+        # Definición de Variables:
+        ArchComponent.Component.__init__(self, obj)
+        self.obj = obj
+        self.setCommonProperties(obj)
+
+        # Does a IfcType exist?
+        obj.IfcType = "Structural Item"
+        obj.setEditorMode("IfcType", 1)
+
+        self.totalAreaShape = None
+        self.changed = True
+
+    def setCommonProperties(self, obj):
+        # Definicion de Propiedades:
+        ArchComponent.Component.setProperties(self, obj)
+
+        pl = obj.PropertiesList
+
+        if not "TopDiameter" in pl:
+            obj.addProperty("App::PropertyLength",
+                            "TopDiameter",
+                            "Post",
+                            QT_TRANSLATE_NOOP("App::Property", "The height of this object")
+                            ).TopDiameter = 40
+
+        if not "BottomDiameter" in pl:
+            obj.addProperty("App::PropertyLength",
+                            "BottomDiameter",
+                            "Post",
+                            QT_TRANSLATE_NOOP("App::Property", "The width of this object")
+                            ).BottomDiameter = 60
+
+        if not "Height" in pl:
+            obj.addProperty("App::PropertyLength",
+                            "Height",
+                            "Post",
+                            QT_TRANSLATE_NOOP("App::Property", "The Length of this object")
+                            ).Height = 6000
+
+        if not "BaseWidth" in pl:
+            obj.addProperty("App::PropertyLength",
+                            "BaseWidth",
+                            "Post",
+                            QT_TRANSLATE_NOOP("App::Property", "The Length of this object")
+                            ).BaseWidth = 300
+
+        if not "BaseHeight" in pl:
+            obj.addProperty("App::PropertyLength",
+                            "BaseHeight",
+                            "Post",
+                            QT_TRANSLATE_NOOP("App::Property", "The Length of this object")
+                            ).BaseHeight = 6
+
+        self.Type = "Post"
+
+    def onChanged(self, obj, prop):
+        ''''''
+
+    def execute(self, obj):
+        pl = obj.Placement
+
+        base = Part.makeBox(obj.BaseWidth, obj.BaseWidth, obj.BaseHeight)
+        base1 = Part.show(Part.makeSphere(45, FreeCAD.Vector(0, 0, 0), FreeCAD.Vector(0, 0, 1), 30, 90, 360))
+        tube = Part.makeCone(obj.BottonDiameter / 2, obj.TopDiameter / 2, obj.Height)
+
+        obj.Shape = base.fuse([base1, tube])
+        obj.Placement = pl
+
+
+class ViewProviderPost(ArchComponent.ViewProviderComponent):
+    "A View Provider for the Pipe object"
+
+    def __init__(self, vobj):
+        ArchComponent.ViewProviderComponent.__init__(self, vobj)
+
+    def getIcon(self):
+        import Arch_rc
+        return ":/icons/Arch_Pipe_Tree.svg"
+
+
+class CommandMultiRowTracker:
+    "the Arch Building command definition"
+
+    def GetResources(self):
+        return {'Pixmap': str(os.path.join(DirIcons, "solar-tracker.svg")),
+                'MenuText': "Multi-row Tracker",
+                'Accel': "R, M",
+                'ToolTip': "Creates a multi-row Tracker object from trackers."}
+
+    def IsActive(self):
+        return not FreeCAD.ActiveDocument is None
+
+        if FreeCAD.ActiveDocument is not None:
+            if FreeCADGui.Selection.getCompleteSelection():
+                for ob in FreeCAD.ActiveDocument.Objects:
+                    if ob.Name[:4] == "Site":
+                        return True
+
+    def Activated(self):
+        self.TaskPanel = _FixedRackTaskPanel()
+        FreeCADGui.Control.showDialog(self.TaskPanel)
+        return
+
+if FreeCAD.GuiUp:
+    class CommandRackGroup:
+
+        def GetCommands(self):
+            return tuple(['PVPlantFixedRack',
+                          'PVPlantTracker'
+                          ])
+
+        def GetResources(self):
+            return {'MenuText': QT_TRANSLATE_NOOP("", 'Rack Types'),
+                    'ToolTip': QT_TRANSLATE_NOOP("", 'Rack Types')
+                    }
+
+        def IsActive(self):
+            return not FreeCAD.ActiveDocument is None
+
+
+    FreeCADGui.addCommand('PVPlantCreatePost', CommandFixedRack())

PVPlantCreateTerrainMesh.py

@@ -0,0 +1,271 @@
+# /**********************************************************************
+# *                                                                     *
+# * Copyright (c) 2021 Javier Braña <javier.branagutierrez@gmail.com>  *
+# *                                                                     *
+# * This program is free software; you can redistribute it and/or modify*
+# * it under the terms of the GNU Lesser General Public License (LGPL)  *
+# * as published by the Free Software Foundation; either version 2 of   *
+# * the License, or (at your option) any later version.                 *
+# * for detail see the LICENCE text file.                               *
+# *                                                                     *
+# * This program is distributed in the hope that it will be useful,     *
+# * but WITHOUT ANY WARRANTY; without even the implied warranty of      *
+# * MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE.  See the       *
+# * GNU Library General Public License for more details.                *
+# *                                                                     *
+# * You should have received a copy of the GNU Library General Public   *
+# * License along with this program; if not, write to the Free Software *
+# * Foundation, Inc., 59 Temple Place, Suite 330, Boston, MA  02111-1307*
+# * USA                                                                 *
+# *                                                                     *
+# ***********************************************************************
+
+import FreeCAD, FreeCADGui, Draft
+from PySide import QtCore, QtGui, QtSvg
+from PySide.QtCore import QT_TRANSLATE_NOOP
+
+try:
+    _fromUtf8 = QtCore.QString.fromUtf8
+except AttributeError:
+    def _fromUtf8(s):
+        return s
+
+import os, math
+from PVPlantResources import DirIcons as DirIcons
+
+class _TaskPanel:
+    def __init__(self, obj = None):
+        self.obj = None
+        self.select = 0
+
+        self.form = FreeCADGui.PySideUic.loadUi(os.path.dirname(__file__) + "/PVPlantCreateTerrainMesh.ui")
+        self.form.buttonAdd.clicked.connect(self.add)
+
+    def add(self):
+        sel = FreeCADGui.Selection.getSelection()
+        if len(sel) > 0:
+            self.obj = sel[0]
+            self.form.editCloud.setText(self.obj.Label)
+
+    def MaxLength(self, P1, P2, P3, MaxlengthLE):
+        """
+        Calculation of the 2D length between triangle edges
+        """
+
+        p1 = FreeCAD.Vector(P1[0], P1[1], 0)
+        p2 = FreeCAD.Vector(P2[0], P2[1], 0)
+        p3 = FreeCAD.Vector(P3[0], P3[1], 0)
+
+        List = [[p1, p2], [p2, p3], [p3, p1]]
+        for i, j in List:
+            vec = i.sub(j)
+            if vec.Length > MaxlengthLE:
+                return False
+
+        return True
+
+    def MaxAngle(self, P1, P2, P3, MaxAngleLE):
+        """
+        Calculation of the 2D angle between triangle edges
+        """
+
+        p1 = FreeCAD.Vector(P1[0], P1[1], 0)
+        p2 = FreeCAD.Vector(P2[0], P2[1], 0)
+        p3 = FreeCAD.Vector(P3[0], P3[1], 0)
+
+        List = [[p1, p2, p3], [p2, p3, p1], [p3, p1, p2]]
+        for j, k, l in List:
+            vec1 = j.sub(k)
+            vec2 = l.sub(k)
+            radian = vec1.getAngle(vec2)
+            if radian > MaxAngleLE:
+                return False
+
+        return True
+
+    def accept(self):
+        from datetime import datetime
+        starttime = datetime.now()       
+
+        import Part
+        import numpy as np
+        from scipy.spatial import Delaunay
+
+        bnd = FreeCAD.ActiveDocument.Site.Terrain.CuttingBoundary.Shape
+        if len(bnd.Faces) == 0:
+            bnd = Part.Face(bnd)
+
+        # Get user input
+        MaxlengthLE = int(self.form.MaxlengthLE.text()) * 1000
+        MaxAngleLE = math.radians(int(self.form.MaxAngleLE.text()))
+
+        firstPoint = self.obj.Points.Points[0]
+        nbase = FreeCAD.Vector(firstPoint.x, firstPoint.y, firstPoint.z)
+        data = []
+        for point in self.obj.Points.Points:
+            tmp = FreeCAD.Vector(0, 0, 0).add(point)
+            tmp.z = 0
+            if bnd.isInside(tmp, 0, True):
+                p = point - nbase
+                data.append([float(p.x), float(p.y), float(p.z)])
+
+        Data = np.array(data)
+        data.clear()
+
+        ''' not working:
+        import multiprocessing
+        rows = Data.shape[0]
+
+        cpus = multiprocessing.cpu_count()
+        steps = math.ceil(rows / cpus)
+
+        for cpu in range(cpus - 1):
+            start = steps * cpu
+            end = steps * (cpu + 1)
+            if end > rows:
+                end = rows - start
+            tmp = Data[start : end, :]
+            p = multiprocessing.Process(target = Triangulate, args = (tmp,))
+            p.start()
+            p.join()
+        return
+        '''
+
+        # TODO: si es muy grande, dividir el cálculo de la maya en varias etapas
+        # Create delaunay triangulation
+        tri = Delaunay(Data[:, :2])
+        print("tiempo delaunay:", datetime.now() - starttime)
+
+        faces = tri.simplices
+        from stl import mesh
+        wireframe = mesh.Mesh(np.zeros(faces.shape[0], dtype=mesh.Mesh.dtype))
+        for i, f in enumerate(faces):
+            if self.MaxLength(Data[f[0]], Data[f[1]], Data[f[2]], MaxlengthLE) and \
+               self.MaxAngle(Data[f[0]], Data[f[1]], Data[f[2]], MaxAngleLE):
+                for j in range(3):
+                    wireframe.vectors[i][j] = Data[f[j], :]
+
+        import Mesh
+        MeshObject = Mesh.Mesh(wireframe.vectors.tolist())
+        MeshObject.Placement.move(nbase)
+        MeshObject.harmonizeNormals()
+        Surface = FreeCAD.ActiveDocument.addObject("Mesh::Feature", self.form.SurfaceNameLE.text())
+        Surface.Mesh = MeshObject
+        Surface.Label = self.form.SurfaceNameLE.text()
+
+        shape = MeshToShape(MeshObject)
+        import Part
+        Part.show(shape)
+
+        FreeCAD.ActiveDocument.recompute()
+        FreeCADGui.Control.closeDialog()
+        print(" --- Tiempo tardado:", datetime.now() - starttime)
+
+    def reject(self):
+        FreeCADGui.Control.closeDialog()
+
+
+#----------------------------------------------------------------------------------------------
+#from PySide.QtWidgets import QVBoxLayout, QLabel, QPushButton, QWidget, QMainWindow, QApplication
+
+def Triangulate(Points, MaxlengthLE = 8000, MaxAngleLE = math.pi, use3d=True):
+    import numpy as np
+    from scipy.spatial import Delaunay
+    from stl import mesh as stlmesh
+    import Mesh
+
+    if Points.__class__ is list:
+        Points = np.array(Points)
+    tri = Delaunay(Points[:, :2])
+    faces = tri.simplices
+    wireframe = stlmesh.Mesh(np.zeros(faces.shape[0], dtype=stlmesh.Mesh.dtype))
+
+    for i, f in enumerate(faces):
+        if MaxLength(Points[f[0]], Points[f[1]], Points[f[2]], MaxlengthLE) and \
+           MaxAngle(Points[f[0]], Points[f[1]], Points[f[2]], MaxAngleLE):
+            for j in range(3):
+                wireframe.vectors[i][j] = Points[f[j], :]
+                if not use3d:
+                    wireframe.vectors[i][j][2] = 0
+
+    MeshObject = Mesh.Mesh(wireframe.vectors.tolist())
+    if len(MeshObject.Facets) == 0:
+        return None
+    MeshObject.harmonizeNormals()
+    if MeshObject.Facets[0].Normal.z < 0:
+        MeshObject.flipNormals()
+    return MeshObject
+
+def MaxLength(P1, P2, P3, MaxlengthLE):
+    """ Calculation of the 2D length between triangle edges """
+    p1 = FreeCAD.Vector(P1[0], P1[1], 0)
+    p2 = FreeCAD.Vector(P2[0], P2[1], 0)
+    p3 = FreeCAD.Vector(P3[0], P3[1], 0)
+
+    List = [[p1, p2], [p2, p3], [p3, p1]]
+    for i, j in List:
+        vec = i.sub(j)
+        if vec.Length > MaxlengthLE:
+            return False
+    return True
+
+def MaxAngle(P1, P2, P3, MaxAngleLE):
+    """ Calculation of the 2D angle between triangle edges """
+    p1 = FreeCAD.Vector(P1[0], P1[1], 0)
+    p2 = FreeCAD.Vector(P2[0], P2[1], 0)
+    p3 = FreeCAD.Vector(P3[0], P3[1], 0)
+    List = [[p1, p2, p3], [p2, p3, p1], [p3, p1, p2]]
+    for j, k, l in List:
+        vec1 = j.sub(k)
+        vec2 = l.sub(k)
+        radian = vec1.getAngle(vec2)
+        if radian > MaxAngleLE:
+            return False
+    return True
+
+def Open3DTriangle(point_cloud):
+    import numpy as np
+    import open3d as o3d
+
+    '''
+    input_path = "your_path_to_file/"
+    output_path = "your_path_to_output_folder/"
+    dataname = "sample.xyz"
+    point_cloud = np.loadtxt(input_path + dataname, skiprows=1)
+    '''
+    pcd = o3d.geometry.PointCloud()
+    pcd.points = o3d.utility.Vector3dVector(point_cloud)
+
+    pcd.normals = o3d.utility.Vector3dVector(np.zeros((1, 3)))
+    pcd.estimate_normals()
+    pcd.orient_normals_consistent_tangent_plane(100)
+
+    mesh, densities = o3d.geometry.TriangleMesh.create_from_point_cloud_poisson(pcd,
+                                                                             depth=8,
+                                                                             width=0,
+                                                                             scale=1.1,
+                                                                             linear_fit=False,
+                                                                             n_threads=8)
+    o3d.visualization.draw_geometries([mesh])
+    #bbox = pcd.get_axis_aligned_bounding_box()
+    #p_mesh_crop = mesh.crop(bbox)
+    return mesh
+
+class _PVPlantCreateTerrainMesh:
+
+    def GetResources(self):
+        return {'Pixmap': str(os.path.join(DirIcons, "surface.svg")),
+                'MenuText': QT_TRANSLATE_NOOP("PVPlant", "Create Surface"),
+                'Accel': "C, S",
+                'ToolTip': QT_TRANSLATE_NOOP("PVPlant", "Creates a surface form a cloud of points.")}
+
+    def IsActive(self):
+        return not FreeCAD.ActiveDocument is None
+
+    def Activated(self):
+        self.TaskPanel = _TaskPanel()
+        FreeCADGui.Control.showDialog(self.TaskPanel)
+
+
+if FreeCAD.GuiUp:
+    FreeCADGui.addCommand('PVPlantCreateTerrainMesh', _PVPlantCreateTerrainMesh())

PVPlantCreateTerrainMesh.ui

@@ -0,0 +1,167 @@
+<?xml version="1.0" encoding="UTF-8"?>
+<ui version="4.0">
+ <class>CreateSurface</class>
+ <widget class="QDialog" name="CreateSurface">
+  <property name="geometry">
+   <rect>
+    <x>0</x>
+    <y>0</y>
+    <width>396</width>
+    <height>331</height>
+   </rect>
+  </property>
+  <property name="windowTitle">
+   <string>Create Surface</string>
+  </property>
+  <layout class="QVBoxLayout" name="verticalLayout_2">
+   <property name="leftMargin">
+    <number>0</number>
+   </property>
+   <property name="topMargin">
+    <number>0</number>
+   </property>
+   <property name="rightMargin">
+    <number>0</number>
+   </property>
+   <property name="bottomMargin">
+    <number>0</number>
+   </property>
+   <item>
+    <layout class="QVBoxLayout" name="verticalLayout">
+     <property name="bottomMargin">
+      <number>0</number>
+     </property>
+     <item>
+      <widget class="QLabel" name="SurfaceNameL">
+       <property name="text">
+        <string>Surface Name</string>
+       </property>
+      </widget>
+     </item>
+     <item>
+      <widget class="QLineEdit" name="SurfaceNameLE">
+       <property name="text">
+        <string>Surface</string>
+       </property>
+      </widget>
+     </item>
+     <item>
+      <widget class="QWidget" name="widget_2" native="true">
+       <layout class="QGridLayout" name="gridLayout_2">
+        <item row="0" column="2">
+         <widget class="QLineEdit" name="editBoundary"/>
+        </item>
+        <item row="0" column="0" rowspan="2" colspan="2">
+         <widget class="QLabel" name="label_2">
+          <property name="text">
+           <string>Boundary</string>
+          </property>
+         </widget>
+        </item>
+        <item row="0" column="3">
+         <widget class="QPushButton" name="buttonBoundary">
+          <property name="text">
+           <string>add</string>
+          </property>
+         </widget>
+        </item>
+       </layout>
+      </widget>
+     </item>
+     <item>
+      <widget class="QLabel" name="SelectPointGroupL">
+       <property name="text">
+        <string>Select Point Groups</string>
+       </property>
+      </widget>
+     </item>
+     <item>
+      <widget class="QWidget" name="widget" native="true">
+       <layout class="QGridLayout" name="gridLayout">
+        <property name="leftMargin">
+         <number>0</number>
+        </property>
+        <property name="topMargin">
+         <number>0</number>
+        </property>
+        <property name="rightMargin">
+         <number>0</number>
+        </property>
+        <property name="bottomMargin">
+         <number>0</number>
+        </property>
+        <item row="0" column="0">
+         <widget class="QLabel" name="label">
+          <property name="text">
+           <string>Nube de puntos</string>
+          </property>
+         </widget>
+        </item>
+        <item row="0" column="1">
+         <widget class="QLineEdit" name="editCloud"/>
+        </item>
+        <item row="0" column="2">
+         <widget class="QPushButton" name="buttonAdd">
+          <property name="text">
+           <string>sel</string>
+          </property>
+         </widget>
+        </item>
+       </layout>
+      </widget>
+     </item>
+     <item>
+      <layout class="QHBoxLayout" name="horizontalLayout">
+       <item>
+        <widget class="QLabel" name="MaxlengthL">
+         <property name="text">
+          <string>Maximum Triangle length:</string>
+         </property>
+        </widget>
+       </item>
+       <item>
+        <widget class="QLineEdit" name="MaxlengthLE">
+         <property name="maximumSize">
+          <size>
+           <width>50</width>
+           <height>16777215</height>
+          </size>
+         </property>
+         <property name="text">
+          <string>5</string>
+         </property>
+        </widget>
+       </item>
+      </layout>
+     </item>
+     <item>
+      <layout class="QHBoxLayout" name="horizontalLayout_2">
+       <item>
+        <widget class="QLabel" name="OtherValueL">
+         <property name="text">
+          <string>Maximum Triangle Angle:</string>
+         </property>
+        </widget>
+       </item>
+       <item>
+        <widget class="QLineEdit" name="MaxAngleLE">
+         <property name="maximumSize">
+          <size>
+           <width>50</width>
+           <height>16777215</height>
+          </size>
+         </property>
+         <property name="text">
+          <string>90</string>
+         </property>
+        </widget>
+       </item>
+      </layout>
+     </item>
+    </layout>
+   </item>
+  </layout>
+ </widget>
+ <resources/>
+ <connections/>
+</ui>

PVPlantEarthWorks.py

@@ -0,0 +1,967 @@
+import math
+
+import FreeCAD
+import Part
+import ArchComponent
+from pivy import coin
+import numpy as np
+
+if FreeCAD.GuiUp:
+    import FreeCADGui, os
+    from PySide import QtCore, QtGui
+    from PySide.QtCore import QT_TRANSLATE_NOOP
+else:
+    # \cond
+    def translate(ctxt, txt):
+        return txt
+
+    def QT_TRANSLATE_NOOP(ctxt, txt):
+        return txt
+    # \endcond
+
+try:
+    _fromUtf8 = QtCore.QString.fromUtf8
+except AttributeError:
+    def _fromUtf8(s):
+        return s
+
+import PVPlantResources
+from PVPlantResources import DirIcons as DirIcons
+
+voltype = ["Fill", "Cut"]
+
+
+def makeEarthWorksVolume(vtype = 0):
+    obj = FreeCAD.ActiveDocument.addObject("Part::FeaturePython", voltype[vtype])
+    EarthWorksVolume(obj)
+    ViewProviderEarthWorksVolume(obj.ViewObject)
+    return obj
+
+
+class EarthWorksVolume(ArchComponent.Component):
+    def __init__(self, obj):
+        # Definición de Variables:
+        ArchComponent.Component.__init__(self, obj)
+        self.obj = obj
+        self.setProperties(obj)
+
+    def setProperties(self, obj):
+        # Definicion de Propiedades:
+        pl = obj.PropertiesList
+
+        if not ("VolumeType" in pl):
+            obj.addProperty("App::PropertyEnumeration",
+                            "VolumeType",
+                            "Volume",
+                            "Connection").VolumeType = voltype
+
+        if not ("SurfaceSlope" in pl):
+            obj.addProperty("App::PropertyPercent",
+                            "SurfaceSlope",
+                            "Volume",
+                            "Connection").SurfaceSlope = 2
+
+        if not ("VolumeMesh" in pl):
+            obj.addProperty("Mesh::PropertyMeshKernel",
+                            "VolumeMesh",
+                            "Volume",
+                            "Volume")
+        obj.setEditorMode("VolumeMesh", 2)
+
+        if not ("Volume" in pl):
+            obj.addProperty("App::PropertyVolume",
+                            "Volume",
+                            "Volume",
+                            "Volume")
+        obj.setEditorMode("Volume", 1)
+
+        obj.Proxy = self
+        obj.IfcType = "Civil Element"
+        obj.setEditorMode("IfcType", 1)
+        obj.Proxy = self
+
+    def onDocumentRestored(self, obj):
+        ArchComponent.Component.onDocumentRestored(self, obj)
+        self.setProperties(obj)
+
+    def onChange(self, obj, prop):
+        if prop == "VolumeMesh":
+            if obj.VolumeMesh:
+                obj.VolumeMesh = obj.VolumeMesh.Volume
+
+    def execute(self, obj):
+        '''  '''
+        pass
+
+
+class ViewProviderEarthWorksVolume:
+    "A View Provider for the Pipe object"
+
+    def __init__(self, vobj):
+        ''' Set view properties.  '''
+        pl = vobj.PropertiesList
+
+        (r, g, b) = (1.0, 0.0, 0.0) if vobj.Object.VolumeType == "Cut" else (0.0, 0.0, 1.0)
+
+        # Triangulation properties.
+        if not "Transparency" in pl:
+            vobj.addProperty("App::PropertyIntegerConstraint",
+                             "Transparency", "Surface Style",
+                             "Set triangle face transparency")
+        vobj.Transparency = (50, 0, 100, 1)
+
+        if not "ShapeColor" in pl:
+            vobj.addProperty("App::PropertyColor",
+                             "ShapeColor",
+                             "Surface Style",
+                             "Set triangle face color")
+        vobj.ShapeColor = (r, g, b, vobj.Transparency / 100)
+
+        if not "ShapeMaterial" in pl:
+            vobj.addProperty("App::PropertyMaterial",
+                             "ShapeMaterial", "Surface Style",
+                             "Triangle face material")
+        vobj.ShapeMaterial = FreeCAD.Material()
+
+        if not "LineTransparency" in pl:
+            vobj.addProperty("App::PropertyIntegerConstraint",
+                             "LineTransparency", "Surface Style",
+                             "Set triangle edge transparency")
+        vobj.LineTransparency = (50, 0, 100, 1)
+
+        if not "LineColor" in pl:
+            vobj.addProperty("App::PropertyColor",
+                             "LineColor", "Surface Style",
+                             "Set triangle face color")
+        vobj.LineColor = (0.5, 0.5, 0.5, vobj.LineTransparency / 100)
+
+        '''vobj.addProperty(
+            "App::PropertyMaterial", "LineMaterial", "Surface Style",
+            "Triangle face material").LineMaterial = FreeCAD.Material()
+
+        vobj.addProperty(
+            "App::PropertyFloatConstraint", "LineWidth", "Surface Style",
+            "Set triangle edge line width").LineWidth = (0.0, 1.0, 20.0, 1.0)
+
+        # Boundary properties.
+        vobj.addProperty(
+            "App::PropertyColor", "BoundaryColor", "Boundary Style",
+            "Set boundary contour color").BoundaryColor = (0.0, 0.75, 1.0, 0.0)
+
+        vobj.addProperty(
+            "App::PropertyFloatConstraint", "BoundaryWidth", "Boundary Style",
+            "Set boundary contour line width").BoundaryWidth = (3.0, 1.0, 20.0, 1.0)
+
+        vobj.addProperty(
+            "App::PropertyEnumeration", "BoundaryPattern", "Boundary Style",
+            "Set a line pattern for boundary").BoundaryPattern = [*line_patterns]
+
+        vobj.addProperty(
+            "App::PropertyIntegerConstraint", "PatternScale", "Boundary Style",
+            "Scale the line pattern").PatternScale = (3, 1, 20, 1)
+
+        # Contour properties.
+        vobj.addProperty(
+            "App::PropertyColor", "MajorColor", "Contour Style",
+            "Set major contour color").MajorColor = (1.0, 0.0, 0.0, 0.0)
+
+        vobj.addProperty(
+            "App::PropertyFloatConstraint", "MajorWidth", "Contour Style",
+            "Set major contour line width").MajorWidth = (4.0, 1.0, 20.0, 1.0)
+
+        vobj.addProperty(
+            "App::PropertyColor", "MinorColor", "Contour Style",
+            "Set minor contour color").MinorColor = (1.0, 1.0, 0.0, 0.0)
+
+        vobj.addProperty(
+            "App::PropertyFloatConstraint", "MinorWidth", "Contour Style",
+            "Set major contour line width").MinorWidth = (2.0, 1.0, 20.0, 1.0)
+'''
+        vobj.Proxy = self
+        vobj.ShapeMaterial.DiffuseColor = vobj.ShapeColor
+
+    def onChanged(self, vobj, prop):
+        '''
+        Update Object visuals when a view property changed.
+        '''
+        if prop == "ShapeColor" or prop == "Transparency":
+            if hasattr(vobj, "ShapeColor") and hasattr(vobj, "Transparency"):
+                color = vobj.getPropertyByName("ShapeColor")
+                transparency = vobj.getPropertyByName("Transparency")
+                color = (color[0], color[1], color[2], transparency / 100)
+                vobj.ShapeMaterial.DiffuseColor = color
+
+        if prop == "ShapeMaterial":
+            if hasattr(vobj, "ShapeMaterial"):
+                material = vobj.getPropertyByName("ShapeMaterial")
+                self.face_material.diffuseColor.setValue(material.DiffuseColor[:3])
+                self.face_material.transparency = material.DiffuseColor[3]
+
+        if prop == "LineColor" or prop == "LineTransparency":
+            if hasattr(vobj, "LineColor") and hasattr(vobj, "LineTransparency"):
+                color = vobj.getPropertyByName("LineColor")
+                transparency = vobj.getPropertyByName("LineTransparency")
+                color = (color[0], color[1], color[2], transparency / 100)
+                vobj.LineMaterial.DiffuseColor = color
+
+        if prop == "LineMaterial":
+            material = vobj.getPropertyByName(prop)
+            self.edge_material.diffuseColor.setValue(material.DiffuseColor[:3])
+            self.edge_material.transparency = material.DiffuseColor[3]
+
+        if prop == "LineWidth":
+            width = vobj.getPropertyByName(prop)
+            self.edge_style.lineWidth = width
+
+        if prop == "BoundaryColor":
+            color = vobj.getPropertyByName(prop)
+            self.boundary_color.rgb = color[:3]
+
+        if prop == "BoundaryWidth":
+            width = vobj.getPropertyByName(prop)
+            self.boundary_style.lineWidth = width
+
+        if prop == "BoundaryPattern":
+            if hasattr(vobj, "BoundaryPattern"):
+                pattern = vobj.getPropertyByName(prop)
+                self.boundary_style.linePattern = line_patterns[pattern]
+
+        if prop == "PatternScale":
+            if hasattr(vobj, "PatternScale"):
+                scale = vobj.getPropertyByName(prop)
+                self.boundary_style.linePatternScaleFactor = scale
+
+        if prop == "MajorColor":
+            color = vobj.getPropertyByName(prop)
+            self.major_color.rgb = color[:3]
+
+        if prop == "MajorWidth":
+            width = vobj.getPropertyByName(prop)
+            self.major_style.lineWidth = width
+
+        if prop == "MinorColor":
+            color = vobj.getPropertyByName(prop)
+            self.minor_color.rgb = color[:3]
+
+        if prop == "MinorWidth":
+            width = vobj.getPropertyByName(prop)
+            self.minor_style.lineWidth = width
+
+
+    def attach(self, vobj):
+        '''
+        Create Object visuals in 3D view.
+        '''
+        # GeoCoords Node.
+        self.geo_coords = coin.SoGeoCoordinate()
+
+        # Surface features.
+        self.triangles = coin.SoIndexedFaceSet()
+        self.face_material = coin.SoMaterial()
+        self.edge_material = coin.SoMaterial()
+        self.edge_color = coin.SoBaseColor()
+        self.edge_style = coin.SoDrawStyle()
+        self.edge_style.style = coin.SoDrawStyle.LINES
+
+        shape_hints = coin.SoShapeHints()
+        shape_hints.vertex_ordering = coin.SoShapeHints.COUNTERCLOCKWISE
+        mat_binding = coin.SoMaterialBinding()
+        mat_binding.value = coin.SoMaterialBinding.PER_FACE
+        offset = coin.SoPolygonOffset()
+        offset.styles = coin.SoPolygonOffset.LINES
+        offset.factor = -2.0
+
+        # Boundary features.
+        self.boundary_color = coin.SoBaseColor()
+        self.boundary_coords = coin.SoGeoCoordinate()
+        self.boundary_lines = coin.SoLineSet()
+        self.boundary_style = coin.SoDrawStyle()
+        self.boundary_style.style = coin.SoDrawStyle.LINES
+
+        # Boundary root.
+        boundaries = coin.SoType.fromName('SoFCSelection').createInstance()
+        boundaries.style = 'EMISSIVE_DIFFUSE'
+        boundaries.addChild(self.boundary_color)
+        boundaries.addChild(self.boundary_style)
+        boundaries.addChild(self.boundary_coords)
+        boundaries.addChild(self.boundary_lines)
+
+        # Major Contour features.
+        self.major_color = coin.SoBaseColor()
+        self.major_coords = coin.SoGeoCoordinate()
+        self.major_lines = coin.SoLineSet()
+        self.major_style = coin.SoDrawStyle()
+        self.major_style.style = coin.SoDrawStyle.LINES
+
+        # Major Contour root.
+        major_contours = coin.SoSeparator()
+        major_contours.addChild(self.major_color)
+        major_contours.addChild(self.major_style)
+        major_contours.addChild(self.major_coords)
+        major_contours.addChild(self.major_lines)
+
+        # Minor Contour features.
+        self.minor_color = coin.SoBaseColor()
+        self.minor_coords = coin.SoGeoCoordinate()
+        self.minor_lines = coin.SoLineSet()
+        self.minor_style = coin.SoDrawStyle()
+        self.minor_style.style = coin.SoDrawStyle.LINES
+
+        # Minor Contour root.
+        minor_contours = coin.SoSeparator()
+        minor_contours.addChild(self.minor_color)
+        minor_contours.addChild(self.minor_style)
+        minor_contours.addChild(self.minor_coords)
+        minor_contours.addChild(self.minor_lines)
+
+        # Highlight for selection.
+        highlight = coin.SoType.fromName('SoFCSelection').createInstance()
+        highlight.style = 'EMISSIVE_DIFFUSE'
+        highlight.addChild(shape_hints)
+        highlight.addChild(mat_binding)
+        highlight.addChild(self.geo_coords)
+        highlight.addChild(self.triangles)
+        highlight.addChild(boundaries)
+
+        # Face root.
+        face = coin.SoSeparator()
+        face.addChild(self.face_material)
+        face.addChild(highlight)
+
+        # Edge root.
+        edge = coin.SoSeparator()
+        edge.addChild(self.edge_material)
+        edge.addChild(self.edge_style)
+        edge.addChild(highlight)
+
+        # Surface root.
+        surface_root = coin.SoSeparator()
+        surface_root.addChild(face)
+        surface_root.addChild(offset)
+        surface_root.addChild(edge)
+        surface_root.addChild(major_contours)
+        surface_root.addChild(minor_contours)
+        vobj.addDisplayMode(surface_root, "Surface")
+
+        # Boundary root.
+        boundary_root = coin.SoSeparator()
+        boundary_root.addChild(boundaries)
+        vobj.addDisplayMode(boundary_root, "Boundary")
+
+        # Elevation/Shaded root.
+        shaded_root = coin.SoSeparator()
+        shaded_root.addChild(face)
+        vobj.addDisplayMode(shaded_root, "Elevation")
+        vobj.addDisplayMode(shaded_root, "Slope")
+        vobj.addDisplayMode(shaded_root, "Shaded")
+
+        # Flat Lines root.
+        flatlines_root = coin.SoSeparator()
+        flatlines_root.addChild(face)
+        flatlines_root.addChild(offset)
+        flatlines_root.addChild(edge)
+        vobj.addDisplayMode(flatlines_root, "Flat Lines")
+
+        # Wireframe root.
+        wireframe_root = coin.SoSeparator()
+        wireframe_root.addChild(edge)
+        wireframe_root.addChild(major_contours)
+        wireframe_root.addChild(minor_contours)
+        vobj.addDisplayMode(wireframe_root, "Wireframe")
+
+        # Take features from properties.
+        self.onChanged(vobj, "ShapeColor")
+        self.onChanged(vobj, "LineColor")
+        self.onChanged(vobj, "LineWidth")
+        '''self.onChanged(vobj, "BoundaryColor")
+        self.onChanged(vobj, "BoundaryWidth")
+        self.onChanged(vobj, "BoundaryPattern")
+        self.onChanged(vobj, "PatternScale")
+        self.onChanged(vobj, "MajorColor")
+        self.onChanged(vobj, "MajorWidth")
+        self.onChanged(vobj, "MinorColor")
+        self.onChanged(vobj, "MinorWidth")'''
+
+
+    def updateData(self, obj, prop):
+        '''
+        Update Object visuals when a data property changed.
+        '''
+
+        # Set System.
+        geo_system = ["UTM", FreeCAD.ActiveDocument.Site.UtmZone, "FLAT"]
+        self.geo_coords.geoSystem.setValues(geo_system)
+        self.boundary_coords.geoSystem.setValues(geo_system)
+        self.major_coords.geoSystem.setValues(geo_system)
+        self.minor_coords.geoSystem.setValues(geo_system)
+
+        if prop == "VolumeMesh":
+            mesh = obj.VolumeMesh
+            copy_mesh = mesh.copy()
+            #copy_mesh.Placement.move(origin.Origin)
+
+            triangles = []
+            for i in copy_mesh.Topology[1]:
+                triangles.extend(list(i))
+                triangles.append(-1)
+
+            self.geo_coords.point.values = copy_mesh.Topology[0]
+            self.triangles.coordIndex.values = triangles
+            del copy_mesh
+
+        '''if prop == "ContourShapes":
+            contour_shape = obj.getPropertyByName(prop)
+
+            if contour_shape.SubShapes:
+                major_shape = contour_shape.SubShapes[0]
+                points, vertices = self.wire_view(major_shape, origin.Origin)
+
+                self.major_coords.point.values = points
+                self.major_lines.numVertices.values = vertices
+
+                minor_shape = contour_shape.SubShapes[1]
+                points, vertices = self.wire_view(minor_shape, origin.Origin)
+
+                self.minor_coords.point.values = points
+                self.minor_lines.numVertices.values = vertices
+
+        if prop == "BoundaryShapes":
+            boundary_shape = obj.getPropertyByName(prop)
+            points, vertices = self.wire_view(boundary_shape, origin.Origin, True)
+
+            self.boundary_coords.point.values = points
+            self.boundary_lines.numVertices.values = vertices
+
+        if prop == "AnalysisType" or prop == "Ranges":
+            analysis_type = obj.getPropertyByName("AnalysisType")
+            ranges = obj.getPropertyByName("Ranges")
+
+            if analysis_type == "Default":
+                if hasattr(obj.ViewObject, "ShapeMaterial"):
+                    material = obj.ViewObject.ShapeMaterial
+                    self.face_material.diffuseColor = material.DiffuseColor[:3]
+
+            if analysis_type == "Elevation":
+                colorlist = self.elevation_analysis(obj.Mesh, ranges)
+                self.face_material.diffuseColor.setValues(0, len(colorlist), colorlist)
+
+            elif analysis_type == "Slope":
+                colorlist = self.slope_analysis(obj.Mesh, ranges)
+                self.face_material.diffuseColor.setValues(0, len(colorlist), colorlist)
+    '''
+    def getIcon(self):
+        """ Return the path to the appropriate icon. """
+        return str(os.path.join(DirIcons, "solar-fixed.svg"))
+
+    def getDisplayModes(self, vobj):
+        '''
+        Return a list of display modes.
+        '''
+        modes = ["Surface", "Boundary", "Flat Lines", "Shaded", "Wireframe"]
+
+        return modes
+
+    def getDefaultDisplayMode(self):
+        '''
+        Return the name of the default display mode.
+        '''
+
+        return "Surface"
+
+    def setDisplayMode(self, mode):
+        '''
+        Map the display mode defined in attach with
+        those defined in getDisplayModes.
+        '''
+        return mode
+
+    def __getstate__(self):
+        """
+        Save variables to file.
+        """
+        return None
+
+    def __setstate__(self, state):
+        """
+        Get variables from file.
+        """
+        return None
+
+
+class _EarthWorksTaskPanel:
+    def __init__(self):
+        self.To = None
+
+        # self.form:
+        self.form = FreeCADGui.PySideUic.loadUi(os.path.join(PVPlantResources.__dir__, "PVPlantEarthworks.ui"))
+        self.form.setWindowIcon(QtGui.QIcon(os.path.join(PVPlantResources.DirIcons, "convert.svg")))
+
+    def accept(self):
+        from datetime import datetime
+        starttime = datetime.now()
+
+        import MeshPart as mp
+        land = FreeCAD.ActiveDocument.Terrain.Mesh.copy()
+        frames = []
+        for obj in FreeCADGui.Selection.getSelection():
+            if hasattr(obj, "Proxy"):
+                if obj.Proxy.Type == "Tracker":
+                    if not (obj in frames):
+                        frames.append(obj)
+                elif obj.Proxy.Type == "FrameArea":
+                    for fr in obj.Frames:
+                        if not (fr in frames):
+                            frames.append(fr)
+        if len(frames) == 0:
+            return False
+
+        FreeCAD.ActiveDocument.openTransaction("Calcular movimiento de tierras")
+        def calculateEarthWorks(line, extreme=False):
+            pts = []
+            pts1 = []
+            line1 = line.copy()
+            angles = line.Placement.Rotation.toEulerAngles("XYZ")
+            line1.Placement.Rotation.setEulerAngles("XYZ", 0, 0, angles[2])
+            line1.Placement.Base.z = 0
+            pro = mp.projectShapeOnMesh(line1, land, FreeCAD.Vector(0, 0, 1))
+            flat = []
+            for points in pro:
+                flat.extend(points)
+            pro = Part.makePolygon(flat)
+            points = pro.discretize(Distance=500)
+
+            for point in points:
+                ver = Part.Vertex(point)
+                dist = ver.distToShape(line)
+                linepoint = dist[1][0][1]
+
+                if not extreme:
+                    if self.form.groupTolerances.isChecked():
+                        if linepoint.z > point.z:
+                            if linepoint.sub(point).Length > self.form.editToleranceCut.value():
+                                pts.append(linepoint)
+                        elif linepoint.z < point.z:
+                            if linepoint.sub(point).Length > self.form.editToleranceFill.value():
+                                pts1.append(linepoint)
+                    else:
+                        if linepoint.z > point.z:
+                            pts.append(linepoint)
+                        elif linepoint.z < point.z:
+                            pts1.append(linepoint)
+                        #pts.append(linepoint)
+                else:
+                    if linepoint.z > point.z:
+                        if linepoint.sub(point).Length > 200:
+                            pts.append(linepoint)
+
+            return pts, pts1
+
+        tools = [[],[]]
+        ver = 2
+        if ver == 0:
+            frames = sorted(frames, key=lambda x: (x.Placement.Base.x, x.Placement.Base.y))
+            for frame in frames:
+                length = frame.Setup.Length.Value / 2
+                p1 = FreeCAD.Vector(-length, 0, 0)
+                p2 = FreeCAD.Vector(length, 0, 0)
+                line = Part.LineSegment(p1, p2).toShape()
+                line.Placement = frame.Placement.copy()
+                line.Placement.Base.x = frame.Shape.BoundBox.XMin
+                step = (frame.Shape.BoundBox.XMax - frame.Shape.BoundBox.XMin) / 2
+                for n in range(3):
+                    ret = calculateEarthWorks(line, n % 2)
+                    tools[0].extend(ret[0])
+                    tools[1].extend(ret[1])
+                    line.Placement.Base.x += step
+        elif ver == 1:
+            from PVPlantPlacement import getCols
+            columns = getCols(frames)
+
+            '''colelements = set()
+            rowelements = set()
+            for groups in columns:
+                for group in groups:
+                    for frame in group:
+                        colelements.add(frame.Placement.Base.x)
+                        rowelements.add(frame.Placement.Base.y)
+            colelements = sorted(colelements)
+            rowelements = sorted(rowelements, reverse=True)
+            print("Cols: ", len(colelements), " - ", colelements)
+            print("Rows: ", len(rowelements), " - ", rowelements)
+
+            a = []
+            colnum = len(colelements)
+            for r in range(len(rowelements)):
+                a.append([None] * colnum)
+            mat = np.array(a, dtype=object)
+            for groups in columns:
+                for group in groups:
+                    for frame in group:
+                        colidx = colelements.index(frame.Placement.Base.x)
+                        rowidx = rowelements.index(frame.Placement.Base.y)
+                        mat[rowidx][colidx] = frame
+            print(mat)
+            return'''
+
+            for groups in columns:
+                for group in groups:
+                    first = group[0]
+                    last = group[-1]
+                    for frame in group:
+                        length = frame.Setup.Length.Value / 2
+                        p1 = FreeCAD.Vector(-(length + (self.form.editOffset.value() if frame == first else -1000)),
+                                            0, 0)
+                        p2 = FreeCAD.Vector(length + (self.form.editOffset.value() if frame == last else -1000),
+                                            0, 0)
+                        line = Part.LineSegment(p1, p2).toShape()
+                        line.Placement = frame.Placement.copy()
+                        line.Placement.Base.x = frame.Shape.BoundBox.XMin
+                        step = (frame.Shape.BoundBox.XMax - frame.Shape.BoundBox.XMin) / 2
+                        for n in range(3):
+                            ret = calculateEarthWorks(line, n % 2 == 1)
+                            tools[0].extend(ret[0])
+                            tools[1].extend(ret[1])
+                            line.Placement.Base.x += step
+        elif ver == 2:
+            print("versión 2")
+            import PVPlantPlacement
+            rows, columns = PVPlantPlacement.getRows(frames)
+            if (rows is None) or (columns is None):
+                print("Nada que procesar")
+                return False
+            tools = []
+            lofts = []
+            for group in rows:
+                lines = []
+                cont = 0
+                while cont < len(group):
+                    aw = 0
+                    if cont > 0:
+                        p0 = FreeCAD.Vector(group[cont - 1].Placement.Base)
+                        p1 = FreeCAD.Vector(group[cont].Placement.Base)
+                        aw = getAngle(p0, p1)
+
+                    ae = 0
+                    if cont < (len(group) - 1):
+                        p1 = FreeCAD.Vector(group[cont].Placement.Base)
+                        p2 = FreeCAD.Vector(group[cont + 1].Placement.Base)
+                        ae = getAngle(p1, p2)
+
+                    lng = int(group[cont].Setup.Length / 2)
+                    wdt = int(group[cont].Setup.Width / 2)
+                    line = Part.LineSegment(FreeCAD.Vector(-lng, 0, 0),
+                                            FreeCAD.Vector(lng, 0, 0)).toShape()
+
+                    line = Part.LineSegment(FreeCAD.Vector(group[cont].Setup.Shape.SubShapes[1].SubShapes[0].SubShapes[0].Placement.Base.x, 0, 0),
+                                            FreeCAD.Vector(group[cont].Setup.Shape.SubShapes[1].SubShapes[0].SubShapes[-1].Placement.Base.x, 0, 0)).toShape()
+
+                    anf = (aw + ae) / 2
+                    if anf > FreeCAD.ActiveDocument.MaximumWestEastSlope.Value:
+                        anf = FreeCAD.ActiveDocument.MaximumWestEastSlope.Value
+                    zz = wdt * math.sin(math.radians(anf))
+
+                    li = line.copy()
+                    li.Placement = group[cont].Placement
+                    li.Placement.Rotation = group[cont].Placement.Rotation
+                    li.Placement.Base.x -= wdt #+ (3000 if cont == 0 else 0))
+                    li.Placement.Base.z -= zz
+                    lines.append(li)
+
+                    ld = line.copy()
+                    ld.Placement = group[cont].Placement
+                    ld.Placement.Rotation = group[cont].Placement.Rotation
+                    ld.Placement.Base.x += wdt #+ (3000 if cont == len(group) - 1 else 0))
+                    ld.Placement.Base.z += zz
+                    lines.append(ld)
+                    tools.append([group[cont], li, ld])
+                    cont += 1
+                loft = Part.makeLoft(lines, False, True, False)
+                lofts.append(loft)
+
+            for group in rows:
+                lines = []
+                for frame in group:
+                    col, idx = searchFrameInColumns(frame, columns)
+                    tool = searchTool(frame, tools)
+                    if idx == 0:
+                        ''' '''
+
+                    if idx == (len(col) - 1):
+                        ''' '''
+
+                    if (idx + 1) < len(col):
+                        frame1 = col[idx + 1]
+                        tool1 = searchTool(frame1, tools)
+                        line = Part.LineSegment(tool[1].Vertexes[1].Point, tool1[1].Vertexes[0].Point).toShape()
+                        lines.append(line)
+                        line = Part.LineSegment(tool[2].Vertexes[1].Point, tool1[2].Vertexes[0].Point).toShape()
+                        lines.append(line)
+
+                if len(lines) > 0:
+                    loft = Part.makeLoft(lines, False, True, False)
+                    lofts.append(loft)
+
+            faces = []
+            for loft in lofts:
+                faces.extend(loft.Faces)
+            sh = Part.makeShell(faces)
+            import Utils.PVPlantUtils as utils
+            import Mesh
+            pro = utils.getProjected(sh)
+            pro = utils.simplifyWire(pro)
+            #pro = pro.makeOffset2D(20000, 2, False, False, True)
+            Part.show(sh, "loft")
+            Part.show(pro, "pro")
+            pts = [ver.Point for ver in pro.Vertexes]
+            '''if pts[0] != pts[-1]:
+                pts.append(pts[0])'''
+            land.trim(pts, 1)
+            tmp = []
+            for face in sh.Faces:
+                wire = face.Wires[0].copy()
+                pl = wire.Placement.Base
+                wire.Placement.Base = wire.Placement.Base - pl
+                wire = wire.scale(2)
+                wire.Placement.Base = wire.Placement.Base + pl
+                #wire = wire.makeOffset2D(10000, 0, False, False, True)
+                wire.Placement.Base.z = wire.Placement.Base.z - 10000
+                face1 = Part.makeLoft([face.Wires[0], wire], True, True, False)
+
+
+                Part.show(face1, "tool")
+                #tmp.append(face.extrude(FreeCAD.Vector(0, 0, -10000)))
+                #Part.show(tmp[-1], "face-extrude")
+            sh = sh.extrude(FreeCAD.Vector(0, 0, -10000))
+            sh = Part.Solid(sh)
+            Part.show(sh)
+            import MeshPart as mp
+            msh = mp.meshFromShape(Shape=sh)  # , MaxLength=1)
+            # msh = msh.smooth("Laplace", 3)
+            Mesh.show(msh, "tool")
+            Mesh.show(land, "trim")
+            '''inner = msh.inner(land)
+            Mesh.show(inner)
+            outer = msh.inner(land)
+            Mesh.show(outer)'''
+            '''intersec = land.section(msh, MinDist=0.01)
+            import Draft
+            for sec in intersec:
+                Draft.makeWire(sec)'''
+
+            FreeCAD.ActiveDocument.commitTransaction()
+            self.closeForm()
+            return True
+
+        import MeshTools.Triangulation as TriangulateMesh
+        import MeshTools.MeshGetBoundary as mgb
+        import Mesh
+
+        for ind, points in enumerate(tools):
+            mesh = TriangulateMesh.Triangulate(points, MaxlengthLE=3000, MaxAngleLE=math.radians(100))
+            if mesh:
+                for mesh in mesh.getSeparateComponents():
+                    boundary = mgb.get_boundary(mesh)
+                    Part.show(boundary)
+                    '''if self.form.editOffset.value() != 0:
+                        import Utils.PVPlantUtils as utils
+                        pro = utils.getProjected(boundary)
+                        pro = pro.makeOffset2D(self.form.editOffset.value(), 0, False, False, True)
+                        # TODO: paso intermedio de restar las areas prohibidas
+                        pro = mp.projectShapeOnMesh(pro, land, FreeCAD.Vector(0, 0, 1))
+                        cnt = 0
+                        for lp in pro:
+                            cnt += len(lp)
+                        # points.extend(boundary.Wires[0].discretize(Number=cnt))
+                        points = boundary.Wires[0].discretize(Distance=cnt)
+                        for lp in pro:
+                            points.extend(lp)
+                        mesh1 = TriangulateMesh.Triangulate(points, MaxlengthLE=5000)  # , MaxAngleLE=math.pi / 1.334)
+                        import Mesh
+                        Mesh.show(mesh1)
+                        boundary = Part.makeCompound([])
+                        for section in pro:
+                            if len(section) > 0:
+                                try:
+                                    boundary.add(Part.makePolygon(section))
+                                except:
+                                    pass
+                    Part.show(boundary)'''
+                    #mesh.smooth("Laplace", 3)
+                    #Mesh.show(mesh)
+                    #Part.show(boundary)
+                    vol = makeEarthWorksVolume(ind)
+                    vol.VolumeMesh = mesh.copy()
+                    if ind == 0:
+                        ''' put inside fills group '''
+                    else:
+                        ''' put inside fills group '''
+
+        FreeCAD.ActiveDocument.commitTransaction()
+        self.closeForm()
+        return True
+
+    def reject(self):
+        self.closeForm()
+        return True
+
+    def closeForm(self):
+        FreeCADGui.Control.closeDialog()
+
+
+def getAngle(vec1, vec2):
+    dX = vec2.x - vec1.x
+    dZ = vec2.z - vec1.z
+    return math.degrees(math.atan2(float(dZ), float(dX)))
+
+
+def searchFrameInColumns(obj, columns):
+    for colidx, col in enumerate(columns):
+        for group in col:
+            if obj in group:
+                return group, group.index(obj) #groupidx
+
+
+def searchTool(obj, tools):
+    for tool in tools:
+        if obj in tool:
+            return tool
+
+
+class _CommandCalculateEarthworks:
+
+    def GetResources(self):
+        return {'Pixmap': str(os.path.join(PVPlantResources.DirIcons, "pico.svg")),
+                'Accel': "C, E",
+                'MenuText': QT_TRANSLATE_NOOP("Placement", "Movimiento de tierras"),
+                'ToolTip': QT_TRANSLATE_NOOP("Placement", "Calcular el movimiento de tierras")}
+
+    def Activated(self):
+        TaskPanel = _EarthWorksTaskPanel()
+        FreeCADGui.Control.showDialog(TaskPanel)
+
+    def IsActive(self):
+        active = not (FreeCAD.ActiveDocument is None)
+        if not (FreeCAD.ActiveDocument.getObject("Terrain") is None):
+            active = active and not (FreeCAD.ActiveDocument.getObject("Terrain").Mesh is None)
+        return active
+
+if FreeCAD.GuiUp:
+    FreeCADGui.addCommand('PVPlantEarthworks', _CommandCalculateEarthworks())
+
+
+def accept():
+    import MeshPart as mp
+    land = FreeCAD.ActiveDocument.Terrain.Mesh
+    frames = []
+    for obj in FreeCADGui.Selection.getSelection():
+        if hasattr(obj, "Proxy"):
+            if obj.Proxy.Type == "Tracker":
+                if not (obj in frames):
+                    frames.append(obj)
+            elif obj.Proxy.Type == "FrameArea":
+                for fr in obj.Frames:
+                    if not (fr in frames):
+                        frames.append(fr)
+    if len(frames) == 0:
+        return False
+
+    FreeCAD.ActiveDocument.openTransaction("Calcular movimiento de tierras")
+    import PVPlantPlacement
+    rows, columns = PVPlantPlacement.getRows(frames)
+    if (rows is None) or (columns is None):
+        print("Nada que procesar")
+        return False
+    tools = []
+
+    for group in rows:
+        lines = []
+        cont = 0
+        while cont < len(group):
+            aw = 0
+            if cont > 0:
+                p0 = FreeCAD.Vector(group[cont - 1].Placement.Base)
+                p1 = FreeCAD.Vector(group[cont].Placement.Base)
+                aw = getAngle(p0, p1)
+
+            ae = 0
+            if cont < (len(group) - 1):
+                p1 = FreeCAD.Vector(group[cont].Placement.Base)
+                p2 = FreeCAD.Vector(group[cont + 1].Placement.Base)
+                ae = getAngle(p1, p2)
+
+            lng = int(group[cont].Setup.Length / 2)
+            wdt = int(group[cont].Setup.Width / 2)
+            line = Part.LineSegment(FreeCAD.Vector(-lng, 0, 0),
+                                    FreeCAD.Vector(lng, 0, 0)).toShape()
+
+            line = Part.LineSegment(FreeCAD.Vector(group[cont].Setup.Shape.SubShapes[1].SubShapes[0].SubShapes[0].Placement.Base.x, 0, 0),
+                                    FreeCAD.Vector(group[cont].Setup.Shape.SubShapes[1].SubShapes[0].SubShapes[-1].Placement.Base.x, 0, 0)).toShape()
+
+            anf = (aw + ae) / 2
+            if anf > FreeCAD.ActiveDocument.MaximumWestEastSlope.Value:
+                anf = FreeCAD.ActiveDocument.MaximumWestEastSlope.Value
+            zz = wdt * math.sin(math.radians(anf))
+
+            li = line.copy()
+            li.Placement = group[cont].Placement
+            li.Placement.Rotation = group[cont].Placement.Rotation
+            li.Placement.Base.x -= wdt #+ (3000 if cont == 0 else 0))
+            li.Placement.Base.z -= zz
+            lines.append(li)
+
+            ld = line.copy()
+            ld.Placement = group[cont].Placement
+            ld.Placement.Rotation = group[cont].Placement.Rotation
+            ld.Placement.Base.x += wdt #+ (3000 if cont == len(group) - 1 else 0))
+            ld.Placement.Base.z += zz
+            lines.append(ld)
+            tools.append([group[cont], li, ld])
+            cont += 1
+
+        loft = Part.makeLoft(lines, False, True, False)
+        import MeshPart as mp
+        msh = mp.meshFromShape(Shape=loft)  #, MaxLength=1)
+        #msh = msh.smooth("Laplace", 3)
+        import Mesh
+        Mesh.show(msh)
+        '''intersec = land.section(msh, MinDist=0.01)
+        import Draft
+        for sec in intersec:
+            Draft.makeWire(sec)'''
+
+    for group in rows:
+        lines = []
+        for frame in group:
+            col, idx = searchFrameInColumns(frame, columns)
+            tool = searchTool(frame, tools)
+            if idx == 0:
+                ''' '''
+            if idx == (len(col) - 1):
+                ''' '''
+
+            if (idx + 1) < len(col):
+                frame1 = col[idx + 1]
+                tool1 = searchTool(frame1, tools)
+                line = Part.LineSegment(tool[1].Vertexes[1].Point, tool1[1].Vertexes[0].Point).toShape()
+                Part.show(line)
+                lines.append(line)
+                line = Part.LineSegment(tool[2].Vertexes[1].Point, tool1[2].Vertexes[0].Point).toShape()
+                Part.show(line)
+                lines.append(line)
+
+
+        if len(lines) > 0:
+            loft = Part.makeLoft(lines, False, True, False)
+            import MeshPart as mp
+            msh = mp.meshFromShape(Shape=loft)  # , MaxLength=1)
+            #msh = msh.smooth("Laplace", 3)
+            import Mesh
+            Mesh.show(msh)
+            intersec = land.section(msh, MinDist=0.01)
+            import Draft
+            for sec in intersec:
+                Draft.makeWire(sec)
+
+    FreeCAD.ActiveDocument.commitTransaction()
+    self.closeForm()
+    return True

PVPlantEarthworks.ui

@@ -0,0 +1,180 @@
+<?xml version="1.0" encoding="UTF-8"?>
+<ui version="4.0">
+ <class>formRack</class>
+ <widget class="QDialog" name="formRack">
+  <property name="geometry">
+   <rect>
+    <x>0</x>
+    <y>0</y>
+    <width>291</width>
+    <height>141</height>
+   </rect>
+  </property>
+  <property name="windowTitle">
+   <string>Calculate Earthworks for frames</string>
+  </property>
+  <layout class="QVBoxLayout" name="verticalLayout">
+   <item>
+    <widget class="QGroupBox" name="groupTolerances">
+     <property name="title">
+      <string>Use tolerances</string>
+     </property>
+     <property name="checkable">
+      <bool>true</bool>
+     </property>
+     <layout class="QGridLayout" name="gridLayout">
+      <property name="leftMargin">
+       <number>6</number>
+      </property>
+      <property name="topMargin">
+       <number>6</number>
+      </property>
+      <property name="rightMargin">
+       <number>6</number>
+      </property>
+      <property name="bottomMargin">
+       <number>6</number>
+      </property>
+      <property name="verticalSpacing">
+       <number>5</number>
+      </property>
+      <item row="0" column="0">
+       <widget class="QLabel" name="label_9">
+        <property name="text">
+         <string>Tolerancia para el corte:</string>
+        </property>
+       </widget>
+      </item>
+      <item row="1" column="1">
+       <widget class="QSpinBox" name="editToleranceFill">
+        <property name="minimumSize">
+         <size>
+          <width>90</width>
+          <height>0</height>
+         </size>
+        </property>
+        <property name="maximumSize">
+         <size>
+          <width>90</width>
+          <height>16777215</height>
+         </size>
+        </property>
+        <property name="alignment">
+         <set>Qt::AlignRight|Qt::AlignTrailing|Qt::AlignVCenter</set>
+        </property>
+        <property name="buttonSymbols">
+         <enum>QAbstractSpinBox::NoButtons</enum>
+        </property>
+        <property name="suffix">
+         <string> mm</string>
+        </property>
+        <property name="maximum">
+         <number>1000</number>
+        </property>
+        <property name="value">
+         <number>200</number>
+        </property>
+       </widget>
+      </item>
+      <item row="1" column="0">
+       <widget class="QLabel" name="label_10">
+        <property name="text">
+         <string>Tolerancia para el relleno:</string>
+        </property>
+       </widget>
+      </item>
+      <item row="0" column="1">
+       <widget class="QSpinBox" name="editToleranceCut">
+        <property name="minimumSize">
+         <size>
+          <width>90</width>
+          <height>0</height>
+         </size>
+        </property>
+        <property name="maximumSize">
+         <size>
+          <width>90</width>
+          <height>16777215</height>
+         </size>
+        </property>
+        <property name="alignment">
+         <set>Qt::AlignRight|Qt::AlignTrailing|Qt::AlignVCenter</set>
+        </property>
+        <property name="buttonSymbols">
+         <enum>QAbstractSpinBox::NoButtons</enum>
+        </property>
+        <property name="suffix">
+         <string> mm</string>
+        </property>
+        <property name="maximum">
+         <number>1000</number>
+        </property>
+        <property name="value">
+         <number>200</number>
+        </property>
+       </widget>
+      </item>
+     </layout>
+    </widget>
+   </item>
+   <item>
+    <widget class="QWidget" name="widget" native="true">
+     <layout class="QGridLayout" name="gridLayout_3">
+      <property name="topMargin">
+       <number>0</number>
+      </property>
+      <property name="bottomMargin">
+       <number>0</number>
+      </property>
+      <item row="0" column="0">
+       <widget class="QLabel" name="label">
+        <property name="text">
+         <string>Distancia offset:</string>
+        </property>
+       </widget>
+      </item>
+      <item row="0" column="1">
+       <widget class="QSpinBox" name="editOffset">
+        <property name="sizePolicy">
+         <sizepolicy hsizetype="Fixed" vsizetype="Fixed">
+          <horstretch>0</horstretch>
+          <verstretch>0</verstretch>
+         </sizepolicy>
+        </property>
+        <property name="minimumSize">
+         <size>
+          <width>90</width>
+          <height>0</height>
+         </size>
+        </property>
+        <property name="maximumSize">
+         <size>
+          <width>90</width>
+          <height>16777215</height>
+         </size>
+        </property>
+        <property name="alignment">
+         <set>Qt::AlignRight|Qt::AlignTrailing|Qt::AlignVCenter</set>
+        </property>
+        <property name="buttonSymbols">
+         <enum>QAbstractSpinBox::NoButtons</enum>
+        </property>
+        <property name="suffix">
+         <string> mm</string>
+        </property>
+        <property name="maximum">
+         <number>10000</number>
+        </property>
+        <property name="value">
+         <number>3000</number>
+        </property>
+       </widget>
+      </item>
+     </layout>
+    </widget>
+   </item>
+  </layout>
+ </widget>
+ <resources/>
+ <connections/>
+</ui>

PVPlantFence.py

@@ -0,0 +1,895 @@
+# /**********************************************************************
+# *                                                                     *
+# * Copyright (c) 2021 Javier Braña <javier.branagutierrez@gmail.com>  *
+# *                                                                     *
+# * This program is free software; you can redistribute it and/or modify*
+# * it under the terms of the GNU Lesser General Public License (LGPL)  *
+# * as published by the Free Software Foundation; either version 2 of   *
+# * the License, or (at your option) any later version.                 *
+# * for detail see the LICENCE text file.                               *
+# *                                                                     *
+# * This program is distributed in the hope that it will be useful,     *
+# * but WITHOUT ANY WARRANTY; without even the implied warranty of      *
+# * MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE.  See the       *
+# * GNU Library General Public License for more details.                *
+# *                                                                     *
+# * You should have received a copy of the GNU Library General Public   *
+# * License along with this program; if not, write to the Free Software *
+# * Foundation, Inc., 59 Temple Place, Suite 330, Boston, MA  02111-1307*
+# * USA                                                                 *
+# *                                                                     *
+# ***********************************************************************
+
+import copy
+import math
+
+import ArchComponent
+import Draft
+import FreeCAD
+import Part
+
+import PVPlantFencePost
+import PVPlantSite
+
+if FreeCAD.GuiUp:
+    import FreeCADGui
+    from PySide import QtCore, QtGui
+    from PySide.QtCore import QT_TRANSLATE_NOOP
+    import PySide.QtGui as QtGui
+    from pivy import coin
+else:
+    # \cond
+    def translate(ctxt, txt):
+        return txt
+    def QT_TRANSLATE_NOOP(ctxt, txt):
+        return txt
+    # \endcond
+
+try:
+    _fromUtf8 = QtCore.QString.fromUtf8
+except AttributeError:
+    def _fromUtf8(s):
+        return s
+
+import os
+from PVPlantResources import DirIcons as DirIcons
+
+EAST = FreeCAD.Vector(1, 0, 0)
+
+def makeprojection(pathwire):
+    site = FreeCAD.ActiveDocument.Site
+    land = site.Terrain.Shape
+    proj = land.makeParallelProjection(pathwire, FreeCAD.Vector(0, 0, 1))
+    return proj
+
+def makePVPlantFence(section, post, path):
+    obj = FreeCAD.ActiveDocument.addObject('Part::FeaturePython', 'Fence')
+
+    _Fence(obj)
+    obj.Post = post
+    obj.Base = path
+
+    if FreeCAD.GuiUp:
+        _ViewProviderFence(obj.ViewObject)
+
+        hide(section)
+        hide(post)
+        hide(path)
+
+    FreeCAD.ActiveDocument.recompute()
+    return obj
+
+def hide(obj):
+    if hasattr(obj, 'ViewObject') and obj.ViewObject:
+        obj.ViewObject.Visibility = False
+
+def getAngle(Line1, Line2):
+    v1 = Line1.Vertexes[1].Point - Line1.Vertexes[0].Point
+    v2 = Line2.Vertexes[1].Point - Line2.Vertexes[0].Point
+    return v1.getAngle(v2)
+
+
+def get_parameter_from_v0(edge, offset):
+    """Return parameter at distance offset from edge.Vertexes[0].
+    sb method in Part.TopoShapeEdge???
+    """
+    import DraftVecUtils
+
+    lpt = edge.valueAt(edge.getParameterByLength(0))
+    vpt = edge.Vertexes[0].Point
+
+    if not DraftVecUtils.equals(vpt, lpt):
+        # this edge is flipped
+        length = edge.Length - offset
+    else:
+        # this edge is right way around
+        length = offset
+    return edge.getParameterByLength(length)
+
+
+def calculatePlacement(globalRotation, edge, offset, RefPt, xlate, align, normal=None):
+    """Orient shape to tangent at parm offset along edge."""
+    import functools
+    import DraftVecUtils
+    # http://en.wikipedia.org/wiki/Euler_angles
+    # start with null Placement point so translate goes to right place.
+
+    placement = FreeCAD.Placement()
+    placement.Rotation = globalRotation
+    placement.move(RefPt + xlate)
+
+    if not align:
+        return placement
+
+    # unit +Z  Probably defined elsewhere?
+    z = FreeCAD.Vector(0, 0, 1)
+    # y = FreeCAD.Vector(0, 1, 0)               # unit +Y
+    x = FreeCAD.Vector(1, 0, 0)  # unit +X
+    nullv = FreeCAD.Vector(0, 0, 0)
+
+    # get local coord system - tangent, normal, binormal, if possible
+    t = edge.tangentAt(get_parameter_from_v0(edge, offset))
+    t.normalize()
+    n = normal
+    b = t.cross(n)
+    b.normalize()
+
+    lnodes = z.cross(b)
+    try:
+        # Can't normalize null vector.
+        lnodes.normalize()
+    except:
+        # pathological cases:
+        pass
+
+    print(b, " - ", b.dot(z))
+    if abs(b.dot(z)) == 1.0:  # 2) binormal is || z
+        # align shape to tangent only
+        psi = math.degrees(DraftVecUtils.angle(x, t, z))
+        theta = 0.0
+        phi = 0.0
+        FreeCAD.Console.PrintWarning("Draft PathArray.orientShape - Gimbal lock. Infinite lnodes. Change Path or Base.\n")
+    else:  # regular case
+        psi = math.degrees(DraftVecUtils.angle(x, lnodes, z))
+        theta = math.degrees(DraftVecUtils.angle(z, b, lnodes))
+        phi = math.degrees(DraftVecUtils.angle(lnodes, t, b))
+
+    rotations = [placement.Rotation]
+
+    if psi != 0.0:
+        rotations.insert(0, FreeCAD.Rotation(z, psi))
+    if theta != 0.0:
+        rotations.insert(0, FreeCAD.Rotation(lnodes, theta))
+    if phi != 0.0:
+        rotations.insert(0, FreeCAD.Rotation(b, phi))
+
+    if len(rotations) == 1:
+        finalRotation = rotations[0]
+    else:
+        finalRotation = functools.reduce(lambda rot1, rot2: rot1.multiply(rot2), rotations)
+
+    placement.Rotation = FreeCAD.Rotation(FreeCAD.Vector(0, 0, 1), finalRotation.toEuler()[2])
+
+    return placement
+
+def calculatePlacementsOnPath(shapeRotation, pathwire, count, xlate, align):
+    """ Calculates the placements of a shape along a given path so that each copy will be distributed evenly
+        - shapeRotation: rotation offset
+        - pathwire: path where place the shapes
+        - count: number of sections
+        - xlate: transformation offset
+    """
+    import Part
+    import DraftGeomUtils
+
+    closedpath = DraftGeomUtils.isReallyClosed(pathwire)
+    normal = DraftGeomUtils.getNormal(pathwire)
+    if normal:
+        if normal.z < 0:  # asegurarse de que siempre se dibuje por encima del suelo
+            normal.z *= -1
+    else:
+        normal = FreeCAD.Vector(0, 0, 1)
+    path = Part.__sortEdges__(pathwire.Edges)
+    ends = []
+    cdist = 0
+
+    # -----------------------------------------------------------------------------------------------------------------
+    totalEdges = len(path)
+    if not closedpath:
+        totalEdges -= 1
+    # -----------------------------------------------------------------------------------------------------------------
+
+    for e in path:  # find cumulative edge end distance
+        cdist += e.Length
+        ends.append(cdist)
+
+    placements = []
+    # place the start shape
+    pt = path[0].Vertexes[0].Point
+    placements.append(calculatePlacement(shapeRotation, path[0], 0, pt, xlate, align, normal))
+
+    # closed path doesn't need shape on last vertex
+    if not closedpath:
+        # place the end shape
+        pt = path[-1].Vertexes[-1].Point
+        placements.append(calculatePlacement(shapeRotation, path[-1], path[-1].Length, pt, xlate, align, normal))
+
+    if count < 3:
+        return placements
+
+    # place the middle shapes
+    if closedpath:
+        stop = count
+    else:
+        stop = count - 1
+    step = float(cdist) / stop
+    travel = step
+    for i in range(1, stop):
+        # which edge in path should contain this shape?
+        # avoids problems with float math travel > ends[-1]
+        iend = len(ends) - 1
+        for j in range(0, len(ends)):
+            if travel <= ends[j]:
+                iend = j
+                break
+        # place shape at proper spot on proper edge
+        remains = ends[iend] - travel
+        offset = path[iend].Length - remains
+        pt = path[iend].valueAt(get_parameter_from_v0(path[iend], offset))
+        placements.append(calculatePlacement(shapeRotation, path[iend], offset, pt, xlate, align, normal))
+        travel += step
+
+    return placements
+
+class _Fence(ArchComponent.Component):
+    def __init__(self, obj):
+        ArchComponent.Component.__init__(self, obj)
+        self.setProperties(obj)
+        self.Posts = []
+        self.Foundations = []
+
+        # Does a IfcType exist?
+        # obj.IfcType = "Fence"
+
+    def setProperties(self, obj):
+        ArchComponent.Component.setProperties(self, obj)
+
+        pl = obj.PropertiesList
+
+        if not "Gate" in pl:
+            obj.addProperty("App::PropertyLinkList",
+                            "Gate",
+                            "Fence",
+                            "A single fence post")
+
+        if not "Post" in pl:
+            obj.addProperty("App::PropertyLink",
+                            "Post",
+                            "Fence",
+                            QT_TRANSLATE_NOOP("App::Property", "A single fence post"))
+
+        if not "Foundation" in pl:
+            obj.addProperty("App::PropertyLength",
+                            "Foundation",
+                            "Fence",
+                            QT_TRANSLATE_NOOP("App::Property", "A single fence post"))
+
+        if not "Depth" in pl:
+            obj.addProperty("App::PropertyLength",
+                            "Depth",
+                            "Fence",
+                            QT_TRANSLATE_NOOP("App::Property", "A single fence post")).Depth = 650
+
+        if not "Gap" in pl:
+            obj.addProperty("App::PropertyLength",
+                            "Gap",
+                            "Fence",
+                            QT_TRANSLATE_NOOP("App::Property", "A single fence post")).Gap = 4000
+
+        if not "Angle" in pl:
+            obj.addProperty("App::PropertyAngle",
+                            "Angle",
+                            "Fence",
+                            QT_TRANSLATE_NOOP("App::Property", "A single fence post")).Angle = 60
+
+        if not "MeshOffsetZ" in pl:
+            obj.addProperty("App::PropertyLength",
+                            "MeshOffsetZ",
+                            "Fence",
+                            QT_TRANSLATE_NOOP("App::Property", "A single fence post")).MeshOffsetZ = 0
+
+        if not "MeshHeight" in pl:
+            obj.addProperty("App::PropertyLength",
+                            "MeshHeight",
+                            "Fence",
+                            QT_TRANSLATE_NOOP("App::Property", "A single fence post")).MeshHeight = 2000
+
+        if not "Reinforce" in pl:
+            obj.addProperty("App::PropertyLength",
+                            "Reinforce",
+                            "Fence",
+                            QT_TRANSLATE_NOOP("App::Property", "A single fence post")).Reinforce = 50000
+
+
+        ########## Datos informativos:
+        if not "NumberOfSections" in pl:
+            obj.addProperty("App::PropertyQuantity",
+                            "NumberOfSections",
+                            "Output",
+                            QT_TRANSLATE_NOOP("App::Property", "The number of sections the fence is built of"))
+            obj.setEditorMode("NumberOfSections", 1)
+
+        if not "NumberOfPosts" in pl:
+            obj.addProperty("App::PropertyQuantity",
+                            "NumberOfPosts",
+                            "Output",
+                            QT_TRANSLATE_NOOP("App::Property", "The number of posts used to build the fence"))
+            obj.setEditorMode("NumberOfPosts", 1)
+
+        if not "Length" in pl:
+            obj.addProperty("App::PropertyLength",
+                            "Length",
+                            "Output",
+                            QT_TRANSLATE_NOOP("App::Property", "The number of posts used to build the fence"))
+            obj.setEditorMode("Length", 1)
+
+        if not "Concrete" in pl:
+            obj.addProperty("App::PropertyVolume",
+                            "Concrete",
+                            "Output",
+                            "Concrete Volume")
+            obj.setEditorMode("Concrete", 1)
+
+        if not "PlacementList" in pl:
+            obj.addProperty("App::PropertyPlacementList",
+                            "PlacementList",
+                            "Output",
+                            QT_TRANSLATE_NOOP("App::Property", "The number of posts used to build the fence"))
+            obj.setEditorMode("Length", 1)
+
+
+        self.Type = "PVPlatFence"
+
+    def __getstate__(self):
+        if hasattr(self, 'sectionFaceNumbers'):
+            return (self.sectionFaceNumbers)
+        return None
+
+    def __setstate__(self, state):
+        if state is not None and isinstance(state, tuple):
+            self.sectionFaceNumbers = state[0]
+        return None
+
+    def execute(self, obj):
+
+        pathwire = self.calculatePathWire(obj)
+        if pathwire is None:
+            # FreeCAD.Console.PrintLog("ArchFence.execute: path " + obj.Base.Name + " has no edges\n")
+            return
+
+        if not obj.Post:
+            FreeCAD.Console.PrintLog("ArchFence.execute: Post not set\n")
+            return
+
+        self.Posts = []
+        self.Foundations = []
+        site = PVPlantSite.get()
+        if True:  # prueba
+            import MeshPart as mp
+            land = FreeCAD.ActiveDocument.Terrain.Mesh
+            segments = mp.projectShapeOnMesh(pathwire, land, FreeCAD.Vector(0, 0, 1))
+            points=[]
+            for segment in segments:
+                points.extend(segment)
+            pathwire = Part.makePolygon(points)
+        else:
+            if PVPlantSite.get().Terrain.TypeId == 'Mesh::Feature':
+                import MeshPart as mp
+                land = PVPlantSite.get().Terrain.Mesh
+                pathwire = mp.projectShapeOnMesh(pathwire, land, FreeCAD.Vector(0, 0, 1))
+
+            else:
+                land = site.Terrain.Shape
+                pathwire = land.makeParallelProjection(pathwire, FreeCAD.Vector(0, 0, 1))
+
+        if pathwire is None:
+            return
+
+        ''' no sirve:
+        if len(pathwire.Wires) > 1:
+            import draftgeoutils
+            pathwire = draftgeoutils.wires.superWire(pathwire.Edges, True)
+            Part.show(pathwire)
+        '''
+
+        ''' unir todas en una '''
+        '''
+        if len(pathwire.Wires) > 1:
+            import Utils.PVPlantUtils as utils
+            wires = pathwire.Wires
+            new_wire = []
+            to_compare = utils.getPoints(wires.pop(0))
+            new_wire.extend(to_compare)
+            while len(wires)>0:
+                wire = wires[0]
+                points = utils.getPoints(wire)
+                to_remove = None
+                if points[0] in to_compare:
+                    to_remove = points[0]
+                if points[-1] in to_compare:
+                    to_remove = points[-1]
+                if to_remove:
+                    to_compare = points.copy()
+                    points.remove(to_remove)
+                    new_wire.extend(points)
+                    wires.pop()
+                    continue
+                wires.append(wires.pop())
+            pathwire = Part.makePolygon(new_wire)
+            #Part.show(pathwire)
+        #return
+        '''
+
+        sectionLength = obj.Gap.Value
+        postLength = 0 #obj.Post.Diameter.Value   #considerarlo 0 porque no influye
+        postPlacements = []
+        pathsegments = self.calculateSegments(obj, pathwire)
+
+        count = 0
+        drawFirstPost = True
+        pathLength = 0
+        for segment in pathsegments:
+            segwire = Part.Wire(Part.__sortEdges__(segment))
+            pathLength += segwire.Length
+
+            obj.NumberOfSections = self.calculateNumberOfSections(segwire.Length, sectionLength, postLength)
+            obj.NumberOfPosts = obj.NumberOfSections + 1
+
+            count += obj.NumberOfSections
+
+            downRotation = FreeCAD.Rotation(FreeCAD.Vector(1, 0, 0), -90)
+            placements = self.calculatePostPlacements(obj, segwire, downRotation)
+
+            if drawFirstPost:
+                drawFirstPost = False
+            else:
+                placements.pop(0)
+
+            postPlacements.extend(placements)
+
+        postShapes, postFoundation = self.calculatePosts(obj, postPlacements)
+        sections, num = self.calculateSections(obj, postPlacements)
+
+        postShapes = Part.makeCompound(postShapes)
+        postFoundation = Part.makeCompound(postFoundation)
+        sections = Part.makeCompound(sections)
+        compound = Part.makeCompound([postShapes, postFoundation, sections])
+        obj.Shape = compound
+
+        # Give information
+        obj.NumberOfSections = count
+        obj.NumberOfPosts = obj.NumberOfSections + 1
+        obj.Length = pathLength
+        obj.Concrete = count * postFoundation.SubShapes[0].Volume
+
+    def calculateSegments(self, obj, pathwire):
+        ''' Calcular los segmentos de la ruta '''
+        import math
+        segments = []
+        segment = [pathwire.Edges[0]]
+        segments.append(segment)
+        for ind in range(len(pathwire.Edges) - 1):
+            ed1 = pathwire.Edges[ind]
+            ed2 = pathwire.Edges[ind + 1]
+            vec1 = ed1.Vertexes[1].Point - ed1.Vertexes[0].Point
+            vec2 = ed2.Vertexes[1].Point - ed2.Vertexes[0].Point
+            angle = math.degrees(vec1.getAngle(vec2))
+            if angle > obj.Angle.Value:
+                segment = []
+                segments.append(segment)
+            segment.append(ed2)
+        return segments
+
+    def calculateNumberOfSections(self, pathLength, sectionLength, postLength):
+        withoutLastPost = pathLength - postLength
+        realSectionLength = sectionLength + postLength
+        return math.ceil(withoutLastPost / realSectionLength)
+
+    def calculatePostPlacements(self, obj, pathwire, rotation):
+        postWidth = obj.Post.Diameter.Value
+        transformationVector = FreeCAD.Vector(0, postWidth / 2, 0)
+        placements = calculatePlacementsOnPath(rotation, pathwire, int(obj.NumberOfSections) + 1, transformationVector, True)
+        # The placement of the last object is always the second entry in the list.
+        # So we move it to the end:
+        if len(placements) > 1:
+            placements.append(placements.pop(1))
+        return placements
+
+    def calculatePosts(self, obj, postPlacements):
+        posts = []
+        foundations = []
+        for placement in postPlacements:
+            postCopy = obj.Post.Shape.copy()
+            postCopy = Part.Solid(postCopy)
+            postCopy.Placement = placement
+            postCopy.Placement.Base.z += 100
+            posts.append(postCopy)
+
+            foundation = Part.makeCylinder(150, 700)
+            foundation.Placement = placement
+            foundation.Placement.Base.z -= obj.Depth.Value
+            foundation = foundation.cut(postCopy)
+            foundations.append(foundation)
+
+        return posts, foundations
+
+    def calculateSections(self, obj, postPlacements):
+        shapes = []
+        faceNumbers = []
+
+        offsetz = obj.MeshOffsetZ.Value
+        meshHeight = obj.MeshHeight.Value
+        for i in range(len(postPlacements) - 1):
+            startPlacement = postPlacements[i]
+            endPlacement = postPlacements[i + 1]
+
+            p1 = startPlacement.Base + FreeCAD.Vector(0, 0, offsetz)
+            p2 = endPlacement.Base + FreeCAD.Vector(0, 0, offsetz)
+            p3 = p2 + FreeCAD.Vector(0, 0, meshHeight)
+            p4 = p1 + FreeCAD.Vector(0, 0, meshHeight)
+            pointlist = [p1, p2, p3, p4, p1]
+
+            try:
+                pol = Part.makePolygon(pointlist)
+                face = Part.Face(pol)
+                shapes.append(face)
+                faceNumbers.append(1)
+            except:
+                print("No es posible crear la cara: ---------------------------------------------------")
+                print("  +++++ Start: ", startPlacement.Base, " - end: ", endPlacement.Base)
+                print("  +++++ algo: ", pointlist, "\n")
+                print("---------------------------------------------------\n")
+        return (shapes, faceNumbers)
+
+    def calculatePathWire(self, obj):
+        if obj.Base:
+            wire = None
+            if hasattr(obj.Base.Shape, 'Wires') and obj.Base.Shape.Wires:
+                wire = obj.Base.Shape.Wires[0]
+            elif obj.Base.Shape.Edges:
+                wire = Part.Wire(obj.Base.Shape.Edges)
+            return wire
+        return None
+
+
+class _ViewProviderFence(ArchComponent.ViewProviderComponent):
+    "A View Provider for the Fence object"
+
+    def __init__(self, vobj):
+        ArchComponent.ViewProviderComponent.__init__(self, vobj)
+        vobj.Proxy = self
+        #vobj.addExtension("Gui::ViewProviderGroupExtensionPython")
+
+    def getIcon(self):
+        return str(os.path.join(DirIcons, "fence.svg"))
+
+    def attach(self, vobj):
+        '''
+        Create Object visuals in 3D view.
+        '''
+
+        self.Object = vobj.Object
+
+        # GeoCoords Node.
+        self.geo_coords = coin.SoGeoCoordinate()
+
+        # Surface features.
+        self.triangles = coin.SoIndexedFaceSet()
+        self.face_material = coin.SoMaterial()
+        self.edge_material = coin.SoMaterial()
+        self.edge_color = coin.SoBaseColor()
+        self.edge_style = coin.SoDrawStyle()
+        self.edge_style.style = coin.SoDrawStyle.LINES
+
+        shape_hints = coin.SoShapeHints()
+        shape_hints.vertex_ordering = coin.SoShapeHints.COUNTERCLOCKWISE
+        mat_binding = coin.SoMaterialBinding()
+        mat_binding.value = coin.SoMaterialBinding.PER_FACE
+        offset = coin.SoPolygonOffset()
+
+        # Face root.
+        faces = coin.SoSeparator()
+        faces.addChild(shape_hints)
+        faces.addChild(self.face_material)
+        faces.addChild(mat_binding)
+        faces.addChild(self.geo_coords)
+        faces.addChild(self.triangles)
+
+        # Highlight for selection.
+        highlight = coin.SoType.fromName('SoFCSelection').createInstance()
+        highlight.style = 'EMISSIVE_DIFFUSE'
+        faces.addChild(shape_hints)
+        highlight.addChild(self.edge_material)
+        highlight.addChild(mat_binding)
+        highlight.addChild(self.edge_style)
+        highlight.addChild(self.geo_coords)
+        highlight.addChild(self.triangles)
+
+    def updateData(self, obj, prop):
+        '''
+        Update Object visuals when a data property changed.
+        '''
+        origin = PVPlantSite.get()
+        base = copy.deepcopy(origin.Origin)
+        base.z = 0
+        #print("  - Propiedad: ", prop)
+        if prop == "Shape":
+            shape = obj.getPropertyByName(prop)
+            # Get GeoOrigin.
+            points = [ver.Point for ver in shape.Vertexes]
+            # Set GeoCoords.
+            geo_system = ["UTM", origin.UtmZone, "FLAT"]
+            self.geo_coords.geoSystem.setValues(geo_system)
+            self.geo_coords.point.values = points
+
+    def claimChildren(self):
+        children = []
+        if self.Object.Post:
+            children.append(self.Object.Post)
+        if self.Object.Base:
+            children.append(self.Object.Base)
+        if self.Object.Gate:
+            children.append(self.Object.Gate)
+        return children
+
+class _FenceTaskPanel:
+    '''The TaskPanel to setup the fence'''
+
+    def __init__(self):
+        self.section = None
+        self.post = None
+        self.path = None
+
+        # form: -----------------------------------------------------------------------------------
+        self.formFence = QtGui.QWidget()
+        self.formFence.resize(800, 640)
+        self.formFence.setWindowTitle("Fence setup")
+        self.formFence.setWindowIcon(QtGui.QIcon(os.path.join(DirIcons, "contours.svg")))
+        self.grid = QtGui.QGridLayout(self.formFence)
+
+        # parameters
+        self.labelPath = QtGui.QLabel()
+        self.labelPath.setText("Recorrido:")
+        self.linePath = QtGui.QLineEdit(self.formFence)
+        self.linePath.setObjectName(_fromUtf8("lineEdit1"))
+        self.linePath.readOnly = True
+        self.grid.addWidget(self.labelPath, self.grid.rowCount(), 0, 1, 1)
+        self.grid.addWidget(self.linePath, self.grid.rowCount() - 1, 1, 1, 1)
+
+        self.buttonPathSelect = QtGui.QPushButton('Add')
+        self.grid.addWidget(self.buttonPathSelect, self.grid.rowCount() - 1, 2, 1, 1)
+
+        self.line1 = QtGui.QFrame()
+        self.line1.setFrameShape(QtGui.QFrame.HLine)
+        self.line1.setFrameShadow(QtGui.QFrame.Sunken)
+        self.grid.addWidget(self.line1, self.grid.rowCount(), 0, 1, -1)
+
+        self.label = QtGui.QLabel()
+        self.label.setText("Separación entre apoyos:")
+        self.grid.addWidget(self.label, self.grid.rowCount(), 0, 1, -1)
+
+        self.labelInterval = QtGui.QLabel()
+        self.labelInterval.setText("Intervalo:")
+        self.valueInterval = FreeCADGui.UiLoader().createWidget("Gui::InputField")
+        self.valueInterval.setText("4,0 m")
+        self.grid.addWidget(self.labelInterval, self.grid.rowCount(), 0, 1, 1)
+        self.grid.addWidget(self.valueInterval, self.grid.rowCount() - 1, 1, 1, 2)
+
+        self.line1 = QtGui.QFrame()
+        self.line1.setFrameShape(QtGui.QFrame.HLine)
+        self.line1.setFrameShadow(QtGui.QFrame.Sunken)
+        self.grid.addWidget(self.line1, self.grid.rowCount(), 0, 1, -1)
+
+        self.label = QtGui.QLabel()
+        self.label.setText("Mayado:")
+        self.grid.addWidget(self.label, self.grid.rowCount(), 0, 1, -1)
+
+        self.labelHeight = QtGui.QLabel()
+        self.labelHeight.setText("Altura:")
+        self.valueHeight = FreeCADGui.UiLoader().createWidget("Gui::InputField")
+        self.valueHeight.setText("2 m")
+        self.grid.addWidget(self.labelHeight, self.grid.rowCount(), 0, 1, 1)
+        self.grid.addWidget(self.valueHeight, self.grid.rowCount() - 1, 1, 1, 2)
+
+        self.labelOffset = QtGui.QLabel()
+        self.labelOffset.setText("Separación del suelo:")
+        self.valueOffset = FreeCADGui.UiLoader().createWidget("Gui::InputField")
+        self.valueOffset.setText("0 m")
+        self.grid.addWidget(self.labelOffset, self.grid.rowCount(), 0, 1, 1)
+        self.grid.addWidget(self.valueOffset, self.grid.rowCount() - 1, 1, 1, 2)
+
+        self.buttonPathSelect.clicked.connect(self.addPath)
+        self.valueInterval.valueChanged.connect(self.SetupGrid)
+        self.valueHeight.valueChanged.connect(self.SetupGrid)
+        # self.valueDepth.valueChanged.connect(self.SetupPost)
+
+        # Form para configurar el poste: -------------------------------------------------------------------
+        self.formPost = QtGui.QWidget()
+        self.formPost.resize(800, 640)
+        self.formPost.setWindowTitle("Post setup")
+        self.formPost.setWindowIcon(QtGui.QIcon(os.path.join(DirIcons, "contours.svg")))
+        self.grid = QtGui.QGridLayout(self.formPost)
+
+        # parameters
+        self.labelDiameter = QtGui.QLabel()
+        self.labelDiameter.setText("Diámetro:")
+        self.valueDiameter = FreeCADGui.UiLoader().createWidget("Gui::InputField")
+        self.valueDiameter.setText("48 mm")
+        self.grid.addWidget(self.labelDiameter, self.grid.rowCount(), 0, 1, 1)
+        self.grid.addWidget(self.valueDiameter, self.grid.rowCount() - 1, 1, 1, 1)
+
+        self.labelLength = QtGui.QLabel()
+        self.labelLength.setText("Longitud:")
+        self.valueLength = FreeCADGui.UiLoader().createWidget("Gui::InputField")
+        self.valueLength.setText("3,0 m")
+        self.grid.addWidget(self.labelLength, self.grid.rowCount(), 0, 1, 1)
+        self.grid.addWidget(self.valueLength, self.grid.rowCount() - 1, 1, 1, 1)
+
+        self.labelDepth = QtGui.QLabel()
+        self.labelDepth.setText("Profundidad:")
+        self.valueDepth = FreeCADGui.UiLoader().createWidget("Gui::InputField")
+        self.valueDepth.setText("700,0 mm")
+        self.grid.addWidget(self.labelDepth, self.grid.rowCount(), 0, 1, 1)
+        self.grid.addWidget(self.valueDepth, self.grid.rowCount() - 1, 1, 1, 1)
+
+        self.valueDiameter.valueChanged.connect(self.SetupPost)
+        self.valueLength.valueChanged.connect(self.SetupPost)
+        self.valueDepth.valueChanged.connect(self.SetupPost)
+
+        # Form para configurar la zapata: ----------------------------------------------------------
+        self.formFoundation = QtGui.QWidget()
+        self.formFoundation.resize(800, 640)
+        self.formFoundation.setWindowTitle("Post setup")
+        self.formFoundation.setWindowIcon(QtGui.QIcon(os.path.join(DirIcons, "contours.svg")))
+        self.grid = QtGui.QGridLayout(self.formFoundation)
+
+        # parameters
+        self.labelFoundationDiameter = QtGui.QLabel()
+        self.labelFoundationDiameter.setText("Cimentación:")
+        self.grid.addWidget(self.labelFoundationDiameter, self.grid.rowCount(), 0, 1, 1)
+
+        self.labelFoundationDiameter = QtGui.QLabel()
+        self.labelFoundationDiameter.setText("Diámetro:")
+        self.valueFoundationDiameter = FreeCADGui.UiLoader().createWidget("Gui::InputField")
+        self.valueFoundationDiameter.setText("200,0 mm")
+        self.grid.addWidget(self.labelFoundationDiameter, self.grid.rowCount(), 0, 1, 1)
+        self.grid.addWidget(self.valueFoundationDiameter, self.grid.rowCount() - 1, 1, 1, 1)
+
+        self.labelFoundationDepth = QtGui.QLabel()
+        self.labelFoundationDepth.setText("Profundidad:")
+        self.valueFoundationDepth = FreeCADGui.UiLoader().createWidget("Gui::InputField")
+        self.valueFoundationDepth.setText("700,0 mm")
+        self.grid.addWidget(self.labelFoundationDepth, self.grid.rowCount(), 0, 1, 1)
+        self.grid.addWidget(self.valueFoundationDepth, self.grid.rowCount() - 1, 1, 1, 1)
+
+        self.form = [self.formFence, self.formPost, self.formFoundation]
+
+        # valores iniciales y creación del la valla:
+        import Draft
+        self.post = PVPlantFencePost.makeFencePost()  # Arch.makePipe()
+        self.post.Label = "Post"
+        Draft.autogroup(self.post)
+
+        '''
+        self.section = self.makeGrid()
+        self.path = self.section.Base
+        '''
+
+        FreeCAD.ActiveDocument.recompute()
+        self.fence = makePVPlantFence(self.section, self.post, self.path)
+
+    def addPath(self):
+        sel = FreeCADGui.Selection.getSelection()
+        if len(sel) > 0:
+            self.path = sel[0]
+            self.linePath.setText(self.path.Label)
+            self.fence.Base = self.path
+
+        FreeCAD.ActiveDocument.recompute()
+
+    def SetupPost(self):
+        if self.post.Diameter != FreeCAD.Units.Quantity(self.valueDiameter.text()).Value:
+            self.post.Diameter = FreeCAD.Units.Quantity(self.valueDiameter.text()).Value
+        if self.post.Length != FreeCAD.Units.Quantity(self.valueLength.text()).Value:
+            self.post.Length = FreeCAD.Units.Quantity(self.valueLength.text()).Value
+
+        if self.post.Placement.Base.z != -FreeCAD.Units.Quantity(self.valueDepth.text()).Value:
+            self.post.Placement.Base.z = -FreeCAD.Units.Quantity(self.valueDepth.text()).Value
+            self.fence.Depth = FreeCAD.Units.Quantity(self.valueDepth.text()).Value
+
+        FreeCAD.ActiveDocument.recompute()
+
+    def SetupGrid(self):
+        return
+        if self.path.End.x != FreeCAD.Units.Quantity(self.valueInterval.text()).Value:
+            self.path.End.x = FreeCAD.Units.Quantity(self.valueInterval.text()).Value
+        if self.section.LengthFwd != FreeCAD.Units.Quantity(self.valueHeight.text()).Value:
+            self.section.LengthFwd = FreeCAD.Units.Quantity(self.valueHeight.text()).Value
+
+        FreeCAD.ActiveDocument.recompute()
+
+    def makeGrid(self):
+        return None
+
+        import Draft
+
+        p1 = FreeCAD.Vector(0, 0, 0)
+        p2 = FreeCAD.Vector(4000, 0, 0)
+        line = Draft.makeLine(p1, p2)
+
+        section = FreeCAD.ActiveDocument.addObject('Part::Extrusion', 'Extrude')
+        section.Base = line
+        section.DirMode = "Custom"
+        section.Dir = FreeCAD.Vector(0.0, 0.0, 1.0)
+        section.DirLink = None
+        section.LengthFwd = 2000.0
+        section.LengthRev = 0.0
+        section.Solid = False
+        section.Reversed = False
+        section.Symmetric = False
+        section.TaperAngle = 0.0
+        section.TaperAngleRev = 0.0
+        line.Visibility = False
+
+        return section
+
+
+# Commands ---------------------------------------------------------------------------------
+class _CommandPVPlantFence:
+    "the PVPlant Fence command definition"
+
+    def GetResources(self):
+        return {'Pixmap': str(os.path.join(DirIcons, "fence.svg")),
+                'Accel': "C, F",
+                'MenuText': QT_TRANSLATE_NOOP("PVPlantFence", "Fence"),
+                'ToolTip': QT_TRANSLATE_NOOP("PVPlantFence",
+                                             "Creates a fence object from a selected section, post and path")}
+
+    def IsActive(self):
+        return not FreeCAD.ActiveDocument is None
+
+    def Activated(self):
+        self.TaskPanel = _FenceTaskPanel()
+        FreeCADGui.Control.showDialog(self.TaskPanel)
+
+
+if FreeCAD.GuiUp:
+    class CommandFenceGroup:
+        def GetCommands(self):
+            return tuple(['PVPlantFence',
+                          'PVPlantGate',
+                          'PVPlantFencePost'
+                          ])
+
+        def GetResources(self):
+            return {'MenuText': QT_TRANSLATE_NOOP("", 'PVPlantFence'),
+                    'ToolTip': QT_TRANSLATE_NOOP("", 'PVPlantFence')
+                    }
+
+        def IsActive(self):
+            return (not (FreeCAD.ActiveDocument is None) and
+                    not (FreeCAD.ActiveDocument.getObject("Site") is None) and
+                    not (FreeCAD.ActiveDocument.getObject("Terrain") is None))
+
+    import PVPlantFenceGate
+    FreeCADGui.addCommand('PVPlantFence', _CommandPVPlantFence())
+    FreeCADGui.addCommand('PVPlantGate', PVPlantFenceGate._CommandPVPlantGate())
+    FreeCADGui.addCommand('PVPlantFencePost', PVPlantFencePost._CommandFencePost())
+    FreeCADGui.addCommand('PVPlantFenceGroup', CommandFenceGroup())
+
+def movep(obj):
+    pl = obj.Shape.BoundBox.Center
+    points = []
+    for ind in range(len(obj.Shape.Vertexes)):
+        points.append(obj.Shape.Vertexes[ind].Point - pl)
+    Draft.makeWire(points)

PVPlantFence.ui

@@ -0,0 +1,768 @@
+<?xml version="1.0" encoding="UTF-8"?>
+<ui version="4.0">
+ <class>formRack</class>
+ <widget class="QDialog" name="formRack">
+  <property name="geometry">
+   <rect>
+    <x>0</x>
+    <y>0</y>
+    <width>476</width>
+    <height>641</height>
+   </rect>
+  </property>
+  <property name="windowTitle">
+   <string>Fixed Frame:</string>
+  </property>
+  <layout class="QVBoxLayout" name="verticalLayout">
+   <property name="leftMargin">
+    <number>5</number>
+   </property>
+   <property name="topMargin">
+    <number>5</number>
+   </property>
+   <property name="rightMargin">
+    <number>5</number>
+   </property>
+   <property name="bottomMargin">
+    <number>5</number>
+   </property>
+   <item>
+    <widget class="QGroupBox" name="groupBox">
+     <property name="sizePolicy">
+      <sizepolicy hsizetype="Preferred" vsizetype="Fixed">
+       <horstretch>0</horstretch>
+       <verstretch>0</verstretch>
+      </sizepolicy>
+     </property>
+     <property name="title">
+      <string>Configuración de la valla</string>
+     </property>
+     <layout class="QGridLayout" name="gridLayout">
+      <property name="leftMargin">
+       <number>5</number>
+      </property>
+      <property name="topMargin">
+       <number>5</number>
+      </property>
+      <property name="rightMargin">
+       <number>5</number>
+      </property>
+      <property name="bottomMargin">
+       <number>5</number>
+      </property>
+      <property name="horizontalSpacing">
+       <number>5</number>
+      </property>
+      <property name="verticalSpacing">
+       <number>2</number>
+      </property>
+      <item row="0" column="2">
+       <widget class="QPushButton" name="pushButton">
+        <property name="text">
+         <string>Add</string>
+        </property>
+       </widget>
+      </item>
+      <item row="1" column="2">
+       <widget class="QDoubleSpinBox" name="editModuleLenght">
+        <property name="sizePolicy">
+         <sizepolicy hsizetype="Fixed" vsizetype="Fixed">
+          <horstretch>0</horstretch>
+          <verstretch>0</verstretch>
+         </sizepolicy>
+        </property>
+        <property name="minimumSize">
+         <size>
+          <width>140</width>
+          <height>0</height>
+         </size>
+        </property>
+        <property name="alignment">
+         <set>Qt::AlignRight|Qt::AlignTrailing|Qt::AlignVCenter</set>
+        </property>
+        <property name="buttonSymbols">
+         <enum>QAbstractSpinBox::NoButtons</enum>
+        </property>
+        <property name="decimals">
+         <number>3</number>
+        </property>
+        <property name="maximum">
+         <double>5.000000000000000</double>
+        </property>
+        <property name="singleStep">
+         <double>0.010000000000000</double>
+        </property>
+        <property name="value">
+         <double>0.960000000000000</double>
+        </property>
+       </widget>
+      </item>
+      <item row="1" column="0">
+       <widget class="QLabel" name="label_10">
+        <property name="text">
+         <string>Separación entre apoyos (m)</string>
+        </property>
+       </widget>
+      </item>
+      <item row="0" column="0">
+       <widget class="QLabel" name="label_9">
+        <property name="text">
+         <string>Recorrido:</string>
+        </property>
+       </widget>
+      </item>
+     </layout>
+    </widget>
+   </item>
+   <item>
+    <widget class="QGroupBox" name="groupBox_2">
+     <property name="title">
+      <string>Configuración del poste</string>
+     </property>
+     <layout class="QGridLayout" name="gridLayout_3">
+      <item row="3" column="0">
+       <widget class="QLabel" name="label_2">
+        <property name="text">
+         <string>Columnas (un)</string>
+        </property>
+       </widget>
+      </item>
+      <item row="6" column="1">
+       <widget class="QDoubleSpinBox" name="editFrontHeight">
+        <property name="sizePolicy">
+         <sizepolicy hsizetype="Fixed" vsizetype="Fixed">
+          <horstretch>0</horstretch>
+          <verstretch>0</verstretch>
+         </sizepolicy>
+        </property>
+        <property name="minimumSize">
+         <size>
+          <width>140</width>
+          <height>0</height>
+         </size>
+        </property>
+        <property name="alignment">
+         <set>Qt::AlignRight|Qt::AlignTrailing|Qt::AlignVCenter</set>
+        </property>
+        <property name="buttonSymbols">
+         <enum>QAbstractSpinBox::NoButtons</enum>
+        </property>
+        <property name="maximum">
+         <double>5.000000000000000</double>
+        </property>
+        <property name="singleStep">
+         <double>0.100000000000000</double>
+        </property>
+        <property name="value">
+         <double>0.800000000000000</double>
+        </property>
+       </widget>
+      </item>
+      <item row="1" column="0">
+       <widget class="QLabel" name="label_5">
+        <property name="text">
+         <string>Orientación del módulo</string>
+        </property>
+       </widget>
+      </item>
+      <item row="5" column="1">
+       <widget class="QDoubleSpinBox" name="editVerticalGap">
+        <property name="sizePolicy">
+         <sizepolicy hsizetype="Fixed" vsizetype="Fixed">
+          <horstretch>0</horstretch>
+          <verstretch>0</verstretch>
+         </sizepolicy>
+        </property>
+        <property name="minimumSize">
+         <size>
+          <width>140</width>
+          <height>0</height>
+         </size>
+        </property>
+        <property name="alignment">
+         <set>Qt::AlignRight|Qt::AlignTrailing|Qt::AlignVCenter</set>
+        </property>
+        <property name="buttonSymbols">
+         <enum>QAbstractSpinBox::NoButtons</enum>
+        </property>
+        <property name="maximum">
+         <double>0.900000000000000</double>
+        </property>
+        <property name="singleStep">
+         <double>0.010000000000000</double>
+        </property>
+        <property name="value">
+         <double>0.020000000000000</double>
+        </property>
+       </widget>
+      </item>
+      <item row="2" column="1">
+       <widget class="QSpinBox" name="editRows">
+        <property name="sizePolicy">
+         <sizepolicy hsizetype="Fixed" vsizetype="Fixed">
+          <horstretch>0</horstretch>
+          <verstretch>0</verstretch>
+         </sizepolicy>
+        </property>
+        <property name="minimumSize">
+         <size>
+          <width>140</width>
+          <height>0</height>
+         </size>
+        </property>
+        <property name="alignment">
+         <set>Qt::AlignRight|Qt::AlignTrailing|Qt::AlignVCenter</set>
+        </property>
+        <property name="buttonSymbols">
+         <enum>QAbstractSpinBox::NoButtons</enum>
+        </property>
+        <property name="minimum">
+         <number>1</number>
+        </property>
+       </widget>
+      </item>
+      <item row="0" column="1">
+       <widget class="QComboBox" name="comboFrameType">
+        <property name="sizePolicy">
+         <sizepolicy hsizetype="Fixed" vsizetype="Fixed">
+          <horstretch>0</horstretch>
+          <verstretch>0</verstretch>
+         </sizepolicy>
+        </property>
+        <property name="minimumSize">
+         <size>
+          <width>140</width>
+          <height>0</height>
+         </size>
+        </property>
+        <item>
+         <property name="text">
+          <string>Fija</string>
+         </property>
+        </item>
+        <item>
+         <property name="text">
+          <string>Tracker 1 Eje</string>
+         </property>
+        </item>
+       </widget>
+      </item>
+      <item row="7" column="1">
+       <widget class="QDoubleSpinBox" name="editLeftOffset">
+        <property name="sizePolicy">
+         <sizepolicy hsizetype="Fixed" vsizetype="Fixed">
+          <horstretch>0</horstretch>
+          <verstretch>0</verstretch>
+         </sizepolicy>
+        </property>
+        <property name="minimumSize">
+         <size>
+          <width>140</width>
+          <height>0</height>
+         </size>
+        </property>
+        <property name="alignment">
+         <set>Qt::AlignRight|Qt::AlignTrailing|Qt::AlignVCenter</set>
+        </property>
+        <property name="buttonSymbols">
+         <enum>QAbstractSpinBox::NoButtons</enum>
+        </property>
+        <property name="maximum">
+         <double>0.900000000000000</double>
+        </property>
+        <property name="singleStep">
+         <double>0.010000000000000</double>
+        </property>
+        <property name="value">
+         <double>0.050000000000000</double>
+        </property>
+       </widget>
+      </item>
+      <item row="12" column="0">
+       <widget class="QLabel" name="label_18">
+        <property name="text">
+         <string>Offset borde derecha (m)</string>
+        </property>
+       </widget>
+      </item>
+      <item row="14" column="0">
+       <widget class="QLabel" name="label_3">
+        <property name="text">
+         <string>Ángulo de inclinación (º)</string>
+        </property>
+       </widget>
+      </item>
+      <item row="12" column="1">
+       <widget class="QDoubleSpinBox" name="editRightOffset">
+        <property name="sizePolicy">
+         <sizepolicy hsizetype="Fixed" vsizetype="Fixed">
+          <horstretch>0</horstretch>
+          <verstretch>0</verstretch>
+         </sizepolicy>
+        </property>
+        <property name="minimumSize">
+         <size>
+          <width>140</width>
+          <height>0</height>
+         </size>
+        </property>
+        <property name="alignment">
+         <set>Qt::AlignRight|Qt::AlignTrailing|Qt::AlignVCenter</set>
+        </property>
+        <property name="buttonSymbols">
+         <enum>QAbstractSpinBox::NoButtons</enum>
+        </property>
+        <property name="maximum">
+         <double>0.900000000000000</double>
+        </property>
+        <property name="singleStep">
+         <double>0.010000000000000</double>
+        </property>
+        <property name="value">
+         <double>0.050000000000000</double>
+        </property>
+       </widget>
+      </item>
+      <item row="14" column="1">
+       <widget class="QSpinBox" name="editTilt">
+        <property name="sizePolicy">
+         <sizepolicy hsizetype="Fixed" vsizetype="Fixed">
+          <horstretch>0</horstretch>
+          <verstretch>0</verstretch>
+         </sizepolicy>
+        </property>
+        <property name="minimumSize">
+         <size>
+          <width>140</width>
+          <height>0</height>
+         </size>
+        </property>
+        <property name="alignment">
+         <set>Qt::AlignRight|Qt::AlignTrailing|Qt::AlignVCenter</set>
+        </property>
+        <property name="buttonSymbols">
+         <enum>QAbstractSpinBox::NoButtons</enum>
+        </property>
+        <property name="minimum">
+         <number>1</number>
+        </property>
+        <property name="maximum">
+         <number>60</number>
+        </property>
+       </widget>
+      </item>
+      <item row="15" column="1">
+       <widget class="QSpinBox" name="editInclination">
+        <property name="sizePolicy">
+         <sizepolicy hsizetype="Fixed" vsizetype="Fixed">
+          <horstretch>0</horstretch>
+          <verstretch>0</verstretch>
+         </sizepolicy>
+        </property>
+        <property name="minimumSize">
+         <size>
+          <width>140</width>
+          <height>0</height>
+         </size>
+        </property>
+        <property name="alignment">
+         <set>Qt::AlignRight|Qt::AlignTrailing|Qt::AlignVCenter</set>
+        </property>
+        <property name="buttonSymbols">
+         <enum>QAbstractSpinBox::NoButtons</enum>
+        </property>
+        <property name="minimum">
+         <number>1</number>
+        </property>
+        <property name="maximum">
+         <number>60</number>
+        </property>
+       </widget>
+      </item>
+      <item row="2" column="0">
+       <widget class="QLabel" name="label">
+        <property name="text">
+         <string>Filas (un)</string>
+        </property>
+       </widget>
+      </item>
+      <item row="6" column="0">
+       <widget class="QLabel" name="label_8">
+        <property name="text">
+         <string>Distancia al suelo en el frente (m)</string>
+        </property>
+       </widget>
+      </item>
+      <item row="3" column="1">
+       <widget class="QSpinBox" name="editCols">
+        <property name="sizePolicy">
+         <sizepolicy hsizetype="Fixed" vsizetype="Fixed">
+          <horstretch>0</horstretch>
+          <verstretch>0</verstretch>
+         </sizepolicy>
+        </property>
+        <property name="minimumSize">
+         <size>
+          <width>140</width>
+          <height>0</height>
+         </size>
+        </property>
+        <property name="alignment">
+         <set>Qt::AlignRight|Qt::AlignTrailing|Qt::AlignVCenter</set>
+        </property>
+        <property name="buttonSymbols">
+         <enum>QAbstractSpinBox::NoButtons</enum>
+        </property>
+        <property name="minimum">
+         <number>20</number>
+        </property>
+       </widget>
+      </item>
+      <item row="5" column="0">
+       <widget class="QLabel" name="labelVerticalGap">
+        <property name="text">
+         <string>Separación vertical entre módulos (m)</string>
+        </property>
+       </widget>
+      </item>
+      <item row="1" column="1">
+       <widget class="QComboBox" name="comboModuleOrientation">
+        <property name="sizePolicy">
+         <sizepolicy hsizetype="Fixed" vsizetype="Fixed">
+          <horstretch>0</horstretch>
+          <verstretch>0</verstretch>
+         </sizepolicy>
+        </property>
+        <property name="minimumSize">
+         <size>
+          <width>140</width>
+          <height>0</height>
+         </size>
+        </property>
+        <item>
+         <property name="text">
+          <string>Landscape</string>
+         </property>
+        </item>
+        <item>
+         <property name="text">
+          <string>Portrait</string>
+         </property>
+        </item>
+       </widget>
+      </item>
+      <item row="4" column="0">
+       <widget class="QLabel" name="label_4">
+        <property name="text">
+         <string>Separación horizontal entre módulos (m)</string>
+        </property>
+       </widget>
+      </item>
+      <item row="15" column="0">
+       <widget class="QLabel" name="label_7">
+        <property name="text">
+         <string>Ängulo máximo de inclinación longitudinal (ª)</string>
+        </property>
+       </widget>
+      </item>
+      <item row="4" column="1">
+       <widget class="QDoubleSpinBox" name="editHorizontalGap">
+        <property name="sizePolicy">
+         <sizepolicy hsizetype="Fixed" vsizetype="Fixed">
+          <horstretch>0</horstretch>
+          <verstretch>0</verstretch>
+         </sizepolicy>
+        </property>
+        <property name="minimumSize">
+         <size>
+          <width>140</width>
+          <height>0</height>
+         </size>
+        </property>
+        <property name="alignment">
+         <set>Qt::AlignRight|Qt::AlignTrailing|Qt::AlignVCenter</set>
+        </property>
+        <property name="buttonSymbols">
+         <enum>QAbstractSpinBox::NoButtons</enum>
+        </property>
+        <property name="maximum">
+         <double>0.900000000000000</double>
+        </property>
+        <property name="singleStep">
+         <double>0.010000000000000</double>
+        </property>
+        <property name="value">
+         <double>0.020000000000000</double>
+        </property>
+       </widget>
+      </item>
+      <item row="0" column="0">
+       <widget class="QLabel" name="label_6">
+        <property name="text">
+         <string>Tipo de estructura</string>
+        </property>
+       </widget>
+      </item>
+      <item row="7" column="0">
+       <widget class="QLabel" name="label_17">
+        <property name="text">
+         <string>Offset borde izquierda (m)</string>
+        </property>
+       </widget>
+      </item>
+      <item row="16" column="0" colspan="2">
+       <widget class="QWidget" name="widgetTracker" native="true">
+        <layout class="QGridLayout" name="gridLayout_4">
+         <property name="leftMargin">
+          <number>0</number>
+         </property>
+         <property name="topMargin">
+          <number>0</number>
+         </property>
+         <property name="rightMargin">
+          <number>0</number>
+         </property>
+         <property name="bottomMargin">
+          <number>0</number>
+         </property>
+         <property name="spacing">
+          <number>5</number>
+         </property>
+         <item row="2" column="0">
+          <widget class="QLabel" name="labelVerticalGap_2">
+           <property name="text">
+            <string>Separación entre uniones (m)</string>
+           </property>
+          </widget>
+         </item>
+         <item row="0" column="0">
+          <widget class="QCheckBox" name="checkBox">
+           <property name="text">
+            <string>Separación Motor (m)</string>
+           </property>
+          </widget>
+         </item>
+         <item row="1" column="1">
+          <widget class="QSpinBox" name="editInternalGapNumber">
+           <property name="sizePolicy">
+            <sizepolicy hsizetype="Fixed" vsizetype="Fixed">
+             <horstretch>0</horstretch>
+             <verstretch>0</verstretch>
+            </sizepolicy>
+           </property>
+           <property name="minimumSize">
+            <size>
+             <width>140</width>
+             <height>0</height>
+            </size>
+           </property>
+           <property name="alignment">
+            <set>Qt::AlignRight|Qt::AlignTrailing|Qt::AlignVCenter</set>
+           </property>
+           <property name="buttonSymbols">
+            <enum>QAbstractSpinBox::NoButtons</enum>
+           </property>
+           <property name="minimum">
+            <number>0</number>
+           </property>
+           <property name="maximum">
+            <number>6</number>
+           </property>
+           <property name="value">
+            <number>0</number>
+           </property>
+          </widget>
+         </item>
+         <item row="1" column="0">
+          <widget class="QLabel" name="label_19">
+           <property name="text">
+            <string>Número de uniones</string>
+           </property>
+          </widget>
+         </item>
+         <item row="2" column="1">
+          <widget class="QDoubleSpinBox" name="editInternalGap">
+           <property name="sizePolicy">
+            <sizepolicy hsizetype="Fixed" vsizetype="Fixed">
+             <horstretch>0</horstretch>
+             <verstretch>0</verstretch>
+            </sizepolicy>
+           </property>
+           <property name="minimumSize">
+            <size>
+             <width>140</width>
+             <height>0</height>
+            </size>
+           </property>
+           <property name="alignment">
+            <set>Qt::AlignRight|Qt::AlignTrailing|Qt::AlignVCenter</set>
+           </property>
+           <property name="buttonSymbols">
+            <enum>QAbstractSpinBox::NoButtons</enum>
+           </property>
+           <property name="maximum">
+            <double>0.900000000000000</double>
+           </property>
+           <property name="singleStep">
+            <double>0.010000000000000</double>
+           </property>
+           <property name="value">
+            <double>0.020000000000000</double>
+           </property>
+          </widget>
+         </item>
+         <item row="0" column="1">
+          <widget class="QDoubleSpinBox" name="editMotorGap">
+           <property name="sizePolicy">
+            <sizepolicy hsizetype="Fixed" vsizetype="Fixed">
+             <horstretch>0</horstretch>
+             <verstretch>0</verstretch>
+            </sizepolicy>
+           </property>
+           <property name="minimumSize">
+            <size>
+             <width>140</width>
+             <height>0</height>
+            </size>
+           </property>
+           <property name="alignment">
+            <set>Qt::AlignRight|Qt::AlignTrailing|Qt::AlignVCenter</set>
+           </property>
+           <property name="buttonSymbols">
+            <enum>QAbstractSpinBox::NoButtons</enum>
+           </property>
+           <property name="maximum">
+            <double>0.900000000000000</double>
+           </property>
+           <property name="singleStep">
+            <double>0.010000000000000</double>
+           </property>
+           <property name="value">
+            <double>0.020000000000000</double>
+           </property>
+          </widget>
+         </item>
+        </layout>
+       </widget>
+      </item>
+     </layout>
+    </widget>
+   </item>
+   <item>
+    <widget class="QGroupBox" name="groupBox_3">
+     <property name="title">
+      <string>Cimentación</string>
+     </property>
+     <layout class="QGridLayout" name="gridLayout_2">
+      <item row="0" column="0">
+       <widget class="QLabel" name="label_13">
+        <property name="text">
+         <string>Total de módulos</string>
+        </property>
+       </widget>
+      </item>
+      <item row="0" column="1">
+       <widget class="QLineEdit" name="editTotalModules">
+        <property name="sizePolicy">
+         <sizepolicy hsizetype="Fixed" vsizetype="Fixed">
+          <horstretch>0</horstretch>
+          <verstretch>0</verstretch>
+         </sizepolicy>
+        </property>
+        <property name="minimumSize">
+         <size>
+          <width>140</width>
+          <height>0</height>
+         </size>
+        </property>
+        <property name="readOnly">
+         <bool>true</bool>
+        </property>
+       </widget>
+      </item>
+      <item row="1" column="0">
+       <widget class="QLabel" name="label_14">
+        <property name="text">
+         <string>Potencia total (wp)</string>
+        </property>
+       </widget>
+      </item>
+      <item row="1" column="1">
+       <widget class="QLineEdit" name="editTotalPower">
+        <property name="sizePolicy">
+         <sizepolicy hsizetype="Fixed" vsizetype="Fixed">
+          <horstretch>0</horstretch>
+          <verstretch>0</verstretch>
+         </sizepolicy>
+        </property>
+        <property name="minimumSize">
+         <size>
+          <width>140</width>
+          <height>0</height>
+         </size>
+        </property>
+        <property name="readOnly">
+         <bool>true</bool>
+        </property>
+       </widget>
+      </item>
+      <item row="2" column="0">
+       <widget class="QLabel" name="label_15">
+        <property name="text">
+         <string>Longitud (m)</string>
+        </property>
+       </widget>
+      </item>
+      <item row="2" column="1">
+       <widget class="QLineEdit" name="editTotalLength">
+        <property name="sizePolicy">
+         <sizepolicy hsizetype="Fixed" vsizetype="Fixed">
+          <horstretch>0</horstretch>
+          <verstretch>0</verstretch>
+         </sizepolicy>
+        </property>
+        <property name="minimumSize">
+         <size>
+          <width>140</width>
+          <height>0</height>
+         </size>
+        </property>
+        <property name="readOnly">
+         <bool>true</bool>
+        </property>
+       </widget>
+      </item>
+      <item row="3" column="0">
+       <widget class="QLabel" name="label_16">
+        <property name="text">
+         <string>Anchura (m)</string>
+        </property>
+       </widget>
+      </item>
+      <item row="3" column="1">
+       <widget class="QLineEdit" name="editTotalWidth">
+        <property name="sizePolicy">
+         <sizepolicy hsizetype="Fixed" vsizetype="Fixed">
+          <horstretch>0</horstretch>
+          <verstretch>0</verstretch>
+         </sizepolicy>
+        </property>
+        <property name="minimumSize">
+         <size>
+          <width>140</width>
+          <height>0</height>
+         </size>
+        </property>
+        <property name="readOnly">
+         <bool>true</bool>
+        </property>
+       </widget>
+      </item>
+     </layout>
+    </widget>
+   </item>
+  </layout>
+ </widget>
+ <resources/>
+ <connections/>
+</ui>

PVPlantFenceGate.py

@@ -0,0 +1,425 @@
+# /**********************************************************************
+# *                                                                     *
+# * Copyright (c) 2021 Javier Braña <javier.branagutierrez@gmail.com>  *
+# *                                                                     *
+# * This program is free software; you can redistribute it and/or modify*
+# * it under the terms of the GNU Lesser General Public License (LGPL)  *
+# * as published by the Free Software Foundation; either version 2 of   *
+# * the License, or (at your option) any later version.                 *
+# * for detail see the LICENCE text file.                               *
+# *                                                                     *
+# * This program is distributed in the hope that it will be useful,     *
+# * but WITHOUT ANY WARRANTY; without even the implied warranty of      *
+# * MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE.  See the       *
+# * GNU Library General Public License for more details.                *
+# *                                                                     *
+# * You should have received a copy of the GNU Library General Public   *
+# * License along with this program; if not, write to the Free Software *
+# * Foundation, Inc., 59 Temple Place, Suite 330, Boston, MA  02111-1307*
+# * USA                                                                 *
+# *                                                                     *
+# ***********************************************************************
+
+import ArchComponent
+import FreeCAD
+import Part
+
+if FreeCAD.GuiUp:
+    import FreeCADGui
+    from PySide import QtCore, QtGui, QtSvg
+    from PySide.QtCore import QT_TRANSLATE_NOOP
+    import PySide.QtGui as QtGui
+    import draftguitools.gui_trackers as DraftTrackers
+else:
+    # \cond
+    def translate(ctxt, txt):
+        return txt
+
+    def QT_TRANSLATE_NOOP(ctxt, txt):
+        return txt
+    # \endcond
+
+try:
+    _fromUtf8 = QtCore.QString.fromUtf8
+except AttributeError:
+    def _fromUtf8(s):
+        return s
+
+import os
+import PVPlantResources
+from PVPlantResources import DirIcons as DirIcons
+
+def makePVPlantFence():
+    obj = FreeCAD.ActiveDocument.addObject('Part::FeaturePython', 'FenceGate')
+    FenceGate(obj)
+    if FreeCAD.GuiUp:
+        ViewProviderGate(obj.ViewObject)
+    return obj
+
+
+class FenceGate(ArchComponent.Component):
+    def __init__(self, obj):
+        ArchComponent.Component.__init__(self, obj)
+        self.setProperties(obj)
+
+    def setProperties(self, obj):
+        pl = obj.PropertiesList
+
+        if not ("GateType" in pl):
+            obj.addProperty("App::PropertyEnumeration",
+                            "GateType",
+                            "Gate",
+                            QT_TRANSLATE_NOOP("App::Property",
+                                              "The facemaker type to use to build the profile of this object")
+                            ).GateType = ["Single", "Double"]
+
+        if not ("GateWidth" in pl):
+            obj.addProperty("App::PropertyDistance",
+                            "GateWidth",
+                            "Gate",
+                            "Base wire"
+                            ).GateWidth = 3000
+
+        if not ("GateHeight" in pl):
+            obj.addProperty("App::PropertyDistance",
+                            "GateHeight",
+                            "Gate",
+                            "Base wire"
+                            ).GateHeight = 2000
+
+        if not ("PostWidth" in pl):
+            obj.addProperty("App::PropertyDistance",
+                            "PostWidth",
+                            "Gate",
+                            "Base wire"
+                            ).PostWidth = 60
+
+        if not ("PostHeight" in pl):
+            obj.addProperty("App::PropertyDistance",
+                            "PostHeight",
+                            "Gate",
+                            "Base wire"
+                            ).PostHeight = 2000
+
+        if not "PostDepth" in pl:
+            obj.addProperty("App::PropertyLength",
+                            "PostDepth",
+                            "Fence",
+                            "A single fence post").PostDepth = 700
+
+        self.Type = "PVPlatFenceGate"
+        #obj.Type = self.Type
+        obj.Proxy = self
+        self.obj = obj
+
+    def __getstate__(self):
+        if hasattr(self, 'sectionFaceNumbers'):
+            return (self.sectionFaceNumbers)
+        return None
+
+    def __setstate__(self, state):
+        if state is not None and isinstance(state, tuple):
+            self.sectionFaceNumbers = state[0]
+        return None
+
+    def onDocumentRestored(self, obj):
+        """Method run when the document is restored."""
+        self.setProperties(obj)
+
+    def onChanged(self, obj, prop):
+        '''Do something when a property has changed'''
+
+    def execute(self, obj):
+        tubewidth = 50
+        gap = 20
+        posts = Part.makeCompound([])
+        gates = Part.makeCompound([])
+        pl = obj.Placement
+
+        post = Part.makeBox(obj.PostWidth.Value,
+                            obj.PostWidth.Value,
+                            obj.PostHeight.Value + obj.PostDepth.Value)
+
+        gate = Part.makeBox(obj.GateWidth.Value,
+                            tubewidth,
+                            obj.GateHeight.Value)
+
+        cut = Part.makeBox(obj.GateWidth.Value - tubewidth * 2,
+                           tubewidth,
+                           obj.GateHeight.Value - tubewidth * 2)
+        cut.Placement.Base += FreeCAD.Vector(tubewidth, 0, tubewidth)
+        gate = gate.cut(cut)
+
+        if obj.GateType == "Single":
+            post.Placement.Base = FreeCAD.Vector(-(obj.PostWidth.Value + gap + obj.GateWidth.Value / 2),
+                                                 -obj.PostWidth.Value / 2,
+                                                 -obj.PostDepth.Value)
+            posts.add(post)
+            post = post.copy()
+            post.Placement.Base.x = -(post.Placement.Base.x + obj.PostWidth.Value)
+            posts.add(post)
+            gate.Placement.Base += FreeCAD.Vector(-obj.GateWidth.Value / 2,
+                                                  obj.PostWidth.Value / 2 - tubewidth,
+                                                  0)
+            gates.add(gate)
+        else:
+            post.Placement.Base = FreeCAD.Vector(-(obj.PostWidth.Value + gap * 1.5 + obj.GateWidth.Value),
+                                                 -obj.PostWidth.Value / 2,
+                                                 -obj.PostDepth.Value)
+            posts.add(post)
+            post = post.copy()
+            post.Placement.Base.x = -(post.Placement.Base.x + obj.PostWidth.Value)
+            posts.add(post)
+
+            gate.Placement.Base += FreeCAD.Vector(-(obj.GateWidth.Value + gap * 0.5),
+                                                  obj.PostWidth.Value / 2 - tubewidth,
+                                                  0)
+            gates.add(gate)
+            gate = gate.copy()
+            gate.Placement.Base.x = gap * 0.5
+            gates.add(gate)
+
+        obj.Shape = Part.makeCompound([gates, posts])
+        obj.Placement = pl
+
+
+class ViewProviderGate:
+    def __init__(self, vobj):
+        ''' Set view properties. '''
+        vobj.Proxy = self
+
+    def attach(self, vobj):
+        self.Object = vobj.Object
+
+    def getIcon(self):
+        ''' Return object treeview icon. '''
+        return str(os.path.join(DirIcons, "gate.svg"))
+
+    def claimChildren(self):
+        """ Provides object grouping """
+        children = []
+        if self.Object.Base:
+            children.append(self.Object.Base)
+        return children
+
+class _CommandPVPlantGate:
+    "the PVPlant Fence command definition"
+
+    def __init__(self):
+        ''' p = FreeCAD.ParamGet("User parameter:BaseApp/Preferences/Mod/Arch")
+        self.Thickness = p.GetFloat("WindowThickness", 50)
+        self.Width = p.GetFloat("WindowWidth", 1000)
+        self.Height = p.GetFloat("DoorHeight", 2100)'''
+
+        self.Width = 0
+        self.Height = 0
+        self.Length = 0
+        self.tracker = None
+
+    def GetResources(self):
+        return {'Pixmap': str(os.path.join(DirIcons, "gate.svg")),
+                'Accel': "C, F",
+                'MenuText': QT_TRANSLATE_NOOP("PVPlantFence", "Gate"),
+                'ToolTip': QT_TRANSLATE_NOOP("PVPlantFence",
+                                             "Creates a fence object from a selected section, post and path")}
+
+    def IsActive(self):
+        return not FreeCAD.ActiveDocument is None
+
+    def Activated(self):
+        self.tracker = DraftTrackers.boxTracker()
+        self.tracker.length(self.Length)
+        self.tracker.width(self.Width)
+        self.tracker.height(self.Height)
+        self.tracker.on()
+        FreeCAD.Console.PrintMessage("Choose a face on an existing object or select a preset" + "\n")
+        FreeCADGui.Snapper.getPoint(callback=self.getPoint,
+                                    movecallback=self.update,
+                                    extradlg=self.taskbox())
+
+    def getPoint(self, point=None, obj=None):
+        "this function is called by the snapper when it has a 3D point"
+
+        if obj.Name[:5] == "Fence":
+            self.tracker.finalize()
+            if point is None:
+                return
+            ver = Part.Vertex(point)
+            dist = ver.distToShape(obj.Base.Shape)
+            point1 = dist[1][0][1]
+            ed = None
+            if dist[2][0][3] == "Edge":
+                ed = obj.Base.Shape.Edges[int(dist[-1][0][4])]
+            vec = ed.Vertexes[1].Point.sub(ed.Vertexes[0].Point)
+
+            FreeCAD.ActiveDocument.openTransaction("Create Gate")
+            gate = makePVPlantFence()
+            try:
+                import MeshPart as mp
+                point1 = mp.projectPointsOnMesh([point1,], FreeCAD.ActiveDocument.Terrain.Mesh, FreeCAD.Vector(0, 0, 1))[0]
+
+            except:
+                FreeCAD.Console.PrintError("No se puede encontrar punto 3D.." + "\n")
+                pass
+
+            gate.Placement.Base = point1
+            gate.Placement.Rotation = FreeCAD.Rotation(FreeCAD.Vector(-1, 0, 0), vec)
+            tmp = obj.Gate
+            tmp.append(gate)
+            obj.Gate = tmp
+
+            FreeCAD.ActiveDocument.commitTransaction()
+            FreeCAD.ActiveDocument.recompute()
+            return
+        else:
+            FreeCADGui.Snapper.getPoint(callback=self.getPoint,
+                                        movecallback=self.update,
+                                        extradlg=self.taskbox())
+    def update(self, point, info):
+        ''' this function is called by the Snapper when the mouse is moved '''
+
+        delta = FreeCAD.Vector(self.Length / 2, self.Width / 2, self.Height / 2)
+        rot = FreeCAD.Rotation()
+
+        #self.tracker.setRotation(rot)
+        self.tracker.pos(point)
+        return
+
+        delta = FreeCAD.Vector(self.Length / 2, self.Width / 2, self.Height / 2)
+        delta = delta.add(FreeCAD.Vector(0, 0, self.Sill))
+        rot = FreeCAD.Rotation()
+        if info:
+            if "Face" in info['Component']:
+                import WorkingPlane
+                o = FreeCAD.ActiveDocument.getObject(info['Object'])
+                self.baseFace = [o, int(info['Component'][4:]) - 1]
+                # print("switching to ",o.Label," face ",self.baseFace[1])
+                f = o.Shape.Faces[self.baseFace[1]]
+                p = WorkingPlane.getPlacementFromFace(f, rotated=True)
+                if p:
+                    rot = p.Rotation
+                    self.tracker.setRotation(rot)
+        r = self.tracker.trans.rotation.getValue().getValue()
+        if r != (0, 0, 0, 1):
+            delta = FreeCAD.Rotation(r[0], r[1], r[2], r[3]).multVec(FreeCAD.Vector(delta.x, -delta.y, -delta.z))
+        self.tracker.pos(point.add(delta))
+
+    def taskbox(self):
+        "sets up a taskbox widget"
+
+        w = FreeCADGui.PySideUic.loadUi(PVPlantResources.__dir__ + "/PVPlantFenceGate.ui")
+        self.Width = 80
+        self.Height = 2000
+        self.Length = 6146
+        return w
+
+        w = QtGui.QWidget()
+        ui = FreeCADGui.UiLoader()
+
+        w.setWindowTitle("Window options")
+        grid = QtGui.QGridLayout(w)
+
+        # include box
+        include = QtGui.QCheckBox(translate("Arch","Auto include in host object"))
+        include.setChecked(True)
+        grid.addWidget(include,0,0,1,2)
+        QtCore.QObject.connect(include,QtCore.SIGNAL("stateChanged(int)"),self.setInclude)
+
+        # sill height
+        labels = QtGui.QLabel(translate("Arch","Sill height"))
+        values = ui.createWidget("Gui::InputField")
+        grid.addWidget(labels,1,0,1,1)
+        grid.addWidget(values,1,1,1,1)
+        QtCore.QObject.connect(values,QtCore.SIGNAL("valueChanged(double)"),self.setSill)
+
+        # check for Parts library and Arch presets
+
+        # because of the use of FreeCADGui.doCommand() backslashes in the
+        # paths in librarypresets need to be double escaped "\\\\", so let's
+        # use forward slashes instead...
+        self.librarypresets = []
+        librarypath = FreeCAD.ParamGet("User parameter:Plugins/parts_library").GetString("destination", "")
+        # librarypath should have only forward slashes already, but let's use replace() anyway just to be sure:
+        librarypath = librarypath.replace("\\", "/") + "/Architectural Parts"
+        presetdir = FreeCAD.getUserAppDataDir().replace("\\", "/") + "/Arch"
+        for path in [librarypath, presetdir]:
+            if os.path.isdir(path):
+                for wtype in ["Windows", "Doors"]:
+                    wdir = path + "/" + wtype
+                    if os.path.isdir(wdir):
+                        for subtype in os.listdir(wdir):
+                            subdir = wdir + "/" + subtype
+                            if os.path.isdir(subdir):
+                                for subfile in os.listdir(subdir):
+                                    if (os.path.isfile(subdir + "/" + subfile)
+                                            and subfile.lower().endswith(".fcstd")):
+                                        self.librarypresets.append([wtype + " - " + subtype + " - " + subfile[:-6],
+                                                                    subdir + "/" + subfile])
+
+        # presets box
+        labelp = QtGui.QLabel(translate("Arch","Preset"))
+        valuep = QtGui.QComboBox()
+        valuep.setMinimumContentsLength(6)
+        valuep.setSizeAdjustPolicy(QtGui.QComboBox.AdjustToContents)
+        valuep.addItems(WindowPresets)
+        valuep.setCurrentIndex(self.Preset)
+        grid.addWidget(labelp,2,0,1,1)
+        grid.addWidget(valuep,2,1,1,1)
+        QtCore.QObject.connect(valuep,QtCore.SIGNAL("currentIndexChanged(int)"),self.setPreset)
+        for it in self.librarypresets:
+            valuep.addItem(it[0])
+
+        # image display
+        self.pic = QtGui.QLabel()
+        grid.addWidget(self.pic,3,0,1,2)
+        self.pic.setFixedHeight(128)
+        self.pic.hide()
+
+        # SVG display
+        self.im = QtSvg.QSvgWidget(":/ui/ParametersWindowFixed.svg")
+        self.im.setMaximumWidth(200)
+        self.im.setMinimumHeight(120)
+        grid.addWidget(self.im,4,0,1,2)
+        #self.im.hide()
+
+        # parameters
+        i = 5
+        for param in self.wparams:
+            lab = QtGui.QLabel(translate("Arch",param))
+            setattr(self,"val"+param,ui.createWidget("Gui::InputField"))
+            wid = getattr(self,"val"+param)
+            if param == "Width":
+                wid.setText(FreeCAD.Units.Quantity(self.Width,FreeCAD.Units.Length).UserString)
+            elif param == "Height":
+                wid.setText(FreeCAD.Units.Quantity(self.Height,FreeCAD.Units.Length).UserString)
+            elif param == "O1":
+                n = FreeCAD.ParamGet("User parameter:BaseApp/Preferences/Mod/Arch").GetFloat("WindowO1",0.0)
+                wid.setText(FreeCAD.Units.Quantity(n,FreeCAD.Units.Length).UserString)
+                setattr(self,param,n)
+            elif param == "W1":
+                n = FreeCAD.ParamGet("User parameter:BaseApp/Preferences/Mod/Arch").GetFloat("WindowW1",self.Thickness*2)
+                wid.setText(FreeCAD.Units.Quantity(n,FreeCAD.Units.Length).UserString)
+                setattr(self,param,n)
+            else:
+                n = FreeCAD.ParamGet("User parameter:BaseApp/Preferences/Mod/Arch").GetFloat("Window"+param,self.Thickness)
+                wid.setText(FreeCAD.Units.Quantity(n,FreeCAD.Units.Length).UserString)
+                setattr(self,param,n)
+            grid.addWidget(lab,i,0,1,1)
+            grid.addWidget(wid,i,1,1,1)
+            i += 1
+            valueChanged = self.getValueChanged(param)
+            FreeCAD.wid = wid
+            QtCore.QObject.connect(getattr(self,"val"+param),QtCore.SIGNAL("valueChanged(double)"), valueChanged)
+
+        # restore saved states
+        if self.doormode:
+            i = FreeCAD.ParamGet("User parameter:BaseApp/Preferences/Mod/Arch").GetInt("DoorPreset",0)
+            d = FreeCAD.ParamGet("User parameter:BaseApp/Preferences/Mod/Arch").GetFloat("DoorSill",0)
+        else:
+            i = FreeCAD.ParamGet("User parameter:BaseApp/Preferences/Mod/Arch").GetInt("WindowPreset",0)
+            d = FreeCAD.ParamGet("User parameter:BaseApp/Preferences/Mod/Arch").GetFloat("WindowSill",0)
+        if i < valuep.count():
+            valuep.setCurrentIndex(i)
+        values.setText(FreeCAD.Units.Quantity(d,FreeCAD.Units.Length).UserString)
+
+        return w

PVPlantFenceGate.ui

@@ -0,0 +1,352 @@
+<?xml version="1.0" encoding="UTF-8"?>
+<ui version="4.0">
+ <class>formGate</class>
+ <widget class="QWidget" name="formGate">
+  <property name="geometry">
+   <rect>
+    <x>0</x>
+    <y>0</y>
+    <width>317</width>
+    <height>289</height>
+   </rect>
+  </property>
+  <property name="windowTitle">
+   <string>Puerta:</string>
+  </property>
+  <layout class="QVBoxLayout" name="verticalLayout">
+   <property name="leftMargin">
+    <number>5</number>
+   </property>
+   <property name="topMargin">
+    <number>5</number>
+   </property>
+   <property name="rightMargin">
+    <number>5</number>
+   </property>
+   <property name="bottomMargin">
+    <number>5</number>
+   </property>
+   <item>
+    <widget class="QGroupBox" name="groupBox_2">
+     <property name="title">
+      <string>Puerta</string>
+     </property>
+     <layout class="QGridLayout" name="gridLayout_3">
+      <item row="0" column="0">
+       <widget class="QLabel" name="label_6">
+        <property name="text">
+         <string>Tipo de puerta</string>
+        </property>
+       </widget>
+      </item>
+      <item row="2" column="1">
+       <widget class="QDoubleSpinBox" name="editGateHeight">
+        <property name="sizePolicy">
+         <sizepolicy hsizetype="Fixed" vsizetype="Fixed">
+          <horstretch>0</horstretch>
+          <verstretch>0</verstretch>
+         </sizepolicy>
+        </property>
+        <property name="minimumSize">
+         <size>
+          <width>140</width>
+          <height>0</height>
+         </size>
+        </property>
+        <property name="alignment">
+         <set>Qt::AlignRight|Qt::AlignTrailing|Qt::AlignVCenter</set>
+        </property>
+        <property name="buttonSymbols">
+         <enum>QAbstractSpinBox::NoButtons</enum>
+        </property>
+        <property name="maximum">
+         <double>5.000000000000000</double>
+        </property>
+        <property name="singleStep">
+         <double>0.100000000000000</double>
+        </property>
+        <property name="value">
+         <double>2.000000000000000</double>
+        </property>
+       </widget>
+      </item>
+      <item row="1" column="0">
+       <widget class="QLabel" name="labelVerticalGap">
+        <property name="text">
+         <string>Ancho (m)</string>
+        </property>
+       </widget>
+      </item>
+      <item row="1" column="1">
+       <widget class="QDoubleSpinBox" name="editGateWidth">
+        <property name="sizePolicy">
+         <sizepolicy hsizetype="Fixed" vsizetype="Fixed">
+          <horstretch>0</horstretch>
+          <verstretch>0</verstretch>
+         </sizepolicy>
+        </property>
+        <property name="minimumSize">
+         <size>
+          <width>140</width>
+          <height>0</height>
+         </size>
+        </property>
+        <property name="alignment">
+         <set>Qt::AlignRight|Qt::AlignTrailing|Qt::AlignVCenter</set>
+        </property>
+        <property name="buttonSymbols">
+         <enum>QAbstractSpinBox::NoButtons</enum>
+        </property>
+        <property name="maximum">
+         <double>10000.000000000000000</double>
+        </property>
+        <property name="singleStep">
+         <double>0.500000000000000</double>
+        </property>
+        <property name="value">
+         <double>0.850000000000000</double>
+        </property>
+       </widget>
+      </item>
+      <item row="2" column="0">
+       <widget class="QLabel" name="label_8">
+        <property name="text">
+         <string>Alto (m)</string>
+        </property>
+       </widget>
+      </item>
+      <item row="0" column="1">
+       <widget class="QComboBox" name="comboFrameType">
+        <property name="sizePolicy">
+         <sizepolicy hsizetype="Fixed" vsizetype="Fixed">
+          <horstretch>0</horstretch>
+          <verstretch>0</verstretch>
+         </sizepolicy>
+        </property>
+        <property name="minimumSize">
+         <size>
+          <width>140</width>
+          <height>0</height>
+         </size>
+        </property>
+        <item>
+         <property name="text">
+          <string>Simple</string>
+         </property>
+        </item>
+        <item>
+         <property name="text">
+          <string>Doble</string>
+         </property>
+        </item>
+       </widget>
+      </item>
+     </layout>
+    </widget>
+   </item>
+   <item>
+    <widget class="QGroupBox" name="groupBox">
+     <property name="sizePolicy">
+      <sizepolicy hsizetype="Preferred" vsizetype="Fixed">
+       <horstretch>0</horstretch>
+       <verstretch>0</verstretch>
+      </sizepolicy>
+     </property>
+     <property name="title">
+      <string>Poste</string>
+     </property>
+     <layout class="QGridLayout" name="gridLayout">
+      <property name="leftMargin">
+       <number>9</number>
+      </property>
+      <property name="topMargin">
+       <number>9</number>
+      </property>
+      <property name="rightMargin">
+       <number>9</number>
+      </property>
+      <property name="bottomMargin">
+       <number>9</number>
+      </property>
+      <property name="spacing">
+       <number>6</number>
+      </property>
+      <item row="3" column="2">
+       <widget class="QDoubleSpinBox" name="editPostBuried">
+        <property name="sizePolicy">
+         <sizepolicy hsizetype="Fixed" vsizetype="Fixed">
+          <horstretch>0</horstretch>
+          <verstretch>0</verstretch>
+         </sizepolicy>
+        </property>
+        <property name="minimumSize">
+         <size>
+          <width>140</width>
+          <height>0</height>
+         </size>
+        </property>
+        <property name="alignment">
+         <set>Qt::AlignRight|Qt::AlignTrailing|Qt::AlignVCenter</set>
+        </property>
+        <property name="buttonSymbols">
+         <enum>QAbstractSpinBox::NoButtons</enum>
+        </property>
+        <property name="maximum">
+         <double>2000.000000000000000</double>
+        </property>
+        <property name="singleStep">
+         <double>50.000000000000000</double>
+        </property>
+        <property name="value">
+         <double>700.000000000000000</double>
+        </property>
+       </widget>
+      </item>
+      <item row="1" column="0">
+       <widget class="QLabel" name="label_10">
+        <property name="text">
+         <string>Alto (m)</string>
+        </property>
+       </widget>
+      </item>
+      <item row="3" column="0">
+       <widget class="QLabel" name="label_17">
+        <property name="text">
+         <string>Enterramiento (m)</string>
+        </property>
+       </widget>
+      </item>
+      <item row="1" column="2">
+       <widget class="QDoubleSpinBox" name="editPostHeight">
+        <property name="sizePolicy">
+         <sizepolicy hsizetype="Fixed" vsizetype="Fixed">
+          <horstretch>0</horstretch>
+          <verstretch>0</verstretch>
+         </sizepolicy>
+        </property>
+        <property name="minimumSize">
+         <size>
+          <width>140</width>
+          <height>0</height>
+         </size>
+        </property>
+        <property name="alignment">
+         <set>Qt::AlignRight|Qt::AlignTrailing|Qt::AlignVCenter</set>
+        </property>
+        <property name="buttonSymbols">
+         <enum>QAbstractSpinBox::NoButtons</enum>
+        </property>
+        <property name="decimals">
+         <number>3</number>
+        </property>
+        <property name="maximum">
+         <double>5000.000000000000000</double>
+        </property>
+        <property name="singleStep">
+         <double>500.000000000000000</double>
+        </property>
+        <property name="value">
+         <double>2000.000000000000000</double>
+        </property>
+       </widget>
+      </item>
+      <item row="2" column="0">
+       <widget class="QLabel" name="label_9">
+        <property name="text">
+         <string>Ancho (mm)</string>
+        </property>
+       </widget>
+      </item>
+      <item row="2" column="2">
+       <widget class="QSpinBox" name="editPostWidth">
+        <property name="sizePolicy">
+         <sizepolicy hsizetype="Fixed" vsizetype="Fixed">
+          <horstretch>0</horstretch>
+          <verstretch>0</verstretch>
+         </sizepolicy>
+        </property>
+        <property name="minimumSize">
+         <size>
+          <width>140</width>
+          <height>0</height>
+         </size>
+        </property>
+        <property name="layoutDirection">
+         <enum>Qt::LeftToRight</enum>
+        </property>
+        <property name="alignment">
+         <set>Qt::AlignRight|Qt::AlignTrailing|Qt::AlignVCenter</set>
+        </property>
+        <property name="buttonSymbols">
+         <enum>QAbstractSpinBox::NoButtons</enum>
+        </property>
+        <property name="maximum">
+         <number>200</number>
+        </property>
+        <property name="value">
+         <number>80</number>
+        </property>
+       </widget>
+      </item>
+     </layout>
+    </widget>
+   </item>
+   <item>
+    <widget class="QWidget" name="widget" native="true">
+     <layout class="QHBoxLayout" name="horizontalLayout">
+      <item>
+       <widget class="QLabel" name="label">
+        <property name="text">
+         <string>Espacio (mm)</string>
+        </property>
+       </widget>
+      </item>
+      <item>
+       <widget class="QSpinBox" name="editGap">
+        <property name="sizePolicy">
+         <sizepolicy hsizetype="Fixed" vsizetype="Fixed">
+          <horstretch>0</horstretch>
+          <verstretch>0</verstretch>
+         </sizepolicy>
+        </property>
+        <property name="minimumSize">
+         <size>
+          <width>140</width>
+          <height>0</height>
+         </size>
+        </property>
+        <property name="alignment">
+         <set>Qt::AlignRight|Qt::AlignTrailing|Qt::AlignVCenter</set>
+        </property>
+        <property name="buttonSymbols">
+         <enum>QAbstractSpinBox::NoButtons</enum>
+        </property>
+        <property name="maximum">
+         <number>10</number>
+        </property>
+        <property name="value">
+         <number>2</number>
+        </property>
+       </widget>
+      </item>
+     </layout>
+    </widget>
+   </item>
+   <item>
+    <spacer name="verticalSpacer">
+     <property name="orientation">
+      <enum>Qt::Vertical</enum>
+     </property>
+     <property name="sizeHint" stdset="0">
+      <size>
+       <width>20</width>
+       <height>40</height>
+      </size>
+     </property>
+    </spacer>
+   </item>
+  </layout>
+ </widget>
+ <resources/>
+ <connections/>
+</ui>

PVPlantFencePost.py

@@ -0,0 +1,285 @@
+import ArchComponent
+import FreeCAD
+
+if FreeCAD.GuiUp:
+    import FreeCADGui
+    from PySide import QtCore
+    from PySide.QtCore import QT_TRANSLATE_NOOP
+else:
+    # \cond
+    def translate(ctxt, txt):
+        return txt
+
+
+    def QT_TRANSLATE_NOOP(ctxt, txt):
+        return txt
+    # \endcond
+
+try:
+    _fromUtf8 = QtCore.QString.fromUtf8
+except AttributeError:
+    def _fromUtf8(s):
+        return s
+
+
+def makeFencePost(diameter=48, length=3000, placement=None, name="Post"):
+    "makePipe([baseobj,diamerter,length,placement,name]): creates an pipe object from the given base object"
+
+    if not FreeCAD.ActiveDocument:
+        FreeCAD.Console.PrintError("No active document. Aborting\n")
+        return
+
+    obj = FreeCAD.ActiveDocument.addObject("Part::FeaturePython", name)
+    obj.Label = name
+    _FencePost(obj)
+
+    if FreeCAD.GuiUp:
+        _ViewProviderFencePost(obj.ViewObject)
+
+    obj.Length = length
+    obj.Diameter = diameter
+
+    if placement:
+        obj.Placement = placement
+    return obj
+
+
+def makeFenceReinforcePost(diameter=48, length=3000, placement=None, name="Post"):
+    "makePipe([baseobj,diamerter,length,placement,name]): creates an pipe object from the given base object"
+
+    if not FreeCAD.ActiveDocument:
+        FreeCAD.Console.PrintError("No active document. Aborting\n")
+        return
+
+    obj = FreeCAD.ActiveDocument.addObject("Part::FeaturePython", name)
+    obj.Label = name
+    _FenceReinforcePostPost(obj)
+
+    if FreeCAD.GuiUp:
+        _ViewProviderFencePost(obj.ViewObject)
+
+    obj.Length = length
+    obj.Diameter = diameter
+
+    if placement:
+        obj.Placement = placement
+    return obj
+
+
+class _FencePost(ArchComponent.Component):
+    def __init__(self, obj):
+        ArchComponent.Component.__init__(self, obj)
+        self.setProperties(obj)
+        obj.IfcType = "Pipe Segment"
+        self.Type = "FencePost"
+
+    def setProperties(self, obj):
+
+        pl = obj.PropertiesList
+        if not "Diameter" in pl:
+            obj.addProperty("App::PropertyLength", "Diameter", "Pipe",
+                            QT_TRANSLATE_NOOP("App::Property", "The diameter of this pipe, if not based on a profile")
+                            ).Diameter = 48
+        if not "Thickness" in pl:
+            obj.addProperty("App::PropertyLength", "Thickness", "Pipe",
+                            QT_TRANSLATE_NOOP("App::Property", "The Thickness of this pipe, if not based on a profile")
+                            ).Thickness = 4
+        if not "Length" in pl:
+            obj.addProperty("App::PropertyLength", "Length", "Pipe",
+                            QT_TRANSLATE_NOOP("App::Property", "The length of this pipe, if not based on an edge")
+                            ).Length = 3000
+
+    def onDocumentRestored(self, obj):
+
+        ArchComponent.Component.onDocumentRestored(self, obj)
+        self.setProperties(obj)
+
+    def execute(self, obj):
+        import Part
+        pl = obj.Placement
+
+        if obj.CloneOf:
+            obj.Shape = obj.CloneOf.Shape
+        else:
+            w = self.getProfile(obj)
+            try:
+                # sh = w.makePipeShell([p], True, False, 2)
+                sh = w.revolve(FreeCAD.Vector(0.0, 0.0, 0.0), FreeCAD.Vector(0.0, 0.0, 1.0), 360)
+                sh = Part.Solid(sh)
+            except:
+                FreeCAD.Console.PrintError("Unable to build the pipe \n")
+            else:
+                obj.Shape = sh
+        obj.Placement = pl
+
+        return
+
+        #       -------------------------  Prueba para apoyos de refuerzo:
+        import math
+        L = math.pi / 2 * (obj.Diameter.Value - 2 * obj.Thickness.Value)
+
+        v1 = FreeCAD.Vector(L / 2, 0, obj.Thickness.Value)
+        vc1 = FreeCAD.Vector(L / 2 + obj.Thickness.Value, 0, 0)
+        v2 = FreeCAD.Vector(L / 2, 0, -obj.Thickness.Value)
+
+        v11 = FreeCAD.Vector(-L / 2, 0, obj.Thickness.Value)
+        vc11 = FreeCAD.Vector(-(L / 2 + obj.Thickness.Value), 0, 0)
+        v21 = FreeCAD.Vector(-L / 2, 0, -obj.Thickness.Value)
+
+        arc1 = Part.Arc(v1, vc1, v2).toShape()
+        arc11 = Part.Arc(v11, vc11, v21).toShape()
+        line1 = Part.LineSegment(v11, v1).toShape()
+        line2 = Part.LineSegment(v21, v2).toShape()
+        w = Part.Wire([arc1, line2, arc11, line1])
+        face = Part.Face(w)
+        pro = face.extrude(FreeCAD.Vector(0, 40, 0))
+
+        #Part.Circle(Center, Normal, Radius)
+        cir1 = Part.Face(Part.Wire(Part.Circle(FreeCAD.Vector(0, -200, 0), FreeCAD.Vector(0, 1, 0), obj.Diameter.Value / 2).toShape()))
+        ext = cir1.extrude(FreeCAD.Vector(0, 170, 0))
+        cir2 = Part.Circle(FreeCAD.Vector(0, -30, 0), FreeCAD.Vector(0, 1, 0), obj.Diameter.Value/2).toShape()
+        loft = Part.makeLoft([cir2, w], True)
+        ext = ext.fuse([loft, pro])
+        Part.show(ext)
+
+
+    def getProfile(self, obj):
+        import Part
+        sin45 = 0.707106781
+        radio = obj.Diameter.Value / 2
+        taph = 20
+        tapw = radio + 2
+        chamfer = 5
+        chamfer2 = chamfer * sin45
+
+        edge1 = Part.makeLine(FreeCAD.Vector(0, 0, 0), FreeCAD.Vector(radio, 0, 0))
+        edge2 = Part.makeLine(FreeCAD.Vector(radio, 0, 0), FreeCAD.Vector(radio, 0, obj.Length.Value - taph))
+        edge3 = Part.makeLine(FreeCAD.Vector(radio, 0, obj.Length.Value - taph),
+                              FreeCAD.Vector(tapw, 0, obj.Length.Value - taph))
+        edge4 = Part.makeLine(FreeCAD.Vector(tapw, 0, obj.Length.Value - taph),
+                              FreeCAD.Vector(tapw, 0, obj.Length.Value - chamfer))
+        if True:
+            edge5 = Part.makeLine(FreeCAD.Vector(tapw, 0, obj.Length.Value - chamfer),
+                                  FreeCAD.Vector(tapw - chamfer, 0, obj.Length.Value))
+        else:
+            edge5 = Part.Arc(FreeCAD.Vector(tapw, 0, obj.Length.Value - chamfer),
+                             FreeCAD.Vector(tapw - chamfer2, 0, obj.Length.Value - chamfer2),
+                             FreeCAD.Vector(tapw - chamfer, 0, obj.Length.Value)
+                             ).toShape()
+        edge6 = Part.makeLine(FreeCAD.Vector(tapw - chamfer, 0, obj.Length.Value),
+                              FreeCAD.Vector(0, 0, obj.Length.Value))
+        w = Part.Wire([edge1, edge2, edge3, edge4, edge5, edge6])
+
+        return w
+
+
+class _FenceReinforcePost(ArchComponent.Component):
+    def __init__(self, obj):
+        ArchComponent.Component.__init__(self, obj)
+        self.setProperties(obj)
+        obj.IfcType = "Pipe Segment"
+        self.Type = "FencePost"
+
+    def setProperties(self, obj):
+
+        pl = obj.PropertiesList
+        if not "Diameter" in pl:
+            obj.addProperty("App::PropertyLength", "Diameter", "Pipe",
+                            QT_TRANSLATE_NOOP("App::Property", "The diameter of this pipe, if not based on a profile")
+                            ).Diameter = 48
+        if not "Length" in pl:
+            obj.addProperty("App::PropertyLength", "Length", "Pipe",
+                            QT_TRANSLATE_NOOP("App::Property", "The length of this pipe, if not based on an edge")
+                            ).Length = 3000
+        self.Type = "Pipe"
+
+    def onDocumentRestored(self, obj):
+
+        ArchComponent.Component.onDocumentRestored(self, obj)
+        self.setProperties(obj)
+
+    def execute(self, obj):
+
+        pl = obj.Placement
+        w = self.getWire(obj)
+
+        try:
+            # sh = w.makePipeShell([p], True, False, 2)
+            sh = w.revolve(FreeCAD.Vector(0.0, 0.0, 0.0), FreeCAD.Vector(0.0, 0.0, 1.0), 360)
+        except:
+            FreeCAD.Console.PrintError(translate("Arch", "Unable to build the pipe") + "\n")
+        else:
+            obj.Shape = sh
+            obj.Placement = pl
+
+    def getWire(self, obj):
+
+        import Part
+        sin45 = 0.707106781
+        radio = obj.Diameter.Value / 2
+        taph = 20
+        tapw = radio + 2
+        chamfer = 5
+        chamfer2 = chamfer * sin45
+
+        edge1 = Part.makeLine(FreeCAD.Vector(0, 0, 0), FreeCAD.Vector(radio, 0, 0))
+        edge2 = Part.makeLine(FreeCAD.Vector(radio, 0, 0), FreeCAD.Vector(radio, 0, obj.Length.Value - taph))
+        edge3 = Part.makeLine(FreeCAD.Vector(radio, 0, obj.Length.Value - taph),
+                              FreeCAD.Vector(tapw, 0, obj.Length.Value - taph))
+        edge4 = Part.makeLine(FreeCAD.Vector(tapw, 0, obj.Length.Value - taph),
+                              FreeCAD.Vector(tapw, 0, obj.Length.Value - chamfer))
+
+        if True:
+            edge5 = Part.makeLine(FreeCAD.Vector(tapw, 0, obj.Length.Value - chamfer),
+                                  FreeCAD.Vector(tapw - chamfer, 0, obj.Length.Value))
+        else:
+            edge5 = Part.Arc(FreeCAD.Vector(tapw, 0, obj.Length.Value - chamfer),
+                             FreeCAD.Vector(tapw - chamfer2, 0, obj.Length.Value - chamfer2),
+                             FreeCAD.Vector(tapw - chamfer, 0, obj.Length.Value)
+                             ).toShape()
+        edge6 = Part.makeLine(FreeCAD.Vector(tapw - chamfer, 0, obj.Length.Value),
+                              FreeCAD.Vector(0, 0, obj.Length.Value))
+        w = Part.Wire([edge1, edge2, edge3, edge4, edge5, edge6])
+
+        return w
+
+
+class _ViewProviderFencePost(ArchComponent.ViewProviderComponent):
+    "A View Provider for the Pipe object"
+
+    def __init__(self, vobj):
+        ArchComponent.ViewProviderComponent.__init__(self, vobj)
+
+    def getIcon(self):
+        return ":/icons/Arch_Pipe_Tree.svg"
+
+
+class _CommandFencePost:
+    "the Arch Pipe command definition"
+
+    def GetResources(self):
+
+        return {'Pixmap': 'Arch_Pipe',
+                'MenuText': QT_TRANSLATE_NOOP("Arch_Pipe", "Pipe"),
+                'Accel': "P, I",
+                'ToolTip': QT_TRANSLATE_NOOP("Arch_Pipe", "Creates a pipe object from a given Wire or Line")}
+
+    def IsActive(self):
+
+        return not FreeCAD.ActiveDocument is None
+
+    def Activated(self):
+        if True:
+            makeFencePost()
+        else:
+            FreeCAD.ActiveDocument.openTransaction(translate("Arch", "Create Pipe"))
+            FreeCADGui.addModule("Arch")
+            FreeCADGui.doCommand("obj = Arch.makePipe()")
+            FreeCADGui.addModule("Draft")
+            FreeCADGui.doCommand("Draft.autogroup(obj)")
+            FreeCAD.ActiveDocument.commitTransaction()
+        FreeCAD.ActiveDocument.recompute()
+
+
+if FreeCAD.GuiUp:
+    FreeCADGui.addCommand('FencePost', _CommandFencePost())

PVPlantFixed.ui

@@ -0,0 +1,877 @@
+<?xml version="1.0" encoding="UTF-8"?>
+<ui version="4.0">
+ <class>formRack</class>
+ <widget class="QDialog" name="formRack">
+  <property name="geometry">
+   <rect>
+    <x>0</x>
+    <y>0</y>
+    <width>476</width>
+    <height>1038</height>
+   </rect>
+  </property>
+  <property name="windowTitle">
+   <string>Tracker:</string>
+  </property>
+  <layout class="QVBoxLayout" name="verticalLayout">
+   <property name="leftMargin">
+    <number>5</number>
+   </property>
+   <property name="topMargin">
+    <number>5</number>
+   </property>
+   <property name="rightMargin">
+    <number>5</number>
+   </property>
+   <property name="bottomMargin">
+    <number>5</number>
+   </property>
+   <item>
+    <widget class="QGroupBox" name="groupBox">
+     <property name="sizePolicy">
+      <sizepolicy hsizetype="Preferred" vsizetype="Fixed">
+       <horstretch>0</horstretch>
+       <verstretch>0</verstretch>
+      </sizepolicy>
+     </property>
+     <property name="title">
+      <string>Módulos:</string>
+     </property>
+     <layout class="QGridLayout" name="gridLayout">
+      <property name="leftMargin">
+       <number>5</number>
+      </property>
+      <property name="topMargin">
+       <number>5</number>
+      </property>
+      <property name="rightMargin">
+       <number>5</number>
+      </property>
+      <property name="bottomMargin">
+       <number>5</number>
+      </property>
+      <property name="horizontalSpacing">
+       <number>5</number>
+      </property>
+      <property name="verticalSpacing">
+       <number>2</number>
+      </property>
+      <item row="0" column="0">
+       <widget class="QLabel" name="label_9">
+        <property name="text">
+         <string>Altura (m)</string>
+        </property>
+       </widget>
+      </item>
+      <item row="0" column="1">
+       <widget class="QDoubleSpinBox" name="editModuleHeight">
+        <property name="sizePolicy">
+         <sizepolicy hsizetype="Fixed" vsizetype="Fixed">
+          <horstretch>0</horstretch>
+          <verstretch>0</verstretch>
+         </sizepolicy>
+        </property>
+        <property name="minimumSize">
+         <size>
+          <width>140</width>
+          <height>0</height>
+         </size>
+        </property>
+        <property name="alignment">
+         <set>Qt::AlignRight|Qt::AlignTrailing|Qt::AlignVCenter</set>
+        </property>
+        <property name="buttonSymbols">
+         <enum>QAbstractSpinBox::NoButtons</enum>
+        </property>
+        <property name="decimals">
+         <number>3</number>
+        </property>
+        <property name="maximum">
+         <double>5.000000000000000</double>
+        </property>
+        <property name="singleStep">
+         <double>0.010000000000000</double>
+        </property>
+        <property name="value">
+         <double>1.990000000000000</double>
+        </property>
+       </widget>
+      </item>
+      <item row="1" column="0">
+       <widget class="QLabel" name="label_10">
+        <property name="text">
+         <string>Largura (m)</string>
+        </property>
+       </widget>
+      </item>
+      <item row="1" column="1">
+       <widget class="QDoubleSpinBox" name="editModuleLenght">
+        <property name="sizePolicy">
+         <sizepolicy hsizetype="Fixed" vsizetype="Fixed">
+          <horstretch>0</horstretch>
+          <verstretch>0</verstretch>
+         </sizepolicy>
+        </property>
+        <property name="minimumSize">
+         <size>
+          <width>140</width>
+          <height>0</height>
+         </size>
+        </property>
+        <property name="alignment">
+         <set>Qt::AlignRight|Qt::AlignTrailing|Qt::AlignVCenter</set>
+        </property>
+        <property name="buttonSymbols">
+         <enum>QAbstractSpinBox::NoButtons</enum>
+        </property>
+        <property name="decimals">
+         <number>3</number>
+        </property>
+        <property name="maximum">
+         <double>5.000000000000000</double>
+        </property>
+        <property name="singleStep">
+         <double>0.010000000000000</double>
+        </property>
+        <property name="value">
+         <double>0.960000000000000</double>
+        </property>
+       </widget>
+      </item>
+      <item row="2" column="0">
+       <widget class="QLabel" name="label_11">
+        <property name="text">
+         <string>Anchura (m)</string>
+        </property>
+       </widget>
+      </item>
+      <item row="2" column="1">
+       <widget class="QDoubleSpinBox" name="editModuleWidth">
+        <property name="sizePolicy">
+         <sizepolicy hsizetype="Fixed" vsizetype="Fixed">
+          <horstretch>0</horstretch>
+          <verstretch>0</verstretch>
+         </sizepolicy>
+        </property>
+        <property name="minimumSize">
+         <size>
+          <width>140</width>
+          <height>0</height>
+         </size>
+        </property>
+        <property name="alignment">
+         <set>Qt::AlignRight|Qt::AlignTrailing|Qt::AlignVCenter</set>
+        </property>
+        <property name="buttonSymbols">
+         <enum>QAbstractSpinBox::NoButtons</enum>
+        </property>
+        <property name="decimals">
+         <number>3</number>
+        </property>
+        <property name="maximum">
+         <double>0.100000000000000</double>
+        </property>
+        <property name="singleStep">
+         <double>0.010000000000000</double>
+        </property>
+        <property name="value">
+         <double>0.030000000000000</double>
+        </property>
+       </widget>
+      </item>
+      <item row="3" column="0">
+       <widget class="QLabel" name="label_12">
+        <property name="text">
+         <string>Potencia (wp)</string>
+        </property>
+       </widget>
+      </item>
+      <item row="3" column="1">
+       <widget class="QSpinBox" name="editModulePower">
+        <property name="sizePolicy">
+         <sizepolicy hsizetype="Fixed" vsizetype="Fixed">
+          <horstretch>0</horstretch>
+          <verstretch>0</verstretch>
+         </sizepolicy>
+        </property>
+        <property name="minimumSize">
+         <size>
+          <width>140</width>
+          <height>0</height>
+         </size>
+        </property>
+        <property name="alignment">
+         <set>Qt::AlignRight|Qt::AlignTrailing|Qt::AlignVCenter</set>
+        </property>
+        <property name="buttonSymbols">
+         <enum>QAbstractSpinBox::NoButtons</enum>
+        </property>
+        <property name="minimum">
+         <number>150</number>
+        </property>
+        <property name="maximum">
+         <number>1000</number>
+        </property>
+        <property name="singleStep">
+         <number>5</number>
+        </property>
+        <property name="value">
+         <number>350</number>
+        </property>
+       </widget>
+      </item>
+     </layout>
+    </widget>
+   </item>
+   <item>
+    <widget class="QGroupBox" name="groupBox_2">
+     <property name="title">
+      <string>Estructura</string>
+     </property>
+     <layout class="QGridLayout" name="gridLayout_3">
+      <item row="3" column="0">
+       <widget class="QLabel" name="label_2">
+        <property name="text">
+         <string>Columnas (un)</string>
+        </property>
+       </widget>
+      </item>
+      <item row="6" column="1">
+       <widget class="QDoubleSpinBox" name="editFrontHeight">
+        <property name="sizePolicy">
+         <sizepolicy hsizetype="Fixed" vsizetype="Fixed">
+          <horstretch>0</horstretch>
+          <verstretch>0</verstretch>
+         </sizepolicy>
+        </property>
+        <property name="minimumSize">
+         <size>
+          <width>140</width>
+          <height>0</height>
+         </size>
+        </property>
+        <property name="alignment">
+         <set>Qt::AlignRight|Qt::AlignTrailing|Qt::AlignVCenter</set>
+        </property>
+        <property name="buttonSymbols">
+         <enum>QAbstractSpinBox::NoButtons</enum>
+        </property>
+        <property name="maximum">
+         <double>5.000000000000000</double>
+        </property>
+        <property name="singleStep">
+         <double>0.100000000000000</double>
+        </property>
+        <property name="value">
+         <double>0.800000000000000</double>
+        </property>
+       </widget>
+      </item>
+      <item row="1" column="0">
+       <widget class="QLabel" name="label_5">
+        <property name="text">
+         <string>Orientación del módulo</string>
+        </property>
+       </widget>
+      </item>
+      <item row="5" column="1">
+       <widget class="QDoubleSpinBox" name="editVerticalGap">
+        <property name="sizePolicy">
+         <sizepolicy hsizetype="Fixed" vsizetype="Fixed">
+          <horstretch>0</horstretch>
+          <verstretch>0</verstretch>
+         </sizepolicy>
+        </property>
+        <property name="minimumSize">
+         <size>
+          <width>140</width>
+          <height>0</height>
+         </size>
+        </property>
+        <property name="alignment">
+         <set>Qt::AlignRight|Qt::AlignTrailing|Qt::AlignVCenter</set>
+        </property>
+        <property name="buttonSymbols">
+         <enum>QAbstractSpinBox::NoButtons</enum>
+        </property>
+        <property name="maximum">
+         <double>0.900000000000000</double>
+        </property>
+        <property name="singleStep">
+         <double>0.010000000000000</double>
+        </property>
+        <property name="value">
+         <double>0.020000000000000</double>
+        </property>
+       </widget>
+      </item>
+      <item row="2" column="1">
+       <widget class="QSpinBox" name="editRows">
+        <property name="sizePolicy">
+         <sizepolicy hsizetype="Fixed" vsizetype="Fixed">
+          <horstretch>0</horstretch>
+          <verstretch>0</verstretch>
+         </sizepolicy>
+        </property>
+        <property name="minimumSize">
+         <size>
+          <width>140</width>
+          <height>0</height>
+         </size>
+        </property>
+        <property name="alignment">
+         <set>Qt::AlignRight|Qt::AlignTrailing|Qt::AlignVCenter</set>
+        </property>
+        <property name="buttonSymbols">
+         <enum>QAbstractSpinBox::NoButtons</enum>
+        </property>
+        <property name="minimum">
+         <number>1</number>
+        </property>
+       </widget>
+      </item>
+      <item row="0" column="1">
+       <widget class="QComboBox" name="comboFrameType">
+        <property name="sizePolicy">
+         <sizepolicy hsizetype="Fixed" vsizetype="Fixed">
+          <horstretch>0</horstretch>
+          <verstretch>0</verstretch>
+         </sizepolicy>
+        </property>
+        <property name="minimumSize">
+         <size>
+          <width>140</width>
+          <height>0</height>
+         </size>
+        </property>
+        <item>
+         <property name="text">
+          <string>Fija</string>
+         </property>
+        </item>
+        <item>
+         <property name="text">
+          <string>Tracker 1 Eje</string>
+         </property>
+        </item>
+       </widget>
+      </item>
+      <item row="7" column="1">
+       <widget class="QDoubleSpinBox" name="editLeftOffset">
+        <property name="sizePolicy">
+         <sizepolicy hsizetype="Fixed" vsizetype="Fixed">
+          <horstretch>0</horstretch>
+          <verstretch>0</verstretch>
+         </sizepolicy>
+        </property>
+        <property name="minimumSize">
+         <size>
+          <width>140</width>
+          <height>0</height>
+         </size>
+        </property>
+        <property name="alignment">
+         <set>Qt::AlignRight|Qt::AlignTrailing|Qt::AlignVCenter</set>
+        </property>
+        <property name="buttonSymbols">
+         <enum>QAbstractSpinBox::NoButtons</enum>
+        </property>
+        <property name="maximum">
+         <double>0.900000000000000</double>
+        </property>
+        <property name="singleStep">
+         <double>0.010000000000000</double>
+        </property>
+        <property name="value">
+         <double>0.050000000000000</double>
+        </property>
+       </widget>
+      </item>
+      <item row="12" column="0">
+       <widget class="QLabel" name="label_18">
+        <property name="text">
+         <string>Offset borde derecha (m)</string>
+        </property>
+       </widget>
+      </item>
+      <item row="14" column="0">
+       <widget class="QLabel" name="label_3">
+        <property name="text">
+         <string>Ángulo de inclinación (º)</string>
+        </property>
+       </widget>
+      </item>
+      <item row="12" column="1">
+       <widget class="QDoubleSpinBox" name="editRightOffset">
+        <property name="sizePolicy">
+         <sizepolicy hsizetype="Fixed" vsizetype="Fixed">
+          <horstretch>0</horstretch>
+          <verstretch>0</verstretch>
+         </sizepolicy>
+        </property>
+        <property name="minimumSize">
+         <size>
+          <width>140</width>
+          <height>0</height>
+         </size>
+        </property>
+        <property name="alignment">
+         <set>Qt::AlignRight|Qt::AlignTrailing|Qt::AlignVCenter</set>
+        </property>
+        <property name="buttonSymbols">
+         <enum>QAbstractSpinBox::NoButtons</enum>
+        </property>
+        <property name="maximum">
+         <double>0.900000000000000</double>
+        </property>
+        <property name="singleStep">
+         <double>0.010000000000000</double>
+        </property>
+        <property name="value">
+         <double>0.050000000000000</double>
+        </property>
+       </widget>
+      </item>
+      <item row="14" column="1">
+       <widget class="QSpinBox" name="editTilt">
+        <property name="sizePolicy">
+         <sizepolicy hsizetype="Fixed" vsizetype="Fixed">
+          <horstretch>0</horstretch>
+          <verstretch>0</verstretch>
+         </sizepolicy>
+        </property>
+        <property name="minimumSize">
+         <size>
+          <width>140</width>
+          <height>0</height>
+         </size>
+        </property>
+        <property name="alignment">
+         <set>Qt::AlignRight|Qt::AlignTrailing|Qt::AlignVCenter</set>
+        </property>
+        <property name="buttonSymbols">
+         <enum>QAbstractSpinBox::NoButtons</enum>
+        </property>
+        <property name="minimum">
+         <number>1</number>
+        </property>
+        <property name="maximum">
+         <number>60</number>
+        </property>
+       </widget>
+      </item>
+      <item row="15" column="1">
+       <widget class="QSpinBox" name="editInclination">
+        <property name="sizePolicy">
+         <sizepolicy hsizetype="Fixed" vsizetype="Fixed">
+          <horstretch>0</horstretch>
+          <verstretch>0</verstretch>
+         </sizepolicy>
+        </property>
+        <property name="minimumSize">
+         <size>
+          <width>140</width>
+          <height>0</height>
+         </size>
+        </property>
+        <property name="alignment">
+         <set>Qt::AlignRight|Qt::AlignTrailing|Qt::AlignVCenter</set>
+        </property>
+        <property name="buttonSymbols">
+         <enum>QAbstractSpinBox::NoButtons</enum>
+        </property>
+        <property name="minimum">
+         <number>1</number>
+        </property>
+        <property name="maximum">
+         <number>60</number>
+        </property>
+       </widget>
+      </item>
+      <item row="2" column="0">
+       <widget class="QLabel" name="label">
+        <property name="text">
+         <string>Filas (un)</string>
+        </property>
+       </widget>
+      </item>
+      <item row="6" column="0">
+       <widget class="QLabel" name="label_8">
+        <property name="text">
+         <string>Distancia al suelo en el frente (m)</string>
+        </property>
+       </widget>
+      </item>
+      <item row="3" column="1">
+       <widget class="QSpinBox" name="editCols">
+        <property name="sizePolicy">
+         <sizepolicy hsizetype="Fixed" vsizetype="Fixed">
+          <horstretch>0</horstretch>
+          <verstretch>0</verstretch>
+         </sizepolicy>
+        </property>
+        <property name="minimumSize">
+         <size>
+          <width>140</width>
+          <height>0</height>
+         </size>
+        </property>
+        <property name="alignment">
+         <set>Qt::AlignRight|Qt::AlignTrailing|Qt::AlignVCenter</set>
+        </property>
+        <property name="buttonSymbols">
+         <enum>QAbstractSpinBox::NoButtons</enum>
+        </property>
+        <property name="minimum">
+         <number>20</number>
+        </property>
+       </widget>
+      </item>
+      <item row="5" column="0">
+       <widget class="QLabel" name="labelVerticalGap">
+        <property name="text">
+         <string>Separación vertical entre módulos (m)</string>
+        </property>
+       </widget>
+      </item>
+      <item row="1" column="1">
+       <widget class="QComboBox" name="comboModuleOrientation">
+        <property name="sizePolicy">
+         <sizepolicy hsizetype="Fixed" vsizetype="Fixed">
+          <horstretch>0</horstretch>
+          <verstretch>0</verstretch>
+         </sizepolicy>
+        </property>
+        <property name="minimumSize">
+         <size>
+          <width>140</width>
+          <height>0</height>
+         </size>
+        </property>
+        <item>
+         <property name="text">
+          <string>Landscape</string>
+         </property>
+        </item>
+        <item>
+         <property name="text">
+          <string>Portrait</string>
+         </property>
+        </item>
+       </widget>
+      </item>
+      <item row="4" column="0">
+       <widget class="QLabel" name="label_4">
+        <property name="text">
+         <string>Separación horizontal entre módulos (m)</string>
+        </property>
+       </widget>
+      </item>
+      <item row="15" column="0">
+       <widget class="QLabel" name="label_7">
+        <property name="text">
+         <string>Ängulo máximo de inclinación longitudinal (ª)</string>
+        </property>
+       </widget>
+      </item>
+      <item row="4" column="1">
+       <widget class="QDoubleSpinBox" name="editHorizontalGap">
+        <property name="sizePolicy">
+         <sizepolicy hsizetype="Fixed" vsizetype="Fixed">
+          <horstretch>0</horstretch>
+          <verstretch>0</verstretch>
+         </sizepolicy>
+        </property>
+        <property name="minimumSize">
+         <size>
+          <width>140</width>
+          <height>0</height>
+         </size>
+        </property>
+        <property name="alignment">
+         <set>Qt::AlignRight|Qt::AlignTrailing|Qt::AlignVCenter</set>
+        </property>
+        <property name="buttonSymbols">
+         <enum>QAbstractSpinBox::NoButtons</enum>
+        </property>
+        <property name="maximum">
+         <double>0.900000000000000</double>
+        </property>
+        <property name="singleStep">
+         <double>0.010000000000000</double>
+        </property>
+        <property name="value">
+         <double>0.020000000000000</double>
+        </property>
+       </widget>
+      </item>
+      <item row="0" column="0">
+       <widget class="QLabel" name="label_6">
+        <property name="text">
+         <string>Tipo de estructura</string>
+        </property>
+       </widget>
+      </item>
+      <item row="7" column="0">
+       <widget class="QLabel" name="label_17">
+        <property name="text">
+         <string>Offset borde izquierda (m)</string>
+        </property>
+       </widget>
+      </item>
+      <item row="16" column="0" colspan="2">
+       <widget class="QWidget" name="widgetTracker" native="true">
+        <layout class="QGridLayout" name="gridLayout_4">
+         <property name="leftMargin">
+          <number>0</number>
+         </property>
+         <property name="topMargin">
+          <number>0</number>
+         </property>
+         <property name="rightMargin">
+          <number>0</number>
+         </property>
+         <property name="bottomMargin">
+          <number>0</number>
+         </property>
+         <property name="spacing">
+          <number>5</number>
+         </property>
+         <item row="2" column="0">
+          <widget class="QLabel" name="labelVerticalGap_2">
+           <property name="text">
+            <string>Separación entre uniones (m)</string>
+           </property>
+          </widget>
+         </item>
+         <item row="0" column="0">
+          <widget class="QCheckBox" name="checkBox">
+           <property name="text">
+            <string>Separación Motor (m)</string>
+           </property>
+          </widget>
+         </item>
+         <item row="1" column="1">
+          <widget class="QSpinBox" name="editInternalGapNumber">
+           <property name="sizePolicy">
+            <sizepolicy hsizetype="Fixed" vsizetype="Fixed">
+             <horstretch>0</horstretch>
+             <verstretch>0</verstretch>
+            </sizepolicy>
+           </property>
+           <property name="minimumSize">
+            <size>
+             <width>140</width>
+             <height>0</height>
+            </size>
+           </property>
+           <property name="alignment">
+            <set>Qt::AlignRight|Qt::AlignTrailing|Qt::AlignVCenter</set>
+           </property>
+           <property name="buttonSymbols">
+            <enum>QAbstractSpinBox::NoButtons</enum>
+           </property>
+           <property name="minimum">
+            <number>0</number>
+           </property>
+           <property name="maximum">
+            <number>6</number>
+           </property>
+           <property name="value">
+            <number>0</number>
+           </property>
+          </widget>
+         </item>
+         <item row="1" column="0">
+          <widget class="QLabel" name="label_19">
+           <property name="text">
+            <string>Número de uniones</string>
+           </property>
+          </widget>
+         </item>
+         <item row="2" column="1">
+          <widget class="QDoubleSpinBox" name="editInternalGap">
+           <property name="sizePolicy">
+            <sizepolicy hsizetype="Fixed" vsizetype="Fixed">
+             <horstretch>0</horstretch>
+             <verstretch>0</verstretch>
+            </sizepolicy>
+           </property>
+           <property name="minimumSize">
+            <size>
+             <width>140</width>
+             <height>0</height>
+            </size>
+           </property>
+           <property name="alignment">
+            <set>Qt::AlignRight|Qt::AlignTrailing|Qt::AlignVCenter</set>
+           </property>
+           <property name="buttonSymbols">
+            <enum>QAbstractSpinBox::NoButtons</enum>
+           </property>
+           <property name="maximum">
+            <double>0.900000000000000</double>
+           </property>
+           <property name="singleStep">
+            <double>0.010000000000000</double>
+           </property>
+           <property name="value">
+            <double>0.020000000000000</double>
+           </property>
+          </widget>
+         </item>
+         <item row="0" column="1">
+          <widget class="QDoubleSpinBox" name="editMotorGap">
+           <property name="sizePolicy">
+            <sizepolicy hsizetype="Fixed" vsizetype="Fixed">
+             <horstretch>0</horstretch>
+             <verstretch>0</verstretch>
+            </sizepolicy>
+           </property>
+           <property name="minimumSize">
+            <size>
+             <width>140</width>
+             <height>0</height>
+            </size>
+           </property>
+           <property name="alignment">
+            <set>Qt::AlignRight|Qt::AlignTrailing|Qt::AlignVCenter</set>
+           </property>
+           <property name="buttonSymbols">
+            <enum>QAbstractSpinBox::NoButtons</enum>
+           </property>
+           <property name="maximum">
+            <double>0.900000000000000</double>
+           </property>
+           <property name="singleStep">
+            <double>0.010000000000000</double>
+           </property>
+           <property name="value">
+            <double>0.020000000000000</double>
+           </property>
+          </widget>
+         </item>
+        </layout>
+       </widget>
+      </item>
+     </layout>
+    </widget>
+   </item>
+   <item>
+    <widget class="QGroupBox" name="groupBox_3">
+     <property name="title">
+      <string>Resultado</string>
+     </property>
+     <layout class="QGridLayout" name="gridLayout_2">
+      <item row="0" column="0">
+       <widget class="QLabel" name="label_13">
+        <property name="text">
+         <string>Total de módulos</string>
+        </property>
+       </widget>
+      </item>
+      <item row="0" column="1">
+       <widget class="QLineEdit" name="editTotalModules">
+        <property name="sizePolicy">
+         <sizepolicy hsizetype="Fixed" vsizetype="Fixed">
+          <horstretch>0</horstretch>
+          <verstretch>0</verstretch>
+         </sizepolicy>
+        </property>
+        <property name="minimumSize">
+         <size>
+          <width>140</width>
+          <height>0</height>
+         </size>
+        </property>
+        <property name="readOnly">
+         <bool>true</bool>
+        </property>
+       </widget>
+      </item>
+      <item row="1" column="0">
+       <widget class="QLabel" name="label_14">
+        <property name="text">
+         <string>Potencia total (wp)</string>
+        </property>
+       </widget>
+      </item>
+      <item row="1" column="1">
+       <widget class="QLineEdit" name="editTotalPower">
+        <property name="sizePolicy">
+         <sizepolicy hsizetype="Fixed" vsizetype="Fixed">
+          <horstretch>0</horstretch>
+          <verstretch>0</verstretch>
+         </sizepolicy>
+        </property>
+        <property name="minimumSize">
+         <size>
+          <width>140</width>
+          <height>0</height>
+         </size>
+        </property>
+        <property name="readOnly">
+         <bool>true</bool>
+        </property>
+       </widget>
+      </item>
+      <item row="2" column="0">
+       <widget class="QLabel" name="label_15">
+        <property name="text">
+         <string>Longitud (m)</string>
+        </property>
+       </widget>
+      </item>
+      <item row="2" column="1">
+       <widget class="QLineEdit" name="editTotalLength">
+        <property name="sizePolicy">
+         <sizepolicy hsizetype="Fixed" vsizetype="Fixed">
+          <horstretch>0</horstretch>
+          <verstretch>0</verstretch>
+         </sizepolicy>
+        </property>
+        <property name="minimumSize">
+         <size>
+          <width>140</width>
+          <height>0</height>
+         </size>
+        </property>
+        <property name="readOnly">
+         <bool>true</bool>
+        </property>
+       </widget>
+      </item>
+      <item row="3" column="0">
+       <widget class="QLabel" name="label_16">
+        <property name="text">
+         <string>Anchura (m)</string>
+        </property>
+       </widget>
+      </item>
+      <item row="3" column="1">
+       <widget class="QLineEdit" name="editTotalWidth">
+        <property name="sizePolicy">
+         <sizepolicy hsizetype="Fixed" vsizetype="Fixed">
+          <horstretch>0</horstretch>
+          <verstretch>0</verstretch>
+         </sizepolicy>
+        </property>
+        <property name="minimumSize">
+         <size>
+          <width>140</width>
+          <height>0</height>
+         </size>
+        </property>
+        <property name="readOnly">
+         <bool>true</bool>
+        </property>
+       </widget>
+      </item>
+     </layout>
+    </widget>
+   </item>
+  </layout>
+ </widget>
+ <resources/>
+ <connections/>
+</ui>

PVPlantFoundation.py

@@ -0,0 +1,225 @@
+# -*- coding: utf-8 -*-
+
+# ***************************************************************************
+# *   Copyright (c) 2016 Yorik van Havre <yorik@uncreated.net>              *
+# *                                                                         *
+# *   This program is free software; you can redistribute it and/or modify  *
+# *   it under the terms of the GNU Lesser General Public License (LGPL)    *
+# *   as published by the Free Software Foundation; either version 2 of     *
+# *   the License, or (at your option) any later version.                   *
+# *   for detail see the LICENCE text file.                                 *
+# *                                                                         *
+# *   This program is distributed in the hope that it will be useful,       *
+# *   but WITHOUT ANY WARRANTY; without even the implied warranty of        *
+# *   MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE.  See the         *
+# *   GNU Library General Public License for more details.                  *
+# *                                                                         *
+# *   You should have received a copy of the GNU Library General Public     *
+# *   License along with this program; if not, write to the Free Software   *
+# *   Foundation, Inc., 59 Temple Place, Suite 330, Boston, MA  02111-1307  *
+# *   USA                                                                   *
+# *                                                                         *
+# ***************************************************************************
+
+import FreeCAD, ArchComponent
+
+if FreeCAD.GuiUp:
+    import FreeCADGui, os
+    from DraftTools import translate
+    from PySide.QtCore import QT_TRANSLATE_NOOP
+else:
+    # \cond
+    def translate(ctxt, txt):
+        return txt
+
+
+    def QT_TRANSLATE_NOOP(ctxt, txt):
+        return txt
+    # \endcond
+
+from PVPlantResources import DirIcons as DirIcons
+
+__title__="FreeCAD Fotovoltaic Power Plant Toolkit"
+__author__ = "Javier Braña"
+__url__ = "sn"
+
+
+def makeFoundation(baseobj=None, diameter=200, length=700, placement=None, name="Foundation"):
+    "makeFoundation([baseobj,diamerter,length,placement,name]):"
+    "creates an Foundation object from the given base object"
+
+    if not FreeCAD.ActiveDocument:
+        FreeCAD.Console.PrintError("No active document. Aborting\n")
+        return
+
+    obj = FreeCAD.ActiveDocument.addObject("Part::FeaturePython", name)
+    obj.Label = name
+    _PVPlantFoundation(obj)
+
+    if FreeCAD.GuiUp:
+        _ViewProviderFoundation(obj.ViewObject)
+        if baseobj:
+            baseobj.ViewObject.hide()
+    if baseobj:
+        obj.Base = baseobj
+    else:
+        if length:
+            obj.Length = length
+        else:
+            obj.Length = 1000
+    if diameter:
+        obj.Diameter = diameter
+    else:
+        p = FreeCAD.ParamGet("User parameter:BaseApp/Preferences/Mod/Arch")
+        obj.Diameter = p.GetFloat("PipeDiameter", 50)
+    if placement:
+        obj.Placement = placement
+    return obj
+
+
+class _PVPlantFoundation(ArchComponent.Component):
+    "the PVPlant Foundation object"
+
+    def __init__(self, obj):
+        ArchComponent.Component.__init__(self, obj)
+        self.Type = ""
+        self.setProperties(obj)
+
+    def setProperties(self, obj):
+
+        pl = obj.PropertiesList
+        if not "Diameter" in pl:
+            obj.addProperty("App::PropertyLength", "Diameter", "Foundation", QT_TRANSLATE_NOOP("App::Property",
+                                                                                               "The diameter of this Foundation, if not based on a profile"))
+        if not "Length" in pl:
+            obj.addProperty("App::PropertyLength", "Length", "Foundation", QT_TRANSLATE_NOOP("App::Property",
+                                                                                             "The length of this Foundation, if not based on an edge"))
+        if not "Profile" in pl:
+            obj.addProperty("App::PropertyLink", "Profile", "Foundation",
+                            QT_TRANSLATE_NOOP("App::Property", "An optional closed profile to base this Foundation on"))
+
+        self.Type = "Foundation"
+        obj.IfcType = "Element"
+
+    def onDocumentRestored(self, obj):
+        ArchComponent.Component.onDocumentRestored(self, obj)
+        self.setProperties(obj)
+
+    def execute(self, obj):
+
+        import DraftGeomUtils, math
+        pl = obj.Placement
+        w = self.getWire(obj)
+        if not w:
+            FreeCAD.Console.PrintError(translate("Arch", "Unable to build the base path") + "\n")
+            return
+
+        p = self.getProfile(obj)
+        if not p:
+            FreeCAD.Console.PrintError(translate("Arch", "Unable to build the profile") + "\n")
+            return
+
+        # move and rotate the profile to the first point
+        delta = w.Vertexes[0].Point - p.CenterOfMass
+        p.translate(delta)
+        import Draft
+        if Draft.getType(obj.Base) == "BezCurve":
+            v1 = obj.Base.Placement.multVec(obj.Base.Points[1]) - w.Vertexes[0].Point
+        else:
+            v1 = w.Vertexes[1].Point - w.Vertexes[0].Point
+        v2 = DraftGeomUtils.getNormal(p)
+        rot = FreeCAD.Rotation(v2, v1)
+        p.rotate(p.CenterOfMass, rot.Axis, math.degrees(rot.Angle))
+
+        try:
+            sh = w.makePipeShell([p], True, False, 2)
+        except:
+            FreeCAD.Console.PrintError(translate("Arch", "Unable to build the Foundation -- ") + "\n")
+        else:
+            obj.Shape = sh
+            if obj.Base:
+                obj.Length = w.Length
+            else:
+                obj.Placement = pl
+
+    def getWire(self, obj):
+
+        import Part
+        if obj.Base:
+            if not hasattr(obj.Base, 'Shape'):
+                FreeCAD.Console.PrintError(translate("Arch", "The base object is not a Part") + "\n")
+                return
+            if len(obj.Base.Shape.Wires) != 1:
+                FreeCAD.Console.PrintError(translate("Arch", "Too many wires in the base shape") + "\n")
+                return
+            if obj.Base.Shape.Wires[0].isClosed():
+                FreeCAD.Console.PrintError(translate("Arch", "The base wire is closed") + "\n")
+                return
+            w = obj.Base.Shape.Wires[0]
+        else:
+            if obj.Length.Value == 0:
+                return
+            w = Part.Wire([Part.LineSegment(FreeCAD.Vector(0, 0, 0), FreeCAD.Vector(0, 0, obj.Length.Value)).toShape()])
+        return w
+
+    def getProfile(self, obj):
+
+        import Part
+        if obj.Profile:
+            if not obj.Profile.getLinkedObject().isDerivedFrom("Part::Part2DObject"):
+                FreeCAD.Console.PrintError(translate("Arch", "The profile is not a 2D Part") + "\n")
+                return
+            if len(obj.Profile.Shape.Wires) != 1:
+                FreeCAD.Console.PrintError(translate("Arch", "Too many wires in the profile") + "\n")
+                return
+            if not obj.Profile.Shape.Wires[0].isClosed():
+                FreeCAD.Console.PrintError(translate("Arch", "The profile is not closed") + "\n")
+                return
+            p = obj.Profile.Shape.Wires[0]
+        else:
+            if obj.Diameter.Value == 0:
+                return
+            p = Part.Wire(
+                [Part.Circle(FreeCAD.Vector(0, 0, 0), FreeCAD.Vector(0, 0, 1), obj.Diameter.Value / 2).toShape()])
+        return p
+
+
+class _ViewProviderFoundation(ArchComponent.ViewProviderComponent):
+    "A View Provider for the Foundation object"
+
+    def __init__(self, vobj):
+        ArchComponent.ViewProviderComponent.__init__(self, vobj)
+
+    def getIcon(self):
+        return ":/icons/Arch_Pipe_Tree.svg"
+
+
+def _FoundationTaskPanel():
+    ''''''
+
+    return True
+
+
+class _CommandFoundation:
+
+    def GetResources(self):
+        """Set icon, menu and tooltip."""
+        return {'Pixmap': str(os.path.join(DirIcons, "trench.svg")),
+                'MenuText': "Trench",
+                'Accel': "C, T",
+                'ToolTip': "Creates a Trench object from setup dialog."}
+
+    def IsActive(self):
+        if FreeCAD.ActiveDocument:
+            return True
+        else:
+            return False
+
+    def Activated(self):
+        """Execute when the command is called."""
+        task = _FoundationTaskPanel();
+        sel = FreeCADGui.Selection.getSelection()
+
+
+if FreeCAD.GuiUp:
+    FreeCADGui.addCommand('PVPlantFoundation', _CommandFoundation())

PVPlantGeoreferencing.py

@@ -0,0 +1,314 @@
+# /**********************************************************************
+# *                                                                     *
+# * Copyright (c) 2021 Javier Braña <javier.branagutierrez@gmail.com>  *
+# *                                                                     *
+# * This program is free software; you can redistribute it and/or modify*
+# * it under the terms of the GNU Lesser General Public License (LGPL)  *
+# * as published by the Free Software Foundation; either version 2 of   *
+# * the License, or (at your option) any later version.                 *
+# * for detail see the LICENCE text file.                               *
+# *                                                                     *
+# * This program is distributed in the hope that it will be useful,     *
+# * but WITHOUT ANY WARRANTY; without even the implied warranty of      *
+# * MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE.  See the       *
+# * GNU Library General Public License for more details.                *
+# *                                                                     *
+# * You should have received a copy of the GNU Library General Public   *
+# * License along with this program; if not, write to the Free Software *
+# * Foundation, Inc., 59 Temple Place, Suite 330, Boston, MA  02111-1307*
+# * USA                                                                 *
+# *                                                                     *
+# ***********************************************************************
+
+import FreeCAD
+import utm
+
+if FreeCAD.GuiUp:
+    import FreeCADGui
+    from PySide import QtCore, QtGui
+    from PySide.QtCore import QT_TRANSLATE_NOOP
+    from PySide2.QtWebEngineWidgets import QWebEngineView
+    from PySide2.QtWebChannel import QWebChannel
+    import os
+else:
+    # \cond
+    def translate(ctxt,txt):
+        return txt
+    def QT_TRANSLATE_NOOP(ctxt,txt):
+        return txt
+    # \endcond
+
+import PVPlantResources
+from PVPlantResources import DirIcons as DirIcons
+from PVPlantResources import DirResources as DirResources
+
+
+class MapWindow(QtGui.QWidget):
+    def __init__(self, WinTitle="MapWindow"):
+        super(MapWindow, self).__init__()
+        self.raise_()
+        self.lat = 0
+        self.lon = 0
+        self.WinTitle = WinTitle
+
+        self.setupUi()
+
+    def setupUi(self):
+        self.ui = FreeCADGui.PySideUic.loadUi(PVPlantResources.__dir__ + "/PVPlantGeoreferencing.ui", self)
+
+        self.resize(1200, 800)
+        self.setWindowTitle(self.WinTitle)
+        self.setWindowIcon(QtGui.QIcon(os.path.join(DirIcons, "Location.svg")))
+        self.setWindowFlags(QtCore.Qt.WindowStaysOnTopHint)
+
+        self.layout = QtGui.QHBoxLayout(self)
+        self.layout.setContentsMargins(4, 4, 4, 4)
+
+        LeftWidget = QtGui.QWidget(self)
+        LeftLayout = QtGui.QVBoxLayout(LeftWidget)
+        LeftWidget.setLayout(LeftLayout)
+        LeftLayout.setContentsMargins(0, 0, 0, 0)
+
+        RightWidget = QtGui.QWidget(self)
+        RightWidget.setFixedWidth(350)
+        RightLayout = QtGui.QVBoxLayout(RightWidget)
+        RightWidget.setLayout(RightLayout)
+        RightLayout.setContentsMargins(0, 0, 0, 0)
+
+        self.layout.addWidget(LeftWidget)
+        self.layout.addWidget(RightWidget)
+
+        # Left Widgets:
+        # -- Search Bar:
+        self.valueSearch = QtGui.QLineEdit(self)
+        self.valueSearch.setPlaceholderText("Search")
+        self.valueSearch.returnPressed.connect(self.onSearch)
+
+        searchbutton = QtGui.QPushButton('Search')
+        searchbutton.setFixedWidth(80)
+        searchbutton.clicked.connect(self.onSearch)
+
+        SearchBarLayout = QtGui.QHBoxLayout(self)
+        SearchBarLayout.addWidget(self.valueSearch)
+        SearchBarLayout.addWidget(searchbutton)
+        LeftLayout.addLayout(SearchBarLayout)
+
+        # -- Webbroser:
+        self.view = QWebEngineView()
+        self.channel = QWebChannel(self.view.page())
+        self.view.page().setWebChannel(self.channel)
+        self.channel.registerObject("MyApp", self)
+        file = os.path.join(DirResources, "webs", "main.html")
+        self.view.page().loadFinished.connect(self.onLoadFinished)
+        self.view.page().load(QtCore.QUrl.fromLocalFile(file))
+        LeftLayout.addWidget(self.view)
+        # self.layout.addWidget(self.view, 1, 0, 1, 3)
+
+        # -- Latitud y longitud:
+        self.labelCoordinates = QtGui.QLabel()
+        self.labelCoordinates.setFixedHeight(21)
+        LeftLayout.addWidget(self.labelCoordinates)
+        # self.layout.addWidget(self.labelCoordinates, 2, 0, 1, 3)
+
+        # Right Widgets:
+        labelKMZ = QtGui.QLabel()
+        labelKMZ.setText("Cargar un archivo KMZ/KML:")
+        self.kmlButton = QtGui.QPushButton()
+        self.kmlButton.setFixedSize(32, 32)
+        self.kmlButton.setIcon(QtGui.QIcon(os.path.join(DirIcons, "googleearth.svg")))
+        widget = QtGui.QWidget(self)
+        layout = QtGui.QHBoxLayout(widget)
+        widget.setLayout(layout)
+        layout.addWidget(labelKMZ)
+        layout.addWidget(self.kmlButton)
+        RightLayout.addWidget(widget)
+
+        # -----------------------
+        self.groupbox = QtGui.QGroupBox("Importar datos desde:")
+        self.groupbox.setCheckable(True)
+        self.groupbox.setChecked(True)
+        radio1 = QtGui.QRadioButton("Google Elevation")
+        radio2 = QtGui.QRadioButton("Nube de Puntos")
+        radio3 = QtGui.QRadioButton("Datos GPS")
+        radio1.setChecked(True)
+
+        # buttonDialog = QtGui.QPushButton('...')
+        # buttonDialog.setEnabled(False)
+
+        vbox = QtGui.QVBoxLayout(self)
+        vbox.addWidget(radio1)
+        vbox.addWidget(radio2)
+        vbox.addWidget(radio3)
+
+        self.groupbox.setLayout(vbox)
+        RightLayout.addWidget(self.groupbox)
+        # ------------------------
+
+        verticalSpacer = QtGui.QSpacerItem(20, 48, QtGui.QSizePolicy.Minimum, QtGui.QSizePolicy.Expanding)
+        RightLayout.addItem(verticalSpacer)
+
+        self.bAccept = QtGui.QPushButton('Accept')
+        self.bAccept.clicked.connect(self.onAcceptClick)
+        RightLayout.addWidget(self.bAccept)
+
+        # signals/slots
+        QtCore.QObject.connect(self.kmlButton, QtCore.SIGNAL("clicked()"), self.importKML)
+
+
+    def onLoadFinished(self):
+        file = os.path.join(DirResources, "webs", "map.js")
+        frame = self.view.page()
+        with open(file, 'r') as f:
+            frame.runJavaScript(f.read())
+
+    def onSearch(self):
+        if self.valueSearch.text() == "":
+            return
+
+        from geopy.geocoders import Nominatim
+
+        geolocator = Nominatim(user_agent="http")
+        location = geolocator.geocode(self.valueSearch.text())
+        print(location.raw)
+        self.valueSearch.setText(location.address)
+        self.panMap(location.longitude, location.latitude, location.raw['boundingbox'])
+
+    def onAcceptClick(self):
+        frame = self.view.page()
+        # 1. georeferenciar
+        frame.runJavaScript(
+            "MyApp.georeference(drawnItems.getBounds().getCenter().lat, drawnItems.getBounds().getCenter().lng);"
+        )
+
+        # 2. importar todos los elementos dibujados:
+        frame.runJavaScript(
+            "var data = drawnItems.toGeoJSON();"
+            "MyApp.shapes(JSON.stringify(data));"
+        )
+        self.close()
+
+    @QtCore.Slot(float, float)
+    def onMapMove(self, lat, lng):
+        self.lat = lat
+        self.lon = lng
+        x, y, zone_number, zone_letter = utm.from_latlon(lat, lng)
+        self.labelCoordinates.setText('Longitud: {:.5f}, Latitud: {:.5f}'.format(lng, lat) +
+                                      '  |  UTM: ' + str(zone_number) + zone_letter +
+                                      ', {:.5f}m E, {:.5f}m N'.format(x, y))
+
+    @QtCore.Slot(float, float)
+    def georeference(self, lat, lng):
+        import PVPlantSite
+        from geopy.geocoders import Nominatim
+        Site = PVPlantSite.get(create=True)
+        Site.Proxy.setLatLon(lat, lng)
+
+        geolocator = Nominatim(user_agent="http")
+        location = geolocator.reverse('{:.5f}, {:.5f}'.format(lat, lng))
+        if location:
+            if location.raw["address"].get("road"):
+                str = location.raw["address"]["road"]
+                if location.raw["address"].get("house_number"):
+                    str += ' ({0})'.format(location.raw["address"]["house_number"])
+                Site.Address = str
+            if location.raw["address"].get("city"):
+                Site.City = location.raw["address"]["city"]
+            if location.raw["address"].get("postcode"):
+                Site.PostalCode = location.raw["address"]["postcode"]
+            if location.raw["address"].get("address"):
+                Site.Region = '{0}'.format(location.raw["address"]["province"])
+            if location.raw["address"].get("state"):
+                if Site.Region != "":
+                    Site.Region += " - "
+                Site.Region += '{0}'.format(location.raw["address"]["state"])   # province - state
+            Site.Country = location.raw["address"]["country"]
+
+    @QtCore.Slot(str)
+    def shapes(self, drawnItems):
+        import geojson
+        import PVPlantImportGrid as ImportElevation
+        import Draft
+
+        items = geojson.loads(drawnItems)
+        for item in items['features']:
+            if item['geometry']['type'] == "Point":     # 1. if the feature is a Point or Circle:
+                coord = item['geometry']['coordinates']
+                point = ImportElevation.getElevationFromOE([[coord[0], coord[1]],])
+                c = FreeCAD.Vector(point[0][0], point[0][1], point[0][2])
+                if item['properties'].get('radius'):
+                    r = round(item['properties']['radius'] * 1000, 0)
+                    p = FreeCAD.Placement()
+                    p.Base = c
+                    obj = Draft.makeCircle(r, placement=p, face=False)
+                else:
+                    ''' do something '''
+                    obj = Draft.make_point(c * 1000, color=(0.5, 0.3, 0.6), point_size=10)
+            else:                                       # 2. if the feature is a Polygon or Line:
+                cw = False
+                name = "Línea"
+                lp = item['geometry']['coordinates']
+                if item['geometry']['type'] == "Polygon":
+                    cw = True
+                    name = "Area"
+                    lp = item['geometry']['coordinates'][0]
+
+                pts = []
+                for cords in lp:
+                    pts.append([cords[1], cords[0]])
+                tmp = ImportElevation.getElevationFromOE(pts)
+                pts = []
+                for p in tmp:
+                    pts.append(p.sub(FreeCAD.ActiveDocument.Site.Origin))
+
+                obj = Draft.makeWire(pts, closed=cw, face=False)
+                obj.Placement.Base = FreeCAD.ActiveDocument.Site.Origin
+                obj.Label = name
+                Draft.autogroup(obj)
+
+            if item['properties'].get('name'):
+                obj.Label = item['properties']['name']
+
+        FreeCAD.activeDocument().recompute()
+        FreeCADGui.updateGui()
+        FreeCADGui.SendMsgToActiveView("ViewFit")
+
+    def panMap(self, lng, lat, geometry=""):
+        frame = self.view.page()
+        bbox = "[{0}, {1}], [{2}, {3}]".format(float(geometry[0]), float(geometry[2]),
+                                               float(geometry[1]), float(geometry[3]))
+        command =  'map.panTo(L.latLng({lt}, {lg}));'.format(lt=lat, lg=lng)
+        command += 'map.fitBounds([{box}]);'.format(box=bbox)
+        frame.runJavaScript(command)
+
+    def importKML(self):
+        file = QtGui.QFileDialog.getOpenFileName(None, "FileDialog", "", "Google Earth (*.kml *.kmz)")[0]
+
+        from lib.kml2geojson import kmz_convert
+        layers = kmz_convert(file, "", )
+        frame = self.view.page()
+        for layer in layers:
+            command = "drawnItems.addLayer(L.geoJSON({0}));".format(layer)
+            frame.runJavaScript(command)
+
+
+class _CommandPVPlantGeoreferencing:
+
+    def GetResources(self):
+        return {'Pixmap': str(os.path.join(DirIcons, "Location.svg")),
+                'Accel': "G, R",
+                'MenuText': QT_TRANSLATE_NOOP("Georeferencing","Georeferencing"),
+                'ToolTip': QT_TRANSLATE_NOOP("Georeferencing","Referenciar el lugar")}
+
+    def Activated(self):
+        self.form = MapWindow()
+        self.form.show()
+
+    def IsActive(self):
+        if FreeCAD.ActiveDocument:
+            return True
+        else:
+            return False
+
+if FreeCAD.GuiUp:
+    FreeCADGui.addCommand('PVPlantGeoreferencing',_CommandPVPlantGeoreferencing())
+

PVPlantGeoreferencing.ui

@@ -0,0 +1,191 @@
+<?xml version="1.0" encoding="UTF-8"?>
+<ui version="4.0">
+ <class>Georeferencing</class>
+ <widget class="QDialog" name="Georeferencing">
+  <property name="geometry">
+   <rect>
+    <x>0</x>
+    <y>0</y>
+    <width>574</width>
+    <height>350</height>
+   </rect>
+  </property>
+  <property name="sizePolicy">
+   <sizepolicy hsizetype="Preferred" vsizetype="Fixed">
+    <horstretch>0</horstretch>
+    <verstretch>0</verstretch>
+   </sizepolicy>
+  </property>
+  <property name="windowTitle">
+   <string>Create Surface</string>
+  </property>
+  <layout class="QHBoxLayout" name="horizontalLayout">
+   <item>
+    <widget class="QWidget" name="widgetLeft" native="true">
+     <layout class="QVBoxLayout" name="verticalLayout">
+      <property name="leftMargin">
+       <number>0</number>
+      </property>
+      <property name="topMargin">
+       <number>0</number>
+      </property>
+      <property name="rightMargin">
+       <number>0</number>
+      </property>
+      <property name="bottomMargin">
+       <number>0</number>
+      </property>
+      <item>
+       <widget class="QWidget" name="widgetSearch" native="true">
+        <property name="sizePolicy">
+         <sizepolicy hsizetype="Preferred" vsizetype="Fixed">
+          <horstretch>0</horstretch>
+          <verstretch>0</verstretch>
+         </sizepolicy>
+        </property>
+        <layout class="QHBoxLayout" name="horizontalLayout_3">
+         <property name="leftMargin">
+          <number>0</number>
+         </property>
+         <property name="topMargin">
+          <number>0</number>
+         </property>
+         <property name="rightMargin">
+          <number>0</number>
+         </property>
+         <property name="bottomMargin">
+          <number>0</number>
+         </property>
+         <item>
+          <widget class="QLineEdit" name="lineEdit">
+           <property name="placeholderText">
+            <string>Search...</string>
+           </property>
+          </widget>
+         </item>
+         <item>
+          <widget class="QPushButton" name="pushButton">
+           <property name="sizePolicy">
+            <sizepolicy hsizetype="Fixed" vsizetype="Fixed">
+             <horstretch>0</horstretch>
+             <verstretch>0</verstretch>
+            </sizepolicy>
+           </property>
+           <property name="text">
+            <string>Search</string>
+           </property>
+          </widget>
+         </item>
+        </layout>
+       </widget>
+      </item>
+      <item>
+       <widget class="QWebEngineView" name="widget_4" native="true"/>
+      </item>
+      <item>
+       <widget class="QLabel" name="label">
+        <property name="sizePolicy">
+         <sizepolicy hsizetype="Preferred" vsizetype="Fixed">
+          <horstretch>0</horstretch>
+          <verstretch>0</verstretch>
+         </sizepolicy>
+        </property>
+        <property name="text">
+         <string>TextLabel</string>
+        </property>
+       </widget>
+      </item>
+     </layout>
+    </widget>
+   </item>
+   <item>
+    <widget class="QWidget" name="widgetRight" native="true">
+     <property name="sizePolicy">
+      <sizepolicy hsizetype="Fixed" vsizetype="Preferred">
+       <horstretch>0</horstretch>
+       <verstretch>0</verstretch>
+      </sizepolicy>
+     </property>
+     <layout class="QVBoxLayout" name="verticalLayout_2">
+      <item>
+       <widget class="QWidget" name="widget_5" native="true">
+        <layout class="QGridLayout" name="gridLayout">
+         <item row="1" column="1">
+          <widget class="QPushButton" name="pushButton_4">
+           <property name="text">
+            <string>PushButton</string>
+           </property>
+          </widget>
+         </item>
+         <item row="1" column="0">
+          <widget class="QLabel" name="label_2">
+           <property name="text">
+            <string>Cargar un archivo KMZ/KML:</string>
+           </property>
+          </widget>
+         </item>
+         <item row="0" column="0">
+          <widget class="QCheckBox" name="checkBox">
+           <property name="text">
+            <string>Georeferenciar</string>
+           </property>
+          </widget>
+         </item>
+        </layout>
+       </widget>
+      </item>
+      <item>
+       <spacer name="verticalSpacer">
+        <property name="orientation">
+         <enum>Qt::Vertical</enum>
+        </property>
+        <property name="sizeHint" stdset="0">
+         <size>
+          <width>20</width>
+          <height>40</height>
+         </size>
+        </property>
+       </spacer>
+      </item>
+      <item>
+       <widget class="QWidget" name="widget_6" native="true">
+        <property name="sizePolicy">
+         <sizepolicy hsizetype="Preferred" vsizetype="Fixed">
+          <horstretch>0</horstretch>
+          <verstretch>0</verstretch>
+         </sizepolicy>
+        </property>
+        <layout class="QHBoxLayout" name="horizontalLayout_2">
+         <item>
+          <widget class="QPushButton" name="pushButton_2">
+           <property name="text">
+            <string>Cancelar</string>
+           </property>
+          </widget>
+         </item>
+         <item>
+          <widget class="QPushButton" name="pushButton_3">
+           <property name="text">
+            <string>Aceptar</string>
+           </property>
+          </widget>
+         </item>
+        </layout>
+       </widget>
+      </item>
+     </layout>
+    </widget>
+   </item>
+  </layout>
+ </widget>
+ <customwidgets>
+  <customwidget>
+   <class>QWebEngineView</class>
+   <extends>QWidget</extends>
+   <header>qwebengineview.h</header>
+   <container>1</container>
+  </customwidget>
+ </customwidgets>
+ <resources/>
+ <connections/>
+</ui>

PVPlantGeoreferencing.ui.autosave

@@ -0,0 +1,213 @@
+<?xml version="1.0" encoding="UTF-8"?>
+<ui version="4.0">
+ <class>Georeferencing</class>
+ <widget class="QDialog" name="Georeferencing">
+  <property name="geometry">
+   <rect>
+    <x>0</x>
+    <y>0</y>
+    <width>574</width>
+    <height>350</height>
+   </rect>
+  </property>
+  <property name="sizePolicy">
+   <sizepolicy hsizetype="Preferred" vsizetype="Fixed">
+    <horstretch>0</horstretch>
+    <verstretch>0</verstretch>
+   </sizepolicy>
+  </property>
+  <property name="windowTitle">
+   <string>Create Surface</string>
+  </property>
+  <layout class="QHBoxLayout" name="horizontalLayout">
+   <item>
+    <widget class="QWidget" name="widgetLeft" native="true">
+     <layout class="QVBoxLayout" name="verticalLayout">
+      <property name="leftMargin">
+       <number>0</number>
+      </property>
+      <property name="topMargin">
+       <number>0</number>
+      </property>
+      <property name="rightMargin">
+       <number>0</number>
+      </property>
+      <property name="bottomMargin">
+       <number>0</number>
+      </property>
+      <item>
+       <widget class="QWidget" name="widgetSearch" native="true">
+        <property name="sizePolicy">
+         <sizepolicy hsizetype="Preferred" vsizetype="Fixed">
+          <horstretch>0</horstretch>
+          <verstretch>0</verstretch>
+         </sizepolicy>
+        </property>
+        <layout class="QHBoxLayout" name="horizontalLayout_3">
+         <property name="leftMargin">
+          <number>0</number>
+         </property>
+         <property name="topMargin">
+          <number>0</number>
+         </property>
+         <property name="rightMargin">
+          <number>0</number>
+         </property>
+         <property name="bottomMargin">
+          <number>0</number>
+         </property>
+         <item>
+          <widget class="QLineEdit" name="lineEdit">
+           <property name="placeholderText">
+            <string>Search...</string>
+           </property>
+          </widget>
+         </item>
+         <item>
+          <widget class="QPushButton" name="pushButton">
+           <property name="sizePolicy">
+            <sizepolicy hsizetype="Fixed" vsizetype="Fixed">
+             <horstretch>0</horstretch>
+             <verstretch>0</verstretch>
+            </sizepolicy>
+           </property>
+           <property name="text">
+            <string>Search</string>
+           </property>
+          </widget>
+         </item>
+        </layout>
+       </widget>
+      </item>
+      <item>
+       <widget class="QWebEngineView" name="widget_4" native="true"/>
+      </item>
+      <item>
+       <widget class="QLabel" name="label">
+        <property name="sizePolicy">
+         <sizepolicy hsizetype="Preferred" vsizetype="Fixed">
+          <horstretch>0</horstretch>
+          <verstretch>0</verstretch>
+         </sizepolicy>
+        </property>
+        <property name="text">
+         <string>TextLabel</string>
+        </property>
+       </widget>
+      </item>
+     </layout>
+    </widget>
+   </item>
+   <item>
+    <widget class="QWidget" name="widgetRight" native="true">
+     <property name="sizePolicy">
+      <sizepolicy hsizetype="Fixed" vsizetype="Preferred">
+       <horstretch>0</horstretch>
+       <verstretch>0</verstretch>
+      </sizepolicy>
+     </property>
+     <layout class="QVBoxLayout" name="verticalLayout_2">
+      <item>
+       <widget class="QLabel" name="label_3">
+        <property name="text">
+         <string>Configuraciones:</string>
+        </property>
+        <property name="alignment">
+         <set>Qt::AlignCenter</set>
+        </property>
+       </widget>
+      </item>
+      <item>
+       <widget class="QCheckBox" name="checkBox">
+        <property name="text">
+         <string>Georeferenciar</string>
+        </property>
+       </widget>
+      </item>
+      <item>
+       <widget class="QWidget" name="widget" native="true">
+        <layout class="QHBoxLayout" name="horizontalLayout_4">
+         <item>
+          <widget class="QLabel" name="label_2">
+           <property name="text">
+            <string>Cargar un archivo KMZ/KML:</string>
+           </property>
+          </widget>
+         </item>
+         <item>
+          <widget class="QPushButton" name="pushButton_4">
+           <property name="text">
+            <string/>
+           </property>
+          </widget>
+         </item>
+        </layout>
+       </widget>
+      </item>
+      <item>
+       <widget class="QListWidget" name="listWidget">
+        <item>
+         <property name="text">
+          <string>New Item</string>
+         </property>
+         <property name="checkState">
+          <enum>Unchecked</enum>
+         </property>
+        </item>
+       </widget>
+      </item>
+      <item>
+       <spacer name="verticalSpacer">
+        <property name="orientation">
+         <enum>Qt::Vertical</enum>
+        </property>
+        <property name="sizeHint" stdset="0">
+         <size>
+          <width>20</width>
+          <height>40</height>
+         </size>
+        </property>
+       </spacer>
+      </item>
+      <item>
+       <widget class="QWidget" name="widget_6" native="true">
+        <property name="sizePolicy">
+         <sizepolicy hsizetype="Preferred" vsizetype="Fixed">
+          <horstretch>0</horstretch>
+          <verstretch>0</verstretch>
+         </sizepolicy>
+        </property>
+        <layout class="QHBoxLayout" name="horizontalLayout_2">
+         <item>
+          <widget class="QPushButton" name="pushButton_2">
+           <property name="text">
+            <string>Cancelar</string>
+           </property>
+          </widget>
+         </item>
+         <item>
+          <widget class="QPushButton" name="pushButton_3">
+           <property name="text">
+            <string>Aceptar</string>
+           </property>
+          </widget>
+         </item>
+        </layout>
+       </widget>
+      </item>
+     </layout>
+    </widget>
+   </item>
+  </layout>
+ </widget>
+ <customwidgets>
+  <customwidget>
+   <class>QWebEngineView</class>
+   <extends>QWidget</extends>
+   <header>qwebengineview.h</header>
+   <container>1</container>
+  </customwidget>
+ </customwidgets>
+ <resources/>
+ <connections/>
+</ui>

PVPlantImportGrid.py

@@ -0,0 +1,660 @@
+# /**********************************************************************
+# *                                                                     *
+# * Copyright (c) 2021 Javier Braña <javier.branagutierrez@gmail.com>  *
+# *                                                                     *
+# * This program is free software; you can redistribute it and/or modify*
+# * it under the terms of the GNU Lesser General Public License (LGPL)  *
+# * as published by the Free Software Foundation; either version 2 of   *
+# * the License, or (at your option) any later version.                 *
+# * for detail see the LICENCE text file.                               *
+# *                                                                     *
+# * This program is distributed in the hope that it will be useful,     *
+# * but WITHOUT ANY WARRANTY; without even the implied warranty of      *
+# * MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE.  See the       *
+# * GNU Library General Public License for more details.                *
+# *                                                                     *
+# * You should have received a copy of the GNU Library General Public   *
+# * License along with this program; if not, write to the Free Software *
+# * Foundation, Inc., 59 Temple Place, Suite 330, Boston, MA  02111-1307*
+# * USA                                                                 *
+# *                                                                     *
+# ***********************************************************************
+
+import json
+import urllib.request
+
+import Draft
+import FreeCAD
+import FreeCADGui
+from PySide import QtCore, QtGui
+from PySide.QtCore import QT_TRANSLATE_NOOP
+
+try:
+    _fromUtf8 = QtCore.QString.fromUtf8
+except AttributeError:
+    def _fromUtf8(s):
+        return s
+
+import os
+from PVPlantResources import DirIcons as DirIcons
+import PVPlantSite
+
+
+def getElevationFromOE(coordinates):
+    if len(coordinates) == 0:
+        return None
+
+    from requests import get
+    import utm
+
+    str=""
+    total = len(coordinates) - 1
+    for i, point in enumerate(coordinates):
+        str += '{:.6f},{:.6f}'.format(point[0], point[1])
+        if i != total:
+            str += '|'
+    query = 'https://api.open-elevation.com/api/v1/lookup?locations=' + str
+    r = get(query, timeout=20)
+
+    # Only get the json response in case of 200 or 201
+    points = []
+    if r.status_code == 200 or r.status_code == 201:
+        results = r.json()
+        for point in results["results"]:
+            c = utm.from_latlon(point["latitude"], point["longitude"])
+            v = FreeCAD.Vector(round(c[0] * 1000, 0),
+                               round(c[1] * 1000, 0),
+                               round(point["elevation"] * 1000, 0))
+            points.append(v)
+    return points
+
+def getSinglePointElevationFromBing(lat, lng):
+    #http://dev.virtualearth.net/REST/v1/Elevation/List?points={lat1,long1,lat2,long2,latN,longnN}&heights={heights}&key={BingMapsAPIKey}
+    source = "http://dev.virtualearth.net/REST/v1/Elevation/List?points="
+    source += str(lat) + "," + str(lng)
+    source += "&heights=sealevel"
+    source += "&key=AmsPZA-zRt2iuIdQgvXZIxme2gWcgLaz7igOUy7VPB8OKjjEd373eCnj1KFv2CqX"
+
+    import requests
+    response = requests.get(source)
+    ans = response.text
+
+    # +# to do: error handling  - wait and try again
+    s = json.loads(ans)
+    res = s['resourceSets'][0]['resources'][0]['elevations']
+    
+    import utm
+    for elevation in res:
+        c = utm.from_latlon(lat, lng)
+        v = FreeCAD.Vector(
+            round(c[0] * 1000, 0),
+            round(c[1] * 1000, 0),
+            round(elevation * 1000, 0))
+        return v
+
+def getGridElevationFromBing(polygon, lat, lng, resolution = 1000):
+    #http://dev.virtualearth.net/REST/v1/Elevation/Polyline?points=35.89431,-110.72522,35.89393,-110.72578,35.89374,-110.72606,35.89337,-110.72662
+    # &heights=ellipsoid&samples=10&key={BingMapsAPIKey}
+    import utm
+    import math
+    import requests
+
+
+    geo = utm.from_latlon(lat, lng)
+    # result = (679434.3578335291, 4294023.585627955, 30, 'S')
+    # EASTING, NORTHING, ZONE NUMBER, ZONE LETTER
+
+    #StepsXX = int((polygon.Shape.BoundBox.XMax - polygon.Shape.BoundBox.XMin) / (resolution*1000))
+    points = []
+    yy = polygon.Shape.BoundBox.YMax
+    while yy > polygon.Shape.BoundBox.YMin:
+        xx = polygon.Shape.BoundBox.XMin
+        while xx < polygon.Shape.BoundBox.XMax:
+            StepsXX = int(math.ceil((polygon.Shape.BoundBox.XMax - xx) / resolution))
+
+            if StepsXX > 1000:
+                StepsXX = 1000
+                xx1 = xx + 1000 * resolution
+            else:
+                xx1 = xx + StepsXX * resolution
+
+            point1 = utm.to_latlon(xx / 1000, yy / 1000, geo[2], geo[3])
+            point2 = utm.to_latlon(xx1 / 1000, yy / 1000, geo[2], geo[3])
+
+            source = "http://dev.virtualearth.net/REST/v1/Elevation/Polyline?points="
+            source += "{lat1},{lng1}".format(lat1=point1[0], lng1=point1[1])
+            source += ","
+            source += "{lat2},{lng2}".format(lat2=point2[0], lng2=point2[1])
+            source += "&heights=sealevel"
+            source += "&samples={steps}".format(steps=StepsXX)
+            source += "&key=AmsPZA-zRt2iuIdQgvXZIxme2gWcgLaz7igOUy7VPB8OKjjEd373eCnj1KFv2CqX"
+
+            response = requests.get(source)
+            ans = response.text
+
+            # +# to do: error handling  - wait and try again
+            s = json.loads(ans)
+            res = s['resourceSets'][0]['resources'][0]['elevations']
+
+            i = 0
+            for elevation in res:
+                v = FreeCAD.Vector(xx + resolution * i, yy, round(elevation * 1000, 4))
+                points.append(v)
+                i += 1
+            xx = xx1 + resolution # para no repetir un mismo punto
+        yy -= resolution
+
+    return points
+
+def getSinglePointElevation(lat, lon):
+    source = "https://maps.googleapis.com/maps/api/elevation/json?locations="
+    source += str(lat) + "," + str(lon)
+    source += "&key=AIzaSyB07X6lowYJ-iqyPmaFJvr-6zp1J63db8U"
+    #print (source)
+
+    #response = request.urlopen(source)
+    #ans = response.read()
+    import requests
+    response = requests.get(source)
+    ans = response.text
+
+    # +# to do: error handling  - wait and try again
+    s = json.loads(ans)
+    res = s['results']
+
+    from geopy.distance import geodesic
+    for r in res:
+
+        reference = (0.0, 0.0)
+        v = FreeCAD.Vector(
+            round(geodesic(reference, (0.0, r['location']['lng'])).m, 2),
+            round(geodesic(reference, (r['location']['lat'], 0.0)).m, 2),
+            round(r['elevation'] * 1000, 2)
+        )
+
+    return v
+
+def _getSinglePointElevation(lat, lon):
+    source = "https://maps.googleapis.com/maps/api/elevation/json?locations="
+    source += str(lat) + "," + str(lon)
+    source += "&key=AIzaSyB07X6lowYJ-iqyPmaFJvr-6zp1J63db8U"
+    #print (source)
+
+    #response = request.urlopen(source)
+    #ans = response.read()
+    import requests
+    response = requests.get(source)
+    ans = response.text
+
+    # +# to do: error handling  - wait and try again
+    s = json.loads(ans)
+    res = s['results']
+
+    import pymap3d as pm
+    for r in res:
+        x, y, z = pm.geodetic2ecef(round(r['location']['lng'], 2),
+                                   round(r['location']['lat'], 2),
+                                   0)
+        v = FreeCAD.Vector(x,y,z)
+
+    return v
+
+def getSinglePointElevation1(lat, lon):
+    source = "https://maps.googleapis.com/maps/api/elevation/json?locations="
+    source += str(lat) + "," + str(lon)
+    source += "&key=AIzaSyB07X6lowYJ-iqyPmaFJvr-6zp1J63db8U"
+
+    #response = urllib.request.urlopen(source)
+    #ans = response.read()
+    import requests
+    response = requests.get(source)
+    ans = response.text
+
+    # +# to do: error handling  - wait and try again
+    s = json.loads(ans)
+    res = s['results']
+
+    for r in res:
+        c = tm.fromGeographic(r['location']['lat'], r['location']['lng'])
+        v = FreeCAD.Vector(
+            round(c[0], 4),
+            round(c[1], 4),
+            round(r['elevation'] * 1000, 2)
+            )
+    return v
+
+def getSinglePointElevationUtm(lat, lon):
+    source = "https://maps.googleapis.com/maps/api/elevation/json?locations="
+    source += str(lat) + "," + str(lon)
+    source += "&key=AIzaSyB07X6lowYJ-iqyPmaFJvr-6zp1J63db8U"
+    print(source)
+
+    #response = urllib.request.urlopen(source)
+    #ans = response.read()
+    import requests
+    response = requests.get(source)
+    ans = response.text
+
+    # +# to do: error handling  - wait and try again
+    s = json.loads(ans)
+    res = s['results']
+    print (res)
+
+    import utm
+    for r in res:
+        c = utm.from_latlon(r['location']['lat'], r['location']['lng'])
+        v = FreeCAD.Vector(
+            round(c[0] * 1000, 4),
+            round(c[1] * 1000, 4),
+            round(r['elevation'] * 1000, 2))
+        print (v)
+        return v
+
+
+def getElevationUTM(polygon, lat, lng, resolution = 10000):
+
+    import utm
+    geo = utm.from_latlon(lat, lng)
+    # result = (679434.3578335291, 4294023.585627955, 30, 'S')
+    # EASTING, NORTHING, ZONE NUMBER, ZONE LETTER
+
+    StepsXX = int((polygon.Shape.BoundBox.XMax - polygon.Shape.BoundBox.XMin) / (resolution*1000))
+    points = []
+    yy = polygon.Shape.BoundBox.YMax
+    while yy > polygon.Shape.BoundBox.YMin:
+        # utm.to_latlon(EASTING, NORTHING, ZONE NUMBER, ZONE LETTER).
+        # result = (LATITUDE, LONGITUDE)
+        point1 = utm.to_latlon(polygon.Shape.BoundBox.XMin / 1000, yy / 1000, geo[2], geo[3])
+        point2 = utm.to_latlon(polygon.Shape.BoundBox.XMax / 1000, yy / 1000, geo[2], geo[3])
+
+        source = "https://maps.googleapis.com/maps/api/elevation/json?path="
+        source += "{a},{b}".format(a = point1[0], b = point1[1])
+        source += "|"
+        source += "{a},{b}".format(a = point2[0], b = point2[1])
+        source += "&samples={a}".format(a = StepsXX)
+        source += "&key=AIzaSyB07X6lowYJ-iqyPmaFJvr-6zp1J63db8U"
+
+        import requests
+        response = requests.get(source)
+        ans = response.text
+
+        # +# to do: error handling  - wait and try again
+        s = json.loads(ans)
+        res = s['results']
+
+        for r in res:
+            c = utm.from_latlon(r['location']['lat'], r['location']['lng'])
+            v = FreeCAD.Vector(
+                round(c[0] * 1000, 2),
+                round(c[1] * 1000, 2),
+                round(r['elevation'] * 1000, 2)
+            )
+            points.append(v)
+        yy -= (resolution*1000)
+
+    FreeCAD.activeDocument().recompute()
+    return points
+
+def getElevation1(polygon,resolution=10):
+
+    StepsXX = int((polygon.Shape.BoundBox.XMax - polygon.Shape.BoundBox.XMin) / (resolution * 1000))
+    points = []
+    yy = polygon.Shape.BoundBox.YMax
+    while yy > polygon.Shape.BoundBox.YMin:
+        point1 = tm.toGeographic(polygon.Shape.BoundBox.XMin, yy)
+        point2 = tm.toGeographic(polygon.Shape.BoundBox.XMax, yy)
+
+        source = "https://maps.googleapis.com/maps/api/elevation/json?path="
+        source += "{a},{b}".format(a = point1[0], b = point1[1])
+        source += "|"
+        source += "{a},{b}".format(a = point2[0], b = point2[1])
+        source += "&samples={a}".format(a = StepsXX)
+        source += "&key=AIzaSyB07X6lowYJ-iqyPmaFJvr-6zp1J63db8U"
+
+        try:
+            #response = urllib.request.urlopen(source)
+            #ans = response.read()
+            import requests
+            response = requests.get(source)
+            ans = response.text
+
+            # +# to do: error handling  - wait and try again
+
+            s = json.loads(ans)
+            res = s['results']
+        except:
+            continue
+
+        #points = []
+        for r in res:
+            c = tm.fromGeographic(r['location']['lat'], r['location']['lng'])
+            v = FreeCAD.Vector(
+                round(c[0], 2),
+                round(c[1], 2),
+                round(r['elevation'] * 1000, 2)
+            )
+            points.append(v)
+
+        FreeCAD.activeDocument().recompute()
+        yy -= (resolution*1000)
+
+    return points
+
+## download the heights from google:
+def getElevation(lat, lon, b=50.35, le=11.17, size=40):
+    #https://maps.googleapis.com/maps/api/elevation/json?path=36.578581,-118.291994|36.23998,-116.83171&samples=3&key=YOUR_API_KEY
+    #https://maps.googleapis.com/maps/api/elevation/json?locations=39.7391536,-104.9847034&key=YOUR_API_KEY
+
+    source = "https://maps.googleapis.com/maps/api/elevation/json?path="
+    source += str(b-size*0.001) + "," + str(le) + "|" + str(b+size*0.001) + "," + str(le)
+    source += "&samples=" + str(100)
+    source += "&key=AIzaSyB07X6lowYJ-iqyPmaFJvr-6zp1J63db8U"
+
+    response = urllib.request.urlopen(source)
+    ans = response.read()
+
+    # +# to do: error handling  - wait and try again
+    s = json.loads(ans)
+    res = s['results']
+
+    from geopy.distance import geodesic
+    points = []
+    for r in res:
+        reference = (0.0, 0.0)
+        v = FreeCAD.Vector(
+            round(geodesic(reference, (0.0, r['location']['lat'])).m, 2),
+            round(geodesic(reference, (r['location']['lng'], 0.0)).m, 2),
+            round(r['elevation'] * 1000, 2) - baseheight
+        )
+        points.append(v)
+
+    line = Draft.makeWire(points, closed=False, face=False, support=None)
+    line.ViewObject.Visibility = False
+    #FreeCAD.activeDocument().recompute()
+    FreeCADGui.updateGui()
+    return FreeCAD.activeDocument().ActiveObject
+
+
+'''
+# original::
+def getElevation(lat, lon, b=50.35, le=11.17, size=40):
+    tm.lat = lat
+    tm.lon = lon
+    baseheight = 0 #getheight(tm.lat, tm.lon)
+    center = tm.fromGeographic(tm.lat, tm.lon)
+
+    #https://maps.googleapis.com/maps/api/elevation/json?path=36.578581,-118.291994|36.23998,-116.83171&samples=3&key=YOUR_API_KEY
+    #https://maps.googleapis.com/maps/api/elevation/json?locations=39.7391536,-104.9847034&key=YOUR_API_KEY
+
+    source = "https://maps.googleapis.com/maps/api/elevation/json?path="
+    source += str(b-size*0.001) + "," + str(le) + "|" + str(b+size*0.001) + "," + str(le)
+    source += "&samples=" + str(100)
+    source += "&key=AIzaSyB07X6lowYJ-iqyPmaFJvr-6zp1J63db8U"
+
+    response = urllib.request.urlopen(source)
+    ans = response.read()
+
+    # +# to do: error handling  - wait and try again
+    s = json.loads(ans)
+    res = s['results']
+
+    points = []
+    for r in res:
+        c = tm.fromGeographic(r['location']['lat'], r['location']['lng'])
+        v = FreeCAD.Vector(
+            round(c[0], 2),
+            round(c[1], 2),
+            round(r['elevation'] * 1000, 2) - baseheight
+        )
+        points.append(v)
+
+    line = Draft.makeWire(points, closed=False, face=False, support=None)
+    line.ViewObject.Visibility = False
+    #FreeCAD.activeDocument().recompute()
+    FreeCADGui.updateGui()
+    return FreeCAD.activeDocument().ActiveObject
+'''
+
+class _ImportPointsTaskPanel:
+
+    def __init__(self, obj = None):
+        self.obj = None
+        self.Boundary = None
+        self.select = 0
+        self.filename = ""
+
+        # form:
+        self.form1 = FreeCADGui.PySideUic.loadUi(os.path.dirname(__file__) + "/PVPlantImportGrid.ui")
+        self.form1.radio1.toggled.connect(lambda: self.mainToggle(self.form1.radio1))
+        self.form1.radio2.toggled.connect(lambda: self.mainToggle(self.form1.radio2))
+        self.form1.radio1.setChecked(True)  # << --------------Poner al final para que no dispare antes de crear los componentes a los que va a llamar
+        #self.form.buttonAdd.clicked.connect(self.add)
+        self.form1.buttonDEM.clicked.connect(self.openFileDEM)
+
+        self.form2 = FreeCADGui.PySideUic.loadUi(os.path.dirname(__file__) + "/PVPlantCreateTerrainMesh.ui")
+        #self.form2.buttonAdd.clicked.connect(self.add)
+        self.form2.buttonBoundary.clicked.connect(self.addBoundary)
+
+
+        #self.form = [self.form1, self.form2]
+        self.form = self.form1
+
+    ''' future:
+    def retranslateUi(self, dialog):
+        self.form1.setWindowTitle("Configuracion del Rack")
+        self.labelModule.setText(QtGui.QApplication.translate("PVPlant", "Modulo:", None))
+        self.labelModuleLength.setText(QtGui.QApplication.translate("PVPlant", "Longitud:", None))
+        self.labelModuleWidth.setText(QtGui.QApplication.translate("PVPlant", "Ancho:", None))
+        self.labelModuleHeight.setText(QtGui.QApplication.translate("PVPlant", "Alto:", None))
+        self.labelModuleFrame.setText(QtGui.QApplication.translate("PVPlant", "Ancho del marco:", None))
+        self.labelModuleColor.setText(QtGui.QApplication.translate("PVPlant", "Color del modulo:", None))
+        self.labelModules.setText(QtGui.QApplication.translate("Arch", "Colocacion de los Modulos", None))
+        self.labelModuleOrientation.setText(QtGui.QApplication.translate("Arch", "Orientacion del modulo:", None))
+        self.labelModuleGapX.setText(QtGui.QApplication.translate("Arch", "Separacion Horizontal (mm):", None))
+        self.labelModuleGapY.setText(QtGui.QApplication.translate("Arch", "Separacion Vertical (mm):", None))
+        self.labelModuleRows.setText(QtGui.QApplication.translate("Arch", "Filas de modulos:", None))
+        self.labelModuleCols.setText(QtGui.QApplication.translate("Arch", "Columnas de modulos:", None))
+        self.labelRack.setText(QtGui.QApplication.translate("Arch", "Configuracion de la estructura", None))
+        self.labelRackType.setText(QtGui.QApplication.translate("Arch", "Tipo de estructura:", None))
+        self.labelLevel.setText(QtGui.QApplication.translate("Arch", "Nivel:", None))
+        self.labelOffset.setText(QtGui.QApplication.translate("Arch", "Offset", None))
+    '''
+
+    def add(self):
+        sel = FreeCADGui.Selection.getSelection()
+        if len(sel) > 0:
+            self.obj = sel[0]
+            self.lineEdit1.setText(self.obj.Label)
+
+    def addBoundary(self):
+        sel = FreeCADGui.Selection.getSelection()
+        if len(sel) > 0:
+            self.Boundary = sel[0]
+            self.form2.editBoundary.setText(self.Boundary.Label)
+
+    def openFileDEM(self):
+        filters = "Esri ASC (*.asc);;CSV (*.csv);;All files (*.*)"
+        filename = QtGui.QFileDialog.getOpenFileName(None,
+                                                    "Open DEM,",
+                                                    "",
+                                                    filters)
+        self.filename = filename[0]
+        self.form1.editDEM.setText(filename[0])
+
+    def mainToggle(self, radiobox):
+        if radiobox is self.form1.radio1:
+            self.select = 0
+            self.form1.gbLocalFile.setVisible(True)
+        elif radiobox is self.form1.radio2:
+            self.select = 1
+            self.form1.gbLocalFile.setVisible(True)
+
+    def accept(self):
+        from datetime import datetime
+        starttime = datetime.now()
+
+        site = PVPlantSite.get()
+
+        try:
+            PointGroups = FreeCAD.ActiveDocument.Point_Groups
+        except:
+            PointGroups = FreeCAD.ActiveDocument.addObject("App::DocumentObjectGroup", 'Point_Groups')
+            PointGroups.Label = "Point Groups"
+
+        PointGroup = FreeCAD.ActiveDocument.addObject('Points::Feature', "Point_Group")
+        PointGroup.Label = "Land_Grid_Points"
+        FreeCAD.ActiveDocument.Point_Groups.addObject(PointGroup)
+        PointObject = PointGroup.Points.copy()
+
+        if self.select == 0:    # Google or bing or ...
+            #for item in self.obj:
+                #if self.groupbox.isChecked:break
+            resol = FreeCAD.Units.Quantity(self.valueResolution.text()).Value
+            Site = FreeCAD.ActiveDocument.Site
+            pts = getGridElevationFromBing(self.obj, Site.Latitude, Site.Longitude, resol)
+            PointObject.addPoints(pts)
+            PointGroup.Points = PointObject
+
+        else:
+            if self.filename == "":
+                return
+
+            import Utils.importDEM as openDEM
+            if self.select == 1: # DEM.
+                import numpy as np
+                root, extension = os.path.splitext(self.filename)
+                if extension.lower() == ".asc":
+                    x, y, datavals, cellsize, nodata_value = openDEM.openEsri(self.filename)
+
+                    if self.Boundary:
+                        inc_x = self.Boundary.Shape.BoundBox.XLength * 0.05
+                        inc_y = self.Boundary.Shape.BoundBox.YLength * 0.05
+
+                        min_x = 0
+                        max_x = 0
+
+                        comp = (self.Boundary.Shape.BoundBox.XMin - inc_x) / 1000
+                        for i in range(nx):
+                            if x[i] > comp:
+                                min_x = i - 1
+                                break
+                        comp = (self.Boundary.Shape.BoundBox.XMax + inc_x) / 1000
+                        for i in range(min_x, nx):
+                            if x[i] > comp:
+                                max_x = i
+                                break
+
+                        min_y = 0
+                        max_y = 0
+
+                        comp = (self.Boundary.Shape.BoundBox.YMax + inc_y) / 1000
+                        for i in range(ny):
+                            if y[i] < comp:
+                                max_y = i
+                                break
+                        comp = (self.Boundary.Shape.BoundBox.YMin - inc_y) / 1000
+                        for i in range(max_y, ny):
+                            if y[i] < comp:
+                                min_y = i
+                                break
+
+                        x = x[min_x:max_x]
+                        y = y[max_y:min_y]
+                        datavals = datavals[max_y:min_y, min_x:max_x]
+
+                    pts = []
+                    if True: # faster but more memory 46s - 4,25 gb
+                        x, y = np.meshgrid(x, y)
+                        xx = x.flatten()
+                        yy = y.flatten()
+                        zz = datavals.flatten()
+                        x[:] = 0
+                        y[:] = 0
+                        datavals[:] = 0
+
+                        pts = []
+                        for i in range(0, len(xx)):
+                            pts.append(FreeCAD.Vector(xx[i], yy[i], zz[i]) * 1000)
+
+                        xx[:] = 0
+                        yy[:] = 0
+                        zz[:] = 0
+
+                    else:   # 51s 3,2 gb
+                        createmesh = True
+                        if createmesh:
+                            import Part, Draft
+
+                            lines=[]
+                            for j in range(len(y)):
+                                edges = []
+                                for i in range(0, len(x) - 1):
+                                    ed = Part.makeLine(FreeCAD.Vector(x[i], y[j], datavals[j][i]) * 1000,
+                                                       FreeCAD.Vector(x[i + 1], y[j], datavals[j][i + 1]) * 1000)
+                                    edges.append(ed)
+
+                                #bspline = Draft.makeBSpline(pts)
+                                #bspline.ViewObject.hide()
+                                line = Part.Wire(edges)
+                                lines.append(line)
+
+                            '''
+                            for i in range(0, len(bsplines), 100):
+                                p = Part.makeLoft(bsplines[i:i + 100], False, False, False)
+                                Part.show(p)
+                            '''
+                            p = Part.makeLoft(lines, False, True, False)
+                            p = Part.Solid(p)
+                            Part.show(p)
+
+                        else:
+                            pts = []
+                            for j in range(ny):
+                                for i in range(nx):
+                                    pts.append(FreeCAD.Vector(x[i], y[j], datavals[j][i]) * 1000)
+
+                elif extension.lower() == ".csv" or extension.lower() == ".txt":  # x, y, z from gps
+                    pts = openDEM.interpolatePoints(openDEM.openCSV(self.filename))
+
+        PointObject.addPoints(pts)
+        PointGroup.Points = PointObject
+
+        FreeCAD.ActiveDocument.recompute()
+        FreeCADGui.Control.closeDialog()
+        print("tiempo: ", datetime.now() - starttime)
+
+    def reject(self):
+        FreeCADGui.Control.closeDialog()
+
+## Comandos -----------------------------------------------------------------------------------------------------------
+class CommandImportPoints:
+
+    def GetResources(self):
+        return {'Pixmap': str(os.path.join(DirIcons, "cloud.svg")),
+                'MenuText': QT_TRANSLATE_NOOP("PVPlant", "Importer Grid"),
+                'Accel': "B, U",
+                'ToolTip': QT_TRANSLATE_NOOP("PVPlant", "Creates a cloud of points.")}
+
+    def IsActive(self):
+        return not FreeCAD.ActiveDocument is None
+
+    def Activated(self):
+        self.TaskPanel = _ImportPointsTaskPanel()
+        FreeCADGui.Control.showDialog(self.TaskPanel)
+
+if FreeCAD.GuiUp:
+    class CommandPointsGroup:
+
+        def GetCommands(self):
+            return tuple(['ImportPoints'
+                          ])
+        def GetResources(self):
+            return { 'MenuText': QT_TRANSLATE_NOOP("",'Cloud of Points'),
+                     'ToolTip': QT_TRANSLATE_NOOP("",'Cloud of Points')
+                   }
+        def IsActive(self):
+            return not FreeCAD.ActiveDocument is None
+
+    FreeCADGui.addCommand('ImportPoints', CommandImportPoints())
+    FreeCADGui.addCommand('PointsGroup', CommandPointsGroup())
+

PVPlantImportGrid.ui

@@ -0,0 +1,60 @@
+<?xml version="1.0" encoding="UTF-8"?>
+<ui version="4.0">
+ <class>formImportData</class>
+ <widget class="QDialog" name="formImportData">
+  <property name="geometry">
+   <rect>
+    <x>0</x>
+    <y>0</y>
+    <width>408</width>
+    <height>164</height>
+   </rect>
+  </property>
+  <property name="windowTitle">
+   <string>Create Surface</string>
+  </property>
+  <layout class="QVBoxLayout" name="verticalLayout_2">
+   <item>
+    <widget class="QGroupBox" name="groupBox">
+     <property name="title">
+      <string>Importar datos desde:</string>
+     </property>
+     <layout class="QVBoxLayout" name="verticalLayout">
+      <item>
+       <widget class="QRadioButton" name="radio1">
+        <property name="text">
+         <string>Google Elevation</string>
+        </property>
+       </widget>
+      </item>
+      <item>
+       <widget class="QRadioButton" name="radio2">
+        <property name="text">
+         <string>Archivo DEM</string>
+        </property>
+       </widget>
+      </item>
+     </layout>
+    </widget>
+   </item>
+   <item>
+    <widget class="QWidget" name="gbLocalFile" native="true">
+     <layout class="QHBoxLayout" name="horizontalLayout">
+      <item>
+       <widget class="QLineEdit" name="editDEM"/>
+      </item>
+      <item>
+       <widget class="QPushButton" name="buttonDEM">
+        <property name="text">
+         <string>Sel</string>
+        </property>
+       </widget>
+      </item>
+     </layout>
+    </widget>
+   </item>
+  </layout>
+ </widget>
+ <resources/>
+ <connections/>
+</ui>

PVPlantImportGridAjust.ui

@@ -0,0 +1,61 @@
+<?xml version="1.0" encoding="UTF-8"?>
+<ui version="4.0">
+ <class>formSlopeAnalisys</class>
+ <widget class="QDialog" name="formSlopeAnalisys">
+  <property name="geometry">
+   <rect>
+    <x>0</x>
+    <y>0</y>
+    <width>442</width>
+    <height>109</height>
+   </rect>
+  </property>
+  <property name="windowTitle">
+   <string>Create Surface</string>
+  </property>
+  <layout class="QVBoxLayout" name="verticalLayout_2">
+   <item>
+    <widget class="QWidget" name="widget_2" native="true">
+     <layout class="QGridLayout" name="gridLayout">
+      <item row="0" column="0">
+       <widget class="QLabel" name="label_2">
+        <property name="text">
+         <string>Cloud of points</string>
+        </property>
+       </widget>
+      </item>
+      <item row="0" column="1" colspan="2">
+       <widget class="QLineEdit" name="editCloud"/>
+      </item>
+      <item row="0" column="3">
+       <widget class="QPushButton" name="buttonCloud">
+        <property name="text">
+         <string>Sel</string>
+        </property>
+       </widget>
+      </item>
+      <item row="1" column="0" colspan="2">
+       <widget class="QLabel" name="label_3">
+        <property name="text">
+         <string>Boundary</string>
+        </property>
+       </widget>
+      </item>
+      <item row="1" column="2">
+       <widget class="QLineEdit" name="editBoundary"/>
+      </item>
+      <item row="1" column="3">
+       <widget class="QPushButton" name="buttonBoundary">
+        <property name="text">
+         <string>Sel</string>
+        </property>
+       </widget>
+      </item>
+     </layout>
+    </widget>
+   </item>
+  </layout>
+ </widget>
+ <resources/>
+ <connections/>
+</ui>

PVPlantManhole.py

@@ -0,0 +1,278 @@
+# /**********************************************************************
+# *                                                                     *
+# * Copyright (c) 2021 Javier Braña <javier.branagutierrez@gmail.com>  *
+# *                                                                     *
+# * This program is free software; you can redistribute it and/or modify*
+# * it under the terms of the GNU Lesser General Public License (LGPL)  *
+# * as published by the Free Software Foundation; either version 2 of   *
+# * the License, or (at your option) any later version.                 *
+# * for detail see the LICENCE text file.                               *
+# *                                                                     *
+# * This program is distributed in the hope that it will be useful,     *
+# * but WITHOUT ANY WARRANTY; without even the implied warranty of      *
+# * MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE.  See the       *
+# * GNU Library General Public License for more details.                *
+# *                                                                     *
+# * You should have received a copy of the GNU Library General Public   *
+# * License along with this program; if not, write to the Free Software *
+# * Foundation, Inc., 59 Temple Place, Suite 330, Boston, MA  02111-1307*
+# * USA                                                                 *
+# *                                                                     *
+# ***********************************************************************
+
+import ArchComponent
+import FreeCAD
+import Part
+
+if FreeCAD.GuiUp:
+    import FreeCADGui
+    from PySide import QtCore
+    import draftguitools.gui_trackers as DraftTrackers
+else:
+    # \cond
+    def translate(ctxt, txt):
+        return txt
+    def QT_TRANSLATE_NOOP(ctxt, txt):
+        return txt
+    # \endcond
+
+try:
+    _fromUtf8 = QtCore.QString.fromUtf8
+except AttributeError:
+    def _fromUtf8(s):
+        return s
+
+import os
+import PVPlantResources
+from PVPlantResources import DirIcons as DirIcons
+
+
+
+def makeManhole(name="Manhole"):
+    obj = FreeCAD.ActiveDocument.addObject("Part::FeaturePython", "Manhole")
+    obj.Label = name
+    _Manhole(obj)
+    _ViewProviderManhole(obj.ViewObject)
+    FreeCAD.ActiveDocument.recompute()
+    return obj
+
+class _Manhole(ArchComponent.Component):
+    "A Manhole Obcject"
+
+    def __init__(self, obj):
+        # Definición de Variables:
+        ArchComponent.Component.__init__(self, obj)
+        self.setProperties(obj)
+
+    def setProperties(self, obj):
+        pl = obj.PropertiesList
+        # Dimensions: --------------------------------------------------------------------------------------------------
+        if not "Height" in pl:
+            obj.addProperty("App::PropertyLength",
+                            "Height",
+                            "Manhole",
+                            "The height of this object"
+                            ).Height = 1000
+
+        if not "Width" in pl:
+            obj.addProperty("App::PropertyLength",
+                            "Width",
+                            "Manhole",
+                            "The width of this object"
+                            ).Width = 1000
+
+        if not "Length" in pl:
+            obj.addProperty("App::PropertyLength",
+                            "Length",
+                            "Manhole",
+                            "The height of this object"
+                            ).Length = 2000
+
+        if not "Thickness" in pl:
+            obj.addProperty("App::PropertyLength",
+                            "Thickness",
+                            "Manhole",
+                            "The height of this object"
+                            ).Thickness = 100
+
+        # outputs:
+        if not "InternalVolume" in pl:
+            obj.addProperty("App::PropertyVolume",
+                            "InternalVolume",
+                            "Outputs",
+                            "The height of this object"
+                            )
+
+        if not "ExternalVolume" in pl:
+            obj.addProperty("App::PropertyVolume",
+                            "ExternalVolume",
+                            "Outputs",
+                            "The height of this object"
+                            )
+
+        self.Type = "Manhole"
+        obj.Proxy = self
+
+    def onDocumentRestored(self, obj):
+        """Method run when the document is restored.
+        Re-adds the Arch component, and Arch wall properties."""
+        ArchComponent.Component.onDocumentRestored(self, obj)
+        self.setProperties(obj)
+
+    def onChanged(self, obj, prop):
+        '''Do something when a property has changed'''
+
+    def execute(self, obj):
+        w_med = obj.Width.Value / 2
+        l_med = obj.Length.Value / 2
+
+        p1 = FreeCAD.Vector(-l_med, -w_med, 0)
+        p2 = FreeCAD.Vector( l_med, -w_med, 0)
+        p3 = FreeCAD.Vector( l_med,  w_med, 0)
+        p4 = FreeCAD.Vector(-l_med,  w_med, 0)
+        ext = Part.Face(Part.makePolygon([p1, p2, p3, p4, p1, ]))
+        ins = ext.makeOffset2D(-obj.Thickness.Value, join=2, openResult=True)
+        ext_sol = ext.extrude(FreeCAD.Vector(0, 0, -obj.Height.Value))
+        ins_sol = ins.extrude(FreeCAD.Vector(0, 0, -(obj.Height.Value - obj.Thickness.Value)))
+
+        obj.Shape = ext_sol.cut([ins_sol, ], 0.0)
+
+
+
+
+class _ViewProviderManhole(ArchComponent.ViewProviderComponent):
+    "A View Provider for the Pipe object"
+
+    def __init__(self, vobj):
+        ArchComponent.ViewProviderComponent.__init__(self, vobj)
+
+    def getIcon(self):
+        return str(os.path.join(DirIcons, "manhole.svg"))
+
+    def setEdit(self, vobj, mode):
+        """Method called when the document requests the object to enter edit mode.
+
+        Edit mode is entered when a user double clicks on an object in the tree
+        view, or when they use the menu option [Edit -> Toggle Edit Mode].
+
+        Just display the standard Arch component task panel.
+
+        Parameters
+        ----------
+        mode: int or str
+            The edit mode the document has requested. Set to 0 when requested via
+            a double click or [Edit -> Toggle Edit Mode].
+
+        Returns
+        -------
+        bool
+            If edit mode was entered.
+        """
+
+        if (mode == 0) and hasattr(self, "Object"):
+            taskd = _ManholeTaskPanel(self.Object)
+            taskd.obj = self.Object
+            # taskd.update()
+            FreeCADGui.Control.showDialog(taskd)
+            return True
+
+        return False
+
+import draftguitools.gui_tool_utils as gui_tool_utils
+
+class _ManholeTaskPanel:
+    def __init__(self, obj=None):
+        self.new = False
+        if obj is None:
+            self.new = True
+            obj = makeManhole()
+
+        self.obj = obj
+
+        self.form = FreeCADGui.PySideUic.loadUi(PVPlantResources.__dir__ + "/PVPlantManhole.ui")
+
+        self.node = None
+        self.view = FreeCADGui.ActiveDocument.ActiveView
+        self.tracker = DraftTrackers.ghostTracker(obj)
+        self.tracker.on()
+        self.call = self.view.addEventCallback("SoEvent", self.action)
+
+    def action(self, arg):
+        """Handle the 3D scene events.
+
+        This is installed as an EventCallback in the Inventor view.
+
+        Parameters
+        ----------
+        arg: dict
+            Dictionary with strings that indicates the type of event received
+            from the 3D view.
+        """
+
+        if arg["Type"] == "SoKeyboardEvent" and arg["Key"] == "ESCAPE":
+            self.finish()
+
+        elif arg["Type"] == "SoLocation2Event":
+            point, ctrlPoint, info = gui_tool_utils.getPoint(self, arg)
+            if info:
+                self.tracker.move(FreeCAD.Vector(info["x"], info["y"], info["z"]))
+            else:
+                self.tracker.move(point)
+
+        elif (arg["Type"] == "SoMouseButtonEvent" and
+              arg["State"] == "DOWN" and
+              arg["Button"] == "BUTTON1"):
+
+            point, ctrlPoint, info = gui_tool_utils.getPoint(self, arg)
+            if info:
+                self.obj.Placement.Base = FreeCAD.Vector(info["x"], info["y"], info["z"])
+            else:
+                self.obj.Placement.Base = point
+            self.finish()
+
+    def finish(self):
+        self.accept()
+
+    def accept(self):
+        self.closeForm()
+        return True
+
+    def reject(self):
+        if self.new:
+            FreeCAD.ActiveDocument.removeObject(self.obj.Name)
+        self.closeForm()
+        return True
+
+    def closeForm(self):
+        self.tracker.finalize()
+        FreeCADGui.Control.closeDialog()
+        self.view.removeEventCallback("SoEvent", self.call)
+
+
+class _CommandManhole:
+    "the Arch Building command definition"
+
+    def GetResources(self):
+        return {'Pixmap': str(os.path.join(DirIcons, "manhole.svg")),
+                'MenuText': "Manhole",
+                'Accel': "C, M",
+                'ToolTip': "Creates a Manhole object from setup dialog."}
+
+    def IsActive(self):
+        return not FreeCAD.ActiveDocument is None
+
+        if FreeCAD.ActiveDocument is not None:
+            if FreeCADGui.Selection.getCompleteSelection():
+                for ob in FreeCAD.ActiveDocument.Objects:
+                    if ob.Name[:4] == "Site":
+                        return True
+
+    def Activated(self):
+        TaskPanel = _ManholeTaskPanel()
+        FreeCADGui.Control.showDialog(TaskPanel)
+        return
+
+
+if FreeCAD.GuiUp:
+    FreeCADGui.addCommand('PVPlantManhole', _CommandManhole())
+

PVPlantManhole.ui

@@ -0,0 +1,218 @@
+<?xml version="1.0" encoding="UTF-8"?>
+<ui version="4.0">
+ <class>formRack</class>
+ <widget class="QDialog" name="formRack">
+  <property name="geometry">
+   <rect>
+    <x>0</x>
+    <y>0</y>
+    <width>332</width>
+    <height>157</height>
+   </rect>
+  </property>
+  <property name="windowTitle">
+   <string>Fixed Frame:</string>
+  </property>
+  <layout class="QVBoxLayout" name="verticalLayout">
+   <item>
+    <widget class="QGroupBox" name="groupBox">
+     <property name="sizePolicy">
+      <sizepolicy hsizetype="Preferred" vsizetype="Fixed">
+       <horstretch>0</horstretch>
+       <verstretch>0</verstretch>
+      </sizepolicy>
+     </property>
+     <property name="title">
+      <string>Dimensions</string>
+     </property>
+     <layout class="QGridLayout" name="gridLayout">
+      <property name="leftMargin">
+       <number>5</number>
+      </property>
+      <property name="topMargin">
+       <number>5</number>
+      </property>
+      <property name="rightMargin">
+       <number>5</number>
+      </property>
+      <property name="bottomMargin">
+       <number>5</number>
+      </property>
+      <property name="horizontalSpacing">
+       <number>5</number>
+      </property>
+      <property name="verticalSpacing">
+       <number>2</number>
+      </property>
+      <item row="0" column="0">
+       <widget class="QLabel" name="label_9">
+        <property name="text">
+         <string>Heigth (m)</string>
+        </property>
+       </widget>
+      </item>
+      <item row="0" column="1">
+       <widget class="QDoubleSpinBox" name="editModuleHeight">
+        <property name="sizePolicy">
+         <sizepolicy hsizetype="Fixed" vsizetype="Fixed">
+          <horstretch>0</horstretch>
+          <verstretch>0</verstretch>
+         </sizepolicy>
+        </property>
+        <property name="minimumSize">
+         <size>
+          <width>140</width>
+          <height>0</height>
+         </size>
+        </property>
+        <property name="alignment">
+         <set>Qt::AlignRight|Qt::AlignTrailing|Qt::AlignVCenter</set>
+        </property>
+        <property name="buttonSymbols">
+         <enum>QAbstractSpinBox::NoButtons</enum>
+        </property>
+        <property name="decimals">
+         <number>3</number>
+        </property>
+        <property name="maximum">
+         <double>10000.000000000000000</double>
+        </property>
+        <property name="singleStep">
+         <double>0.010000000000000</double>
+        </property>
+        <property name="value">
+         <double>1000.000000000000000</double>
+        </property>
+       </widget>
+      </item>
+      <item row="1" column="1">
+       <widget class="QDoubleSpinBox" name="editModuleLenght">
+        <property name="sizePolicy">
+         <sizepolicy hsizetype="Fixed" vsizetype="Fixed">
+          <horstretch>0</horstretch>
+          <verstretch>0</verstretch>
+         </sizepolicy>
+        </property>
+        <property name="minimumSize">
+         <size>
+          <width>140</width>
+          <height>0</height>
+         </size>
+        </property>
+        <property name="alignment">
+         <set>Qt::AlignRight|Qt::AlignTrailing|Qt::AlignVCenter</set>
+        </property>
+        <property name="buttonSymbols">
+         <enum>QAbstractSpinBox::NoButtons</enum>
+        </property>
+        <property name="decimals">
+         <number>3</number>
+        </property>
+        <property name="maximum">
+         <double>10000.000000000000000</double>
+        </property>
+        <property name="singleStep">
+         <double>0.010000000000000</double>
+        </property>
+        <property name="value">
+         <double>2000.000000000000000</double>
+        </property>
+       </widget>
+      </item>
+      <item row="2" column="0">
+       <widget class="QLabel" name="label_11">
+        <property name="text">
+         <string>Anchura (m)</string>
+        </property>
+       </widget>
+      </item>
+      <item row="3" column="0">
+       <widget class="QLabel" name="label">
+        <property name="text">
+         <string>TextLabel</string>
+        </property>
+       </widget>
+      </item>
+      <item row="1" column="0">
+       <widget class="QLabel" name="label_10">
+        <property name="text">
+         <string>Largura (m)</string>
+        </property>
+       </widget>
+      </item>
+      <item row="2" column="1">
+       <widget class="QDoubleSpinBox" name="editModuleWidth">
+        <property name="sizePolicy">
+         <sizepolicy hsizetype="Fixed" vsizetype="Fixed">
+          <horstretch>0</horstretch>
+          <verstretch>0</verstretch>
+         </sizepolicy>
+        </property>
+        <property name="minimumSize">
+         <size>
+          <width>140</width>
+          <height>0</height>
+         </size>
+        </property>
+        <property name="alignment">
+         <set>Qt::AlignRight|Qt::AlignTrailing|Qt::AlignVCenter</set>
+        </property>
+        <property name="buttonSymbols">
+         <enum>QAbstractSpinBox::NoButtons</enum>
+        </property>
+        <property name="decimals">
+         <number>3</number>
+        </property>
+        <property name="maximum">
+         <double>10000.000000000000000</double>
+        </property>
+        <property name="singleStep">
+         <double>0.010000000000000</double>
+        </property>
+        <property name="value">
+         <double>1000.000000000000000</double>
+        </property>
+       </widget>
+      </item>
+      <item row="3" column="1">
+       <widget class="QDoubleSpinBox" name="editModuleWidth_2">
+        <property name="sizePolicy">
+         <sizepolicy hsizetype="Fixed" vsizetype="Fixed">
+          <horstretch>0</horstretch>
+          <verstretch>0</verstretch>
+         </sizepolicy>
+        </property>
+        <property name="minimumSize">
+         <size>
+          <width>140</width>
+          <height>0</height>
+         </size>
+        </property>
+        <property name="alignment">
+         <set>Qt::AlignRight|Qt::AlignTrailing|Qt::AlignVCenter</set>
+        </property>
+        <property name="buttonSymbols">
+         <enum>QAbstractSpinBox::NoButtons</enum>
+        </property>
+        <property name="decimals">
+         <number>3</number>
+        </property>
+        <property name="maximum">
+         <double>10000.000000000000000</double>
+        </property>
+        <property name="singleStep">
+         <double>0.010000000000000</double>
+        </property>
+        <property name="value">
+         <double>1000.000000000000000</double>
+        </property>
+       </widget>
+      </item>
+     </layout>
+    </widget>
+   </item>
+  </layout>
+ </widget>
+ <resources/>
+ <connections/>
+</ui>

PVPlantMenuEditor.ui

@@ -0,0 +1,218 @@
+<?xml version="1.0" encoding="UTF-8"?>
+<ui version="4.0">
+ <class>formRack</class>
+ <widget class="QDialog" name="formRack">
+  <property name="geometry">
+   <rect>
+    <x>0</x>
+    <y>0</y>
+    <width>332</width>
+    <height>157</height>
+   </rect>
+  </property>
+  <property name="windowTitle">
+   <string>Fixed Frame:</string>
+  </property>
+  <layout class="QVBoxLayout" name="verticalLayout">
+   <item>
+    <widget class="QGroupBox" name="groupBox">
+     <property name="sizePolicy">
+      <sizepolicy hsizetype="Preferred" vsizetype="Fixed">
+       <horstretch>0</horstretch>
+       <verstretch>0</verstretch>
+      </sizepolicy>
+     </property>
+     <property name="title">
+      <string>Dimensions</string>
+     </property>
+     <layout class="QGridLayout" name="gridLayout">
+      <property name="leftMargin">
+       <number>5</number>
+      </property>
+      <property name="topMargin">
+       <number>5</number>
+      </property>
+      <property name="rightMargin">
+       <number>5</number>
+      </property>
+      <property name="bottomMargin">
+       <number>5</number>
+      </property>
+      <property name="horizontalSpacing">
+       <number>5</number>
+      </property>
+      <property name="verticalSpacing">
+       <number>2</number>
+      </property>
+      <item row="0" column="0">
+       <widget class="QLabel" name="label_9">
+        <property name="text">
+         <string>Heigth (m)</string>
+        </property>
+       </widget>
+      </item>
+      <item row="0" column="1">
+       <widget class="QDoubleSpinBox" name="editModuleHeight">
+        <property name="sizePolicy">
+         <sizepolicy hsizetype="Fixed" vsizetype="Fixed">
+          <horstretch>0</horstretch>
+          <verstretch>0</verstretch>
+         </sizepolicy>
+        </property>
+        <property name="minimumSize">
+         <size>
+          <width>140</width>
+          <height>0</height>
+         </size>
+        </property>
+        <property name="alignment">
+         <set>Qt::AlignRight|Qt::AlignTrailing|Qt::AlignVCenter</set>
+        </property>
+        <property name="buttonSymbols">
+         <enum>QAbstractSpinBox::NoButtons</enum>
+        </property>
+        <property name="decimals">
+         <number>3</number>
+        </property>
+        <property name="maximum">
+         <double>10000.000000000000000</double>
+        </property>
+        <property name="singleStep">
+         <double>0.010000000000000</double>
+        </property>
+        <property name="value">
+         <double>1000.000000000000000</double>
+        </property>
+       </widget>
+      </item>
+      <item row="1" column="1">
+       <widget class="QDoubleSpinBox" name="editModuleLenght">
+        <property name="sizePolicy">
+         <sizepolicy hsizetype="Fixed" vsizetype="Fixed">
+          <horstretch>0</horstretch>
+          <verstretch>0</verstretch>
+         </sizepolicy>
+        </property>
+        <property name="minimumSize">
+         <size>
+          <width>140</width>
+          <height>0</height>
+         </size>
+        </property>
+        <property name="alignment">
+         <set>Qt::AlignRight|Qt::AlignTrailing|Qt::AlignVCenter</set>
+        </property>
+        <property name="buttonSymbols">
+         <enum>QAbstractSpinBox::NoButtons</enum>
+        </property>
+        <property name="decimals">
+         <number>3</number>
+        </property>
+        <property name="maximum">
+         <double>10000.000000000000000</double>
+        </property>
+        <property name="singleStep">
+         <double>0.010000000000000</double>
+        </property>
+        <property name="value">
+         <double>2000.000000000000000</double>
+        </property>
+       </widget>
+      </item>
+      <item row="2" column="0">
+       <widget class="QLabel" name="label_11">
+        <property name="text">
+         <string>Anchura (m)</string>
+        </property>
+       </widget>
+      </item>
+      <item row="3" column="0">
+       <widget class="QLabel" name="label">
+        <property name="text">
+         <string>TextLabel</string>
+        </property>
+       </widget>
+      </item>
+      <item row="1" column="0">
+       <widget class="QLabel" name="label_10">
+        <property name="text">
+         <string>Largura (m)</string>
+        </property>
+       </widget>
+      </item>
+      <item row="2" column="1">
+       <widget class="QDoubleSpinBox" name="editModuleWidth">
+        <property name="sizePolicy">
+         <sizepolicy hsizetype="Fixed" vsizetype="Fixed">
+          <horstretch>0</horstretch>
+          <verstretch>0</verstretch>
+         </sizepolicy>
+        </property>
+        <property name="minimumSize">
+         <size>
+          <width>140</width>
+          <height>0</height>
+         </size>
+        </property>
+        <property name="alignment">
+         <set>Qt::AlignRight|Qt::AlignTrailing|Qt::AlignVCenter</set>
+        </property>
+        <property name="buttonSymbols">
+         <enum>QAbstractSpinBox::NoButtons</enum>
+        </property>
+        <property name="decimals">
+         <number>3</number>
+        </property>
+        <property name="maximum">
+         <double>10000.000000000000000</double>
+        </property>
+        <property name="singleStep">
+         <double>0.010000000000000</double>
+        </property>
+        <property name="value">
+         <double>1000.000000000000000</double>
+        </property>
+       </widget>
+      </item>
+      <item row="3" column="1">
+       <widget class="QDoubleSpinBox" name="editModuleWidth_2">
+        <property name="sizePolicy">
+         <sizepolicy hsizetype="Fixed" vsizetype="Fixed">
+          <horstretch>0</horstretch>
+          <verstretch>0</verstretch>
+         </sizepolicy>
+        </property>
+        <property name="minimumSize">
+         <size>
+          <width>140</width>
+          <height>0</height>
+         </size>
+        </property>
+        <property name="alignment">
+         <set>Qt::AlignRight|Qt::AlignTrailing|Qt::AlignVCenter</set>
+        </property>
+        <property name="buttonSymbols">
+         <enum>QAbstractSpinBox::NoButtons</enum>
+        </property>
+        <property name="decimals">
+         <number>3</number>
+        </property>
+        <property name="maximum">
+         <double>10000.000000000000000</double>
+        </property>
+        <property name="singleStep">
+         <double>0.010000000000000</double>
+        </property>
+        <property name="value">
+         <double>1000.000000000000000</double>
+        </property>
+       </widget>
+      </item>
+     </layout>
+    </widget>
+   </item>
+  </layout>
+ </widget>
+ <resources/>
+ <connections/>
+</ui>

PVPlantPad.py

@@ -0,0 +1,439 @@
+# /**********************************************************************
+# *                                                                     *
+# * Copyright (c) 2021 Javier Braña <javier.branagutierrez@gmail.com>  *
+# *                                                                     *
+# * This program is free software; you can redistribute it and/or modify*
+# * it under the terms of the GNU Lesser General Public License (LGPL)  *
+# * as published by the Free Software Foundation; either version 2 of   *
+# * the License, or (at your option) any later version.                 *
+# * for detail see the LICENCE text file.                               *
+# *                                                                     *
+# * This program is distributed in the hope that it will be useful,     *
+# * but WITHOUT ANY WARRANTY; without even the implied warranty of      *
+# * MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE.  See the       *
+# * GNU Library General Public License for more details.                *
+# *                                                                     *
+# * You should have received a copy of the GNU Library General Public   *
+# * License along with this program; if not, write to the Free Software *
+# * Foundation, Inc., 59 Temple Place, Suite 330, Boston, MA  02111-1307*
+# * USA                                                                 *
+# *                                                                     *
+# ***********************************************************************
+
+import FreeCAD, Part
+import BOPTools.SplitAPI as splitter
+import ArchComponent
+import PVPlantSite
+import math
+
+if FreeCAD.GuiUp:
+    import FreeCADGui
+    from PySide import QtCore
+    from DraftTools import translate
+    from PySide.QtCore import QT_TRANSLATE_NOOP
+    import os
+else:
+    # \cond
+    def translate(ctxt, txt):
+        return txt
+
+
+    def QT_TRANSLATE_NOOP(ctxt, txt):
+        return txt
+    # \endcond
+
+__title__ = "PVPlant Trench"
+__author__ = "Javier Braña"
+__url__ = "http://www.sogos-solar.com"
+
+import PVPlantResources
+from PVPlantResources import DirIcons as DirIcons
+
+def makePad(base=None):
+    obj = FreeCAD.ActiveDocument.addObject("Part::FeaturePython", "Pad")
+    Pad(obj)
+    ViewProviderPad(obj.ViewObject)
+    obj.Base = base
+    return obj
+
+class Pad(ArchComponent.Component):
+    def __init__(self, obj):
+        # Definición de Variables:
+        ArchComponent.Component.__init__(self, obj)
+        self.obj = obj
+        self.base = None
+
+        self.setProperties(obj)
+
+        obj.Proxy = self
+        obj.IfcType = "Civil Element"
+        obj.setEditorMode("IfcType", 1)
+
+        obj.ViewObject.ShapeColor = (0.305, 0.230, 0.191)
+
+    def setProperties(self, obj):
+        # Definicion de Propiedades:
+
+        #TODO: Los parametros width y length desaparecerán. Se tiene que selecionar objeto base
+        obj.addProperty("App::PropertyLength",
+                        "Width",
+                        "Pad",
+                        QT_TRANSLATE_NOOP("App::Property", "Connection")).Width = 5000
+
+        obj.addProperty("App::PropertyLength",
+                        "Length",
+                        "Pad",
+                        QT_TRANSLATE_NOOP("App::Property", "Connection")).Length = 10000
+
+        obj.addProperty("App::PropertyAngle",
+                        "FillSlope",
+                        "Pad",
+                        QT_TRANSLATE_NOOP("App::Property", "Connection")).FillSlope = 45.00
+
+        obj.addProperty("App::PropertyAngle",
+                        "CutSlope",
+                        "Pad",
+                        QT_TRANSLATE_NOOP("App::Property", "Connection")).CutSlope = 60.00
+
+        obj.addProperty("App::PropertyBool",
+                        "TopsoilCalculation",
+                        "Pad",
+                        QT_TRANSLATE_NOOP("App::Property", "Connection")).TopsoilCalculation = False
+
+        obj.addProperty("App::PropertyLength",
+                        "TopsoilHeight",
+                        "Pad",
+                        QT_TRANSLATE_NOOP("App::Property", "Connection")).TopsoilHeight = 300
+
+        # Output values:
+        obj.addProperty("App::PropertyVolume",
+                        "CutVolume",
+                        "Output",
+                        QT_TRANSLATE_NOOP("App::Property", "Connection"))
+        obj.setEditorMode("CutVolume", 1)
+
+        obj.addProperty("App::PropertyVolume",
+                        "FillVolume",
+                        "Output",
+                        QT_TRANSLATE_NOOP("App::Property", "Connection"))
+        obj.setEditorMode("FillVolume", 1)
+
+        obj.addProperty("App::PropertyArea",
+                        "PadArea",
+                        "Output",
+                        QT_TRANSLATE_NOOP("App::Property", "Connection"))
+        obj.setEditorMode("PadArea", 1)
+
+        obj.addProperty("App::PropertyArea",
+                        "TopSoilArea",
+                        "Output",
+                        QT_TRANSLATE_NOOP("App::Property", "Connection"))
+        obj.setEditorMode("TopSoilArea", 1)
+
+        obj.addProperty("App::PropertyVolume",
+                        "TopSoilVolume",
+                        "Output",
+                        QT_TRANSLATE_NOOP("App::Property", "Connection"))
+        obj.setEditorMode("TopSoilVolume", 1)
+        obj.setEditorMode("Placement", 1)
+
+        self.Type = "Pad"
+        obj.Proxy = self
+
+    def onDocumentRestored(self, obj):
+        """Method run when the document is restored.
+        Re-adds the Arch component, and object properties."""
+
+        ArchComponent.Component.onDocumentRestored(self, obj)
+        self.obj = obj
+        self.Type = "Pad"
+        obj.Proxy = self
+
+    def onChanged(self, fp, prop):
+        '''Do something when a property has changed'''
+
+    def execute(self, obj):
+        from datetime import datetime
+        starttime = datetime.now()
+
+        pb = obj.Placement.Base
+        land = PVPlantSite.get().Terrain
+        shapes = []
+        pad = None
+
+        if obj.Base:
+            if hasattr(obj.Base.Shape, 'Wires') and obj.Base.Shape.Wires:
+                pad = obj.Base.Shape.Wires[0]
+            elif obj.Base.Shape.Edges:
+                pad = Part.Wire(obj.Base.Shape.Edges)
+            pb = obj.Base.Placement.Base
+        else:
+            # Si no hay una base seleccionada se crea una rectangular:
+            halfWidth = obj.Width.Value / 2
+            halfLength = obj.Length.Value / 2
+
+            p1 = FreeCAD.Vector(-halfLength, -halfWidth, 0)
+            p2 = FreeCAD.Vector( halfLength, -halfWidth, 0)
+            p3 = FreeCAD.Vector( halfLength,  halfWidth, 0)
+            p4 = FreeCAD.Vector(-halfLength,  halfWidth, 0)
+            pad = Part.makePolygon([p1, p2, p3, p4, p1])
+            '''pad = Draft.makeWire([p1, p2, p3, p4, p1])
+            obj.Base = pad
+            pad = obj.Base.Shape.Wires[0]'''
+
+        # 1. Terraplén (fill):
+        fill = None
+        fillcommon = None
+        if land.Shape.BoundBox.ZMin < pb.z:
+            tool = self.createSolid(obj, pad, land, -1)
+            fillcommon, fill = self.calculateFill(obj, tool)
+        else:
+            print("- PAD: NOOOO  Calculete fill solid:")
+
+        # 2. Desmonte (cut):
+        cut = None
+        '''cutcommon = None
+        if land.Shape.BoundBox.ZMax > pb.z:
+            cut = self.createSolid(obj, pad, land, 1)
+            cut.Placement.Base += pb
+            cutcommon, cut = self.calculateCut(obj, cut)
+        else:
+            print("- PAD: NOOOO Calcalete cut solid:")'''
+
+        topsoilArea = 0
+        topsoilVolume = 0
+        if fill:
+            if obj.TopsoilCalculation:
+                filltopsoil = fillcommon.extrude(FreeCAD.Vector(0, 0, -obj.TopsoilHeight))
+                topsoilVolume += filltopsoil.Volume
+                filltopsoil.Placement.Base -= pb
+                shapes.append(filltopsoil)
+            fill.Placement.Base -= pb
+            shapes.append(fill)
+            topsoilArea += fill.Area
+        if cut:
+            cut.Placement.Base -= pb
+            shapes.append(cut)
+            topsoilArea += cut.Area
+            if obj.TopsoilCalculation:
+                cuttopsoil = cutcommon.extrude(FreeCAD.Vector(0, 0, -obj.TopsoilHeight))
+                topsoilVolume += cuttopsoil.Volume
+                obj.CutVolume = obj.CutVolume.Value - cuttopsoil.Volume
+
+        pad = Part.Face(pad)
+        if len(shapes) == 0:
+            shapes.append(pad)
+
+        shape = Part.makeCompound(shapes)
+        #shape.Placement.Base = FreeCAD.Vector(0)
+        obj.Shape = shape
+        obj.Placement.Base = pb
+        obj.PadArea = pad.Area
+        obj.TopSoilArea = topsoilArea
+        obj.TopSoilVolume = topsoilVolume
+
+        total_time = datetime.now() - starttime
+        print(" -- Tiempo tardado:", total_time)
+
+    def createSolid(self, obj, base, land, dir = -1):
+        base_copy = base.copy()
+        base_copy.Placement.Base =  FreeCAD.Vector(0,0,0)
+        if dir == -1:
+            zz = land.Mesh.BoundBox.ZMin
+            angle = obj.FillSlope.Value
+        else:
+            zz = land.Mesh.BoundBox.ZMax
+            angle = obj.CutSlope.Value
+        height = abs(zz - base.Placement.Base.z)
+        offset = base_copy.makeOffset2D(height / math.tan(math.radians(angle)), 0, False, False, True)
+        offset.Placement.Base.z = dir * height
+
+        import DraftGeomUtils
+        base_fillet = DraftGeomUtils.filletWire(base_copy, 1) #trick to get a nice shape: (fillet of 1 mm)
+        pad = Part.makeLoft([base_fillet, offset], True)
+        pad.Placement.Base = base.Placement.Base
+        return pad
+
+    def calculateFill(self, obj, solid):
+        common = solid.common(PVPlantSite.get().Terrain.Shape)
+        if common.Area > 0:
+            sp = splitter.slice(solid, [common, ], "Split")
+            commoncopy = common.copy()
+            commoncopy.Placement.Base.z += 10
+            volume = 0
+            fills = []
+            for sol in sp.Solids:
+                common1 = sol.common(commoncopy)
+                if common1.Area > 0:
+                    volume += sol.Volume
+                    fills.append(sol)
+            obj.FillVolume = volume
+            if len(fills) > 0:
+                base = fills.pop(0)
+                if len(fills) > 0:
+                    base = base.fuse(fills)
+                return common, base
+        else:
+            obj.FillVolume = 0
+            print("--- Fill: no common Area --------------------------")
+        return None, None
+
+    def calculateCut(self, obj, solid):
+        common = solid.common(PVPlantSite.get().Terrain.Shape)
+        if common.Area > 0:
+            sp = splitter.slice(solid, [common, ], "Split")
+            shells = []
+            volume = 0
+            commoncopy = common.copy()
+            commoncopy.Placement.Base.z -= 1
+            for sol in sp.Solids:
+                common1 = sol.common(commoncopy)
+                if common1.Area > 0:
+                    volume += sol.Volume
+                    shell = sol.Shells[0]
+                    shell = shell.cut(common)
+                    shells.append(shell)
+            obj.CutVolume = volume
+            if len(shells) > 0:
+                base = shells.pop(0)
+                if len(shells) > 0:
+                    base = base.fuse(shells)
+                return common, base
+        else:
+            obj.CutVolume = 0
+            print("--- Cut: no common Area --------------------------")
+
+        return None, None
+
+class ViewProviderPad(ArchComponent.ViewProviderComponent):
+    def __init__(self, vobj):
+        ArchComponent.ViewProviderComponent.__init__(self, vobj)
+
+    def getIcon(self):
+        return str(os.path.join(PVPlantResources.DirIcons, "pad.svg"))
+
+class _PadTaskPanel:
+
+    def __init__(self, obj=None):
+
+        if obj is None:
+            self.new = True
+            self.obj = makeTrench()
+        else:
+            self.new = False
+            self.obj = obj
+
+        self.form = FreeCADGui.PySideUic.loadUi(os.path.join(PVPlantResources.__dir__, "PVPlantTrench.ui"))
+
+    def accept(self):
+        FreeCAD.ActiveDocument.openTransaction("Create Pad")
+        FreeCADGui.Control.closeDialog()
+        return True
+
+    def reject(self):
+        FreeCAD.ActiveDocument.removeObject(self.obj.Name)
+        if self.new:
+            FreeCADGui.Control.closeDialog()
+        return True
+
+
+import sys
+from PySide.QtCore import QT_TRANSLATE_NOOP
+
+import draftutils.utils as utils
+import draftutils.gui_utils as gui_utils
+import draftutils.todo as todo
+import draftguitools.gui_base_original as gui_base_original
+import draftguitools.gui_tool_utils as gui_tool_utils
+
+from draftutils.translate import translate
+
+
+class _CommandPad(gui_base_original.Creator):
+    """Gui command for the Line tool."""
+
+    def __init__(self):
+        # super(_CommandTrench, self).__init__()
+        gui_base_original.Creator.__init__(self)
+        self.path = None
+        self.obj = None
+
+    def GetResources(self):
+        """Set icon, menu and tooltip."""
+        return {'Pixmap': str(os.path.join(DirIcons, "pad.svg")),
+                'MenuText': QtCore.QT_TRANSLATE_NOOP("PVPlantPad", "Pad"),
+                'Accel': "C, P",
+                'ToolTip': QtCore.QT_TRANSLATE_NOOP("PVPlantPad",
+                                                    "Creates a Pad object from setup dialog.")}
+
+    def Activated(self, name=translate("draft", "Line")):
+        """Execute when the command is called."""
+
+        sel = FreeCADGui.Selection.getSelection()
+        base = None
+        needbase = True
+        if len(sel) > 0:
+            needbase = False
+            base = sel[0]
+        self.obj = makePad(base)
+
+        if needbase:
+            gui_base_original.Creator.Activated(self, name=translate("draft", "Line"))
+            self.ui.wireUi(name)
+            self.ui.setTitle("Pad")
+            #self.obj = self.doc.addObject("Part::Feature", self.featureName)
+            #gui_utils.format_object(self.obj)
+            self.call = self.view.addEventCallback("SoEvent", self.action)
+
+    def action(self, arg):
+        """Handle the 3D scene events.
+
+        This is installed as an EventCallback in the Inventor view.
+
+        Parameters
+        ----------
+        arg: dict
+            Dictionary with strings that indicates the type of event received
+            from the 3D view.
+        """
+
+        print(self.obj)
+        if arg["Type"] == "SoKeyboardEvent" and arg["Key"] == "ESCAPE":
+            self.finish()
+            FreeCAD.ActiveDocument.removeObject(self.obj.Name)
+
+        elif arg["Type"] == "SoLocation2Event":
+            self.point, ctrlPoint, self.info = gui_tool_utils.getPoint(self, arg)
+            gui_tool_utils.redraw3DView()
+            self.obj.Placement.Base = FreeCAD.Vector(self.info["x"], self.info["y"], self.info["z"])
+
+        elif (arg["Type"] == "SoMouseButtonEvent"
+              and arg["State"] == "DOWN"
+              and arg["Button"] == "BUTTON1"):
+
+            gui_tool_utils.getSupport(arg)
+            self.point, ctrlPoint, self.info = gui_tool_utils.getPoint(self, arg)
+
+            if self.point:
+                self.point = FreeCAD.Vector(self.info["x"], self.info["y"], self.info["z"])
+                self.ui.redraw()
+                self.obj.Placement.Base = FreeCAD.Vector(self.info["x"], self.info["y"], self.info["z"])
+                self.finish()
+                FreeCAD.ActiveDocument.recompute()
+
+    def finish(self, closed=False, cont=False):
+        """Terminate the operation and close the polyline if asked.
+
+        Parameters
+        ----------
+        closed: bool, optional
+            Close the line if `True`.
+        """
+
+        # super(_CommandTrench, self).finish()
+        gui_base_original.Creator.finish(self)
+        if self.ui and self.ui.continueMode:
+            self.Activated()
+
+if FreeCAD.GuiUp:
+    FreeCADGui.addCommand('PVPlantPad', _CommandPad())

PVPlantPlacement.ui

@@ -0,0 +1,519 @@
+<?xml version="1.0" encoding="UTF-8"?>
+<ui version="4.0">
+ <author>Javier Braña</author>
+ <class>Form</class>
+ <widget class="QWidget" name="Form">
+  <property name="geometry">
+   <rect>
+    <x>0</x>
+    <y>0</y>
+    <width>388</width>
+    <height>576</height>
+   </rect>
+  </property>
+  <property name="windowTitle">
+   <string>Park Settings</string>
+  </property>
+  <layout class="QGridLayout" name="gridLayout">
+   <item row="6" column="0" colspan="3">
+    <widget class="QGroupBox" name="groupCorridor">
+     <property name="title">
+      <string>Corridor settings</string>
+     </property>
+     <property name="flat">
+      <bool>false</bool>
+     </property>
+     <property name="checkable">
+      <bool>true</bool>
+     </property>
+     <property name="checked">
+      <bool>false</bool>
+     </property>
+     <layout class="QGridLayout" name="gridLayout_3">
+      <item row="2" column="0">
+       <widget class="QLabel" name="label_16">
+        <property name="maximumSize">
+         <size>
+          <width>120</width>
+          <height>16777215</height>
+         </size>
+        </property>
+        <property name="text">
+         <string>Row amount</string>
+        </property>
+       </widget>
+      </item>
+      <item row="3" column="0">
+       <widget class="QLabel" name="label_17">
+        <property name="maximumSize">
+         <size>
+          <width>120</width>
+          <height>16777215</height>
+         </size>
+        </property>
+        <property name="text">
+         <string>Vertical distance</string>
+        </property>
+       </widget>
+      </item>
+      <item row="3" column="1">
+       <widget class="QDoubleSpinBox" name="editRowGap">
+        <property name="alignment">
+         <set>Qt::AlignRight|Qt::AlignTrailing|Qt::AlignVCenter</set>
+        </property>
+        <property name="buttonSymbols">
+         <enum>QAbstractSpinBox::NoButtons</enum>
+        </property>
+        <property name="prefix">
+         <string/>
+        </property>
+        <property name="suffix">
+         <string> m</string>
+        </property>
+        <property name="decimals">
+         <number>3</number>
+        </property>
+        <property name="maximum">
+         <double>100.000000000000000</double>
+        </property>
+        <property name="value">
+         <double>4.000000000000000</double>
+        </property>
+       </widget>
+      </item>
+      <item row="0" column="0">
+       <widget class="QLabel" name="label_14">
+        <property name="maximumSize">
+         <size>
+          <width>120</width>
+          <height>16777215</height>
+         </size>
+        </property>
+        <property name="text">
+         <string>Column amount</string>
+        </property>
+       </widget>
+      </item>
+      <item row="1" column="0">
+       <widget class="QLabel" name="label_15">
+        <property name="maximumSize">
+         <size>
+          <width>120</width>
+          <height>16777215</height>
+         </size>
+        </property>
+        <property name="text">
+         <string>Horizontal distance</string>
+        </property>
+       </widget>
+      </item>
+      <item row="1" column="1">
+       <widget class="QDoubleSpinBox" name="editColGap">
+        <property name="alignment">
+         <set>Qt::AlignRight|Qt::AlignTrailing|Qt::AlignVCenter</set>
+        </property>
+        <property name="buttonSymbols">
+         <enum>QAbstractSpinBox::NoButtons</enum>
+        </property>
+        <property name="prefix">
+         <string/>
+        </property>
+        <property name="suffix">
+         <string> m</string>
+        </property>
+        <property name="decimals">
+         <number>3</number>
+        </property>
+        <property name="maximum">
+         <double>100.000000000000000</double>
+        </property>
+        <property name="value">
+         <double>4.000000000000000</double>
+        </property>
+       </widget>
+      </item>
+      <item row="2" column="1">
+       <widget class="QSpinBox" name="editRowCount">
+        <property name="alignment">
+         <set>Qt::AlignRight|Qt::AlignTrailing|Qt::AlignVCenter</set>
+        </property>
+        <property name="buttonSymbols">
+         <enum>QAbstractSpinBox::NoButtons</enum>
+        </property>
+        <property name="value">
+         <number>4</number>
+        </property>
+       </widget>
+      </item>
+      <item row="0" column="1">
+       <widget class="QSpinBox" name="editColCount">
+        <property name="alignment">
+         <set>Qt::AlignRight|Qt::AlignTrailing|Qt::AlignVCenter</set>
+        </property>
+        <property name="buttonSymbols">
+         <enum>QAbstractSpinBox::NoButtons</enum>
+        </property>
+        <property name="value">
+         <number>8</number>
+        </property>
+       </widget>
+      </item>
+     </layout>
+    </widget>
+   </item>
+   <item row="1" column="2">
+    <widget class="QPushButton" name="buttonPVArea">
+     <property name="text">
+      <string>Add</string>
+     </property>
+    </widget>
+   </item>
+   <item row="0" column="2">
+    <widget class="QWidget" name="widget_2" native="true">
+     <layout class="QVBoxLayout" name="verticalLayout_2">
+      <property name="leftMargin">
+       <number>0</number>
+      </property>
+      <property name="topMargin">
+       <number>0</number>
+      </property>
+      <property name="rightMargin">
+       <number>0</number>
+      </property>
+      <property name="bottomMargin">
+       <number>0</number>
+      </property>
+      <item>
+       <widget class="QPushButton" name="buttonAddFrame">
+        <property name="text">
+         <string>Add</string>
+        </property>
+       </widget>
+      </item>
+      <item>
+       <widget class="QPushButton" name="buttonRemoveFrame">
+        <property name="text">
+         <string>Remove</string>
+        </property>
+       </widget>
+      </item>
+     </layout>
+    </widget>
+   </item>
+   <item row="1" column="0">
+    <widget class="QLabel" name="label">
+     <property name="text">
+      <string>Area:</string>
+     </property>
+    </widget>
+   </item>
+   <item row="7" column="1">
+    <spacer name="verticalSpacer">
+     <property name="orientation">
+      <enum>Qt::Vertical</enum>
+     </property>
+     <property name="sizeHint" stdset="0">
+      <size>
+       <width>20</width>
+       <height>40</height>
+      </size>
+     </property>
+    </spacer>
+   </item>
+   <item row="1" column="1">
+    <widget class="QLineEdit" name="editPVArea"/>
+   </item>
+   <item row="5" column="0" colspan="3">
+    <widget class="QGroupBox" name="groupBox">
+     <property name="title">
+      <string>Configuración</string>
+     </property>
+     <layout class="QGridLayout" name="gridLayout_2">
+      <property name="horizontalSpacing">
+       <number>10</number>
+      </property>
+      <property name="verticalSpacing">
+       <number>6</number>
+      </property>
+      <item row="8" column="0">
+       <widget class="QLabel" name="label_9">
+        <property name="maximumSize">
+         <size>
+          <width>120</width>
+          <height>16777215</height>
+         </size>
+        </property>
+        <property name="text">
+         <string>Offset Vertical</string>
+        </property>
+       </widget>
+      </item>
+      <item row="0" column="0">
+       <widget class="QLabel" name="label_4">
+        <property name="maximumSize">
+         <size>
+          <width>120</width>
+          <height>16777215</height>
+         </size>
+        </property>
+        <property name="text">
+         <string>Orientación</string>
+        </property>
+       </widget>
+      </item>
+      <item row="9" column="1">
+       <widget class="QCheckBox" name="cbAlignFrames">
+        <property name="text">
+         <string>Alinear estructuras</string>
+        </property>
+        <property name="checked">
+         <bool>true</bool>
+        </property>
+       </widget>
+      </item>
+      <item row="4" column="0">
+       <widget class="QLabel" name="label_5">
+        <property name="maximumSize">
+         <size>
+          <width>120</width>
+          <height>16777215</height>
+         </size>
+        </property>
+        <property name="text">
+         <string>Espacio entre filas</string>
+        </property>
+       </widget>
+      </item>
+      <item row="5" column="0">
+       <widget class="QLabel" name="label_2">
+        <property name="maximumSize">
+         <size>
+          <width>120</width>
+          <height>16777215</height>
+         </size>
+        </property>
+        <property name="text">
+         <string>Dirección Horizontal</string>
+        </property>
+       </widget>
+      </item>
+      <item row="7" column="0">
+       <widget class="QLabel" name="label_7">
+        <property name="maximumSize">
+         <size>
+          <width>120</width>
+          <height>16777215</height>
+         </size>
+        </property>
+        <property name="text">
+         <string>Offset Horizontal</string>
+        </property>
+       </widget>
+      </item>
+      <item row="3" column="0">
+       <widget class="QLabel" name="label_6">
+        <property name="maximumSize">
+         <size>
+          <width>120</width>
+          <height>16777215</height>
+         </size>
+        </property>
+        <property name="text">
+         <string>Pitch</string>
+        </property>
+       </widget>
+      </item>
+      <item row="6" column="0">
+       <widget class="QLabel" name="label_11">
+        <property name="maximumSize">
+         <size>
+          <width>120</width>
+          <height>16777215</height>
+         </size>
+        </property>
+        <property name="text">
+         <string>Dirección Vertical</string>
+        </property>
+       </widget>
+      </item>
+      <item row="0" column="1">
+       <widget class="QComboBox" name="comboOrientation">
+        <item>
+         <property name="text">
+          <string>Norte - Sur</string>
+         </property>
+        </item>
+        <item>
+         <property name="text">
+          <string>Este - Oeste</string>
+         </property>
+        </item>
+       </widget>
+      </item>
+      <item row="3" column="1">
+       <widget class="QDoubleSpinBox" name="editGapCols">
+        <property name="alignment">
+         <set>Qt::AlignRight|Qt::AlignTrailing|Qt::AlignVCenter</set>
+        </property>
+        <property name="buttonSymbols">
+         <enum>QAbstractSpinBox::NoButtons</enum>
+        </property>
+        <property name="suffix">
+         <string> m</string>
+        </property>
+        <property name="decimals">
+         <number>3</number>
+        </property>
+        <property name="maximum">
+         <double>100.000000000000000</double>
+        </property>
+        <property name="value">
+         <double>5.000000000000000</double>
+        </property>
+       </widget>
+      </item>
+      <item row="5" column="1">
+       <widget class="QComboBox" name="comboDirH">
+        <item>
+         <property name="text">
+          <string>De izquierda a derecha</string>
+         </property>
+        </item>
+        <item>
+         <property name="text">
+          <string>De derecha a izquiera</string>
+         </property>
+        </item>
+        <item>
+         <property name="text">
+          <string>De centro a los lados</string>
+         </property>
+        </item>
+       </widget>
+      </item>
+      <item row="6" column="1">
+       <widget class="QComboBox" name="comboDirV">
+        <item>
+         <property name="text">
+          <string>De arriba a abajo</string>
+         </property>
+        </item>
+        <item>
+         <property name="text">
+          <string>De abajo a arriba</string>
+         </property>
+        </item>
+        <item>
+         <property name="text">
+          <string>Del centro a los lados</string>
+         </property>
+        </item>
+       </widget>
+      </item>
+      <item row="7" column="1">
+       <widget class="QDoubleSpinBox" name="editOffsetHorizontal">
+        <property name="alignment">
+         <set>Qt::AlignRight|Qt::AlignTrailing|Qt::AlignVCenter</set>
+        </property>
+        <property name="buttonSymbols">
+         <enum>QAbstractSpinBox::NoButtons</enum>
+        </property>
+        <property name="suffix">
+         <string> m</string>
+        </property>
+        <property name="decimals">
+         <number>3</number>
+        </property>
+        <property name="minimum">
+         <double>-10000.000000000000000</double>
+        </property>
+        <property name="maximum">
+         <double>10000.000000000000000</double>
+        </property>
+       </widget>
+      </item>
+      <item row="8" column="1">
+       <widget class="QDoubleSpinBox" name="editOffsetVertical">
+        <property name="alignment">
+         <set>Qt::AlignRight|Qt::AlignTrailing|Qt::AlignVCenter</set>
+        </property>
+        <property name="buttonSymbols">
+         <enum>QAbstractSpinBox::NoButtons</enum>
+        </property>
+        <property name="suffix">
+         <string> m</string>
+        </property>
+        <property name="decimals">
+         <number>3</number>
+        </property>
+        <property name="minimum">
+         <double>-10000.000000000000000</double>
+        </property>
+        <property name="maximum">
+         <double>10000.000000000000000</double>
+        </property>
+       </widget>
+      </item>
+      <item row="4" column="1">
+       <widget class="QSpinBox" name="editGapRows">
+        <property name="alignment">
+         <set>Qt::AlignRight|Qt::AlignTrailing|Qt::AlignVCenter</set>
+        </property>
+        <property name="buttonSymbols">
+         <enum>QAbstractSpinBox::NoButtons</enum>
+        </property>
+        <property name="suffix">
+         <string> mm</string>
+        </property>
+        <property name="maximum">
+         <number>10000</number>
+        </property>
+        <property name="value">
+         <number>500</number>
+        </property>
+       </widget>
+      </item>
+     </layout>
+    </widget>
+   </item>
+   <item row="0" column="0" alignment="Qt::AlignTop">
+    <widget class="QLabel" name="label_3">
+     <property name="text">
+      <string>Estructura:</string>
+     </property>
+    </widget>
+   </item>
+   <item row="0" column="1">
+    <widget class="QListWidget" name="listFrameSetups">
+     <property name="maximumSize">
+      <size>
+       <width>16777215</width>
+       <height>54</height>
+      </size>
+     </property>
+    </widget>
+   </item>
+  </layout>
+ </widget>
+ <tabstops>
+  <tabstop>buttonAddFrame</tabstop>
+  <tabstop>buttonRemoveFrame</tabstop>
+  <tabstop>editPVArea</tabstop>
+  <tabstop>buttonPVArea</tabstop>
+  <tabstop>comboOrientation</tabstop>
+  <tabstop>editGapCols</tabstop>
+  <tabstop>editGapRows</tabstop>
+  <tabstop>comboDirH</tabstop>
+  <tabstop>comboDirV</tabstop>
+  <tabstop>editOffsetHorizontal</tabstop>
+  <tabstop>editOffsetVertical</tabstop>
+  <tabstop>cbAlignFrames</tabstop>
+  <tabstop>groupCorridor</tabstop>
+  <tabstop>editColCount</tabstop>
+  <tabstop>editColGap</tabstop>
+  <tabstop>editRowCount</tabstop>
+  <tabstop>editRowGap</tabstop>
+ </tabstops>
+ <resources/>
+ <connections/>
+</ui>

PVPlantPlacementAdjust.ui

@@ -0,0 +1,161 @@
+<?xml version="1.0" encoding="UTF-8"?>
+<ui version="4.0">
+ <author>Javier Braña</author>
+ <class>Form</class>
+ <widget class="QWidget" name="Form">
+  <property name="geometry">
+   <rect>
+    <x>0</x>
+    <y>0</y>
+    <width>310</width>
+    <height>210</height>
+   </rect>
+  </property>
+  <property name="windowTitle">
+   <string>Park Settings</string>
+  </property>
+  <layout class="QVBoxLayout" name="verticalLayout">
+   <item>
+    <widget class="QGroupBox" name="groupBox">
+     <property name="title">
+      <string>Configuración</string>
+     </property>
+     <layout class="QGridLayout" name="gridLayout_2">
+      <item row="3" column="1" colspan="2">
+       <widget class="QComboBox" name="comboDirH">
+        <item>
+         <property name="text">
+          <string>De izquierda a derecha</string>
+         </property>
+        </item>
+        <item>
+         <property name="text">
+          <string>De derecha a izquiera</string>
+         </property>
+        </item>
+        <item>
+         <property name="text">
+          <string>De centro a los lados</string>
+         </property>
+        </item>
+       </widget>
+      </item>
+      <item row="0" column="1" colspan="2">
+       <widget class="QComboBox" name="comboMethod">
+        <item>
+         <property name="text">
+          <string>Individual</string>
+         </property>
+        </item>
+        <item>
+         <property name="text">
+          <string>Conjunto</string>
+         </property>
+        </item>
+       </widget>
+      </item>
+      <item row="4" column="0">
+       <widget class="QLabel" name="label_11">
+        <property name="text">
+         <string>Dirección Vertical</string>
+        </property>
+       </widget>
+      </item>
+      <item row="3" column="0">
+       <widget class="QLabel" name="label_2">
+        <property name="text">
+         <string>Dirección Horizontal</string>
+        </property>
+       </widget>
+      </item>
+      <item row="0" column="0">
+       <widget class="QLabel" name="label_4">
+        <property name="text">
+         <string>Método:</string>
+        </property>
+       </widget>
+      </item>
+      <item row="4" column="1" colspan="2">
+       <widget class="QComboBox" name="comboDirV">
+        <item>
+         <property name="text">
+          <string>De arriba a abajo</string>
+         </property>
+        </item>
+        <item>
+         <property name="text">
+          <string>De abajo a arriba</string>
+         </property>
+        </item>
+        <item>
+         <property name="text">
+          <string>Del centro a los lados</string>
+         </property>
+        </item>
+       </widget>
+      </item>
+     </layout>
+    </widget>
+   </item>
+   <item>
+    <widget class="QGroupBox" name="groupBox_2">
+     <property name="title">
+      <string>GroupBox</string>
+     </property>
+     <layout class="QGridLayout" name="gridLayout">
+      <item row="1" column="1">
+       <widget class="QSpinBox" name="editStepSize">
+        <property name="alignment">
+         <set>Qt::AlignRight|Qt::AlignTrailing|Qt::AlignVCenter</set>
+        </property>
+        <property name="suffix">
+         <string> mm</string>
+        </property>
+        <property name="maximum">
+         <number>1000</number>
+        </property>
+        <property name="value">
+         <number>250</number>
+        </property>
+       </widget>
+      </item>
+      <item row="1" column="0">
+       <widget class="QLabel" name="label">
+        <property name="text">
+         <string>Escalón</string>
+        </property>
+       </widget>
+      </item>
+      <item row="0" column="0" colspan="2">
+       <widget class="QCheckBox" name="checkTrenck">
+        <property name="text">
+         <string>Ajustal a la media de la curva</string>
+        </property>
+       </widget>
+      </item>
+     </layout>
+    </widget>
+   </item>
+   <item>
+    <spacer name="verticalSpacer">
+     <property name="orientation">
+      <enum>Qt::Vertical</enum>
+     </property>
+     <property name="sizeHint" stdset="0">
+      <size>
+       <width>20</width>
+       <height>40</height>
+      </size>
+     </property>
+    </spacer>
+   </item>
+  </layout>
+ </widget>
+ <tabstops>
+  <tabstop>comboMethod</tabstop>
+  <tabstop>comboDirH</tabstop>
+  <tabstop>comboDirV</tabstop>
+ </tabstops>
+ <resources/>
+ <connections/>
+</ui>

PVPlantPlacementConvert.ui

@@ -0,0 +1,59 @@
+<?xml version="1.0" encoding="UTF-8"?>
+<ui version="4.0">
+ <class>Form</class>
+ <widget class="QWidget" name="Form">
+  <property name="geometry">
+   <rect>
+    <x>0</x>
+    <y>0</y>
+    <width>497</width>
+    <height>520</height>
+   </rect>
+  </property>
+  <property name="windowTitle">
+   <string>Convertir a...</string>
+  </property>
+  <layout class="QGridLayout" name="gridLayout">
+   <item row="1" column="2">
+    <widget class="QPushButton" name="buttonTo">
+     <property name="text">
+      <string>Sel</string>
+     </property>
+    </widget>
+   </item>
+   <item row="0" column="0" colspan="3">
+    <widget class="QLabel" name="label_3">
+     <property name="text">
+      <string>1. Primero seleccióna el objeto al que quieres transformar
+2. Selecciiona todos los objetos que quieres tansfomrar</string>
+     </property>
+    </widget>
+   </item>
+   <item row="4" column="1">
+    <spacer name="verticalSpacer">
+     <property name="orientation">
+      <enum>Qt::Vertical</enum>
+     </property>
+     <property name="sizeHint" stdset="0">
+      <size>
+       <width>20</width>
+       <height>40</height>
+      </size>
+     </property>
+    </spacer>
+   </item>
+   <item row="1" column="0">
+    <widget class="QLabel" name="label">
+     <property name="text">
+      <string>Objeto al que quieres transformar</string>
+     </property>
+    </widget>
+   </item>
+   <item row="1" column="1">
+    <widget class="QLineEdit" name="editTo"/>
+   </item>
+  </layout>
+ </widget>
+ <resources/>
+ <connections/>
+</ui>

PVPlantRackChecking.py

@@ -0,0 +1,93 @@
+# /**********************************************************************
+# *                                                                     *
+# * Copyright (c) 2021 Javier Braña <javier.branagutierrez@gmail.com>  *
+# *                                                                     *
+# * This program is free software; you can redistribute it and/or modify*
+# * it under the terms of the GNU Lesser General Public License (LGPL)  *
+# * as published by the Free Software Foundation; either version 2 of   *
+# * the License, or (at your option) any later version.                 *
+# * for detail see the LICENCE text file.                               *
+# *                                                                     *
+# * This program is distributed in the hope that it will be useful,     *
+# * but WITHOUT ANY WARRANTY; without even the implied warranty of      *
+# * MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE.  See the       *
+# * GNU Library General Public License for more details.                *
+# *                                                                     *
+# * You should have received a copy of the GNU Library General Public   *
+# * License along with this program; if not, write to the Free Software *
+# * Foundation, Inc., 59 Temple Place, Suite 330, Boston, MA  02111-1307*
+# * USA                                                                 *
+# *                                                                     *
+# ***********************************************************************
+
+import FreeCAD
+
+if FreeCAD.GuiUp:
+    import FreeCADGui
+
+else:
+    # \cond
+    def translate(ctxt, txt):
+        return txt
+
+    def QT_TRANSLATE_NOOP(ctxt, txt):
+        return txt
+    # \endcond
+
+__title__ = "PVPlant Frames"
+__author__ = "Javier Braña"
+__url__ = "http://www.sogos-solar.com"
+
+import os
+from PVPlantResources import DirIcons as DirIcons
+
+
+def checkSingleTracker(frame, val):
+    doc = FreeCAD.ActiveDocument
+    if val:
+        if frame.AngleY < doc.MaximumTiltNegative.Value:
+            frame.ViewObject.ShapeColor = doc.MaximumTiltNegativeColor
+        elif frame.AngleY > doc.MaximumTiltPositive.Value:
+            frame.ViewObject.ShapeColor = doc.MaximumTiltPositiveColor
+        else:
+            frame.ViewObject.ShapeColor = frame.Setup.ViewObject.ShapeColor
+    else:
+        frame.ViewObject.ShapeColor = frame.Setup.ViewObject.ShapeColor
+
+
+def checkTrackers(val):
+    from Utils.PVPlantUtils import findObjects
+    tlist = findObjects("Tracker")
+    for obj in tlist:
+        checkSingleTracker(obj, val)
+
+
+class CommandRackCheck:
+
+    def GetResources(self):
+        checked = False
+        if hasattr(FreeCAD.ActiveDocument, "FramesChecking"):
+            checked = FreeCAD.ActiveDocument.FramesChecking
+        return {'Pixmap': str(os.path.join(DirIcons, "checked.png")),
+                'MenuText': "Tracker slope checker",
+                'Accel': "R, C",
+                'ToolTip': "Tracker slope checker.",
+                'CmdType': "NoTransaction",
+                'Checkable': checked}
+
+    def IsActive(self):
+        return not FreeCAD.ActiveDocument is None
+
+    def Activated(self, val):
+        val = bool(val)
+        if not hasattr(FreeCAD.ActiveDocument, "FramesChecking"):
+            ''' Abrir dialogo '''
+        else:
+            FreeCAD.ActiveDocument.FramesChecking = val
+        checkTrackers(val)
+        return
+
+
+if FreeCAD.GuiUp:
+    FreeCADGui.addCommand('PVPlantRackCheck', CommandRackCheck())
+

PVPlantRackFixedPiling.ui

@@ -0,0 +1,274 @@
+<?xml version="1.0" encoding="UTF-8"?>
+<ui version="4.0">
+ <class>formRack</class>
+ <widget class="QDialog" name="formRack">
+  <property name="geometry">
+   <rect>
+    <x>0</x>
+    <y>0</y>
+    <width>363</width>
+    <height>596</height>
+   </rect>
+  </property>
+  <property name="windowTitle">
+   <string>Piling</string>
+  </property>
+  <layout class="QVBoxLayout" name="verticalLayout">
+   <item>
+    <widget class="QWidget" name="widget" native="true"/>
+   </item>
+   <item>
+    <widget class="QGroupBox" name="groupBreadthways">
+     <property name="sizePolicy">
+      <sizepolicy hsizetype="Preferred" vsizetype="Fixed">
+       <horstretch>0</horstretch>
+       <verstretch>0</verstretch>
+      </sizepolicy>
+     </property>
+     <property name="minimumSize">
+      <size>
+       <width>0</width>
+       <height>210</height>
+      </size>
+     </property>
+     <property name="title">
+      <string>Distancias a lo ancho</string>
+     </property>
+     <layout class="QGridLayout" name="gridLayout_2">
+      <item row="0" column="0">
+       <widget class="QLabel" name="label_2">
+        <property name="text">
+         <string>Número de postes:</string>
+        </property>
+       </widget>
+      </item>
+      <item row="0" column="1">
+       <widget class="QSpinBox" name="editBreadthwaysNumOfPost">
+        <property name="sizePolicy">
+         <sizepolicy hsizetype="Fixed" vsizetype="Fixed">
+          <horstretch>0</horstretch>
+          <verstretch>0</verstretch>
+         </sizepolicy>
+        </property>
+        <property name="minimum">
+         <number>2</number>
+        </property>
+        <property name="maximum">
+         <number>50</number>
+        </property>
+       </widget>
+      </item>
+      <item row="1" column="0" colspan="2">
+       <widget class="QTableWidget" name="tableBreadthwaysPosts">
+        <property name="horizontalScrollBarPolicy">
+         <enum>Qt::ScrollBarAlwaysOff</enum>
+        </property>
+        <property name="editTriggers">
+         <set>QAbstractItemView::AllEditTriggers</set>
+        </property>
+        <property name="cornerButtonEnabled">
+         <bool>false</bool>
+        </property>
+        <attribute name="verticalHeaderVisible">
+         <bool>false</bool>
+        </attribute>
+        <row>
+         <property name="text">
+          <string>1</string>
+         </property>
+        </row>
+        <row>
+         <property name="text">
+          <string>2</string>
+         </property>
+        </row>
+        <row>
+         <property name="text">
+          <string>3</string>
+         </property>
+        </row>
+        <column>
+         <property name="text">
+          <string>Tramo</string>
+         </property>
+        </column>
+        <column>
+         <property name="text">
+          <string>Distancia</string>
+         </property>
+        </column>
+        <item row="0" column="0">
+         <property name="text">
+          <string notr="true">Side - 1</string>
+         </property>
+         <property name="textAlignment">
+          <set>AlignCenter</set>
+         </property>
+         <property name="flags">
+          <set>NoItemFlags</set>
+         </property>
+        </item>
+        <item row="0" column="1">
+         <property name="text">
+          <string notr="true"/>
+         </property>
+         <property name="flags">
+          <set>ItemIsSelectable|ItemIsEditable|ItemIsEnabled</set>
+         </property>
+        </item>
+        <item row="1" column="0">
+         <property name="text">
+          <string>1 - 2</string>
+         </property>
+         <property name="textAlignment">
+          <set>AlignCenter</set>
+         </property>
+        </item>
+        <item row="2" column="0">
+         <property name="text">
+          <string>2 - Side</string>
+         </property>
+         <property name="textAlignment">
+          <set>AlignCenter</set>
+         </property>
+        </item>
+        <item row="2" column="1">
+         <property name="text">
+          <string/>
+         </property>
+         <property name="flags">
+          <set>NoItemFlags</set>
+         </property>
+        </item>
+       </widget>
+      </item>
+     </layout>
+    </widget>
+   </item>
+   <item>
+    <widget class="QGroupBox" name="groupAlong">
+     <property name="minimumSize">
+      <size>
+       <width>0</width>
+       <height>350</height>
+      </size>
+     </property>
+     <property name="title">
+      <string>Distancias a lo largo</string>
+     </property>
+     <layout class="QGridLayout" name="gridLayout">
+      <item row="0" column="0">
+       <widget class="QLabel" name="label">
+        <property name="text">
+         <string>Número de postes:</string>
+        </property>
+       </widget>
+      </item>
+      <item row="0" column="1">
+       <widget class="QSpinBox" name="editAlongNumOfPost">
+        <property name="sizePolicy">
+         <sizepolicy hsizetype="Fixed" vsizetype="Fixed">
+          <horstretch>0</horstretch>
+          <verstretch>0</verstretch>
+         </sizepolicy>
+        </property>
+        <property name="minimum">
+         <number>2</number>
+        </property>
+        <property name="maximum">
+         <number>50</number>
+        </property>
+       </widget>
+      </item>
+      <item row="1" column="0" colspan="2">
+       <widget class="QTableWidget" name="tableAlongPosts">
+        <property name="horizontalScrollBarPolicy">
+         <enum>Qt::ScrollBarAlwaysOff</enum>
+        </property>
+        <property name="editTriggers">
+         <set>QAbstractItemView::AllEditTriggers</set>
+        </property>
+        <property name="cornerButtonEnabled">
+         <bool>false</bool>
+        </property>
+        <attribute name="verticalHeaderVisible">
+         <bool>false</bool>
+        </attribute>
+        <row>
+         <property name="text">
+          <string>1</string>
+         </property>
+        </row>
+        <row>
+         <property name="text">
+          <string>2</string>
+         </property>
+        </row>
+        <row>
+         <property name="text">
+          <string>3</string>
+         </property>
+        </row>
+        <column>
+         <property name="text">
+          <string>Tramo</string>
+         </property>
+        </column>
+        <column>
+         <property name="text">
+          <string>Distancia</string>
+         </property>
+        </column>
+        <item row="0" column="0">
+         <property name="text">
+          <string notr="true">Side - 1</string>
+         </property>
+         <property name="textAlignment">
+          <set>AlignCenter</set>
+         </property>
+         <property name="flags">
+          <set>NoItemFlags</set>
+         </property>
+        </item>
+        <item row="0" column="1">
+         <property name="text">
+          <string notr="true"/>
+         </property>
+         <property name="flags">
+          <set>ItemIsSelectable|ItemIsEditable|ItemIsEnabled</set>
+         </property>
+        </item>
+        <item row="1" column="0">
+         <property name="text">
+          <string>1 - 2</string>
+         </property>
+         <property name="textAlignment">
+          <set>AlignCenter</set>
+         </property>
+        </item>
+        <item row="2" column="0">
+         <property name="text">
+          <string>2 - Side</string>
+         </property>
+         <property name="textAlignment">
+          <set>AlignCenter</set>
+         </property>
+        </item>
+        <item row="2" column="1">
+         <property name="text">
+          <string/>
+         </property>
+         <property name="flags">
+          <set>NoItemFlags</set>
+         </property>
+        </item>
+       </widget>
+      </item>
+     </layout>
+    </widget>
+   </item>
+  </layout>
+ </widget>
+ <resources/>
+ <connections/>
+</ui>

PVPlantResources.py

@@ -0,0 +1,11 @@
+import os
+
+import FreeCAD
+
+__dir__ = os.path.join(FreeCAD.getUserAppDataDir(), 'Mod', 'PVPlant')
+DirResources = os.path.join(__dir__, 'Resources')
+DirIcons = os.path.join(DirResources, 'Icons')
+DirImages = os.path.join(DirResources, 'Images')
+DirDocuments = os.path.join(DirResources, 'Documents')
+DirDDDDocuments = os.path.join(DirResources, '3dObjects')
+

PVPlantRoad.py

@@ -0,0 +1,616 @@
+import FreeCAD
+import ArchComponent
+
+if FreeCAD.GuiUp:
+    import FreeCADGui
+    from PySide import QtCore
+    from DraftTools import translate
+    from PySide.QtCore import QT_TRANSLATE_NOOP
+
+    import Part
+    import os
+else:
+    # \cond
+    def translate(ctxt, txt):
+        return txt
+
+    def QT_TRANSLATE_NOOP(ctxt, txt):
+        return txt
+    # \endcond
+
+__title__ = "PVPlant Road"
+__author__ = "Javier Braña"
+__url__ = "http://www.sogos-solar.com"
+
+import PVPlantResources
+from PVPlantResources import DirIcons as DirIcons
+
+
+def makeRoad(base=None):
+    obj = FreeCAD.ActiveDocument.addObject("Part::FeaturePython", "Road")
+    _Road(obj)
+    _ViewProviderRoad(obj.ViewObject)
+    obj.Base = base
+
+    from Project.Area import PVPlantArea
+    offset = PVPlantArea.makeOffsetArea(obj, 4000)
+    PVPlantArea.makeProhibitedArea(offset)
+    return obj
+
+
+class _Road(ArchComponent.Component):
+    def __init__(self, obj):
+        # Definición de Variables:
+        ArchComponent.Component.__init__(self, obj)
+        self.obj = obj
+        self.setProperties(obj)
+        self.Type = "Road"
+        obj.Proxy = self
+
+        self.route = False
+
+        obj.IfcType = "Civil Element"  ## puede ser: Cable Carrier Segment
+        obj.setEditorMode("IfcType", 1)
+
+
+        self.count = 0
+
+    def setProperties(self, obj):
+        # Definicion de Propiedades:
+        '''[
+        'App::PropertyBool',
+        'App::PropertyBoolList',
+        'App::PropertyFloat',
+        'App::PropertyFloatList',
+        'App::PropertyFloatConstraint',
+        'App::PropertyPrecision',
+        'App::PropertyQuantity',
+        'App::PropertyQuantityConstraint',
+        'App::PropertyAngle',
+        'App::PropertyDistance',
+        'App::PropertyLength',
+        'App::PropertyArea',
+        'App::PropertyVolume',
+        'App::PropertyFrequency',
+        'App::PropertySpeed',
+        'App::PropertyAcceleration',
+        'App::PropertyForce',
+        'App::PropertyPressure',
+        'App::PropertyVacuumPermittivity',
+        'App::PropertyInteger',
+        'App::PropertyIntegerConstraint',
+        'App::PropertyPercent',
+        'App::PropertyEnumeration',
+        'App::PropertyIntegerList',
+        'App::PropertyIntegerSet',
+        'App::PropertyMap',
+        'App::PropertyString',
+        'App::PropertyPersistentObject',
+        'App::PropertyUUID',
+        'App::PropertyFont',
+        'App::PropertyStringList',
+        'p::PropertyLink',
+        'App::PropertyLinkChild',
+        'App::PropertyLinkGlobal',
+        'App::PropertyLinkHidden',
+        'App::PropertyLinkSub',
+        'App::PropertyLinkSubChild',
+        'App::PropertyLinkSubGlobal',
+        'App::PropertyLinkSubHidden',
+        'App::PropertyLinkList',
+        'App::PropertyLinkListChild',
+        'App::PropertyLinkListGlobal',
+        'App::PropertyLinkListHidden',
+        'App::PropertyLinkSubList',
+        'App::PropertyLinkSubListChild',
+        'App::PropertyLinkSubListGlobal',
+        'App::PropertyLinkSubListHidden',
+        'App::PropertyXLink',
+        'App::PropertyXLinkSub',
+        'App::PropertyXLinkSubList',
+        'App::PropertyXLinkList',
+        'App::PropertyMatrix',
+        'App::PropertyVector',
+        'App::PropertyVectorDistance',
+        'App::PropertyPosition',
+        'App::PropertyDirection',
+        'App::PropertyVectorList',
+        'App::PropertyPlacement',
+        'App::PropertyPlacementList',
+        'App::PropertyPlacementLink',
+        'App::PropertyColor',
+        'App::PropertyColorList',
+        'App::PropertyMaterial',
+        'App::PropertyMaterialList',
+        'App::PropertyPath',
+        'App::PropertyFile',
+        'App::PropertyFileIncluded',
+        'App::PropertyPythonObject',
+        'App::PropertyExpressionEngine',
+        'Part::PropertyPartShape',
+        'Part::PropertyGeometryList',
+        'Part::PropertyShapeHistory',
+        'Part::PropertyFilletEdges',
+        'Mesh::PropertyNormalList',
+        'Mesh::PropertyCurvatureList',
+        'Mesh::PropertyMeshKernel',
+        'Sketcher::PropertyConstraintList'
+        ]'''
+
+        obj.addProperty("App::PropertyPercent",
+                        "SurfaceSlope",
+                        "Road",
+                        QT_TRANSLATE_NOOP("App::Property", "Connection")).SurfaceSlope = 2
+
+        obj.addProperty("App::PropertyPercent",
+                        "SurfaceDrainSlope",
+                        "Road",
+                        QT_TRANSLATE_NOOP("App::Property", "Connection")).SurfaceDrainSlope = int(3 / 2 * 100)
+
+        obj.addProperty("App::PropertyPercent",
+                        "SubbaseDrainSlope",
+                        "Road",
+                        QT_TRANSLATE_NOOP("App::Property", "Connection")).SubbaseDrainSlope = int(2 / 3 * 100)
+
+        obj.addProperty("App::PropertyLength",
+                        "Width",
+                        "Road",
+                        QT_TRANSLATE_NOOP("App::Property", "Connection")).Width = 4000
+
+        obj.addProperty("App::PropertyLength",
+                        "Height",
+                        "Road",
+                        QT_TRANSLATE_NOOP("App::Property", "Connection")).Height = 250
+
+        obj.addProperty("App::PropertyLength",
+                        "Subbase",
+                        "Road",
+                        QT_TRANSLATE_NOOP("App::Property", "Connection")).Subbase = 400
+
+    def onDocumentRestored(self, obj):
+        """Method run when the document is restored.
+        Re-adds the Arch component, and object properties."""
+
+        ArchComponent.Component.onDocumentRestored(self, obj)
+        self.obj = obj
+        self.Type = "Road"
+        obj.Proxy = self
+
+
+    def execute(self, obj):
+        import Part, math
+
+        w = obj.Base.Shape
+        profiles = []
+
+        SurfaceDrainSlope = obj.SurfaceDrainSlope / 100
+        SubbaseDrainSlope = obj.SubbaseDrainSlope / 100
+
+        vec_up_left = FreeCAD.Vector(-obj.Width.Value / 2, 0, obj.Height.Value)
+        vec_up_center = FreeCAD.Vector(0, 0, obj.SurfaceSlope * obj.Width.Value / 200 + obj.Height.Value)
+        vec_up_right = FreeCAD.Vector(obj.Width.Value / 2, 0, obj.Height.Value)
+
+        vec_down_left = FreeCAD.Vector(-(obj.Width.Value / 2 + obj.Height.Value / SurfaceDrainSlope), 0, 0)
+        vec_down_right = FreeCAD.Vector((obj.Width.Value / 2 + obj.Height.Value / SurfaceDrainSlope), 0, 0)
+
+        vec_sand_left = FreeCAD.Vector(-(obj.Width.Value / 2 + obj.Height.Value * (1 / SurfaceDrainSlope + SubbaseDrainSlope)), 0, - obj.Subbase.Value)
+        vec_sand_right = FreeCAD.Vector((obj.Width.Value / 2 + obj.Height.Value * (1 / SurfaceDrainSlope + SubbaseDrainSlope)), 0, - obj.Subbase.Value)
+
+        edge1 = Part.makeLine(vec_down_left, vec_down_right)
+        edge2 = Part.makeLine(vec_down_right, vec_up_right)
+        edge3 = Part.makeLine(vec_up_right, vec_up_center)
+        edge4 = Part.makeLine(vec_up_center, vec_up_left)
+        edge5 = Part.makeLine(vec_up_left, vec_down_left)
+
+        edge6 = Part.makeLine(vec_sand_left, vec_sand_right)
+        edge7 = Part.makeLine(vec_sand_left, vec_down_left)
+        edge8 = Part.makeLine(vec_sand_right, vec_down_right)
+
+        p = Part.Wire([edge1, edge2, edge3, edge4, edge5])
+        profiles.append(p)
+        p = Part.Wire([edge6, edge8, edge1, edge7])
+        profiles.append(p)
+        shapes = self.makeSolids(obj, profiles, w, (vec_down_right + vec_down_left) / 2)
+
+        angle = 30
+        height = FreeCAD.ActiveDocument.Site.Terrain.Shape.BoundBox.ZMax - obj.Height.Value
+        offset = height / math.tan(math.radians(angle))
+
+        '''cutProfile = Part.makePolygon([vec_sand_left, vec_sand_right, vec_sand_right + FreeCAD.Vector(offset, 0, FreeCAD.ActiveDocument.Site.Terrain.Shape.BoundBox.ZMax),
+                                       vec_sand_left + FreeCAD.Vector(-offset, 0, FreeCAD.ActiveDocument.Site.Terrain.Shape.BoundBox.ZMax), vec_sand_left])
+
+        height = obj.Height.Value - FreeCAD.ActiveDocument.Site.Terrain.Shape.BoundBox.ZMin
+        offset = height / math.tan(math.radians(angle))
+        fillProfile = Part.makePolygon([vec_sand_left, vec_sand_right, vec_sand_right + FreeCAD.Vector(offset, 0, FreeCAD.ActiveDocument.Site.Terrain.Shape.BoundBox.ZMin),
+                                       vec_sand_left + FreeCAD.Vector(-offset, 0, FreeCAD.ActiveDocument.Site.Terrain.Shape.BoundBox.ZMin), vec_sand_left])
+
+        cutshapes, fillshapes = self.makeSolids(obj, [cutProfile, fillProfile], w, (vec_up_right + vec_up_left) / 2)
+        cuts = self.calculateCut(obj, cutshapes)
+        fills = self.calculateFill(obj, fillshapes)
+        if cuts:
+            for cut in cuts:
+                Part.show(cut, "RoadCut")
+        if fills:
+            for fill in fills:
+                Part.show(fill, "RoadFill")'''
+
+        obj.Shape = Part.makeCompound(shapes)
+
+    def makeSolids(self, obj, profiles, w, origen):
+        import Draft
+        import DraftGeomUtils
+
+        shapes = []
+        for p in profiles:
+            if hasattr(p, "CenterOfMass"):
+                c = p.CenterOfMass
+            else:
+                c = p.BoundBox.Center
+            c = origen
+            delta = w.Vertexes[0].Point - c
+            p.translate(delta)
+
+            if Draft.getType(obj.Base) == "BezCurve":
+                v1 = obj.Base.Placement.multVec(obj.Base.Points[1]) - w.Vertexes[0].Point
+            else:
+                v1 = w.Vertexes[1].Point - w.Vertexes[0].Point
+            v2 = DraftGeomUtils.getNormal(p)
+            rot = FreeCAD.Rotation(v2, v1)
+            #p.rotate(w.Vertexes[0].Point, rot.Axis, math.degrees(rot.Angle))
+            ang = rot.toEuler()[0]
+            p.Placement.Rotation = FreeCAD.Rotation(FreeCAD.Vector(0, 0, 1), ang)
+
+            if p.Faces:
+                for f in p.Faces:
+                    sh = w.makePipeShell([f.OuterWire], True, False, 2)
+                    for shw in f.Wires:
+                        if shw.hashCode() != f.OuterWire.hashCode():
+                            sh2 = w.makePipeShell([shw], True, False, 2)
+                            sh = sh.cut(sh2)
+                    shapes.append(sh)
+            elif p.Wires:
+                for pw in p.Wires:
+                    sh = w.makePipeShell([pw], True, False, 2)
+                    shapes.append(sh)
+        return shapes
+
+    def calculateFill(self, obj, solid):
+        import BOPTools.SplitAPI as splitter
+        common = solid.common(FreeCAD.ActiveDocument.Site.Terrain.Shape)
+        if common.Area > 0:
+            sp = splitter.slice(solid, [common, ], "Split")
+            common.Placement.Base.z += 1
+            solids = []
+            for sol in sp.Solids:
+                common1 = sol.common(common)
+                if common1.Area > 0:
+                    solids.append(sol)
+            if len(solids) > 0:
+                return solids
+        return None
+
+    def calculateCut(self, obj, solid):
+        import BOPTools.SplitAPI as splitter
+        common = solid.common(FreeCAD.ActiveDocument.Site.Terrain.Shape)
+        if common.Area > 0:
+            sp = splitter.slice(solid, [common, ], "Split")
+            shells = []
+            commoncopy = common.copy()
+            commoncopy.Placement.Base.z -= 1
+            for sol in sp.Solids:
+                common1 = sol.common(commoncopy)
+                if common1.Area > 0:
+                    shell = sol.Shells[0]
+                    shell = shell.cut(common)
+                    shells.append(shell)
+            if len(shells) > 0:
+                return shells
+        return None
+
+    def makeLoft(self, profile):
+        return
+
+
+class _ViewProviderRoad(ArchComponent.ViewProviderComponent):
+    def __init__(self, vobj):
+        ArchComponent.ViewProviderComponent.__init__(self, vobj)
+
+    def getIcon(self):
+        return str(os.path.join(PVPlantResources.DirIcons, "road.svg"))
+
+class _RoadTaskPanel:
+
+    def __init__(self, obj=None):
+
+        if obj is None:
+            self.new = True
+            self.obj = makeRoad()
+        else:
+            self.new = False
+            self.obj = obj
+
+        self.form = FreeCADGui.PySideUic.loadUi(os.path.join(PVPlantResources.__dir__, "PVPlantRoad.ui"))
+
+    def accept(self):
+        FreeCADGui.Control.closeDialog()
+        return True
+
+    def reject(self):
+        FreeCAD.ActiveDocument.removeObject(self.obj.Name)
+        if self.new:
+            FreeCADGui.Control.closeDialog()
+        return True
+
+
+from PySide.QtCore import QT_TRANSLATE_NOOP
+
+import FreeCAD as App
+import FreeCADGui as Gui
+import DraftVecUtils
+import draftutils.utils as utils
+import draftutils.gui_utils as gui_utils
+import draftutils.todo as todo
+import draftguitools.gui_base_original as gui_base_original
+import draftguitools.gui_tool_utils as gui_tool_utils
+
+from draftutils.messages import _msg
+from draftutils.translate import translate
+
+
+class _CommandRoad(gui_base_original.Creator):
+    """Gui command for the Line tool."""
+
+    def __init__(self):
+        # super(_CommandRoad, self).__init__()
+        gui_base_original.Creator.__init__(self)
+        self.path = None
+
+    def GetResources(self):
+        """Set icon, menu and tooltip."""
+        return {'Pixmap': str(os.path.join(DirIcons, "road.svg")),
+                'MenuText': QtCore.QT_TRANSLATE_NOOP("PVPlantRoad", "Road"),
+                'Accel': "C, R",
+                'ToolTip': QtCore.QT_TRANSLATE_NOOP("PVPlantRoad",
+                                                    "Creates a Road object from setup dialog.")}
+
+    def Activated(self, name=translate("draft", "Line")):
+        """Execute when the command is called."""
+
+        gui_base_original.Creator.Activated(self, name=translate("draft", "Line"))
+
+        self.obj = None  # stores the temp shape
+        self.oldWP = None  # stores the WP if we modify it
+
+        sel = FreeCADGui.Selection.getSelection()
+
+        done = False
+        self.existing = []
+        if len(sel) > 0:
+            print("Crear una carretera a lo largo de un trayecto")
+            # TODO: chequear que el objeto seleccionado sea un "wire"
+            import Draft
+            if Draft.getType(sel[0]) == "Wire":
+                self.path = sel[0]
+                done = True
+
+        if not done:
+            self.ui.wireUi(name)
+            self.ui.setTitle("Road")
+            self.obj = self.doc.addObject("Part::Feature", self.featureName)
+            gui_utils.format_object(self.obj)
+
+            self.call = self.view.addEventCallback("SoEvent", self.action)
+            _msg(translate("draft", "Pick first point"))
+
+    def action(self, arg):
+        """Handle the 3D scene events.
+
+        This is installed as an EventCallback in the Inventor view.
+
+        Parameters
+        ----------
+        arg: dict
+            Dictionary with strings that indicates the type of event received
+            from the 3D view.
+        """
+        if arg["Type"] == "SoKeyboardEvent" and arg["Key"] == "ESCAPE":
+            self.finish()
+        elif arg["Type"] == "SoLocation2Event":
+            self.point, ctrlPoint, self.info = gui_tool_utils.getPoint(self, arg)
+            gui_tool_utils.redraw3DView()
+        elif (arg["Type"] == "SoMouseButtonEvent"
+              and arg["State"] == "DOWN"
+              and arg["Button"] == "BUTTON1"):
+            if arg["Position"] == self.pos:
+                return self.finish(False, cont=True)
+            if (not self.node) and (not self.support):
+                gui_tool_utils.getSupport(arg)
+                self.point, ctrlPoint, self.info = gui_tool_utils.getPoint(self, arg)
+
+            if self.point:
+                self.point = FreeCAD.Vector(self.info["x"], self.info["y"], self.info["z"])
+                self.ui.redraw()
+                self.pos = arg["Position"]
+                self.node.append(self.point)
+                self.drawSegment(self.point)
+                if len(self.node) > 2:
+                    # The wire is closed
+                    if (self.point - self.node[0]).Length < utils.tolerance():
+                        self.undolast()
+                        if len(self.node) > 2:
+                            self.finish(True, cont=True)
+                        else:
+                            self.finish(False, cont=True)
+
+    def finish(self, closed=False, cont=False):
+        """Terminate the operation and close the polyline if asked.
+
+        Parameters
+        ----------
+        closed: bool, optional
+            Close the line if `True`.
+        """
+        self.removeTemporaryObject()
+        if self.oldWP:
+            App.DraftWorkingPlane = self.oldWP
+            if hasattr(Gui, "Snapper"):
+                Gui.Snapper.setGrid()
+                Gui.Snapper.restack()
+        self.oldWP = None
+
+        if len(self.node) > 1:
+
+            if False:
+                Gui.addModule("Draft")
+                # The command to run is built as a series of text strings
+                # to be committed through the `draftutils.todo.ToDo` class.
+                if (len(self.node) == 2
+                        and utils.getParam("UsePartPrimitives", False)):
+                    # Insert a Part::Primitive object
+                    p1 = self.node[0]
+                    p2 = self.node[-1]
+
+                    _cmd = 'FreeCAD.ActiveDocument.'
+                    _cmd += 'addObject("Part::Line", "Line")'
+                    _cmd_list = ['line = ' + _cmd,
+                                 'line.X1 = ' + str(p1.x),
+                                 'line.Y1 = ' + str(p1.y),
+                                 'line.Z1 = ' + str(p1.z),
+                                 'line.X2 = ' + str(p2.x),
+                                 'line.Y2 = ' + str(p2.y),
+                                 'line.Z2 = ' + str(p2.z),
+                                 'Draft.autogroup(line)',
+                                 'FreeCAD.ActiveDocument.recompute()']
+                    self.commit(translate("draft", "Create Line"),
+                                _cmd_list)
+                else:
+                    # Insert a Draft line
+                    rot, sup, pts, fil = self.getStrings()
+
+                    _base = DraftVecUtils.toString(self.node[0])
+                    _cmd = 'Draft.makeWire'
+                    _cmd += '('
+                    _cmd += 'points, '
+                    _cmd += 'placement=pl, '
+                    _cmd += 'closed=' + str(closed) + ', '
+                    _cmd += 'face=' + fil + ', '
+                    _cmd += 'support=' + sup
+                    _cmd += ')'
+                    _cmd_list = ['pl = FreeCAD.Placement()',
+                                 'pl.Rotation.Q = ' + rot,
+                                 'pl.Base = ' + _base,
+                                 'points = ' + pts,
+                                 'line = ' + _cmd,
+                                 'Draft.autogroup(line)',
+                                 'FreeCAD.ActiveDocument.recompute()']
+                    self.commit(translate("draft", "Create Wire"),
+                                _cmd_list)
+            else:
+                import Draft
+                self.path = Draft.makeWire(self.node, closed=False, face=False)
+
+        # super(_CommandRoad, self).finish()
+        gui_base_original.Creator.finish(self)
+        if self.ui and self.ui.continueMode:
+            self.Activated()
+
+        self.makeRoad()
+
+    def makeRoad(self):
+        makeRoad(self.path)
+
+    def removeTemporaryObject(self):
+        """Remove temporary object created."""
+        if self.obj:
+            try:
+                old = self.obj.Name
+            except ReferenceError:
+                # object already deleted, for some reason
+                pass
+            else:
+                todo.ToDo.delay(self.doc.removeObject, old)
+        self.obj = None
+
+    def undolast(self):
+        """Undoes last line segment."""
+        import Part
+        if len(self.node) > 1:
+            self.node.pop()
+            # last = self.node[-1]
+            if self.obj.Shape.Edges:
+                edges = self.obj.Shape.Edges
+                if len(edges) > 1:
+                    newshape = Part.makePolygon(self.node)
+                    self.obj.Shape = newshape
+                else:
+                    self.obj.ViewObject.hide()
+                # DNC: report on removal
+                # _msg(translate("draft", "Removing last point"))
+                _msg(translate("draft", "Pick next point"))
+
+    def drawSegment(self, point):
+        """Draws new line segment."""
+        import Part
+        if self.planetrack and self.node:
+            self.planetrack.set(self.node[-1])
+        if len(self.node) == 1:
+            _msg(translate("draft", "Pick next point"))
+        elif len(self.node) == 2:
+            last = self.node[len(self.node) - 2]
+            newseg = Part.LineSegment(last, point).toShape()
+            self.obj.Shape = newseg
+            self.obj.ViewObject.Visibility = True
+            _msg(translate("draft", "Pick next point"))
+        else:
+            currentshape = self.obj.Shape.copy()
+            last = self.node[len(self.node) - 2]
+            if not DraftVecUtils.equals(last, point):
+                newseg = Part.LineSegment(last, point).toShape()
+                newshape = currentshape.fuse(newseg)
+                self.obj.Shape = newshape
+            _msg(translate("draft", "Pick next point"))
+
+    def wipe(self):
+        """Remove all previous segments and starts from last point."""
+        if len(self.node) > 1:
+            # self.obj.Shape.nullify()  # For some reason this fails
+            self.obj.ViewObject.Visibility = False
+            self.node = [self.node[-1]]
+            if self.planetrack:
+                self.planetrack.set(self.node[0])
+            _msg(translate("draft", "Pick next point"))
+
+    def orientWP(self):
+        """Orient the working plane."""
+        import DraftGeomUtils
+        if hasattr(App, "DraftWorkingPlane"):
+            if len(self.node) > 1 and self.obj:
+                n = DraftGeomUtils.getNormal(self.obj.Shape)
+                if not n:
+                    n = App.DraftWorkingPlane.axis
+                p = self.node[-1]
+                v = self.node[-2].sub(self.node[-1])
+                v = v.negative()
+                if not self.oldWP:
+                    self.oldWP = App.DraftWorkingPlane.copy()
+                App.DraftWorkingPlane.alignToPointAndAxis(p, n, upvec=v)
+                if hasattr(Gui, "Snapper"):
+                    Gui.Snapper.setGrid()
+                    Gui.Snapper.restack()
+                if self.planetrack:
+                    self.planetrack.set(self.node[-1])
+
+    def numericInput(self, numx, numy, numz):
+        """Validate the entry fields in the user interface.
+
+        This function is called by the toolbar or taskpanel interface
+        when valid x, y, and z have been entered in the input fields.
+        """
+        self.point = App.Vector(numx, numy, numz)
+        self.node.append(self.point)
+        self.drawSegment(self.point)
+        self.ui.setNextFocus()
+
+
+if FreeCAD.GuiUp:
+    FreeCADGui.addCommand('PVPlantRoad', _CommandRoad())

PVPlantSetMatrixManual.ui

@@ -0,0 +1,105 @@
+<?xml version="1.0" encoding="UTF-8"?>
+<ui version="4.0">
+ <author>Javier Braña</author>
+ <class>Form</class>
+ <widget class="QWidget" name="Form">
+  <property name="geometry">
+   <rect>
+    <x>0</x>
+    <y>0</y>
+    <width>466</width>
+    <height>568</height>
+   </rect>
+  </property>
+  <property name="windowTitle">
+   <string>Park Settings</string>
+  </property>
+  <layout class="QVBoxLayout" name="verticalLayout_3">
+   <item>
+    <widget class="QGroupBox" name="groupBox">
+     <property name="title">
+      <string>Columnas:</string>
+     </property>
+     <layout class="QVBoxLayout" name="verticalLayout">
+      <item>
+       <widget class="QWidget" name="widget" native="true">
+        <layout class="QHBoxLayout" name="horizontalLayout">
+         <item>
+          <widget class="QPushButton" name="buttonFrame">
+           <property name="text">
+            <string>Detectar columnas automáticamente</string>
+           </property>
+          </widget>
+         </item>
+        </layout>
+       </widget>
+      </item>
+      <item>
+       <widget class="QLabel" name="label_4">
+        <property name="text">
+         <string>Columnas:</string>
+        </property>
+       </widget>
+      </item>
+      <item>
+       <widget class="QWidget" name="widget_2" native="true">
+        <layout class="QHBoxLayout" name="horizontalLayout_2">
+         <item>
+          <widget class="QListWidget" name="listWidget"/>
+         </item>
+         <item alignment="Qt::AlignHCenter|Qt::AlignVCenter">
+          <widget class="QWidget" name="widget_3" native="true">
+           <layout class="QVBoxLayout" name="verticalLayout_2">
+            <item>
+             <widget class="QPushButton" name="pushButton_2">
+              <property name="text">
+               <string>up</string>
+              </property>
+             </widget>
+            </item>
+            <item>
+             <widget class="QPushButton" name="pushButton">
+              <property name="text">
+               <string>down</string>
+              </property>
+             </widget>
+            </item>
+           </layout>
+          </widget>
+         </item>
+        </layout>
+       </widget>
+      </item>
+     </layout>
+    </widget>
+   </item>
+   <item>
+    <widget class="QGroupBox" name="groupBox_2">
+     <property name="title">
+      <string>Filas</string>
+     </property>
+     <layout class="QVBoxLayout" name="verticalLayout_4">
+      <item>
+       <widget class="QListWidget" name="listWidget_2"/>
+      </item>
+     </layout>
+    </widget>
+   </item>
+   <item>
+    <spacer name="verticalSpacer">
+     <property name="orientation">
+      <enum>Qt::Vertical</enum>
+     </property>
+     <property name="sizeHint" stdset="0">
+      <size>
+       <width>20</width>
+       <height>40</height>
+      </size>
+     </property>
+    </spacer>
+   </item>
+  </layout>
+ </widget>
+ <resources/>
+ <connections/>
+</ui>

PVPlantStringSetup.ui

@@ -0,0 +1,212 @@
+<?xml version="1.0" encoding="UTF-8"?>
+<ui version="4.0">
+ <class>form</class>
+ <widget class="QDialog" name="form">
+  <property name="geometry">
+   <rect>
+    <x>0</x>
+    <y>0</y>
+    <width>470</width>
+    <height>478</height>
+   </rect>
+  </property>
+  <property name="windowTitle">
+   <string>Terrain Analisys</string>
+  </property>
+  <layout class="QVBoxLayout" name="verticalLayout">
+   <property name="leftMargin">
+    <number>0</number>
+   </property>
+   <property name="topMargin">
+    <number>0</number>
+   </property>
+   <property name="rightMargin">
+    <number>0</number>
+   </property>
+   <property name="bottomMargin">
+    <number>0</number>
+   </property>
+   <item>
+    <widget class="QWidget" name="widget" native="true">
+     <layout class="QGridLayout" name="gridLayout">
+      <property name="horizontalSpacing">
+       <number>10</number>
+      </property>
+      <property name="verticalSpacing">
+       <number>5</number>
+      </property>
+      <item row="0" column="1">
+       <widget class="QLineEdit" name="editFrame">
+        <property name="readOnly">
+         <bool>true</bool>
+        </property>
+       </widget>
+      </item>
+      <item row="0" column="2">
+       <widget class="QPushButton" name="buttonSelFrame">
+        <property name="text">
+         <string>sel</string>
+        </property>
+       </widget>
+      </item>
+      <item row="2" column="0" colspan="3">
+       <widget class="QGroupBox" name="groupBox_2">
+        <property name="title">
+         <string>Frame information: </string>
+        </property>
+        <layout class="QGridLayout" name="gridLayout_3">
+         <property name="leftMargin">
+          <number>9</number>
+         </property>
+         <property name="topMargin">
+          <number>9</number>
+         </property>
+         <property name="rightMargin">
+          <number>9</number>
+         </property>
+         <property name="bottomMargin">
+          <number>9</number>
+         </property>
+         <property name="spacing">
+          <number>5</number>
+         </property>
+         <item row="1" column="3">
+          <widget class="QLineEdit" name="editLeft">
+           <property name="alignment">
+            <set>Qt::AlignRight|Qt::AlignTrailing|Qt::AlignVCenter</set>
+           </property>
+           <property name="readOnly">
+            <bool>true</bool>
+           </property>
+          </widget>
+         </item>
+         <item row="2" column="0" colspan="2">
+          <widget class="QListWidget" name="listStrings"/>
+         </item>
+         <item row="3" column="0" colspan="2">
+          <widget class="QWidget" name="widget_2" native="true">
+           <layout class="QHBoxLayout" name="horizontalLayout">
+            <property name="spacing">
+             <number>5</number>
+            </property>
+            <property name="leftMargin">
+             <number>0</number>
+            </property>
+            <property name="topMargin">
+             <number>0</number>
+            </property>
+            <property name="rightMargin">
+             <number>0</number>
+            </property>
+            <property name="bottomMargin">
+             <number>0</number>
+            </property>
+            <item>
+             <widget class="QPushButton" name="buttonAddString">
+              <property name="text">
+               <string>Add String</string>
+              </property>
+             </widget>
+            </item>
+            <item>
+             <widget class="QPushButton" name="pushButton">
+              <property name="text">
+               <string>Delete String</string>
+              </property>
+             </widget>
+            </item>
+           </layout>
+          </widget>
+         </item>
+         <item row="2" column="2" rowspan="2" colspan="2">
+          <widget class="QListWidget" name="listModules"/>
+         </item>
+         <item row="1" column="1">
+          <widget class="QLineEdit" name="editTotal">
+           <property name="alignment">
+            <set>Qt::AlignRight|Qt::AlignTrailing|Qt::AlignVCenter</set>
+           </property>
+           <property name="readOnly">
+            <bool>true</bool>
+           </property>
+          </widget>
+         </item>
+         <item row="1" column="2">
+          <widget class="QLineEdit" name="editUsed">
+           <property name="alignment">
+            <set>Qt::AlignRight|Qt::AlignTrailing|Qt::AlignVCenter</set>
+           </property>
+           <property name="readOnly">
+            <bool>true</bool>
+           </property>
+          </widget>
+         </item>
+         <item row="0" column="1">
+          <widget class="QLabel" name="label_5">
+           <property name="text">
+            <string>Totales</string>
+           </property>
+          </widget>
+         </item>
+         <item row="0" column="2">
+          <widget class="QLabel" name="label">
+           <property name="text">
+            <string>Usados</string>
+           </property>
+          </widget>
+         </item>
+         <item row="0" column="3">
+          <widget class="QLabel" name="label_2">
+           <property name="text">
+            <string>Restantes</string>
+           </property>
+          </widget>
+         </item>
+         <item row="1" column="0">
+          <widget class="QLabel" name="label_4">
+           <property name="text">
+            <string>Paneles:</string>
+           </property>
+          </widget>
+         </item>
+        </layout>
+       </widget>
+      </item>
+      <item row="3" column="0">
+       <spacer name="verticalSpacer">
+        <property name="orientation">
+         <enum>Qt::Vertical</enum>
+        </property>
+        <property name="sizeHint" stdset="0">
+         <size>
+          <width>20</width>
+          <height>40</height>
+         </size>
+        </property>
+       </spacer>
+      </item>
+      <item row="0" column="0">
+       <widget class="QLabel" name="label_3">
+        <property name="text">
+         <string>Frame type: </string>
+        </property>
+       </widget>
+      </item>
+      <item row="1" column="1">
+       <widget class="QLineEdit" name="editName"/>
+      </item>
+      <item row="1" column="0">
+       <widget class="QLabel" name="label_6">
+        <property name="text">
+         <string>String Name:</string>
+        </property>
+       </widget>
+      </item>
+     </layout>
+    </widget>
+   </item>
+  </layout>
+ </widget>
+ <resources/>
+ <connections/>
+</ui>

PVPlantStringing.py

@@ -0,0 +1,593 @@
+# /**********************************************************************
+# *                                                                     *
+# * Copyright (c) 2021 Javier Braña <javier.branagutierrez@gmail.com>  *
+# *                                                                     *
+# * This program is free software; you can redistribute it and/or modify*
+# * it under the terms of the GNU Lesser General Public License (LGPL)  *
+# * as published by the Free Software Foundation; either version 2 of   *
+# * the License, or (at your option) any later version.                 *
+# * for detail see the LICENCE text file.                               *
+# *                                                                     *
+# * This program is distributed in the hope that it will be useful,     *
+# * but WITHOUT ANY WARRANTY; without even the implied warranty of      *
+# * MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE.  See the       *
+# * GNU Library General Public License for more details.                *
+# *                                                                     *
+# * You should have received a copy of the GNU Library General Public   *
+# * License along with this program; if not, write to the Free Software *
+# * Foundation, Inc., 59 Temple Place, Suite 330, Boston, MA  02111-1307*
+# * USA                                                                 *
+# *                                                                     *
+# ***********************************************************************
+
+import math
+
+import ArchComponent
+import FreeCAD
+import Part
+
+if FreeCAD.GuiUp:
+    import FreeCADGui
+    from PySide import QtCore
+    from PySide.QtCore import QT_TRANSLATE_NOOP
+else:
+    # \cond
+    def translate(ctxt, txt):
+        return txt
+    def QT_TRANSLATE_NOOP(ctxt, txt):
+        return txt
+    # \endcond
+
+try:
+    _fromUtf8 = QtCore.QString.fromUtf8
+except AttributeError:
+    def _fromUtf8(s):
+        return s
+
+import os
+__dir__ = os.path.join(FreeCAD.getUserAppDataDir(), "Mod", "PVPlant")
+import PVPlantResources
+from PVPlantResources import DirIcons as DirIcons
+Dir3dObjects = os.path.join(PVPlantResources.DirResources, "3dObjects")
+
+def makeStringSetup():
+    obj = FreeCAD.ActiveDocument.addObject("Part::FeaturePython", "StringSetup")
+    _StringSetup(obj)
+    _ViewProviderStringSetup(obj.ViewObject)
+
+    try:
+        if FreeCAD.ActiveDocument.StringsSetup:
+            FreeCAD.ActiveDocument.StringsSetup.addObject(obj)
+    except:
+        pass
+    return obj
+
+class _StringSetup:
+    def __init__(self, obj):
+        self.setCommonProperties(obj)
+        self.obj = obj
+        self.StringCount = 1
+
+    def setCommonProperties(self, obj):
+        pl = obj.PropertiesList
+
+        if not ("NumberOfStrings" in pl):
+            obj.addProperty("App::PropertyInteger",
+                            "NumberOfStrings",
+                            "Setup",
+                            QT_TRANSLATE_NOOP("App::Property", "The height of this object")
+                            ).NumberOfStrings = 0
+            obj.setEditorMode("NumberOfStrings", 1)
+
+        self.Type = "StringSetup"
+        obj.Proxy = self
+
+    def onDocumentRestored(self, obj):
+        self.setProperties(obj)
+
+    def addString(self, modulelist):
+        stringName = "String" + str(self.StringCount)
+        self.obj.addProperty("App::PropertyIntegerList",
+                             stringName,
+                             "Setup",
+                             "String: " + stringName
+                             )
+        setattr(self.obj, stringName, modulelist)
+
+        '''
+        self.obj.addProperty("App::PropertyInteger",
+                             stringName + "_Power",
+                             "Outputs",
+                             QT_TRANSLATE_NOOP("App::Property", "The height of this object")
+                             )
+        setattr(self.obj, stringName + "_Power", len(modulelist) * 450)
+        '''
+        self.obj.NumberOfStrings = self.StringCount
+        self.StringCount += 1
+
+
+class _ViewProviderStringSetup:
+    def __init__(self, vobj):
+        '''
+        Set view properties.
+        '''
+        self.Object = vobj.Object
+        vobj.Proxy = self
+
+    def attach(self, vobj):
+        '''
+        Create Object visuals in 3D view.
+        '''
+        self.Object = vobj.Object
+        return
+
+    def getIcon(self):
+        '''
+        Return object treeview icon.
+        '''
+
+        return str(os.path.join(DirIcons, "stringsetup.svg"))
+    '''
+    def claimChildren(self):
+        """
+        Provides object grouping
+        """
+        return self.Object.Group
+    '''
+
+    def setEdit(self, vobj, mode=0):
+        """
+        Enable edit
+        """
+        return True
+
+    def unsetEdit(self, vobj, mode=0):
+        """
+        Disable edit
+        """
+        return False
+
+    def doubleClicked(self, vobj):
+        """
+        Detect double click
+        """
+        pass
+
+    def setupContextMenu(self, obj, menu):
+        """
+        Context menu construction
+        """
+        pass
+
+    def edit(self):
+        """
+        Edit callback
+        """
+        pass
+
+    def __getstate__(self):
+        """
+        Save variables to file.
+        """
+        return None
+
+    def __setstate__(self,state):
+        """
+        Get variables from file.
+        """
+        return None
+
+class _SelObserver:
+    def __init__(self, form):
+        self.form = form
+
+    def addSelection(self, doc, obj, sub, pnt):
+        rack = FreeCAD.ActiveDocument.getObjectsByLabel(obj)[0].Shape
+        modules = rack.SubShapes[0].SubShapes[0].SubShapes
+        if sub[0:4] == 'Face':
+            numFace = int(sub.replace('Face', '')) - 1
+            selFace = rack.Faces[numFace]
+            for module in modules:
+                for num, face in enumerate(module.Faces):
+                    if selFace.isSame(face):
+                        self.form.setModule(modules.index(module))
+                        FreeCADGui.Selection
+                        return True
+
+        elif sub[0:4] == 'Edge':
+            numEdge = int(sub.replace('Edge', '')) - 1
+            selEdge = rack.Edge[numEdge]
+            for module in modules:
+                for num, edge in enumerate(module.Edges):
+                    if selEdge.isSame(edge):
+                        print("Encontrado: ", modules.index(module))
+                        return True
+        return True
+
+    def removeSelection(self, doc, obj, sub):  # Delete the selected object
+        '''print("FSO-RemSel:" + str(obj) + ":" + str(sub) + "\n")'''
+        return True
+
+    def setSelection(self, doc):  # Selection in ComboView
+        '''print("FSO-SetSel:" + "\n")'''
+        return True
+
+    def clearSelection(self, doc):  # If click on the screen, clear the selection
+        '''print("FSO-ClrSel:" + "\n")'''
+        return True
+
+class _StringSetupPanel:
+    def __init__(self, obj=None):
+        self.obj = obj
+        self.new = False
+
+        if obj is None:
+            self.new = True
+            self.obj = makeStringSetup()
+
+        self.form = FreeCADGui.PySideUic.loadUi(__dir__ + "/PVPlantStringSetup.ui")
+        self.form.buttonSelFrame.clicked.connect(self.selFrame)
+        self.form.buttonAddString.clicked.connect(self.addString)
+        self.form.listStrings.currentRowChanged.connect(self.listStringsCurrentRowChanged)
+        self.form.editName.editingFinished.connect(self.setStringName)
+
+        self.selobserver = _SelObserver(self)
+        self.stringslist = []
+        self.currentstring = 0
+        self.totalModules = 0
+        self.left = 0
+
+        self.frameColor = None
+
+    def selFrame(self):
+        sel = FreeCADGui.Selection.getSelection()
+        frame = None
+        if len(sel) == 0:
+            # TODO: lanzar un error
+            return
+        elif len(sel) == 1:
+            frame = sel[0]
+        else:
+            for obj in sel:
+                if not hasattr(obj, 'Proxy'):
+                    continue
+                print(obj.Proxy.__class__)
+                print(issubclass(obj.Proxy.__class__, PVPlantRack._Frame))
+                if issubclass(obj.Proxy.__class__, PVPlantRack._Frame):
+                    frame = obj
+                    break
+
+        if frame == None:
+            # TODO: lanzar un error
+            print("No frame selected")
+            return
+
+        self.frame = frame
+        self.form.editFrame.setText(frame.Label)
+        self.totalModules = frame.ModuleCols * frame.ModuleRows
+        self.left = self.totalModules
+        self.form.editTotal.setText(str(int(self.totalModules)))
+        self.form.editUsed.setText("0")
+        self.form.editLeft.setText(str(int(self.left)))
+
+        FreeCADGui.Selection.removeObserver(self.selobserver)
+        FreeCADGui.Selection.addObserver(self.selobserver)
+
+        self.frameColor = self.obj.ViewObject.ShapeColor
+        self.colorlist = []
+        for face in self.frame.Shape.Faces:
+            self.colorlist.append((1.0, 0.50, 0.40, 0.25))
+        self.frame.ViewObject.DiffuseColor = self.colorlist
+
+    def addString(self):
+        FreeCADGui.Selection.clearSelection()
+        self.stringslist.append([])
+        self.currentstring = len(self.stringslist) - 1
+        self.form.listStrings.addItem("String" + str(self.form.listStrings.count()))
+        self.form.listStrings.setCurrentRow(self.form.listStrings.count() - 1)
+
+    def listStringsCurrentRowChanged(self, row):
+        self.currentstring = row
+        self.form.listModules.clear()
+        for num in self.stringslist[row]:
+            self.form.listModules.addItem(str(num))
+
+    def setModule(self, numModule):
+        if len(self.stringslist) == 0:
+            return
+
+        if self.left == 0:
+            return
+
+        if numModule in self.stringslist[self.currentstring]:
+            '''remove module ?? '''
+            self.stringslist[self.currentstring].remove(int(numModule))
+            item = self.form.listModules.findItems(str(numModule), QtCore.Qt.MatchExactly)[0]
+            self.form.listModules.takeItem(self.form.listModules.row(item))
+            for moduleFace in self.frame.Shape.Solids[numModule].Faces:
+                for i, face in enumerate(self.frame.Shape.Faces):
+                    if moduleFace.isEqual(face):
+                        self.colorlist[i] = (1.0, 0.50, 0.40, 0.25)
+                        self.frame.ViewObject.DiffuseColor = self.colorlist
+                        break
+        else:
+            self.stringslist[self.currentstring].append(int(numModule))
+            self.form.listModules.addItem(str(numModule))
+            for moduleFace in self.frame.Shape.Solids[numModule].Faces:
+                for i, face in enumerate(self.frame.Shape.Faces):
+                    if moduleFace.isEqual(face):
+                        self.colorlist[i] = (0.0, 0.0, 1.0, 0.0)
+                        self.frame.ViewObject.DiffuseColor = self.colorlist
+                        break
+
+        self.calculateModules()
+
+    def calculateModules(self):
+        num = 0
+        for string in self.stringslist:
+            num += len(string)
+
+        self.left = int(self.totalModules - num)
+        self.form.editUsed.setText(str(num))
+        self.form.editLeft.setText(str(self.left))
+
+    def setStringName(self):
+        self.obj.Label = self.form.editName.text()
+
+    def accept(self):
+        for string in self.stringslist:
+            self.obj.Proxy.addString(string.copy())
+        self.FormClosing()
+        return True
+
+    def reject(self):
+        FreeCAD.ActiveDocument.removeObject(self.obj.Name)
+        self.FormClosing()
+        return True
+
+    def FormClosing(self):
+        FreeCADGui.Selection.removeObserver(self.selobserver)
+        FreeCADGui.Control.closeDialog()
+        self.frame.ViewObject.DiffuseColor = self.frameColor
+
+def makeString(base=None):
+    if base is None:
+        return
+    obj = FreeCAD.ActiveDocument.addObject("Part::FeaturePython", "String")
+    _String(obj)
+    obj.Frame = base
+    _ViewProviderString(obj.ViewObject)
+
+    if FreeCAD.ActiveDocument.Strings:
+        FreeCAD.ActiveDocument.Strings.addObject(obj)
+
+    FreeCAD.ActiveDocument.recompute()
+    return obj
+
+class _String(ArchComponent.Component):
+    def __init__(self, obj):
+
+        ArchComponent.Component.__init__(self, obj)
+        self.setProperties(obj)
+
+        obj.Proxy = self
+        obj.IfcType = "Cable Segment"
+        obj.setEditorMode("IfcType", 1)
+
+    def setProperties(self, obj):
+
+        pl = obj.PropertiesList
+        if not ("Frame" in pl):
+            obj.addProperty("App::PropertyLink",
+                            "Frame",
+                            "Setup",
+                            QT_TRANSLATE_NOOP("App::Property", "The height of this object")
+                            ).Frame = None
+
+        if not ("StringSetup" in pl):
+            obj.addProperty("App::PropertyLink",
+                            "StringSetup",
+                            "Setup",
+                            QT_TRANSLATE_NOOP("App::Property", "The height of this object")
+                            ).StringSetup = None
+
+        if not ("StringPoles" in pl):
+            obj.addProperty("App::PropertyVectorList",
+                            "StringPoles",
+                            "StringOutput",
+                            QT_TRANSLATE_NOOP("App::Property", "The height of this object")
+                            ).StringPoles = []
+            obj.setEditorMode("StringPoles", 1)
+
+        self.Type = "String"
+
+    def onDocumentRestored(self, obj):
+        ArchComponent.Component.onDocumentRestored(self, obj)
+        self.setProperties(obj)
+        obj.Proxy = self
+
+    def __getstate__(self):
+        return self.Type
+
+    def __setstate__(self, state):
+        if state:
+            self.Type = state
+
+    def onBeforeChange(self, obj, prop):
+        ''''''
+
+    def onChanged(self, obj, prop):
+        '''Do something when a property has changed'''
+
+        def getDownFace(module):
+            area_max = max([face.Area for face in module.Faces])
+            faces = []
+            for face in module.Faces:
+                if face.Area == area_max:
+                    faces.append(face)
+            return faces[0] if faces[0].Placement.Base.z > faces[1].Placement.Base.z else faces[1]
+
+        if (prop == "Frame") or (prop == "StringSetup"):
+            if not (obj.Frame is None) and not (obj.StringSetup is None):
+                JuntionBoxPosition = 200
+                portrait = obj.Frame.ModuleOrientation == "Portrait"
+                cableLength = 1200
+                if hasattr(obj.Frame, "PoleCableLength"):
+                    cableLength = obj.Frame.PoleCableLength.Value
+
+                moduleWidth = obj.Frame.ModuleWidth.Value
+                moduleHeight = obj.Frame.ModuleHeight.Value
+                dist_x = JuntionBoxPosition + obj.Frame.ModuleColGap.Value + (
+                    moduleWidth if portrait else moduleHeight) / 2
+                dist_y = obj.Frame.ModuleRowGap.Value + (moduleHeight if portrait else moduleWidth)
+
+                PolePosition = 0
+                if portrait:
+                    PolePosition = moduleWidth / 2 - JuntionBoxPosition
+
+                FrameModules = obj.Frame.Shape.SubShapes[0].SubShapes[0].SubShapes
+                cableProfile = Part.Face(Part.Wire(Part.Circle(FreeCAD.Vector(0, 0, 0), FreeCAD.Vector(1, 0, 0), 6).toShape()))
+                positiveMC4 = Part.Shape()
+                positiveMC4.read(os.path.join(Dir3dObjects, "MC4 POSITIVE.IGS"))
+                negativeMC4 = Part.Shape()
+                negativeMC4.read(os.path.join(Dir3dObjects, "MC4 NEGATIVE.IGS"))
+
+                vec = None
+                if obj.Frame.Route:
+                    vertexes = obj.Frame.Route.Shape.Vertexes
+                    vec = vertexes[1].Point - vertexes[0].Point
+                else:
+                    poles = obj.Frame.Shape.SubShapes[1].SubShapes
+                    vec = poles[1].BoundBox.Center - poles[0].BoundBox.Center
+                vecp= FreeCAD.Vector(-vec.y, vec.x, vec.z)
+            # V1:
+            for stringnum in range(obj.StringSetup.NumberOfStrings):
+                ''''''
+
+            return
+            # V0:
+            for stringnum in range(obj.StringSetup.NumberOfStrings):
+                    string = obj.StringSetup.getPropertyByName("String" + str(stringnum + 1))
+                    total = len(string) - 1
+                    dir = 0
+                    ndir = 0
+                    # dirvec = FrameModules(string[-]).Placement.Base - FrameModules(string[0]).Placement.Base
+                    for i, num in enumerate(string):
+                        face = getDownFace(FrameModules[num])
+
+                        if i < total:
+                            dir = string[i + 1] - num
+                            dir /= abs(dir)
+                            ndir = -dir
+
+                        positivePolePosition = FreeCAD.Vector(0, ndir * PolePosition, 0) + face.CenterOfMass
+                        negativePolePosition = FreeCAD.Vector(0, dir * PolePosition, 0) + face.CenterOfMass
+
+                        # dibujar +:
+                        p1 = positivePolePosition
+                        p2 = p1 + ndir * FreeCAD.Vector(0, 50, 0)
+                        p3 = p2 + ndir * FreeCAD.Vector(cableLength - dist_x, 0, 0)
+                        p4 = p3 + ndir * FreeCAD.Vector(0, dist_x - 50, 0)
+                        w = Part.makePolygon([p1, p2, p3, p4])
+                        #cableProfile.Placement.Base = p1
+                        #cable = w.makePipeShell([cableProfile], True, False, 2)
+                        Part.show(w)
+                        mc4copy = positiveMC4.copy()
+                        mc4copy.Placement.Base = p4 + FreeCAD.Vector(0, mc4copy.BoundBox.XLength/2 + 1.3, 0)
+                        positiveMC4.Placement.Rotation.Angle = math.radians(ndir * 90)
+                        Part.show(mc4copy)
+
+                        # dibujar -:
+                        p1 = negativePolePosition
+                        p2 = p1 + dir * FreeCAD.Vector(0, 50, 0)
+                        p3 = p2 + ndir * FreeCAD.Vector(cableLength - dist_x, 0, 0)
+                        p4 = p3 + dir * FreeCAD.Vector(0, dist_x - 50, 0)
+                        w = Part.makePolygon([p1, p2, p3, p4])
+                        Part.show(w)
+                        mc4copy = negativeMC4.copy()
+                        mc4copy.Placement.Base = p4 - FreeCAD.Vector(0, mc4copy.BoundBox.XLength/2 + 1.3, 0)
+                        mc4copy.Placement.Rotation.Angle = math.radians(dir * 90)
+                        Part.show(mc4copy)
+
+                        if i == 0 or i == total:
+                            list = obj.StringPoles.copy()
+                            list.append(p3)
+                            obj.StringPoles = list
+                    break
+
+    def execute(self, obj):
+        '''Do something when recompute'''
+
+
+class _ViewProviderString(ArchComponent.ViewProviderComponent):
+    def __init__(self, vobj):
+        ArchComponent.ViewProviderComponent.__init__(self, vobj)
+
+    def getIcon(self):
+        return str(os.path.join(DirIcons, "string.svg"))
+
+
+
+class _CommandStringSetup:
+
+    def GetResources(self):
+        return {'Pixmap': str(os.path.join(DirIcons, "stringsetup.svg")),
+                'Accel': "E, C",
+                'MenuText': "String Setup",
+                'ToolTip': "Configure strings of a Frame"}
+
+    def IsActive(self):
+        if FreeCAD.ActiveDocument:
+            return True
+        else:
+            return False
+
+    def Activated(self):
+        self.TaskPanel = _StringSetupPanel()
+        FreeCADGui.Control.showDialog(self.TaskPanel)
+        return
+
+class _CommandStringing:
+    def GetResources(self):
+        return {'Pixmap': str(os.path.join(DirIcons, "string.svg")),
+                'Accel': "E, S",
+                'MenuText': QT_TRANSLATE_NOOP("Placement", "String"),
+                'ToolTip': QT_TRANSLATE_NOOP("Placement", "Make string on a Frame")}
+
+    def IsActive(self):
+        if FreeCAD.ActiveDocument:
+            return True
+        else:
+            return False
+
+    def Activated(self):
+        # issubclass(Car, Vehicles)
+        # isinstance(Car, Vehicles)
+        sel = FreeCADGui.Selection.getSelection()
+        if len(sel) > 0:
+            for obj in sel:
+                if obj.Name.__contains__("Tracker"):
+                    makeString(obj)
+
+
+if FreeCAD.GuiUp:
+    class _CommandStringingGroup:
+
+        def GetCommands(self):
+            return tuple(['PVPlantStringSetup',
+                          'PVPlantStringing'
+                          ])
+
+        def GetResources(self):
+            return {'MenuText': 'Stringing',
+                    'ToolTip': 'Tools to setup and make strings'
+                    }
+
+        def IsActive(self):
+            return not FreeCAD.ActiveDocument is None
+
+    FreeCADGui.addCommand('PVPlantStringSetup', _CommandStringSetup())
+    FreeCADGui.addCommand('PVPlantStringing', _CommandStringing())
+    FreeCADGui.addCommand('Stringing', _CommandStringingGroup())
+
+

PVPlantSurface.py

@@ -0,0 +1,292 @@
+import copy
+import random
+
+import FreeCAD
+import Mesh
+from freecad.trails import ICONPATH, geo_origin
+from pivy import coin
+
+
+def create(name='Surface'):
+    obj = FreeCAD.ActiveDocument.addObject("App::FeaturePython", "Surface")
+    obj.Label = name
+    Surface(obj)
+    ViewProviderSurface(obj.ViewObject)
+    FreeCAD.ActiveDocument.recompute()
+
+    return obj
+
+
+#class Surface(SurfaceFunc):
+class Surface(ArchComponent.Component):
+    """
+    This class is about Surface Object data features.
+    """
+
+    def __init__(self, obj):
+        '''
+        Set data properties.
+        '''
+
+        ArchComponent.Component.__init__(self, obj)
+
+        self.Type = 'PVPlant::Surface'
+        self.setproperties()
+        obj.Proxy = self
+
+        # Does a IfcType exist?
+        obj.IfcType = "Civil Element"
+        obj.setEditorMode("IfcType", 1)
+
+    def setproperties(self):
+        # Triangulation properties.
+        obj.addProperty(
+            'App::PropertyLinkList', "PointGroups", "Base",
+            "List of Point Groups").PointGroups = []
+
+        obj.addProperty(
+            "App::PropertyIntegerList", "Delaunay", "Base",
+            "Index of Delaunay vertices", 4).Delaunay = []
+
+        obj.addProperty(
+            "Mesh::PropertyMeshKernel", "Mesh", "Base",
+            "Mesh object of triangulation").Mesh = Mesh.Mesh()
+
+        obj.addProperty(
+            "App::PropertyLength", "MaxLength", "Base",
+            "Maximum length of triangle edge").MaxLength = 50000
+
+        obj.addProperty(
+            "App::PropertyAngle", "MaxAngle", "Base",
+            "Maximum angle of triangle edge").MaxAngle = 170
+
+        # Contour properties.
+        obj.addProperty(
+            "App::PropertyFloatConstraint", "ContourInterval", "Contour",
+            "Size of the point group").ContourInterval = (1.0, 0.0, 100.0, 1.0)
+
+        obj.addProperty(
+            "App::PropertyVectorList", "ContourPoints", "Contour",
+            "Points of contours", 4).ContourPoints = []
+
+        obj.addProperty(
+            "App::PropertyIntegerList", "ContourVertices", "Contour",
+            "Vertices of contours.", 4).ContourVertices = []
+
+
+    def onChanged(self, obj, prop):
+        '''
+        Do something when a data property has changed.
+        '''
+
+        points = []
+        pgs = obj.getPropertyByName("PointGroups")
+        for pg in pgs:
+            points.extend(pg.Points)
+        if points:
+            origin = geo_origin.get(points[0])
+        else:
+            origin = geo_origin.get()
+
+        if prop == "PointGroups":
+            if len(points) > 2:
+                obj.Delaunay = self.triangulate(points)
+            else:
+                obj.Mesh = Mesh.Mesh()
+
+        if prop == "Delaunay" or prop == "MaxLength" or prop == "MaxAngle":
+            delaunay = obj.getPropertyByName("Delaunay")
+            lmax = obj.getPropertyByName("MaxLength")
+            amax = obj.getPropertyByName("MaxAngle")
+
+            if delaunay:
+                obj.Mesh = self.test_delaunay(
+                    origin.Origin, points, delaunay, lmax, amax)
+
+        if prop == "Mesh" or prop == "ContourInterval":
+            deltaH = obj.getPropertyByName("ContourInterval")
+            mesh = obj.getPropertyByName("Mesh")
+
+            coords, num_vert = self.contour_points(origin.Origin, mesh, deltaH)
+
+            obj.ContourPoints = coords
+            obj.ContourVertices = num_vert
+
+    def execute(self, obj):
+        '''
+        Do something when doing a recomputation.
+        '''
+        pass
+
+
+class ViewProviderSurface:
+    """
+    This class is about Surface Object view features.
+    """
+
+    def __init__(self, vobj):
+        '''
+        Set view properties.
+        '''
+        (r, g, b) = (random.random(), random.random(), random.random())
+
+        vobj.addProperty(
+            "App::PropertyColor", "TriangleColor", "Surface Style",
+            "Color of the point group").TriangleColor = (r, g, b)
+
+        vobj.Proxy = self
+
+    def attach(self, vobj):
+        '''
+        Create Object visuals in 3D view.
+        '''
+        # GeoCoords Node.
+        self.geo_coords = coin.SoGeoCoordinate()
+
+        # Surface features.
+        self.triangles = coin.SoIndexedFaceSet()
+        shape_hints = coin.SoShapeHints()
+        shape_hints.vertex_ordering = coin.SoShapeHints.COUNTERCLOCKWISE
+        self.mat_color = coin.SoMaterial()
+        mat_binding = coin.SoMaterialBinding()
+        mat_binding.value = coin.SoMaterialBinding.OVERALL
+        edge_color = coin.SoBaseColor()
+        edge_color.rgb = (0.5, 0.5, 0.5)
+        offset = coin.SoPolygonOffset()
+
+        # Line style.
+        line_style = coin.SoDrawStyle()
+        line_style.style = coin.SoDrawStyle.LINES
+        line_style.lineWidth = 2
+
+        # Contour features.
+        cont_color = coin.SoBaseColor()
+        cont_color.rgb = (1, 1, 0)
+        self.cont_coords = coin.SoGeoCoordinate()
+        self.cont_lines = coin.SoLineSet()
+
+        # Contour root.
+        contours = coin.SoSeparator()
+        contours.addChild(cont_color)
+        contours.addChild(line_style)
+        contours.addChild(self.cont_coords)
+        contours.addChild(self.cont_lines)
+
+        # Face root.
+        faces = coin.SoSeparator()
+        faces.addChild(shape_hints)
+        faces.addChild(self.mat_color)
+        faces.addChild(mat_binding)
+        faces.addChild(self.geo_coords)
+        faces.addChild(self.triangles)
+
+        # Highlight for selection.
+        highlight = coin.SoType.fromName('SoFCSelection').createInstance()
+        highlight.style = 'EMISSIVE_DIFFUSE'
+        highlight.addChild(edge_color)
+        highlight.addChild(line_style)
+        highlight.addChild(self.geo_coords)
+        highlight.addChild(self.triangles)
+
+        # Surface root.
+        surface_root = coin.SoSeparator()
+        surface_root.addChild(contours)
+        surface_root.addChild(offset)
+        surface_root.addChild(faces)
+        surface_root.addChild(offset)
+        surface_root.addChild(highlight)
+        vobj.addDisplayMode(surface_root, "Surface")
+
+        # Take features from properties.
+        self.onChanged(vobj, "TriangleColor")
+
+    def onChanged(self, vobj, prop):
+        '''
+        Update Object visuals when a view property changed.
+        '''
+        try:
+            if prop == "TriangleColor":
+                color = vobj.getPropertyByName("TriangleColor")
+                self.mat_color.diffuseColor = (color[0], color[1], color[2])
+        except Exception:
+            pass
+
+    def updateData(self, obj, prop):
+        '''
+        Update Object visuals when a data property changed.
+        '''
+        if prop == "Mesh":
+            mesh = obj.getPropertyByName("Mesh")
+            topo_points = mesh.Topology[0]
+            topo_tri = mesh.Topology[1]
+
+            # Get GeoOrigin.
+            points = []
+            triangles = []
+            origin = geo_origin.get()
+            base = copy.deepcopy(origin.Origin)
+            base.z = 0
+
+            for i in topo_points:
+                point = copy.deepcopy(i)
+                points.append(point.add(base))
+
+            for i in topo_tri:
+                triangles.extend(list(i))
+                triangles.append(-1)
+
+            # Set GeoCoords.
+            geo_system = ["UTM", origin.UtmZone, "FLAT"]
+            self.geo_coords.geoSystem.setValues(geo_system)
+            self.geo_coords.point.values = points
+
+            # Set contour system.
+            self.cont_coords.geoSystem.setValues(geo_system)
+            self.triangles.coordIndex.values = triangles
+
+        if prop == "Mesh" or prop == "ContourInterval":
+            cont_points = obj.getPropertyByName("ContourPoints")
+            cont_vert = obj.getPropertyByName("ContourVertices")
+
+            self.cont_coords.point.values = cont_points
+            self.cont_lines.numVertices.values = cont_vert
+
+    def getDisplayModes(self, vobj):
+        '''
+        Return a list of display modes.
+        '''
+        modes = []
+        modes.append("Surface")
+
+        return modes
+
+    def getDefaultDisplayMode(self):
+        '''
+        Return the name of the default display mode.
+        '''
+        return "Surface"
+
+    def setDisplayMode(self, mode):
+        '''
+        Map the display mode defined in attach with
+        those defined in getDisplayModes.
+        '''
+        return mode
+
+    def getIcon(self):
+        '''
+        Return object treeview icon.
+        '''
+        return ICONPATH + '/icons/Surface.svg'
+
+    def __getstate__(self):
+        """
+        Save variables to file.
+        """
+        return None
+
+    def __setstate__(self, state):
+        """
+        Get variables from file.
+        """
+        return None

PVPlantTerrain.py

@@ -0,0 +1,695 @@
+# /**********************************************************************
+# *                                                                     *
+# * Copyright (c) 2021 Javier Braña <javier.branagutierrez@gmail.com>  *
+# *                                                                     *
+# * This program is free software; you can redistribute it and/or modify*
+# * it under the terms of the GNU Lesser General Public License (LGPL)  *
+# * as published by the Free Software Foundation; either version 2 of   *
+# * the License, or (at your option) any later version.                 *
+# * for detail see the LICENCE text file.                               *
+# *                                                                     *
+# * This program is distributed in the hope that it will be useful,     *
+# * but WITHOUT ANY WARRANTY; without even the implied warranty of      *
+# * MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE.  See the       *
+# * GNU Library General Public License for more details.                *
+# *                                                                     *
+# * You should have received a copy of the GNU Library General Public   *
+# * License along with this program; if not, write to the Free Software *
+# * Foundation, Inc., 59 Temple Place, Suite 330, Boston, MA  02111-1307*
+# * USA                                                                 *
+# *                                                                     *
+# ***********************************************************************
+
+import copy
+
+import ArchComponent
+import FreeCAD
+import Part
+import numpy as np
+import math
+
+import PVPlantSite
+
+if FreeCAD.GuiUp:
+    import FreeCADGui
+    from pivy import coin
+    import os
+else:
+    # \cond
+    def translate(ctxt, txt):
+        return txt
+
+    def QT_TRANSLATE_NOOP(ctxt, txt):
+        return txt
+    # \endcond
+
+__title__ = "FreeCAD Fixed Rack"
+__author__ = "Javier Braña"
+__url__ = "http://www.sogos-solar.com"
+__dir__ = os.path.join(FreeCAD.getUserAppDataDir(), "Mod", "PVPlant")
+
+DirResources = os.path.join(__dir__, "Resources")
+DirIcons = os.path.join(DirResources, "Icons")
+DirImages = os.path.join(DirResources, "Images")
+
+line_patterns = {
+    "Continues      _______________________________": 0xFFFF,
+    "Border         __ . __ __ . __ __ . __ __ . __": 0x3CF2,
+    "Border (.5x)   __.__.__.__.__.__.__.__.__.__._": 0x3939,
+    "Border (2x)    ____  ____  .  ____  ____  .  _": 0xFDFA,
+    "Center         ____ _ ____ _ ____ _ ____ _ ___": 0xFF3C,
+    "Center (.5x)   ___ _ ___ _ ___ _ ___ _ ___ _ _": 0xFC78,
+    "Center (2x)    ________  __  ________  __  ___": 0xFFDE,
+    "Dash dot       __ . __ . __ . __ . __ . __ . _": 0xE4E4,
+    "Dash dot (.5x) _._._._._._._._._._._._._._._._": 0xEBAE,
+    "Dash dot (2x)  ____  .  ____  .  ____  .  ____": 0xFF08,
+    "Dashed         __ __ __ __ __ __ __ __ __ __ _": 0x739C,
+    "Dashed (.5x)   _ _ _ _ _ _ _ _ _ _ _ _ _ _ _ _": 0xDB6E,
+    "Dashed (2x)    ____  ____  ____  ____  ____  _": 0xFFE0,
+    "Divide         ____ . . ____ . . ____ . . ____": 0xFF24,
+    "Divide (.5x)   __..__..__..__..__..__..__..__.": 0xEAEA,
+    "Divide (2x)    ________  .  .  ________  .  . ": 0xFFEA,
+    "Dot            . . . . . . . . . . . . . . . .": 0x4924,
+    "Dot (.5x)      ...............................": 0x5555,
+    "Dot (2x)       .  .  .  .  .  .  .  .  .  .  .": 0x8888}
+
+def makeTerrain(name="Terrain"):
+    obj = FreeCAD.ActiveDocument.addObject("Part::FeaturePython", "Terrain")
+    obj.Label = name
+    Terrain(obj)
+    ViewProviderTerrain(obj.ViewObject)
+    FreeCAD.ActiveDocument.recompute()
+    return obj
+
+
+class Terrain(ArchComponent.Component):
+    "A Shadow Terrain Obcject"
+
+    def __init__(self, obj):
+        # Definición de  variables:
+        ArchComponent.Component.__init__(self, obj)
+        self.setProperties(obj)
+        self.obj = obj
+        # Does a IfcType exist?
+        # obj.IfcType = "Fence"
+        # obj.MoveWithHost = False
+
+        self.site = PVPlantSite.get()
+        self.site.Terrain = obj
+        obj.ViewObject.ShapeColor = (0.0000, 0.6667, 0.4980)
+        obj.ViewObject.LineColor = (0.0000, 0.6000, 0.4392)
+
+    def setProperties(self, obj):
+        # Definicion de Propiedades:
+        pl = obj.PropertiesList
+        if not ("CuttingBoundary" in pl):
+            obj.addProperty("App::PropertyLink",
+                            "CuttingBoundary",
+                            "Surface",
+                            "A boundary line to delimit the surface")
+
+        if not ("DEM" in pl):
+            obj.addProperty("App::PropertyFile",
+                            "DEM",
+                            "Surface",
+                            "Load a ASC file to generate the surface")
+
+        if not ("PointsGroup" in pl):
+            obj.addProperty("App::PropertyLink",
+                            "PointsGroup",
+                            "Surface",
+                            "Use a Point Group to generate the surface")
+
+        if not ("Mesh" in pl):
+            obj.addProperty("Mesh::PropertyMeshKernel",
+                            "Mesh",
+                            "Surface",
+                            "Mesh")
+        obj.setEditorMode("Mesh", 1)
+
+        if not ("InitialMesh" in pl):
+            obj.addProperty("Mesh::PropertyMeshKernel",
+                            "InitialMesh",
+                            "Surface",
+                            "Mesh")
+        obj.setEditorMode("InitialMesh", 1)
+
+        '''
+        #obj.setEditorMode("Volume", 1)
+        if not "AllowedAreas" in pl:
+            obj.addProperty("App::PropertyLinkList",
+                            "AllowedAreas",
+                            "Areas",
+                            "A boundary to delimitated the terrain").AllowedAreas = []
+        if not "ProhibitedAreas" in pl:
+            obj.addProperty("App::PropertyLinkList",
+                            "ProhibitedAreas",
+                            "Areas",
+                            "A boundary to delimitated the terrain").ProhibitedAreas = []
+        '''
+
+    def onDocumentRestored(self, obj):
+        ArchComponent.Component.onDocumentRestored(self, obj)
+        self.setProperties(obj)
+
+    def onChanged(self, obj, prop):
+        '''Do something when a property has changed'''
+
+        if prop == "InitialMesh":
+            obj.Mesh = obj.InitialMesh.copy()
+
+        if prop == "DEM" or prop == "CuttingBoundary":
+            from datetime import datetime
+            if obj.DEM and obj.CuttingBoundary:
+                '''
+                Parámetro	            Descripción	                        Requisitos
+                NCOLS:                  Cantidad de columnas de celdas      Entero mayor que 0.
+                NROWS:                  Cantidad de filas de celdas         Entero mayor que 0.
+                XLLCENTER o XLLCORNER:  Coordenada X del origen (por el centro o la esquina inferior izquierda de la celda) Hacer coincidir con el tipo de coordenada y.
+                YLLCENTER o YLLCORNER:  Coordenada Y del origen (por el centro o la esquina inferior izquierda de la celda) Hacer coincidir con el tipo de coordenada x.
+                CELLSIZE:               Tamaño de celda                     Mayor que 0.
+                NODATA_VALUE:           Los valores de entrada que serán NoData en el ráster de salida  Opcional. El valor predeterminado es -9999
+                '''
+                grid_space = 1
+                file = open(obj.DEM, "r")
+                templist = [line.split() for line in file.readlines()]
+                file.close()
+                del file
+
+                # Read meta data:
+                meta = templist[0:6]
+                nx = int(meta[0][1])                     # NCOLS
+                ny = int(meta[1][1])                     # NROWS
+                xllref = meta[2][0]                      # XLLCENTER / XLLCORNER
+                xllvalue = round(float(meta[2][1]), 3)
+                yllref = meta[3][0]                      # YLLCENTER / XLLCORNER
+                yllvalue = round(float(meta[3][1]), 3)
+                cellsize = round(float(meta[4][1]), 3)   # CELLSIZE
+                nodata_value = float(meta[5][1])         # NODATA_VALUE
+
+                # set coarse_factor
+                coarse_factor = max(round(grid_space / cellsize), 1)
+
+                # Get z values
+                templist = templist[6:(6 + ny)]
+                templist = [templist[i][0::coarse_factor] for i in np.arange(0, len(templist), coarse_factor)]
+                datavals = np.array(templist).astype(float)
+                del templist
+
+                # create xy coordinates
+                import PVPlantSite
+                offset = PVPlantSite.get().Origin
+                x = 1000 * (cellsize * np.arange(nx)[0::coarse_factor] + xllvalue) - offset.x
+                y = 1000 * (cellsize * np.arange(ny)[-1::-1][0::coarse_factor] + yllvalue) - offset.y
+                datavals = 1000 * datavals  # - offset.z
+
+                # remove points out of area
+                # 1. coarse:
+                if obj.CuttingBoundary:
+                    inc_x = obj.CuttingBoundary.Shape.BoundBox.XLength * 0.0
+                    inc_y = obj.CuttingBoundary.Shape.BoundBox.YLength * 0.0
+                    tmp = np.where(np.logical_and(x >= (obj.CuttingBoundary.Shape.BoundBox.XMin - inc_x),
+                                                  x <= (obj.CuttingBoundary.Shape.BoundBox.XMax + inc_x)))[0]
+                    print(tmp)
+                    x_max = np.ndarray.max(tmp)
+                    x_min = np.ndarray.min(tmp)
+
+                    tmp = np.where(np.logical_and(y >= (obj.CuttingBoundary.Shape.BoundBox.YMin - inc_y),
+                                                  y <= (obj.CuttingBoundary.Shape.BoundBox.YMax + inc_y)))[0]
+                    y_max = np.ndarray.max(tmp)
+                    y_min = np.ndarray.min(tmp)
+                    del tmp
+
+                    x = x[x_min:x_max+1]
+                    y = y[y_min:y_max+1]
+                    datavals = datavals[y_min:y_max+1, x_min:x_max+1]
+
+                # Create mesh - surface:
+                import MeshTools.Triangulation as Triangulation
+                import Mesh
+                stepsize = 75
+                stepx = math.ceil(nx / stepsize)
+                stepy = math.ceil(ny / stepsize)
+
+                mesh = Mesh.Mesh()
+                for indx in range(stepx):
+                    inix = indx * stepsize - 1
+                    finx = min([stepsize * (indx + 1), len(x)-1])
+                    for indy in range(stepy):
+                        iniy = indy * stepsize - 1
+                        finy = min([stepsize * (indy + 1), len(y) - 1])
+                        pts = []
+                        for i in range(inix, finx):
+                            for j in range(iniy, finy):
+                                if datavals[j][i] != nodata_value:
+                                    if obj.CuttingBoundary:
+                                        if obj.CuttingBoundary.Shape.isInside(FreeCAD.Vector(x[i], y[j], 0), 0, True):
+                                            pts.append([x[i], y[j], datavals[j][i]])
+                                    else:
+                                        pts.append([x[i], y[j], datavals[j][i]])
+                        if len(pts) > 3:
+                            try:
+                                mesh.addMesh(Triangulation.Triangulate(pts))
+                                #Mesh.show(mesh)
+                            except TypeError:
+                                print("error al procesar: {0} puntos".format(len(pts)))
+
+                mesh.removeDuplicatedPoints()
+                mesh.removeFoldsOnSurface()
+                obj.InitialMesh = mesh.copy()
+                Mesh.show(mesh)
+
+        if prop == "PointsGroup" or prop == "CuttingBoundary":
+            if obj.PointsGroup and obj.CuttingBoundary:
+                bnd = obj.CuttingBoundary.Shape
+                if len(bnd.Faces) == 0:
+                    pts = [ver.Point for ver in bnd.Vertexes]
+                    pts.append(pts[0])
+                    bnd = Part.makePolygon(pts)
+
+                # TODO: not use the first point, else the Origin in "Site".
+                #  It is standard for everything.
+                firstPoint = self.obj.PointsGroup.Points.Points[0]
+                nbase = FreeCAD.Vector(firstPoint.x, firstPoint.y, firstPoint.z)
+                data = []
+                for point in self.obj.PointsGroup.Points.Points:
+                    tmp = FreeCAD.Vector(0, 0, 0).add(point)
+                    tmp.z = 0
+                    if bnd.isInside(tmp, 0, True):
+                        p = point - nbase
+                        data.append([float(p.x), float(p.y), float(p.z)])
+
+                Data = np.array(data)
+                data.clear()
+
+                import MeshTools.Triangulation as Triangulation
+                mesh = Triangulation.Triangulate(Data)
+                '''shape = PVPlantCreateTerrainMesh.MeshToShape(mesh)
+                shape.Placement.move(nbase)'''
+
+                obj.Shape = shape
+                if obj.DEM:
+                    obj.DEM = None
+
+    def execute(self, obj):
+        ''''''
+        #print("  -----  Terrain  -  EXECUTE  ----------")
+
+    def __getstate__(self):
+        return self.Type
+
+    def __setstate__(self, state):
+        if state:
+            self.Type = state
+
+
+class ViewProviderTerrain:
+    "A View Provider for the Pipe object"
+
+    def __init__(self, vobj):
+        self.Object = vobj.Object
+        self.boundary_color = None
+        self.edge_style = None
+        self.edge_color = None
+        self.edge_material = None
+        self.face_material = None
+        self.triangles = None
+        self.geo_coords = None
+        self.setProperties(vobj)
+
+    def setProperties(self, vobj):
+        # Triangulation properties.
+        pl = vobj.PropertiesList
+        if not ("Transparency" in pl):
+            vobj.addProperty("App::PropertyIntegerConstraint",
+                             "Transparency",
+                             "Surface Style",
+                             "Set triangle face transparency").Transparency = (50, 0, 100, 1)
+
+        if not ("ShapeColor" in pl):
+            vobj.addProperty("App::PropertyColor",
+                             "ShapeColor",
+                             "Surface Style",
+                             "Set triangle face color").ShapeColor = (r, g, b, vobj.Transparency / 100)
+
+        if not ("ShapeMaterial" in pl):
+            vobj.addProperty("App::PropertyMaterial",
+                             "ShapeMaterial",
+                             "Surface Style",
+                             "Triangle face material").ShapeMaterial = FreeCAD.Material()
+
+        if not ("LineTransparency" in pl):
+            vobj.addProperty("App::PropertyIntegerConstraint",
+                             "LineTransparency",
+                             "Surface Style",
+                             "Set triangle edge transparency").LineTransparency = (50, 0, 100, 1)
+
+        if not ("LineColor" in pl):
+            vobj.addProperty("App::PropertyColor",
+                             "LineColor",
+                             "Surface Style",
+                             "Set triangle face color").LineColor = (0.5, 0.5, 0.5, vobj.LineTransparency / 100)
+
+        if not ("LineMaterial" in pl):
+            vobj.addProperty("App::PropertyMaterial",
+                             "LineMaterial",
+                             "Surface Style",
+                             "Triangle face material").LineMaterial = FreeCAD.Material()
+
+        if not ("LineWidth" in pl):
+            vobj.addProperty("App::PropertyFloatConstraint",
+                             "LineWidth",
+                             "Surface Style",
+                             "Set triangle edge line width").LineWidth = (0.0, 1.0, 20.0, 1.0)
+
+        # Boundary properties.
+        if not ("BoundaryColor" in pl):
+            vobj.addProperty("App::PropertyColor",
+                             "BoundaryColor",
+                             "Boundary Style",
+                             "Set boundary contour color").BoundaryColor = (0.0, 0.75, 1.0, 0.0)
+
+        if not ("BoundaryWidth" in pl):
+            vobj.addProperty("App::PropertyFloatConstraint",
+                             "BoundaryWidth",
+                             "Boundary Style",
+                             "Set boundary contour line width").BoundaryWidth = (3.0, 1.0, 20.0, 1.0)
+
+        if not ("BoundaryPattern" in pl):
+            vobj.addProperty("App::PropertyEnumeration",
+                             "BoundaryPattern",
+                             "Boundary Style",
+                             "Set a line pattern for boundary").BoundaryPattern = [*line_patterns]
+
+        if not ("PatternScale" in pl):
+            vobj.addProperty("App::PropertyIntegerConstraint",
+                             "PatternScale",
+                             "Boundary Style",
+                             "Scale the line pattern").PatternScale = (3, 1, 20, 1)
+
+        # Contour properties.
+        if not ("MajorColor" in pl):
+            vobj.addProperty("App::PropertyColor",
+                             "MajorColor",
+                             "Contour Style",
+                             "Set major contour color").MajorColor = (1.0, 0.0, 0.0, 0.0)
+
+        if not ("MajorWidth" in pl):
+            vobj.addProperty("App::PropertyFloatConstraint",
+                             "MajorWidth",
+                             "Contour Style",
+                             "Set major contour line width").MajorWidth = (4.0, 1.0, 20.0, 1.0)
+
+        if not ("MinorColor" in pl):
+            vobj.addProperty("App::PropertyColor",
+                             "MinorColor",
+                             "Contour Style",
+                             "Set minor contour color").MinorColor = (1.0, 1.0, 0.0, 0.0)
+
+        if not ("MinorWidth" in pl):
+            vobj.addProperty("App::PropertyFloatConstraint",
+                             "MinorWidth",
+                             "Contour Style",
+                             "Set major contour line width").MinorWidth = (2.0, 1.0, 20.0, 1.0)
+
+        vobj.Proxy = self
+        vobj.ShapeMaterial.DiffuseColor = vobj.ShapeColor
+
+    def onDocumentRestored(self, vobj):
+        self.setProperties(vobj)
+
+    def onChanged(self, vobj, prop):
+        ''' Update Object visuals when a view property changed. '''
+        if prop == "ShapeColor" or prop == "Transparency":
+            if hasattr(vobj, "ShapeColor") and hasattr(vobj, "Transparency"):
+                color = vobj.getPropertyByName("ShapeColor")
+                transparency = vobj.getPropertyByName("Transparency")
+                color = (color[0], color[1], color[2], transparency / 100)
+                vobj.ShapeMaterial.DiffuseColor = color
+
+        if prop == "ShapeMaterial":
+            if hasattr(vobj, "ShapeMaterial"):
+                material = vobj.getPropertyByName("ShapeMaterial")
+                self.face_material.diffuseColor.setValue(material.DiffuseColor[:3])
+                self.face_material.transparency = material.DiffuseColor[3]
+
+        if prop == "LineColor" or prop == "LineTransparency":
+            if hasattr(vobj, "LineColor") and hasattr(vobj, "LineTransparency"):
+                color = vobj.getPropertyByName("LineColor")
+                transparency = vobj.getPropertyByName("LineTransparency")
+                color = (color[0], color[1], color[2], transparency / 100)
+                vobj.LineMaterial.DiffuseColor = color
+
+        if prop == "LineMaterial":
+            material = vobj.getPropertyByName(prop)
+            self.edge_material.diffuseColor.setValue(material.DiffuseColor[:3])
+            self.edge_material.transparency = material.DiffuseColor[3]
+
+        if prop == "LineWidth":
+            width = vobj.getPropertyByName(prop)
+            self.edge_style.lineWidth = width
+
+        if prop == "BoundaryColor":
+            color = vobj.getPropertyByName(prop)
+            self.boundary_color.rgb = color[:3]
+
+        if prop == "BoundaryWidth":
+            width = vobj.getPropertyByName(prop)
+            self.boundary_style.lineWidth = width
+
+        if prop == "BoundaryPattern":
+            if hasattr(vobj, "BoundaryPattern"):
+                pattern = vobj.getPropertyByName(prop)
+                self.boundary_style.linePattern = line_patterns[pattern]
+
+        if prop == "PatternScale":
+            if hasattr(vobj, "PatternScale"):
+                scale = vobj.getPropertyByName(prop)
+                self.boundary_style.linePatternScaleFactor = scale
+
+        if prop == "MajorColor":
+            color = vobj.getPropertyByName(prop)
+            self.major_color.rgb = color[:3]
+
+        if prop == "MajorWidth":
+            width = vobj.getPropertyByName(prop)
+            self.major_style.lineWidth = width
+
+        if prop == "MinorColor":
+            color = vobj.getPropertyByName(prop)
+            self.minor_color.rgb = color[:3]
+
+        if prop == "MinorWidth":
+            width = vobj.getPropertyByName(prop)
+            self.minor_style.lineWidth = width
+
+    def attach(self, vobj):
+        ''' Create Object visuals in 3D view.'''
+
+        # GeoCoords Node.
+        self.geo_coords = coin.SoGeoCoordinate()
+
+        # Surface features.
+        self.triangles = coin.SoIndexedFaceSet()
+        self.face_material = coin.SoMaterial()
+        self.edge_material = coin.SoMaterial()
+        self.edge_color = coin.SoBaseColor()
+        self.edge_style = coin.SoDrawStyle()
+        self.edge_style.style = coin.SoDrawStyle.LINES
+
+        shape_hints = coin.SoShapeHints()
+        shape_hints.vertex_ordering = coin.SoShapeHints.COUNTERCLOCKWISE
+        mat_binding = coin.SoMaterialBinding()
+        mat_binding.value = coin.SoMaterialBinding.PER_FACE
+        offset = coin.SoPolygonOffset()
+        offset.styles = coin.SoPolygonOffset.LINES
+        offset.factor = -2.0
+
+        # Boundary features.
+        '''self.boundary_color = coin.SoBaseColor()
+        self.boundary_coords = coin.SoGeoCoordinate()
+        self.boundary_lines = coin.SoLineSet()
+        self.boundary_style = coin.SoDrawStyle()
+        self.boundary_style.style = coin.SoDrawStyle.LINES'''
+
+        # Boundary root.
+        '''boundaries = coin.SoType.fromName('SoFCSelection').createInstance()
+        boundaries.style = 'EMISSIVE_DIFFUSE'
+        boundaries.addChild(self.boundary_color)
+        boundaries.addChild(self.boundary_style)
+        boundaries.addChild(self.boundary_coords)
+        boundaries.addChild(self.boundary_lines)'''
+
+        # Major Contour features.
+        '''self.major_color = coin.SoBaseColor()
+        self.major_coords = coin.SoGeoCoordinate()
+        self.major_lines = coin.SoLineSet()
+        self.major_style = coin.SoDrawStyle()
+        self.major_style.style = coin.SoDrawStyle.LINES'''
+
+        # Major Contour root.
+        '''major_contours = coin.SoSeparator()
+        major_contours.addChild(self.major_color)
+        major_contours.addChild(self.major_style)
+        major_contours.addChild(self.major_coords)
+        major_contours.addChild(self.major_lines)'''
+
+        # Minor Contour features.
+        '''self.minor_color = coin.SoBaseColor()
+        self.minor_coords = coin.SoGeoCoordinate()
+        self.minor_lines = coin.SoLineSet()
+        self.minor_style = coin.SoDrawStyle()
+        self.minor_style.style = coin.SoDrawStyle.LINES'''
+
+        # Minor Contour root.
+        '''minor_contours = coin.SoSeparator()
+        minor_contours.addChild(self.minor_color)
+        minor_contours.addChild(self.minor_style)
+        minor_contours.addChild(self.minor_coords)
+        minor_contours.addChild(self.minor_lines)'''
+
+        # Highlight for selection.
+        highlight = coin.SoType.fromName('SoFCSelection').createInstance()
+        highlight.style = 'EMISSIVE_DIFFUSE'
+        highlight.addChild(shape_hints)
+        highlight.addChild(mat_binding)
+        highlight.addChild(self.geo_coords)
+        highlight.addChild(self.triangles)
+        highlight.addChild(boundaries)
+
+        # Face root.
+        face = coin.SoSeparator()
+        face.addChild(self.face_material)
+        face.addChild(highlight)
+
+        # Edge root.
+        edge = coin.SoSeparator()
+        edge.addChild(self.edge_material)
+        edge.addChild(self.edge_style)
+        edge.addChild(highlight)
+
+        # Surface root.
+        surface_root = coin.SoSeparator()
+        surface_root.addChild(face)
+        surface_root.addChild(offset)
+        surface_root.addChild(edge)
+        surface_root.addChild(major_contours)
+        surface_root.addChild(minor_contours)
+        vobj.addDisplayMode(surface_root, "Surface")
+
+        # Boundary root.
+        boundary_root = coin.SoSeparator()
+        boundary_root.addChild(boundaries)
+        vobj.addDisplayMode(boundary_root, "Boundary")
+
+        # Elevation/Shaded root.
+        '''shaded_root = coin.SoSeparator()
+        shaded_root.addChild(face)
+        vobj.addDisplayMode(shaded_root, "Elevation")
+        vobj.addDisplayMode(shaded_root, "Slope")
+        vobj.addDisplayMode(shaded_root, "Shaded")'''
+
+        # Flat Lines root.
+        flatlines_root = coin.SoSeparator()
+        flatlines_root.addChild(face)
+        flatlines_root.addChild(offset)
+        flatlines_root.addChild(edge)
+        vobj.addDisplayMode(flatlines_root, "Flat Lines")
+
+        # Wireframe root.
+        wireframe_root = coin.SoSeparator()
+        wireframe_root.addChild(edge)
+        wireframe_root.addChild(major_contours)
+        wireframe_root.addChild(minor_contours)
+        vobj.addDisplayMode(wireframe_root, "Wireframe")
+
+        # Take features from properties.
+        self.onChanged(vobj, "ShapeColor")
+        self.onChanged(vobj, "LineColor")
+        self.onChanged(vobj, "LineWidth")
+        #self.onChanged(vobj, "BoundaryColor")
+        #self.onChanged(vobj, "BoundaryWidth")
+        #self.onChanged(vobj, "BoundaryPattern")
+        #self.onChanged(vobj, "PatternScale")
+        #self.onChanged(vobj, "MajorColor")
+        #self.onChanged(vobj, "MajorWidth")
+        #self.onChanged(vobj, "MinorColor")
+        #self.onChanged(vobj, "MinorWidth")
+        
+    def updateData(self, obj, prop):
+        ''' Update Object visuals when a data property changed. '''
+
+        # Set geosystem.
+        geo_system = ["UTM", FreeCAD.ActiveDocument.Site.UtmZone, "FLAT"]
+        self.geo_coords.geoSystem.setValues(geo_system)
+        '''
+        self.boundary_coords.geoSystem.setValues(geo_system)
+        self.major_coords.geoSystem.setValues(geo_system)
+        self.minor_coords.geoSystem.setValues(geo_system)
+        '''
+
+        if prop == "Mesh":
+            print("update terrain mesh")
+            mesh = obj.Mesh
+            copy_mesh = mesh.copy()
+            # copy_mesh.Placement.move(origin.Origin)
+
+            triangles = []
+            for i in copy_mesh.Topology[1]:
+                triangles.extend(list(i))
+                triangles.append(-1)
+
+            self.geo_coords.point.values = copy_mesh.Topology[0]
+            self.triangles.coordIndex.values = triangles
+            del copy_mesh
+
+    def getDisplayModes(self, vobj):
+        ''' Return a list of display modes. '''
+        modes = ["Surface", "Boundary"]
+
+        return modes
+
+    def getDefaultDisplayMode(self):
+        '''
+        Return the name of the default display mode.
+        '''
+        return "Surface"
+
+    def claimChildren(self):
+        return [self.Object.CuttingBoundary, ]
+
+    def getIcon(self):
+        return str(os.path.join(DirIcons, "terrain.svg"))
+
+    def __getstate__(self):
+        """ Save variables to file. """
+        return None
+
+    def __setstate__(self, state):
+        """ Get variables from file. """
+        return None
+
+
+class _CommandTerrain:
+    "the PVPlant Terrain command definition"
+
+    def GetResources(self):
+        return {'Pixmap': str(os.path.join(DirIcons, "terrain.svg")),
+                'MenuText': "Terrain",
+                'Accel': "S, T",
+                'ToolTip': "Creates a Terrain object from setup dialog."}
+
+    def IsActive(self):
+        return (not (FreeCAD.ActiveDocument is None) and
+                not (FreeCAD.ActiveDocument.getObject("Site") is None) and
+                (FreeCAD.ActiveDocument.getObject("Terrain") is None))
+
+    def Activated(self):
+        makeTerrain()
+        # task = _TerrainTaskPanel()
+        # FreeCADGui.Control.showDialog(task)
+        return
+
+
+if FreeCAD.GuiUp:
+    FreeCADGui.addCommand('Terrain', _CommandTerrain())

PVPlantTerrainAnalisys.py

@@ -0,0 +1,806 @@
+import Draft
+import FreeCAD
+import Part
+
+if FreeCAD.GuiUp:
+    import FreeCADGui
+    from PySide import QtCore, QtGui
+    from PySide.QtCore import QT_TRANSLATE_NOOP
+else:
+    # \cond
+    def translate(ctxt, txt):
+        return txt
+    def QT_TRANSLATE_NOOP(ctxt, txt):
+        return txt
+    # \endcond
+
+try:
+    _fromUtf8 = QtCore.QString.fromUtf8
+except AttributeError:
+    def _fromUtf8(s):
+        return s
+
+import os
+from PVPlantResources import DirIcons as DirIcons
+
+def Mest2FemMesh(obj):
+    import Fem
+
+    fm = Fem.FemMesh()
+
+    #i = 0
+    #nodes = []
+    for mp in obj.Mesh.Points:
+        fm.addNode(mp.Vector.x, mp.Vector.y, mp.Vector.z)
+    #    nodes.append(mp)
+    #    i += 1
+    for mf in obj.Mesh.Facets:
+        fm.addFace([mf.PointIndices[0] + 1, mf.PointIndices[1] + 1, mf.PointIndices[2] + 1])
+
+    obj2 = FreeCAD.ActiveDocument.addObject("Fem::FemMeshObject")
+    obj2.FemMesh = fm
+    obj2.ViewObject.DisplayMode = "Faces"
+
+    FreeCAD.activeDocument().recompute()
+    return obj2
+
+def makeContours(land, minor = 1000, mayor = 5000,
+                 minorColor=(0.0, 0.00, 0.80), mayorColor=(0.00, 0.00, 1.00),
+                 minorThickness = 2, mayorThickness = 5,
+                 filter_size = 5):
+    if not land:
+        return
+
+    if land.TypeId == 'Mesh::Feature':
+        Contours_Mesh(land.Mesh, minor, mayor, minorColor, mayorColor, minorThickness, mayorThickness, filter_size)
+    else:
+        Contours_Part(land, minor, mayor, minorColor, mayorColor, minorThickness, mayorThickness, filter_size)
+
+    FreeCAD.ActiveDocument.recompute()
+
+def Contours_Mesh(Mesh, minor, mayor,
+                  minorColor, mayorColor,
+                  minorLineWidth, mayorLineWidth,
+                  filter_size): #filter_size de 3 a 21 y siempre impar
+
+    def calculateSection(cuts):
+        for inc in cuts:
+            CrossSections = Mesh.crossSections([((0, 0, inc), (0, 0, 1))], 0.000001)
+            for PointList in CrossSections[0]:
+                if len(PointList) > 1:
+                    if PointList[0].sub(PointList[-1]).Length <= 10000.0:
+                        PointList.append(PointList[0])
+
+                    # 1. Smooth the points
+                    if (len(PointList) > filter_size) and (filter_size > 0):
+                        for a in range(len(PointList)):
+                            x = 0
+                            y = 0
+                            for p in range(-filter_radius, filter_radius + 1):
+                                point_id = a + p
+                                if point_id < 0:
+                                    point_id = 0
+
+                                if point_id >= len(PointList):
+                                    point_id = len(PointList) - 1
+
+                                x += PointList[point_id].x
+                                y += PointList[point_id].y
+
+                            x /= filter_size
+                            y /= filter_size
+                            PointList[a].x = x
+                            PointList[a].y = y
+
+                        for a in reversed(range(len(PointList))):
+                            x = 0
+                            y = 0
+                            for p in range(-filter_radius, filter_radius + 1):
+                                point_id = a + p
+                                if point_id < 0:
+                                    point_id = 0
+
+                                if point_id >= len(PointList):
+                                    point_id = len(PointList) - 1
+
+                                x += PointList[point_id].x
+                                y += PointList[point_id].y
+
+                            x /= filter_size
+                            y /= filter_size
+                            PointList[a].x = x
+                            PointList[a].y = y
+
+                    # 2. Make lines
+                    #Contour = Draft.makeWire(PointList, closed=False, face=None)
+                    #Contour.Label = str(int(inc / 1000)) + "m"
+                    Contour = Part.makePolygon(PointList)
+                    Part.show(Contour, str(int(inc / 1000)) + "m")
+                    '''Contours.addObject(Contour)
+                    if inc % mayor == 0:
+                        Contour.ViewObject.LineWidth = mayorLineWidth
+                        Contour.ViewObject.LineColor = mayorColor
+                    else:
+                        Contour.ViewObject.LineWidth = minorLineWidth
+                        Contour.ViewObject.LineColor = minorColor'''
+
+                    del Contour, PointList
+            del CrossSections
+
+    filter_radius = int(filter_size / 2)
+    try:
+        Contours = FreeCAD.ActiveDocument.Contours
+    except:
+        Contours = FreeCAD.ActiveDocument.addObject("App::DocumentObjectGroup", 'Contours')
+
+    ZMin = Mesh.BoundBox.ZMin // 10000
+    ZMin *= 10000
+    ZMax = Mesh.BoundBox.ZMax
+
+    import numpy as np
+    minor_array = np.arange(ZMin, ZMax, minor)
+    mayor_array = np.arange(ZMin, ZMax, mayor)
+    minor_array = np.array(list(filter(lambda x: x not in mayor_array, minor_array)))
+    calculateSection(minor_array)
+    calculateSection(mayor_array)
+
+def Contours_Part(Terrain, minor, mayor,
+                  minorColor, mayorColor,
+                  minorLineWidth, mayorLineWidth,
+                  filter_size): #filter_size de 3 a 21 y siempre impar
+
+    def calculateSection(cuts):
+        cnt = 0
+        for inc in cuts:
+            CrossSections = Terrain.Shape.slice(FreeCAD.Vector(0, 0, 1), inc)
+
+            for wire in CrossSections:
+                PointList = []
+                for vertex in wire.Vertexes:
+                    PointList.append(vertex.Point)
+
+                if len(PointList) > 1:
+                    # 1. Smooth the points
+                    if (len(PointList) > filter_size) and (filter_size > 0):
+                        for a in range(len(PointList)):
+                            x = 0
+                            y = 0
+                            for p in range(-filter_radius, filter_radius + 1):
+                                point_id = a + p
+                                if point_id < 0:
+                                    point_id = 0
+
+                                if point_id >= len(PointList):
+                                    point_id = len(PointList) - 1
+
+                                x += PointList[point_id].x
+                                y += PointList[point_id].y
+
+                            x /= filter_size
+                            y /= filter_size
+                            PointList[a].x = x
+                            PointList[a].y = y
+
+                        for a in reversed(range(len(PointList))):
+                            x = 0
+                            y = 0
+                            for p in range(-filter_radius, filter_radius + 1):
+                                point_id = a + p
+                                if point_id < 0:
+                                    point_id = 0
+
+                                if point_id >= len(PointList):
+                                    point_id = len(PointList) - 1
+
+                                x += PointList[point_id].x
+                                y += PointList[point_id].y
+
+                            x /= filter_size
+                            y /= filter_size
+                            PointList[a].x = x
+                            PointList[a].y = y
+                    # 2. TODO: close wire
+
+                    # 3. Make lines
+                    Contour = Draft.makeWire(PointList, closed=False, face=None, support=None)
+                    Contour.MakeFace = False
+                    Contour.Label = str(int(inc / 1000)) + "m"
+                    Contours.addObject(Contour)
+
+                    if inc % mayor == 0:
+                        Contour.ViewObject.LineWidth = mayorLineWidth
+                        Contour.ViewObject.LineColor = mayorColor
+                    else:
+                        Contour.ViewObject.LineWidth = minorLineWidth
+                        Contour.ViewObject.LineColor = minorColor
+            cnt += 1
+            if cnt == 10:
+                return
+
+    filter_radius = int(filter_size / 2)
+    try:
+        Contours = FreeCAD.ActiveDocument.Contours
+    except:
+        Contours = FreeCAD.ActiveDocument.addObject("App::DocumentObjectGroup", 'Contours')
+
+    ZMin = Terrain.Shape.BoundBox.ZMin // 10000
+    ZMin *= 10000
+    ZMax = Terrain.Shape.BoundBox.ZMax
+
+    import numpy as np
+    minor_array = np.arange(ZMin, ZMax, minor)
+    mayor_array = np.arange(ZMin, ZMax, mayor)
+    minor_array = np.array(list(filter(lambda x: x not in mayor_array, minor_array)))
+    calculateSection(minor_array)
+    calculateSection(mayor_array)
+
+# Base widget for task panel terrain analisys
+class _generalTaskPanel:
+    '''The TaskPanel for Slope setup'''
+
+    def __init__(self):
+        self.ranges = []
+
+        self.form = FreeCADGui.PySideUic.loadUi(os.path.dirname(__file__) + "/PVPlantTerrainAnalisys.ui")
+        self.tableWidget = self.form.tableWidget
+        self.form.editSteps.valueChanged.connect(self.changeDivision)
+        self.tableWidget.itemChanged.connect(self.cellChanged)
+
+    def cellChanged(self, item):
+        if (item.column() == 1) and (item.row() != (self.tableWidget.rowCount() - 1)):
+            item2 = self.tableWidget.item(item.row() + 1, 0)
+            item2.setText(item.text())
+
+    def updateTableValues(self):
+        maxval = self.form.editTo.value() - self.form.editFrom.value()
+        ran = maxval / self.tableWidget.rowCount()
+
+        for i in range(self.tableWidget.rowCount()):
+            for j in range(2):
+                item = self.tableWidget.item(i, j)
+                val = ran * (i + j) + self.form.editFrom.value()
+                item.setText('{:.1f}'.format(val))
+                self.ranges[i][j] = val
+
+        #self.tableWidget.item(0, 0).setText('{:.1f}'.format(self.form.editFrom.value()))
+        #self.tableWidget.item(self.tableWidget.rowCount() - 1, 1).setText('{:.1f}'.format(self.form.editTo.value()))
+
+    def changeDivision(self):
+        self.tableWidget.blockSignals(True)
+        rows = self.tableWidget.rowCount()
+        to = self.form.editSteps.value()
+        if to > rows:
+            for i in range(0, to - rows):
+                self.ranges.append([0.0, 0.0, (0.0, 0.0, 0.0)])
+                self.createRow()
+        elif to < rows:
+            self.tableWidget.setRowCount(to)
+            self.ranges = self.ranges[:to]
+        self.updateTableValues()
+        self.tableWidget.blockSignals(False)
+
+    def createRow(self):
+        row = self.tableWidget.rowCount()
+        self.tableWidget.setRowCount(self.tableWidget.rowCount() + 1)
+
+        newItem = QtGui.QTableWidgetItem("item")
+        self.tableWidget.setItem(row, 0, newItem)
+        newItem.setTextAlignment(QtCore.Qt.AlignCenter)
+        newItem.setText("0.0")
+        newItem.setFlags(QtCore.Qt.ItemIsSelectable|QtCore.Qt.ItemIsEditable|QtCore.Qt.ItemIsDragEnabled|
+                         QtCore.Qt.ItemIsDropEnabled|QtCore.Qt.ItemIsUserCheckable)
+
+        newItem = QtGui.QTableWidgetItem("item")
+        self.tableWidget.setItem(row, 1, newItem)
+        newItem.setTextAlignment(QtCore.Qt.AlignCenter)
+        newItem.setText("0.0")
+
+        #import random
+        # r = random.randint(0, 255)
+        # g = random.randint(0, 255)
+        # b = random.randint(0, 255)
+
+        val = int(127 * row / (self.form.editSteps.value() / 2))
+        g = (127 + val) if val <= 127 else 0
+        r = (328 - val if val >= 127 else 0)
+        color = QtGui.QColor(r, g, 0)
+        colorPix = QtGui.QPixmap(16, 16)
+        colorPix.fill(color)
+        self.ranges[row][2] = (color.red()/255, color.green()/255, color.blue()/255)
+        buttonColor = QtGui.QPushButton('')
+        buttonColor.setIcon(QtGui.QIcon(colorPix))
+        buttonColor.setMaximumSize(QtCore.QSize(20, 20))
+        buttonColor.clicked.connect(lambda: self.selColor(buttonColor))
+        self.tableWidget.setCellWidget(row, 2, buttonColor)
+
+    def selColor(self, button):
+        color = QtGui.QColorDialog.getColor()
+        if color.isValid():
+            print("añadir color")
+            colorPix = QtGui.QPixmap(16, 16)
+            colorPix.fill(color)
+            button.setIcon(QtGui.QIcon(colorPix))
+            curentIndex = self.tableWidget.currentIndex()
+            self.ranges[curentIndex.row()][2] = (color.red()/255, color.green()/255, color.blue()/255)
+
+# Contours Analisys: ---------------------------------------------------------------------------------
+class _ContourTaskPanel():
+    '''The editmode TaskPanel for contours generator'''
+
+    def __init__(self):
+        self.MinorColor = (0.5, 0.5, 0.5)
+        self.MayorColor = (0.5, 0.5, 0.5)
+        land = None
+        self.intervals = ["0.1 m", "0.5 m", "1 m", "5 m", "10 m", "50 m", "100 m", "500 m"]
+        self.intervalvalues = [0.1, 0.5, 1, 5, 10, 50, 100, 500]
+
+        # form:
+        self.form = QtGui.QWidget()
+        self.form.resize(800,640)
+        self.form.setWindowTitle("Curvas de nivel")
+        self.form.setWindowIcon(QtGui.QIcon(os.path.join(DirIcons, "contours.svg")))
+        self.grid = QtGui.QGridLayout(self.form)
+
+        # parameters
+        self.labelTerrain = QtGui.QLabel()
+        self.labelTerrain.setText("Terreno:")
+        self.lineEdit1 = QtGui.QLineEdit(self.form)
+        self.lineEdit1.setObjectName(_fromUtf8("lineEdit1"))
+        self.lineEdit1.readOnly = True
+        self.grid.addWidget(self.labelTerrain, self.grid.rowCount(), 0, 1, 1)
+        self.grid.addWidget(self.lineEdit1, self.grid.rowCount() - 1, 1, 1, 1)
+
+        self.buttonAdd = QtGui.QPushButton('Seleccionar Terreno')
+        self.buttonAdd.clicked.connect(self.add)
+        self.grid.addWidget(self.buttonAdd, self.grid.rowCount(), 1, 1, 1)
+
+        ###----------------------
+
+        self.widgetDivisions = QtGui.QGroupBox(self.form)
+        self.grid.addWidget(self.widgetDivisions, self.grid.rowCount(), 0, 1, -1)
+        self.gridDivisions = QtGui.QGridLayout(self.widgetDivisions)
+
+        self.labelTitle1 = QtGui.QLabel()
+        self.labelTitle1.setText("Intervalo")
+        self.labelTitle2 = QtGui.QLabel()
+        self.labelTitle2.setText("Grosor")
+        self.labelTitle3 = QtGui.QLabel()
+        self.labelTitle3.setText("Color")
+        self.gridDivisions.addWidget(self.labelTitle1, self.gridDivisions.rowCount(), 1, 1, -1)
+        self.gridDivisions.addWidget(self.labelTitle2, self.gridDivisions.rowCount() - 1, 2, 1, -1)
+        self.gridDivisions.addWidget(self.labelTitle3, self.gridDivisions.rowCount() - 1, 3, 1, -1)
+
+        self.labelMinorContour = QtGui.QLabel(self.form)
+        self.labelMinorContour.setText("Menor:")
+        self.inputMinorContourMargin = QtGui.QComboBox(self.form)
+        self.inputMinorContourMargin.addItems(self.intervals)
+        self.inputMinorContourMargin.setCurrentIndex(2)
+        self.inputMinorContourThickness = QtGui.QSpinBox(self.form)
+        self.inputMinorContourThickness.setRange(1, 10)
+        self.inputMinorContourThickness.setValue(2)
+
+        self.gridDivisions.addWidget(self.labelMinorContour, self.gridDivisions.rowCount(), 0, 1, 1)
+        self.gridDivisions.addWidget(self.inputMinorContourMargin, self.gridDivisions.rowCount() - 1, 1, 1, 1)
+        self.gridDivisions.addWidget(self.inputMinorContourThickness, self.gridDivisions.rowCount() - 1, 2, 1, 1)
+
+        self.buttonMinorContourColor = QtGui.QPushButton('')
+        self.color = QtGui.QColor(128, 128, 128)
+        colorPix = QtGui.QPixmap(16, 16)
+        colorPix.fill(self.color)
+        self.buttonMinorContourColor.setIcon(QtGui.QIcon(colorPix))
+        self.buttonMinorContourColor.clicked.connect(lambda: self.selColor(self.buttonMinorContourColor))
+        self.gridDivisions.addWidget(self.buttonMinorContourColor, self.gridDivisions.rowCount() - 1, 3, 1, 1)
+
+        ###----------------------
+        
+        self.labelMayorContour = QtGui.QLabel(self.form)
+        self.labelMayorContour.setText("Mayor:")
+
+        self.inputMayorContourMargin = QtGui.QComboBox(self.form)
+        self.inputMayorContourMargin.addItems(self.intervals)
+        self.inputMayorContourMargin.setCurrentIndex(3)
+
+        self.inputMayorContourThickness = QtGui.QSpinBox(self.form)
+        self.inputMayorContourThickness.setRange(1, 10)
+        self.inputMayorContourThickness.setValue(5)
+
+        self.gridDivisions.addWidget(self.labelMayorContour, self.gridDivisions.rowCount(), 0, 1, 1)
+        self.gridDivisions.addWidget(self.inputMayorContourMargin, self.gridDivisions.rowCount() - 1, 1, 1, 1)
+        self.gridDivisions.addWidget(self.inputMayorContourThickness, self.gridDivisions.rowCount() - 1, 2, 1, 1)
+
+        self.buttonMayorContourColor = QtGui.QPushButton('')
+        self.color = QtGui.QColor(128, 128, 128)
+        colorPix = QtGui.QPixmap(16, 16)
+        colorPix.fill(self.color)
+        self.buttonMayorContourColor.setIcon(QtGui.QIcon(colorPix))
+        self.buttonMayorContourColor.clicked.connect(lambda: self.selColor(self.buttonMayorContourColor))
+        self.gridDivisions.addWidget(self.buttonMayorContourColor, self.gridDivisions.rowCount() - 1, 3, 1, 1)
+
+
+    def add(self):
+        sel = FreeCADGui.Selection.getSelection()
+        if len(sel) > 0:
+            self.land = sel[0]
+            self.lineEdit1.setText(self.land.Label)
+
+    def selColor(self, button):
+        color = QtGui.QColorDialog.getColor()
+        colorPix = QtGui.QPixmap(16, 16)
+        colorPix.fill(color)
+        button.setIcon(QtGui.QIcon(colorPix))
+
+        r = float(color.red()/255.0)
+        g = float(color.green()/255.0)
+        b = float(color.blue()/255.0)
+        col = (r, g, b)
+
+        if button is self.buttonMinorContourColor:
+            self.MinorColor = col
+        elif button is self.buttonMayorContourColor:
+            self.MayorColor = col
+
+    def accept(self):
+        from datetime import datetime
+        starttime = datetime.now()
+
+        if self.land is None:
+            print("No hay objetos para procesar")
+            return False
+        else:
+            minor = FreeCAD.Units.Quantity(self.inputMinorContourMargin.currentText()).Value
+            mayor = FreeCAD.Units.Quantity(self.inputMayorContourMargin.currentText()).Value
+
+            i = 2
+            if i == 0:
+                makeContours(self.land, minor, mayor, self.MinorColor, self.MayorColor,
+                          self.inputMinorContourThickness.value(), self.inputMayorContourThickness.value())
+            elif i == 1:
+                import multiprocessing
+                p = multiprocessing.Process(target=makeContours,
+                                            args=(self.land, minor, mayor,
+                                                  self.MinorColor, self.MayorColor,
+                                                  self.inputMinorContourThickness.value(),
+                                                  self.inputMayorContourThickness.value(), ))
+                p.start()
+                p.join()
+
+            else:
+                import threading
+                hilo = threading.Thread(target = makeContours,
+                                        args = (self.land, minor, mayor,
+                                                self.MinorColor, self.MayorColor,
+                                                self.inputMinorContourThickness.value(),
+                                                self.inputMayorContourThickness.value()))
+                hilo.daemon = True
+                hilo.start()
+
+        total_time = datetime.now() - starttime
+        print(" -- Tiempo tardado:", total_time)
+        FreeCADGui.Control.closeDialog()
+        return True
+
+# Height Analisys: ---------------------------------------------------------------------------------
+class _HeightTaskPanel(_generalTaskPanel):
+    '''The TaskPanel for Slope setup'''
+
+    def __init__(self):
+        _generalTaskPanel.__init__(self)
+
+        # Initial set-up:
+        land = FreeCAD.ActiveDocument.Site.Terrain
+        self.form.editFrom.setSuffix(" m")
+        self.form.editFrom.setValue(land.Shape.BoundBox.ZMin / 1000)
+        self.form.editTo.setSuffix(" m")
+        self.form.editTo.setValue(land.Shape.BoundBox.ZMax / 1000)
+        self.form.editSteps.setValue(10)
+        self.form.editFrom.valueChanged.connect(self.updateTableValues)
+        self.form.editTo.valueChanged.connect(self.updateTableValues)
+
+    def accept(self):
+        land = FreeCAD.ActiveDocument.Site.Terrain
+        if land.isDerivedFrom("Part::Feature"):
+            colorlist = []
+            for face in land.Shape.Faces:
+                zz = face.CenterOfMass.z / 1000
+                color = (.0, .0, .0)
+                for i in range(1,len(self.ranges)):
+                    if self.ranges[i][0] <= zz <= self.ranges[i][1]:
+                        color = self.ranges[i][2]
+                        break
+                colorlist.append(color)
+            land.ViewObject.DiffuseColor = colorlist
+        FreeCAD.activeDocument().recompute()
+        return True
+
+# Slope Analisys: ---------------------------------------------------------------------------------
+class _SlopeTaskPanel(_generalTaskPanel):
+    '''The TaskPanel for Slope setup'''
+
+    def __init__(self):
+        _generalTaskPanel.__init__(self)
+        self.angles = self.getAngles()
+        # Initial set-up:
+        self.form.editFrom.setSuffix(" º")
+        self.form.editFrom.setValue(0)
+        self.form.editTo.setSuffix(" º")
+        self.form.editTo.setValue(max(self.angles))
+        self.form.editSteps.setValue(10)
+        self.form.editFrom.valueChanged.connect(self.updateTableValues)
+        self.form.editTo.valueChanged.connect(self.updateTableValues)
+
+    def getAngles(self):
+        import math
+        land = FreeCAD.ActiveDocument.Site.Terrain
+        angles = []
+        for face in land.Shape.Faces:
+            normal = face.normalAt(0, 0)
+            rad = normal.getAngle(FreeCAD.Vector(0, 0, 1))
+            angle = math.degrees(rad)
+            angles.append(angle)
+        return angles
+
+    def getPointSlope(self, ranges = None):
+        from datetime import datetime
+        starttime = datetime.now()
+        import math
+
+        land = FreeCAD.ActiveDocument.Site.Terrain
+        if land.isDerivedFrom("Part::Feature"):
+            colorlist = []
+            for face in land.Shape.Faces:
+                normal = face.normalAt(0, 0)
+                rad = normal.getAngle(FreeCAD.Vector(0, 0, 1))
+                angle = math.degrees(rad)
+                if(angle > 90):
+                    angle -= 90
+                color = (1.0, 1.0, 1.0)
+                for i in range(0, len(ranges)):
+                    if ranges[i][0] <= angle <= ranges[i][1]:
+                        color = ranges[i][2]
+                        break
+                colorlist.append(color)
+            print(len(land.Shape.Faces) == len(colorlist))
+            land.ViewObject.DiffuseColor = colorlist
+
+        # TODO: check this code:
+        elif obj.isDerivedFrom("Mesh::Feature"):
+            fMesh = Mest2FemMesh(land)
+            import math
+            setColors = []
+            i = 1
+            normals = land.Mesh.getPointNormals()
+            for normal in normals:
+                rad = normal.getAngle(FreeCAD.Vector(0, 0, 1))
+                angle = math.degrees(rad)
+
+                # Cambiar esto a la lista de colores configurable
+                if angle < 5:
+                    setColors[i] = (0.0, 0.5, 0.0)
+                elif angle < 7.5:
+                    setColors[i] = (0.0, 1.0, 0.5)
+                elif (angle < 10):
+                    setColors[i] = (0.0, 1.0, 1.0)
+                elif (angle < 12.5):
+                    setColors[i] = (0.0, 0.0, 0.5)
+                elif (angle < 14):
+                    setColors[i] = (0.0, 0.0, 1.0)
+                elif (angle > 20):
+                    setColors[i] = (1.0, 0.0, 0.0)
+                else:
+                    setColors[i] = (1.0, 1.0, 1.0)
+                i += 1
+
+            fMesh.ViewObject.NodeColor = setColors
+
+        FreeCAD.activeDocument().recompute()
+        print("Everything OK (", datetime.now() - starttime, ")")
+
+    def accept(self):
+        # self.getPointSlope()
+        import threading
+        hilo = threading.Thread(target=self.getPointSlope(self.ranges))
+        hilo.start()
+        return True
+
+# Orientation Analisys: ---------------------------------------------------------------------------------
+class _OrientationTaskPanel(_generalTaskPanel):
+    '''The TaskPanel for Orientation setup'''
+
+    def __init__(self):
+        _generalTaskPanel.__init__(self)
+
+        self.getAngles()
+
+        # Initial set-up:
+        self.form.editFrom.setSuffix(" º")
+        self.form.editFrom.setValue(0.0)
+        self.form.editTo.setSuffix(" º")
+        self.form.editTo.setMaximum(360.0)
+        self.form.editTo.setValue(360.0)
+        self.form.editSteps.setValue(15)
+        self.form.editFrom.valueChanged.connect(self.updateTableValues)
+        self.form.editTo.valueChanged.connect(self.updateTableValues)
+
+    def getAngles(self):
+        import math
+        land = FreeCAD.ActiveDocument.Site.Terrain
+        anglesx = []
+        anglesy = []
+        for face in land.Shape.Faces:
+            normal = face.normalAt(0, 0)
+            normal.z = 0
+            anglesx.append(math.degrees(normal.getAngle(FreeCAD.Vector(1, 0, 0))))
+            anglesy.append(math.degrees(normal.getAngle(FreeCAD.Vector(0, 1, 0))))
+
+        print("Min x: ", min(anglesx), " y: ", min(anglesy))
+        print("Max x: ", max(anglesx), " y: ", max(anglesy))
+        return anglesx, anglesy
+
+    def accept(self):
+        import math
+        from datetime import datetime
+        starttime = datetime.now()
+
+        land = FreeCAD.ActiveDocument.Site.Terrain
+        if land.isDerivedFrom("Part::Feature"):
+            colorlist = []
+            j = 0
+            minx = 99999
+            miny = 99999
+            for face in land.Shape.Faces:
+                normal = face.normalAt(0, 0)
+                normal.z = 0
+                anglex = math.degrees(normal.getAngle(FreeCAD.Vector(1, 0, 0)))
+                angley = math.degrees(normal.getAngle(FreeCAD.Vector(0, 1, 0)))
+
+                minx = min([minx, anglex])
+                miny = min([miny, angley])
+                if angley >= 90:
+                    anglex = 360.0 - anglex
+
+                #print(anglex, " ", angley)
+                for i in range(1, len(self.ranges)):
+                    if self.ranges[i][0] <= anglex <= self.ranges[i][1]:
+                        colorlist.append(self.ranges[i][2])
+                        break
+                j += 1
+                if j == 100:
+                    break
+            land.ViewObject.DiffuseColor = colorlist
+            print("Angulos: ", math.degrees(minx), " - ", miny)
+
+        # TODO: check this code:
+        elif land.isDerivedFrom("Mesh::Feature"):
+            fMesh = Mest2FemMesh(land)
+            fMesh = Mest2FemMesh(land)
+
+            setColors = {}
+            i = 1
+            normals = land.Mesh.getPointNormals()
+            print("   ---------   time to FEMMESH:  (", datetime.now() - starttime, ")")
+
+            for normal in normals:
+                rad = normal.getAngle(FreeCAD.Vector(1, 1, 0))
+                angle = math.degrees(rad)
+
+                # Cambiar esto a la lista de colores configurable
+                if angle < 45:
+                    setColors[i] = (0.0, 1.0, 0.0)
+                elif (angle < 90):
+                    setColors[i] = (0.0, 1.0, 1.0)
+                elif (angle < 135):
+                    setColors[i] = (0.0, 0.0, 1.0)
+                elif (angle <= 180):
+                    setColors[i] = (1.0, 0.0, 1.0)
+                #else:
+                #    setColors[i] = (1.0, 0.0, 0.0)
+
+                i += 1
+                if i== 1000:
+                    break
+
+            fMesh.ViewObject.NodeColor = setColors
+
+        FreeCAD.activeDocument().recompute()
+        print("Everything OK (", datetime.now() - starttime, ")")
+        return True
+
+## Commands ----------------------------------------------------------------------------------------------------------
+## 1. Contours:
+class _CommandContours:
+    def GetResources(self):
+        return {'Pixmap': str(os.path.join(DirIcons, "TerrainContours.svg")),
+                'Accel': "T, C",
+                'MenuText': 'Curvas de nivel',
+                'ToolTip': 'Curvas de nivel'
+                }
+
+    def IsActive(self):
+        # return not FreeCAD.ActiveDocument is None
+        if FreeCAD.ActiveDocument is None:
+            return False
+
+        return True
+
+        if FreeCADGui.Selection.getSelection() is not None:
+            selection = FreeCADGui.Selection.getSelection()[-1]
+            if selection.TypeId == 'Mesh::Feature':
+                return True
+
+        return False
+
+    def Activated(self):
+        self.TaskPanel = _ContourTaskPanel()
+        FreeCADGui.Control.showDialog(self.TaskPanel)
+
+## 2. Aspect:
+class _CommandSlopeAnalisys:
+    def GetResources(self):
+        return {'Pixmap': str(os.path.join(DirIcons, "TerrainSlope.svg")),
+                'Accel': "T, S",
+                'MenuText': 'Analisis de Pendiente',
+                'ToolTip': 'Analisis de Pendiente'
+                }
+
+    def IsActive(self):
+        return not FreeCAD.ActiveDocument is None
+
+    def Activated(self):
+        self.TaskPanel = _SlopeTaskPanel()
+        FreeCADGui.Control.showDialog(self.TaskPanel)
+
+## 3. Height:
+class _CommandHeightAnalisys:
+    def GetResources(self):
+        return {'Pixmap': str(os.path.join(DirIcons, "TerrainHeight.svg")),
+                'Accel': "T, H",
+                'MenuText': 'Analisis de Altura',
+                'ToolTip': 'Analisis de Altura'
+                }
+
+    def IsActive(self):
+        return not FreeCAD.ActiveDocument is None
+
+    def Activated(self):
+        self.TaskPanel = _HeightTaskPanel()
+        FreeCADGui.Control.showDialog(self.TaskPanel)
+
+## 4. Orientation:
+class _CommandOrientationAnalisys:
+
+    def GetResources(self):
+        return {'Pixmap': str(os.path.join(DirIcons, "TerrainOrientation.svg")),
+                'Accel': "T, H",
+                'MenuText': 'Analisis de Orientación',
+			    'ToolTip': 'Analisis de Orientación'
+                }
+
+    def IsActive(self):
+        return not FreeCAD.ActiveDocument is None
+
+    def Activated(self):
+        self.TaskPanel = _OrientationTaskPanel()
+        FreeCADGui.Control.showDialog(self.TaskPanel)
+
+## 5. Commands
+if FreeCAD.GuiUp:
+    class CommandTerrainAnalisysGroup:
+
+        def GetCommands(self):
+            return tuple(['Contours',
+                          'HeightAnalisys',
+                          'SlopeAnalisys',
+                          'OrientationAnalisys'
+                          ])
+        def GetResources(self):
+            return { 'MenuText': QT_TRANSLATE_NOOP("",'Terrain Analisys'),
+                     'ToolTip': QT_TRANSLATE_NOOP("",'Terrain Analisys')
+                   }
+        def IsActive(self):
+            return not FreeCAD.ActiveDocument is None
+
+    FreeCADGui.addCommand('Contours', _CommandContours())
+    FreeCADGui.addCommand('SlopeAnalisys', _CommandSlopeAnalisys())
+    FreeCADGui.addCommand('HeightAnalisys', _CommandHeightAnalisys())
+    FreeCADGui.addCommand('OrientationAnalisys', _CommandOrientationAnalisys())
+    FreeCADGui.addCommand('TerrainAnalisys', CommandTerrainAnalisysGroup())

PVPlantTerrainAnalisys.ui

@@ -0,0 +1,172 @@
+<?xml version="1.0" encoding="UTF-8"?>
+<ui version="4.0">
+ <class>form</class>
+ <widget class="QDialog" name="form">
+  <property name="geometry">
+   <rect>
+    <x>0</x>
+    <y>0</y>
+    <width>386</width>
+    <height>511</height>
+   </rect>
+  </property>
+  <property name="windowTitle">
+   <string>Terrain Analisys</string>
+  </property>
+  <layout class="QVBoxLayout" name="verticalLayout">
+   <property name="leftMargin">
+    <number>0</number>
+   </property>
+   <property name="topMargin">
+    <number>0</number>
+   </property>
+   <property name="rightMargin">
+    <number>0</number>
+   </property>
+   <property name="bottomMargin">
+    <number>0</number>
+   </property>
+   <item>
+    <widget class="QGroupBox" name="groupBox_2">
+     <property name="title">
+      <string>Table setup</string>
+     </property>
+     <layout class="QGridLayout" name="gridLayout_3">
+      <property name="leftMargin">
+       <number>20</number>
+      </property>
+      <property name="spacing">
+       <number>2</number>
+      </property>
+      <item row="3" column="1">
+       <widget class="QDoubleSpinBox" name="editTo">
+        <property name="alignment">
+         <set>Qt::AlignRight|Qt::AlignTrailing|Qt::AlignVCenter</set>
+        </property>
+        <property name="buttonSymbols">
+         <enum>QAbstractSpinBox::NoButtons</enum>
+        </property>
+        <property name="maximum">
+         <double>999999.000000000000000</double>
+        </property>
+        <property name="singleStep">
+         <double>0.010000000000000</double>
+        </property>
+       </widget>
+      </item>
+      <item row="1" column="1">
+       <widget class="QDoubleSpinBox" name="editFrom">
+        <property name="layoutDirection">
+         <enum>Qt::LeftToRight</enum>
+        </property>
+        <property name="alignment">
+         <set>Qt::AlignRight|Qt::AlignTrailing|Qt::AlignVCenter</set>
+        </property>
+        <property name="buttonSymbols">
+         <enum>QAbstractSpinBox::NoButtons</enum>
+        </property>
+        <property name="minimum">
+         <double>-999999.000000000000000</double>
+        </property>
+        <property name="maximum">
+         <double>999999.000000000000000</double>
+        </property>
+       </widget>
+      </item>
+      <item row="3" column="0">
+       <widget class="QLabel" name="label_2">
+        <property name="text">
+         <string>Valor final</string>
+        </property>
+       </widget>
+      </item>
+      <item row="1" column="0">
+       <widget class="QLabel" name="label">
+        <property name="text">
+         <string>Valor inicial</string>
+        </property>
+       </widget>
+      </item>
+      <item row="0" column="0">
+       <widget class="QLabel" name="label_4">
+        <property name="text">
+         <string>Pasos</string>
+        </property>
+       </widget>
+      </item>
+      <item row="0" column="1">
+       <widget class="QSpinBox" name="editSteps">
+        <property name="sizePolicy">
+         <sizepolicy hsizetype="Fixed" vsizetype="Fixed">
+          <horstretch>0</horstretch>
+          <verstretch>0</verstretch>
+         </sizepolicy>
+        </property>
+        <property name="minimumSize">
+         <size>
+          <width>140</width>
+          <height>0</height>
+         </size>
+        </property>
+        <property name="alignment">
+         <set>Qt::AlignRight|Qt::AlignTrailing|Qt::AlignVCenter</set>
+        </property>
+        <property name="buttonSymbols">
+         <enum>QAbstractSpinBox::NoButtons</enum>
+        </property>
+        <property name="minimum">
+         <number>1</number>
+        </property>
+        <property name="maximum">
+         <number>60</number>
+        </property>
+        <property name="value">
+         <number>3</number>
+        </property>
+       </widget>
+      </item>
+     </layout>
+    </widget>
+   </item>
+   <item>
+    <widget class="QWidget" name="widget" native="true">
+     <layout class="QVBoxLayout" name="verticalLayout_2">
+      <property name="leftMargin">
+       <number>0</number>
+      </property>
+      <item>
+       <widget class="QTableWidget" name="tableWidget">
+        <property name="wordWrap">
+         <bool>false</bool>
+        </property>
+        <property name="cornerButtonEnabled">
+         <bool>false</bool>
+        </property>
+        <attribute name="verticalHeaderVisible">
+         <bool>false</bool>
+        </attribute>
+        <column>
+         <property name="text">
+          <string>Valor min</string>
+         </property>
+        </column>
+        <column>
+         <property name="text">
+          <string>Valor max</string>
+         </property>
+        </column>
+        <column>
+         <property name="text">
+          <string>Color</string>
+         </property>
+        </column>
+       </widget>
+      </item>
+     </layout>
+    </widget>
+   </item>
+  </layout>
+ </widget>
+ <resources/>
+ <connections/>
+</ui>

PVPlantTree.ui

@@ -0,0 +1,435 @@
+<?xml version="1.0" encoding="UTF-8"?>
+<ui version="4.0">
+ <class>formRack</class>
+ <widget class="QDialog" name="formRack">
+  <property name="geometry">
+   <rect>
+    <x>0</x>
+    <y>0</y>
+    <width>222</width>
+    <height>280</height>
+   </rect>
+  </property>
+  <property name="windowTitle">
+   <string>Tracker:</string>
+  </property>
+  <layout class="QVBoxLayout" name="verticalLayout">
+   <property name="leftMargin">
+    <number>5</number>
+   </property>
+   <property name="topMargin">
+    <number>5</number>
+   </property>
+   <property name="rightMargin">
+    <number>5</number>
+   </property>
+   <property name="bottomMargin">
+    <number>5</number>
+   </property>
+   <item>
+    <widget class="QGroupBox" name="groupBox_2">
+     <property name="title">
+      <string>Canopy</string>
+     </property>
+     <layout class="QGridLayout" name="gridLayout_3">
+      <property name="rightMargin">
+       <number>5</number>
+      </property>
+      <property name="bottomMargin">
+       <number>5</number>
+      </property>
+      <property name="verticalSpacing">
+       <number>2</number>
+      </property>
+      <item row="1" column="0">
+       <widget class="QLabel" name="label_2">
+        <property name="text">
+         <string>Radius</string>
+        </property>
+       </widget>
+      </item>
+      <item row="9" column="0">
+       <widget class="QLabel" name="label_18">
+        <property name="text">
+         <string>Divisiones</string>
+        </property>
+       </widget>
+      </item>
+      <item row="0" column="0">
+       <widget class="QLabel" name="label">
+        <property name="text">
+         <string>Height</string>
+        </property>
+       </widget>
+      </item>
+      <item row="3" column="1">
+       <widget class="QDoubleSpinBox" name="editCrownExpansion">
+        <property name="sizePolicy">
+         <sizepolicy hsizetype="Fixed" vsizetype="Fixed">
+          <horstretch>0</horstretch>
+          <verstretch>0</verstretch>
+         </sizepolicy>
+        </property>
+        <property name="minimumSize">
+         <size>
+          <width>100</width>
+          <height>0</height>
+         </size>
+        </property>
+        <property name="alignment">
+         <set>Qt::AlignRight|Qt::AlignTrailing|Qt::AlignVCenter</set>
+        </property>
+        <property name="buttonSymbols">
+         <enum>QAbstractSpinBox::NoButtons</enum>
+        </property>
+        <property name="maximum">
+         <double>1.000000000000000</double>
+        </property>
+        <property name="singleStep">
+         <double>0.050000000000000</double>
+        </property>
+        <property name="value">
+         <double>0.500000000000000</double>
+        </property>
+       </widget>
+      </item>
+      <item row="3" column="0">
+       <widget class="QLabel" name="label_8">
+        <property name="text">
+         <string>Crown Expansion</string>
+        </property>
+       </widget>
+      </item>
+      <item row="4" column="1">
+       <widget class="QDoubleSpinBox" name="editLeftUmbrellaEffect">
+        <property name="sizePolicy">
+         <sizepolicy hsizetype="Fixed" vsizetype="Fixed">
+          <horstretch>0</horstretch>
+          <verstretch>0</verstretch>
+         </sizepolicy>
+        </property>
+        <property name="minimumSize">
+         <size>
+          <width>100</width>
+          <height>0</height>
+         </size>
+        </property>
+        <property name="alignment">
+         <set>Qt::AlignRight|Qt::AlignTrailing|Qt::AlignVCenter</set>
+        </property>
+        <property name="buttonSymbols">
+         <enum>QAbstractSpinBox::NoButtons</enum>
+        </property>
+        <property name="maximum">
+         <double>1.000000000000000</double>
+        </property>
+        <property name="singleStep">
+         <double>0.050000000000000</double>
+        </property>
+        <property name="value">
+         <double>0.000000000000000</double>
+        </property>
+       </widget>
+      </item>
+      <item row="2" column="1">
+       <widget class="QDoubleSpinBox" name="editSpikiness">
+        <property name="sizePolicy">
+         <sizepolicy hsizetype="Fixed" vsizetype="Fixed">
+          <horstretch>0</horstretch>
+          <verstretch>0</verstretch>
+         </sizepolicy>
+        </property>
+        <property name="minimumSize">
+         <size>
+          <width>100</width>
+          <height>0</height>
+         </size>
+        </property>
+        <property name="alignment">
+         <set>Qt::AlignRight|Qt::AlignTrailing|Qt::AlignVCenter</set>
+        </property>
+        <property name="buttonSymbols">
+         <enum>QAbstractSpinBox::NoButtons</enum>
+        </property>
+        <property name="maximum">
+         <double>1.000000000000000</double>
+        </property>
+        <property name="singleStep">
+         <double>0.050000000000000</double>
+        </property>
+        <property name="value">
+         <double>0.000000000000000</double>
+        </property>
+       </widget>
+      </item>
+      <item row="4" column="0">
+       <widget class="QLabel" name="label_17">
+        <property name="text">
+         <string>Umbrella effect</string>
+        </property>
+       </widget>
+      </item>
+      <item row="9" column="1">
+       <widget class="QSpinBox" name="editLeafCount">
+        <property name="sizePolicy">
+         <sizepolicy hsizetype="Fixed" vsizetype="Fixed">
+          <horstretch>0</horstretch>
+          <verstretch>0</verstretch>
+         </sizepolicy>
+        </property>
+        <property name="minimumSize">
+         <size>
+          <width>100</width>
+          <height>0</height>
+         </size>
+        </property>
+        <property name="alignment">
+         <set>Qt::AlignRight|Qt::AlignTrailing|Qt::AlignVCenter</set>
+        </property>
+        <property name="buttonSymbols">
+         <enum>QAbstractSpinBox::NoButtons</enum>
+        </property>
+        <property name="minimum">
+         <number>1</number>
+        </property>
+        <property name="maximum">
+         <number>100</number>
+        </property>
+        <property name="value">
+         <number>20</number>
+        </property>
+       </widget>
+      </item>
+      <item row="2" column="0">
+       <widget class="QLabel" name="label_4">
+        <property name="text">
+         <string>Spikiness</string>
+        </property>
+       </widget>
+      </item>
+      <item row="1" column="1">
+       <widget class="QDoubleSpinBox" name="editCanopyRadius">
+        <property name="sizePolicy">
+         <sizepolicy hsizetype="Fixed" vsizetype="Fixed">
+          <horstretch>0</horstretch>
+          <verstretch>0</verstretch>
+         </sizepolicy>
+        </property>
+        <property name="minimumSize">
+         <size>
+          <width>100</width>
+          <height>0</height>
+         </size>
+        </property>
+        <property name="alignment">
+         <set>Qt::AlignRight|Qt::AlignTrailing|Qt::AlignVCenter</set>
+        </property>
+        <property name="buttonSymbols">
+         <enum>QAbstractSpinBox::NoButtons</enum>
+        </property>
+        <property name="suffix">
+         <string> m</string>
+        </property>
+        <property name="minimum">
+         <double>0.010000000000000</double>
+        </property>
+        <property name="maximum">
+         <double>20.000000000000000</double>
+        </property>
+        <property name="value">
+         <double>1.500000000000000</double>
+        </property>
+       </widget>
+      </item>
+      <item row="0" column="1">
+       <widget class="QDoubleSpinBox" name="editCanopyHeight">
+        <property name="sizePolicy">
+         <sizepolicy hsizetype="Fixed" vsizetype="Fixed">
+          <horstretch>0</horstretch>
+          <verstretch>0</verstretch>
+         </sizepolicy>
+        </property>
+        <property name="minimumSize">
+         <size>
+          <width>100</width>
+          <height>0</height>
+         </size>
+        </property>
+        <property name="alignment">
+         <set>Qt::AlignRight|Qt::AlignTrailing|Qt::AlignVCenter</set>
+        </property>
+        <property name="buttonSymbols">
+         <enum>QAbstractSpinBox::NoButtons</enum>
+        </property>
+        <property name="suffix">
+         <string> m</string>
+        </property>
+        <property name="minimum">
+         <double>0.010000000000000</double>
+        </property>
+        <property name="maximum">
+         <double>20.000000000000000</double>
+        </property>
+        <property name="value">
+         <double>4.000000000000000</double>
+        </property>
+       </widget>
+      </item>
+     </layout>
+    </widget>
+   </item>
+   <item>
+    <widget class="QGroupBox" name="groupBox">
+     <property name="sizePolicy">
+      <sizepolicy hsizetype="Preferred" vsizetype="Fixed">
+       <horstretch>0</horstretch>
+       <verstretch>0</verstretch>
+      </sizepolicy>
+     </property>
+     <property name="title">
+      <string>Trunk</string>
+     </property>
+     <layout class="QGridLayout" name="gridLayout">
+      <property name="leftMargin">
+       <number>5</number>
+      </property>
+      <property name="topMargin">
+       <number>5</number>
+      </property>
+      <property name="rightMargin">
+       <number>5</number>
+      </property>
+      <property name="bottomMargin">
+       <number>5</number>
+      </property>
+      <property name="horizontalSpacing">
+       <number>5</number>
+      </property>
+      <property name="verticalSpacing">
+       <number>2</number>
+      </property>
+      <item row="0" column="0">
+       <widget class="QLabel" name="label_9">
+        <property name="text">
+         <string>Height</string>
+        </property>
+       </widget>
+      </item>
+      <item row="1" column="0">
+       <widget class="QLabel" name="label_10">
+        <property name="text">
+         <string>Radius</string>
+        </property>
+       </widget>
+      </item>
+      <item row="0" column="1">
+       <widget class="QDoubleSpinBox" name="editTrunkHeight">
+        <property name="sizePolicy">
+         <sizepolicy hsizetype="Fixed" vsizetype="Fixed">
+          <horstretch>0</horstretch>
+          <verstretch>0</verstretch>
+         </sizepolicy>
+        </property>
+        <property name="minimumSize">
+         <size>
+          <width>100</width>
+          <height>0</height>
+         </size>
+        </property>
+        <property name="alignment">
+         <set>Qt::AlignRight|Qt::AlignTrailing|Qt::AlignVCenter</set>
+        </property>
+        <property name="buttonSymbols">
+         <enum>QAbstractSpinBox::NoButtons</enum>
+        </property>
+        <property name="suffix">
+         <string> m</string>
+        </property>
+        <property name="maximum">
+         <double>50.000000000000000</double>
+        </property>
+        <property name="singleStep">
+         <double>0.100000000000000</double>
+        </property>
+        <property name="value">
+         <double>2.000000000000000</double>
+        </property>
+       </widget>
+      </item>
+      <item row="1" column="1">
+       <widget class="QDoubleSpinBox" name="editTrunkRadius">
+        <property name="sizePolicy">
+         <sizepolicy hsizetype="Fixed" vsizetype="Fixed">
+          <horstretch>0</horstretch>
+          <verstretch>0</verstretch>
+         </sizepolicy>
+        </property>
+        <property name="minimumSize">
+         <size>
+          <width>100</width>
+          <height>0</height>
+         </size>
+        </property>
+        <property name="alignment">
+         <set>Qt::AlignRight|Qt::AlignTrailing|Qt::AlignVCenter</set>
+        </property>
+        <property name="buttonSymbols">
+         <enum>QAbstractSpinBox::NoButtons</enum>
+        </property>
+        <property name="suffix">
+         <string> m</string>
+        </property>
+        <property name="minimum">
+         <double>0.010000000000000</double>
+        </property>
+        <property name="maximum">
+         <double>50.000000000000000</double>
+        </property>
+        <property name="singleStep">
+         <double>0.100000000000000</double>
+        </property>
+        <property name="value">
+         <double>0.150000000000000</double>
+        </property>
+       </widget>
+      </item>
+      <item row="2" column="0">
+       <widget class="QLabel" name="label_11">
+        <property name="text">
+         <string>Faces</string>
+        </property>
+       </widget>
+      </item>
+      <item row="2" column="1">
+       <widget class="QSpinBox" name="editTrunkFaces">
+        <property name="sizePolicy">
+         <sizepolicy hsizetype="Fixed" vsizetype="Fixed">
+          <horstretch>0</horstretch>
+          <verstretch>0</verstretch>
+         </sizepolicy>
+        </property>
+        <property name="minimumSize">
+         <size>
+          <width>100</width>
+          <height>0</height>
+         </size>
+        </property>
+        <property name="alignment">
+         <set>Qt::AlignRight|Qt::AlignTrailing|Qt::AlignVCenter</set>
+        </property>
+        <property name="buttonSymbols">
+         <enum>QAbstractSpinBox::NoButtons</enum>
+        </property>
+        <property name="value">
+         <number>6</number>
+        </property>
+       </widget>
+      </item>
+     </layout>
+    </widget>
+   </item>
+  </layout>
+ </widget>
+ <resources/>
+ <connections/>
+</ui>

PVPlantTreeGenerator.py

@@ -0,0 +1,368 @@
+
+import math
+
+import ArchComponent
+import FreeCAD
+
+if FreeCAD.GuiUp:
+    import FreeCADGui
+    from PySide import QtCore, QtGui
+    from DraftTools import translate
+    from PySide.QtCore import QT_TRANSLATE_NOOP
+
+    import Part
+    import os
+else:
+    # \cond
+    def translate(ctxt, txt):
+        return txt
+
+
+    def QT_TRANSLATE_NOOP(ctxt, txt):
+        return txt
+    # \endcond
+
+__title__ = "FreeCAD Fixed Rack"
+__author__ = "Javier Braña"
+__url__ = "http://www.sogos-solar.com"
+
+__dir__ = os.path.join(FreeCAD.getUserAppDataDir(), "Mod", "PVPlant")
+DirResources = os.path.join(__dir__, "Resources")
+DirIcons = os.path.join(DirResources, "Icons")
+DirImages = os.path.join(DirResources, "Images")
+
+
+def makeTree():
+    obj = FreeCAD.ActiveDocument.addObject("Part::FeaturePython", "Tree")
+    Tree(obj)
+    ViewProviderTree(obj.ViewObject)
+    FreeCAD.ActiveDocument.recompute()
+
+    try:
+        folder = FreeCAD.ActiveDocument.Vegetation
+    except:
+        folder = FreeCAD.ActiveDocument.addObject("App::DocumentObjectGroup", 'Vegetation')
+        folder.Label = "Vegetation"
+    folder.addObject(obj)
+
+    return obj
+
+
+class Tree(ArchComponent.Component):
+    """ A Shadow Tree Obcject """
+
+    def __init__(self, obj):
+        # Definición de variables:
+        ArchComponent.Component.__init__(self, obj)
+        self.obj = obj
+        self.setProperties(obj)
+
+    def setProperties(self, obj):
+        # Definicion de Propiedades:
+        pl = obj.PropertiesList
+
+        # CANOPY: ---------------------------------------------------------
+        if not ("CanopyHeight" in pl):
+            obj.addProperty("App::PropertyLength",
+                            "CanopyHeight",
+                            "Canopy",
+                            QT_TRANSLATE_NOOP("App::Property", "The height of self object")
+                            ).CanopyHeight = 4000
+
+        if not ("CanopyRadius" in pl):
+            obj.addProperty("App::PropertyLength",
+                            "CanopyRadius",
+                            "Canopy",
+                            QT_TRANSLATE_NOOP("App::Property", "The height of self object")
+                            ).CanopyRadius = 1500
+
+        if not ("Spikiness" in pl):
+            obj.addProperty("App::PropertyFloatConstraint",
+                            "Spikiness",
+                            "Canopy",
+                            QT_TRANSLATE_NOOP("App::Property", "The height of self object")
+                            ).Spikiness = (0.5, 0.0, 1.0, 0.05)  # (Default, Start, Finish, Step)
+
+        '''
+        if not ("Lumpiness" in pl):
+            obj.addProperty("App::PropertyFloatConstraint",
+                            "Lumpiness",
+                            "Canopy",
+                            QT_TRANSLATE_NOOP("App::Property", "The height of self object")
+                            ).Lumpiness = (0.0, 0.0, 1.0, 0.05) #(Default, Start, Finish, Step)'''
+
+        if not ("CrownExpansion" in pl):
+            obj.addProperty("App::PropertyFloatConstraint",
+                            "CrownExpansion",
+                            "Canopy",
+                            QT_TRANSLATE_NOOP("App::Property", "The height of self object")
+                            ).CrownExpansion = (1.0, 0.0, 2.0, 0.05)  # (Default, Start, Finish, Step)
+
+        if not ("UmbrellaEffect" in pl):
+            obj.addProperty("App::PropertyFloatConstraint",
+                            "UmbrellaEffect",
+                            "Canopy",
+                            QT_TRANSLATE_NOOP("App::Property", "The height of self object")
+                            ).UmbrellaEffect = (0.0, 0.0, 1.0, 0.05)  # (Default, Start, Finish, Step)
+
+        if not ("LeafCount" in pl):
+            obj.addProperty("App::PropertyQuantity",
+                            "LeafCount",
+                            "Canopy",
+                            QT_TRANSLATE_NOOP("App::Property", "The height of self object")
+                            ).LeafCount = 20
+
+        # TRUNK: ------------------------------------------------------------------------------------------------------
+        if not ("TrunkHeight" in pl):
+            obj.addProperty("App::PropertyLength",
+                            "TrunkHeight",
+                            "Trunk",
+                            QT_TRANSLATE_NOOP("App::Property", "The height of self object")
+                            ).TrunkHeight = 2000
+
+        if not ("TrunkRadius" in pl):
+            obj.addProperty("App::PropertyLength",
+                            "TrunkRadius",
+                            "Trunk",
+                            QT_TRANSLATE_NOOP("App::Property", "The height of self object")
+                            ).TrunkRadius = 150
+
+        if not ("TrunkFaces" in pl):
+            obj.addProperty("App::PropertyQuantity",
+                            "TrunkFaces",
+                            "Trunk",
+                            QT_TRANSLATE_NOOP("App::Property", "The height of self object")
+                            ).TrunkFaces = 6
+
+        if not ("Type" in pl):
+            obj.addProperty("App::PropertyString",
+                            "Type",
+                            "Base",
+                            "Type").Type = "Vegetable-Tree"
+        obj.setEditorMode("Type", 1)
+
+        self.Type = obj.Type
+        obj.Proxy = self
+        obj.IfcType = "Shading Device"
+        obj.setEditorMode("IfcType", 1)
+
+    def onDocumentRestored(self, obj):
+        ArchComponent.Component.onDocumentRestored(self, obj)
+        self.setProperties(obj)
+
+    def onChanged(self, obj, prop):
+        '''if prop in ["CanopyHeight", "CanopyHeight", "Spikiness", "CrownExpansion", "UmbrellaEffect",
+                    "LeafCount"]:
+            self.canopy = self.createCanopy(obj)
+
+        if prop in ["TrunkHeight", "TrunkRadius", "TrunkFaces"]:
+            self.trunk = self.createTrunk(obj)'''
+
+    def createTrunk(self, obj):
+        import Part
+        angle = (math.pi * 2) / obj.TrunkFaces.Value
+        delta = obj.TrunkRadius.Value
+        pts = [FreeCAD.Vector(delta, 0, 0)]
+        for i in range(int(obj.TrunkFaces.Value) - 1):
+            ang = (i + 1) * angle
+            pts.append(FreeCAD.Vector(delta * math.cos(ang),
+                                      delta * math.sin(ang),
+                                      0))
+        pts.append(pts[0])
+        p1 = Part.makePolygon(pts)
+        p0 = p1.makeOffset2D(90, 2, False, False, True)
+        p2 = p1.makeOffset2D(-50, 2, False, False, True)
+        p0.Placement.Base.z = -150
+        p1.Placement.Base.z = 150
+        p2.Placement.Base.z = obj.TrunkHeight.Value - 250
+        return Part.makeLoft([p0, p1, p2], True, True, False)
+
+    def createCanopy(self, obj):
+        import Part
+        import random
+        import Mesh
+        import numpy as np
+
+        ncircles = int(obj.LeafCount.Value)
+        if ncircles % 2 == 0:
+            ncircles += 1
+        half_ncircles = int(ncircles / 2)
+        ncirclesumbrella = int(half_ncircles/2)
+        ncirclestop = ncircles - ncirclesumbrella
+
+        # 1. Create circles to define the sphere
+        circles = []
+        dist = 2 * obj.CanopyRadius.Value / (ncircles - 1)
+        margin = dist * 0.01
+        '''for i in range(half_ncircles + 1):
+            if i > 0:
+                d = (obj.CanopyRadius.Value - dist * i)
+            else:
+                d = obj.CanopyRadius.Value - margin
+            r = (obj.CanopyRadius.Value ** 2 - d ** 2) ** 0.5
+            c = Part.makeCircle(r)
+            circles.append(c)
+
+        ctmp = [c.copy() for c in circles]
+        ctmp.pop()
+        ctmp.reverse()
+        circles.extend(ctmp)'''
+
+        d = - obj.CanopyRadius.Value - dist
+        b = (obj.CanopyRadius.Value ** 2 - (dist * (ncirclesumbrella - 1)) ** 2) ** 0.5
+
+        for i in range(ncircles):
+            d += dist
+            r = (obj.CanopyRadius.Value ** 2 - d ** 2) ** 0.5
+            if i > ncirclesumbrella:
+                if obj.CrownExpansion < 1:
+                    r = r * obj.CrownExpansion
+            if r == 0:
+                r = obj.CanopyRadius.Value * 0.01
+            c = Part.makeCircle(r)
+            circles.append(c)
+
+        # 2. Place circles
+        dist = obj.CanopyHeight.Value / ncircles
+        z = 0
+        #zmax = dist * half_ncircles
+        for idx in range(1, half_ncircles):
+            z += dist
+            circles[idx].Placement.Base.z = (1 - obj.UmbrellaEffect) * z
+            #c.Placement.Base.z = obj.UmbrellaEffect * (zmax - z) + z
+
+        dist1 = (obj.CanopyHeight.Value - z) / (half_ncircles + 1)
+        for idx in range(half_ncircles, ncircles):
+            c = circles[idx]
+            z += dist1
+            c.Placement.Base.z = z
+
+        # 3. noise generator
+        pts = []
+        val = (dist / 2 - margin) * obj.Spikiness
+        for c in circles:
+            tmppts = c.discretize(ncircles)
+            for j in range(len(tmppts)):
+                point = tmppts[j]
+                point.x += random.uniform(-val, val)
+                point.y += random.uniform(-val, val)
+                point.z += random.uniform(-val, val)
+                pts.append(point)
+
+        # 4. generate the mesh / solid
+        from scipy import spatial as sp_spatial
+        pts = np.array(pts)
+        hull = sp_spatial.ConvexHull(pts)
+        indices = hull.simplices
+        faces = pts[indices]
+        mesh = Mesh.Mesh(faces.tolist())
+        if len(mesh.Facets) == 0:
+            return None
+        mesh.harmonizeNormals()
+        '''if mesh.Facets[0].Normal.z < 0:
+            mesh.flipNormals()'''
+        shape = Part.Shape()
+        shape.makeShapeFromMesh(mesh.Topology, 0.1)
+        return Part.makeSolid(shape)
+
+    def execute(self, obj):
+        pl = obj.Placement
+
+        trunk = self.createTrunk(obj)
+        canopy = self.createCanopy(obj)
+        canopy.Placement.Base.z = obj.TrunkHeight.Value - 250  # - obj.CanopyRadius.Value / 2
+        obj.Shape = Part.makeCompound([trunk, canopy])
+        obj.Placement = pl
+
+        color = [(0.2510, 0.1255, 0.0)] * len(trunk.Faces)
+        color.extend([(0.0, 0.3922, 0.0)] * len(canopy.Faces))
+        obj.ViewObject.DiffuseColor = color
+
+
+class ViewProviderTree(ArchComponent.ViewProviderComponent):
+    "A View Provider for the Pipe object"
+
+    def __init__(self, vobj):
+        ArchComponent.ViewProviderComponent.__init__(self, vobj)
+
+    def getIcon(self):
+        return str(os.path.join(DirIcons, "tree(1).svg"))
+
+
+class TreeTaskPanel(QtGui.QWidget):
+    def __init__(self, obj=None):
+        QtGui.QWidget.__init__(self)
+        self.obj = obj
+        if self.obj is None:
+            self.obj = makeTree()
+
+        self.form = FreeCADGui.PySideUic.loadUi(__dir__ + "/PVPlantTree.ui")
+        self.layout = QtGui.QHBoxLayout(self)
+        self.layout.setContentsMargins(4, 4, 4, 4)
+        self.layout.addWidget(self.form)
+
+        self.form.editCanopyHeight.valueChanged.connect(self.Canopy)
+        self.form.editCanopyRadius.valueChanged.connect(self.Canopy)
+        self.form.editSpikiness.valueChanged.connect(self.Canopy)
+        self.form.editCrownExpansion.valueChanged.connect(self.Canopy)
+        self.form.editLeftUmbrellaEffect.valueChanged.connect(self.Canopy)
+        self.form.editLeafCount.valueChanged.connect(self.Canopy)
+
+    def Canopy(self):
+        self.obj.CanopyHeight = FreeCAD.Units.Quantity(self.form.editCanopyHeight.text()).Value
+        self.obj.CanopyRadius = FreeCAD.Units.Quantity(self.form.editCanopyRadius.text()).Value
+        self.obj.Spikiness = self.form.editSpikiness.value()
+        self.obj.CrownExpansion = self.form.editCrownExpansion.value()
+        self.obj.UmbrellaEffect = self.form.editLeftUmbrellaEffect.value()
+        self.obj.LeafCount = self.form.editLeafCount.value()
+
+        FreeCAD.ActiveDocument.recompute()
+
+    def accept(self):
+        FreeCADGui.Control.closeDialog()
+        return True
+
+    def reject(self):
+        FreeCAD.ActiveDocument.removeObject(self.obj.Name)
+        FreeCADGui.Control.closeDialog()
+        return True
+
+
+class _CommandTree:
+    "the PVPlant Tree command definition"
+
+    def GetResources(self):
+        return {'Pixmap': str(os.path.join(DirIcons, "tree(1).svg")),
+                'MenuText': QtCore.QT_TRANSLATE_NOOP("PVPlantTree", "Tree"),
+                'Accel': "S, T",
+                'ToolTip': QtCore.QT_TRANSLATE_NOOP("PVPlanTree",
+                                                    "Creates a Tree object from setup dialog.")}
+
+    def IsActive(self):
+        return not FreeCAD.ActiveDocument is None
+
+    def Activated(self):
+        import draftguitools.gui_trackers as DraftTrackers
+        self.tree = makeTree()
+        FreeCADGui.Snapper.getPoint(callback=self.getPoint,
+                                    movecallback=self.mousemove,
+                                    extradlg=self.taskbox(),
+                                    title="Position of the tree:")
+
+    def getPoint(self, point=None, obj=None):
+        self.tree.Placement.Base = point
+        FreeCAD.ActiveDocument.commitTransaction()
+        FreeCAD.ActiveDocument.recompute()
+        self.tracker.finalize()
+
+    def mousemove(self, pt, snapInfo):
+        self.tree.Placement.Base = pt
+
+    def taskbox(self):
+        self.form = TreeTaskPanel(self.tree)
+        return self.form
+
+
+if FreeCAD.GuiUp:
+    FreeCADGui.addCommand('PVPlantTree', _CommandTree())
+

PVPlantTrench.ui

@@ -0,0 +1,302 @@
+<?xml version="1.0" encoding="UTF-8"?>
+<ui version="4.0">
+ <class>formRack</class>
+ <widget class="QDialog" name="formRack">
+  <property name="geometry">
+   <rect>
+    <x>0</x>
+    <y>0</y>
+    <width>361</width>
+    <height>395</height>
+   </rect>
+  </property>
+  <property name="windowTitle">
+   <string>Tracker:</string>
+  </property>
+  <layout class="QVBoxLayout" name="verticalLayout">
+   <property name="leftMargin">
+    <number>5</number>
+   </property>
+   <property name="topMargin">
+    <number>5</number>
+   </property>
+   <property name="rightMargin">
+    <number>5</number>
+   </property>
+   <property name="bottomMargin">
+    <number>5</number>
+   </property>
+   <item>
+    <widget class="QGroupBox" name="groupBox">
+     <property name="sizePolicy">
+      <sizepolicy hsizetype="Preferred" vsizetype="Fixed">
+       <horstretch>0</horstretch>
+       <verstretch>0</verstretch>
+      </sizepolicy>
+     </property>
+     <property name="title">
+      <string>Shape</string>
+     </property>
+     <layout class="QGridLayout" name="gridLayout">
+      <property name="leftMargin">
+       <number>5</number>
+      </property>
+      <property name="topMargin">
+       <number>5</number>
+      </property>
+      <property name="rightMargin">
+       <number>5</number>
+      </property>
+      <property name="bottomMargin">
+       <number>5</number>
+      </property>
+      <property name="horizontalSpacing">
+       <number>5</number>
+      </property>
+      <property name="verticalSpacing">
+       <number>2</number>
+      </property>
+      <item row="2" column="0">
+       <widget class="QLabel" name="label_9">
+        <property name="text">
+         <string>Altura (m)</string>
+        </property>
+       </widget>
+      </item>
+      <item row="1" column="0">
+       <widget class="QLabel" name="label_11">
+        <property name="text">
+         <string>Anchura (m)</string>
+        </property>
+       </widget>
+      </item>
+      <item row="2" column="1">
+       <widget class="QDoubleSpinBox" name="editModuleHeight">
+        <property name="sizePolicy">
+         <sizepolicy hsizetype="Fixed" vsizetype="Fixed">
+          <horstretch>0</horstretch>
+          <verstretch>0</verstretch>
+         </sizepolicy>
+        </property>
+        <property name="minimumSize">
+         <size>
+          <width>140</width>
+          <height>0</height>
+         </size>
+        </property>
+        <property name="alignment">
+         <set>Qt::AlignRight|Qt::AlignTrailing|Qt::AlignVCenter</set>
+        </property>
+        <property name="buttonSymbols">
+         <enum>QAbstractSpinBox::NoButtons</enum>
+        </property>
+        <property name="decimals">
+         <number>3</number>
+        </property>
+        <property name="maximum">
+         <double>5.000000000000000</double>
+        </property>
+        <property name="singleStep">
+         <double>0.010000000000000</double>
+        </property>
+        <property name="value">
+         <double>1.990000000000000</double>
+        </property>
+       </widget>
+      </item>
+      <item row="0" column="1">
+       <widget class="QComboBox" name="comboBox">
+        <item>
+         <property name="text">
+          <string>Rectangle</string>
+         </property>
+        </item>
+        <item>
+         <property name="text">
+          <string>Trapeze</string>
+         </property>
+        </item>
+       </widget>
+      </item>
+      <item row="1" column="1">
+       <widget class="QDoubleSpinBox" name="editModuleWidth">
+        <property name="sizePolicy">
+         <sizepolicy hsizetype="Fixed" vsizetype="Fixed">
+          <horstretch>0</horstretch>
+          <verstretch>0</verstretch>
+         </sizepolicy>
+        </property>
+        <property name="minimumSize">
+         <size>
+          <width>140</width>
+          <height>0</height>
+         </size>
+        </property>
+        <property name="alignment">
+         <set>Qt::AlignRight|Qt::AlignTrailing|Qt::AlignVCenter</set>
+        </property>
+        <property name="buttonSymbols">
+         <enum>QAbstractSpinBox::NoButtons</enum>
+        </property>
+        <property name="decimals">
+         <number>3</number>
+        </property>
+        <property name="maximum">
+         <double>0.100000000000000</double>
+        </property>
+        <property name="singleStep">
+         <double>0.010000000000000</double>
+        </property>
+        <property name="value">
+         <double>0.030000000000000</double>
+        </property>
+       </widget>
+      </item>
+      <item row="0" column="0">
+       <widget class="QLabel" name="label">
+        <property name="text">
+         <string>Type:</string>
+        </property>
+       </widget>
+      </item>
+     </layout>
+    </widget>
+   </item>
+   <item>
+    <widget class="QGroupBox" name="groupBox_3">
+     <property name="title">
+      <string>Layers</string>
+     </property>
+     <layout class="QVBoxLayout" name="verticalLayout_3">
+      <item>
+       <widget class="QWidget" name="widget_2" native="true">
+        <layout class="QHBoxLayout" name="horizontalLayout">
+         <property name="spacing">
+          <number>10</number>
+         </property>
+         <property name="leftMargin">
+          <number>0</number>
+         </property>
+         <property name="topMargin">
+          <number>0</number>
+         </property>
+         <property name="rightMargin">
+          <number>0</number>
+         </property>
+         <property name="bottomMargin">
+          <number>0</number>
+         </property>
+         <item>
+          <widget class="QListWidget" name="listLayers">
+           <property name="frameShape">
+            <enum>QFrame::Panel</enum>
+           </property>
+          </widget>
+         </item>
+         <item>
+          <widget class="QWidget" name="widget" native="true">
+           <layout class="QVBoxLayout" name="verticalLayout_2">
+            <property name="spacing">
+             <number>5</number>
+            </property>
+            <property name="leftMargin">
+             <number>0</number>
+            </property>
+            <property name="topMargin">
+             <number>0</number>
+            </property>
+            <property name="rightMargin">
+             <number>0</number>
+            </property>
+            <property name="bottomMargin">
+             <number>0</number>
+            </property>
+            <item>
+             <spacer name="verticalSpacer">
+              <property name="orientation">
+               <enum>Qt::Vertical</enum>
+              </property>
+              <property name="sizeHint" stdset="0">
+               <size>
+                <width>20</width>
+                <height>40</height>
+               </size>
+              </property>
+             </spacer>
+            </item>
+            <item>
+             <widget class="QPushButton" name="buttonUp">
+              <property name="text">
+               <string>Up</string>
+              </property>
+             </widget>
+            </item>
+            <item>
+             <widget class="QPushButton" name="buttonDown">
+              <property name="text">
+               <string>Down</string>
+              </property>
+             </widget>
+            </item>
+            <item>
+             <spacer name="verticalSpacer_2">
+              <property name="orientation">
+               <enum>Qt::Vertical</enum>
+              </property>
+              <property name="sizeHint" stdset="0">
+               <size>
+                <width>20</width>
+                <height>40</height>
+               </size>
+              </property>
+             </spacer>
+            </item>
+           </layout>
+          </widget>
+         </item>
+        </layout>
+       </widget>
+      </item>
+      <item>
+       <widget class="QWidget" name="widget_3" native="true">
+        <layout class="QHBoxLayout" name="horizontalLayout_2">
+         <property name="spacing">
+          <number>10</number>
+         </property>
+         <property name="leftMargin">
+          <number>0</number>
+         </property>
+         <property name="topMargin">
+          <number>0</number>
+         </property>
+         <property name="rightMargin">
+          <number>0</number>
+         </property>
+         <property name="bottomMargin">
+          <number>0</number>
+         </property>
+         <item>
+          <widget class="QPushButton" name="buttonAddLayer">
+           <property name="text">
+            <string>Add Layer</string>
+           </property>
+          </widget>
+         </item>
+         <item>
+          <widget class="QPushButton" name="buttonDeleteLayer">
+           <property name="text">
+            <string>Delete Layer</string>
+           </property>
+          </widget>
+         </item>
+        </layout>
+       </widget>
+      </item>
+     </layout>
+    </widget>
+   </item>
+  </layout>
+ </widget>
+ <resources/>
+ <connections/>
+</ui>

Project/Area/PVPlantArea.py

@@ -0,0 +1,803 @@
+# /**********************************************************************
+# *                                                                     *
+# * Copyright (c) 2021 Javier Braña <javier.branagutierrez@gmail.com>  *
+# *                                                                     *
+# * This program is free software; you can redistribute it and/or modify*
+# * it under the terms of the GNU Lesser General Public License (LGPL)  *
+# * as published by the Free Software Foundation; either version 2 of   *
+# * the License, or (at your option) any later version.                 *
+# * for detail see the LICENCE text file.                               *
+# *                                                                     *
+# * This program is distributed in the hope that it will be useful,     *
+# * but WITHOUT ANY WARRANTY; without even the implied warranty of      *
+# * MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE.  See the       *
+# * GNU Library General Public License for more details.                *
+# *                                                                     *
+# * You should have received a copy of the GNU Library General Public   *
+# * License along with this program; if not, write to the Free Software *
+# * Foundation, Inc., 59 Temple Place, Suite 330, Boston, MA  02111-1307*
+# * USA                                                                 *
+# *                                                                     *
+# ***********************************************************************
+
+import FreeCAD
+import Part
+import PVPlantSite
+import Utils.PVPlantUtils as utils
+import MeshPart as mp
+
+if FreeCAD.GuiUp:
+    import FreeCADGui
+    from DraftTools import translate
+else:
+    # \cond
+    def translate(ctxt,txt):
+        return txt
+    def QT_TRANSLATE_NOOP(ctxt,txt):
+        return txt
+    # \endcond
+
+import os
+from PVPlantResources import DirIcons as DirIcons
+
+__title__ = "PVPlant Areas"
+__author__ = "Javier Braña"
+__url__ = "http://www.sogos-solar.com"
+
+import PVPlantResources
+from PVPlantResources import DirIcons as DirIcons
+Dir3dObjects = os.path.join(PVPlantResources.DirResources, "3dObjects")
+
+''' Default Area: '''
+
+
+def makeArea(points = None, type = 0):
+    obj = FreeCAD.ActiveDocument.addObject("Part::FeaturePython", "Area")
+    if type == 0:
+        _Area(obj)
+        _ViewProviderArea(obj.ViewObject)
+    elif type == 1:
+        _ForbiddenArea(obj)
+        _ViewProviderForbiddenArea(obj.ViewObject)
+    if points:
+        obj.Points = points
+    return obj
+
+
+class _Area:
+    def __init__(self, obj):
+        ''' Initialize the Area object '''
+        self.Type = None
+        self.obj = None
+
+    def setProperties(self, obj):
+        pl = obj.PropertiesList
+
+        if not ("Base" in pl):
+            obj.addProperty("App::PropertyLink",
+                            "Base",
+                            "Area",
+                            "Base wire"
+                            ).Base = None
+
+        if not ("Type" in pl):
+            obj.addProperty("App::PropertyString",
+                            "Type",
+                            "Area",
+                            "Points that define the area"
+                            ).Type = "Area"
+        obj.setEditorMode("Type", 1)
+
+        self.Type = obj.Type
+        obj.Proxy = self
+
+    def onDocumentRestored(self, obj):
+        """ Method run when the document is restored """
+        self.setProperties(obj)
+
+
+class _ViewProviderArea:
+    def __init__(self, vobj):
+        self.Object = vobj.Object
+        vobj.Proxy = self
+
+    def attach(self, vobj):
+        '''
+        Create Object visuals in 3D view.
+        '''
+        self.Object = vobj.Object
+        return
+
+    def getIcon(self):
+        '''
+        Return object treeview icon.
+        '''
+
+        return str(os.path.join(DirIcons, "area.svg"))
+    '''
+    def claimChildren(self):
+        """
+        Provides object grouping
+        """
+        return self.Object.Group
+    '''
+
+    def setEdit(self, vobj, mode=0):
+        """
+        Enable edit
+        """
+        return True
+
+    def unsetEdit(self, vobj, mode=0):
+        """
+        Disable edit
+        """
+        return False
+
+    def doubleClicked(self, vobj):
+        """
+        Detect double click
+        """
+        pass
+
+    def setupContextMenu(self, obj, menu):
+        """
+        Context menu construction
+        """
+        pass
+
+    def edit(self):
+        """
+        Edit callback
+        """
+        pass
+
+    def __getstate__(self):
+        """
+        Save variables to file.
+        """
+        return None
+
+    def __setstate__(self, state):
+        """
+        Get variables from file.
+        """
+        return None
+
+
+''' Frame Area '''
+
+def makeFramedArea(base = None, select = None):
+    obj = FreeCAD.ActiveDocument.addObject("Part::FeaturePython", "FrameArea")
+    FrameArea(obj)
+    ViewProviderFrameArea(obj.ViewObject)
+    if base:
+        obj.Base = base
+
+    if select:
+        frames = []
+        for o in select:
+            if hasattr(o, "Proxy") and (o.Proxy.Type == "Tracker"):
+                if not (o in frames):
+                    frames.append(o)
+        if len(frames) > 0:
+            print(frames)
+            obj.Frames = frames
+
+    try:
+        group = FreeCAD.ActiveDocument.FrameZones
+    except:
+        group = FreeCAD.ActiveDocument.addObject("App::DocumentObjectGroup", 'FrameZones')
+        group.Label = "FrameZones"
+    group.addObject(obj)
+
+    return obj
+
+
+class FrameArea(_Area):
+    def __init__(self, obj):
+        _Area.__init__(self, obj)
+        self.setProperties(obj)
+        self.obj = None
+
+    def setProperties(self, obj):
+        _Area.setProperties(self, obj)
+        pl = obj.PropertiesList
+
+        if not ("Frames" in pl):
+            obj.addProperty("App::PropertyLinkList",
+                            "Frames",
+                            "Area",
+                            "All the frames inside this area."
+                            )
+
+        if not ("FrameNumber" in pl):
+            obj.addProperty("App::PropertyInteger",
+                            "FrameNumber",
+                            "Area",
+                            "The number of frames inside this area."
+                            )
+        obj.setEditorMode("FrameNumber", 1)
+
+        if not ("Type" in pl):
+            obj.addProperty("App::PropertyString",
+                            "Type",
+                            "Base",
+                            "The facemaker type to use to build the profile of this object"
+                            ).Type = "FrameArea"
+        obj.setEditorMode("Type", 1)
+
+        self.Type = "FrameArea"
+        obj.Proxy = self
+        self.obj = obj
+
+    def onDocumentRestored(self, obj):
+        """Method run when the document is restored."""
+        self.setProperties(obj)
+
+    def onBeforeChange(self, obj, prop):
+        ''' '''
+        pass
+
+    def onChanged(self, obj, prop):
+        if prop == "Base":
+            if obj.Base.Shape is None:
+                obj.Shape = Part.Shape()
+                return
+
+            import Utils.PVPlantUtils as utils
+
+            base = obj.Base.Shape
+            land = PVPlantSite.get().Terrain.Mesh
+            vec = FreeCAD.Vector(0,0,1)
+            wire = utils.getProjected(base, vec)
+            tmp = mp.projectShapeOnMesh(wire, land, vec)
+            shape = Part.makeCompound([])
+            for section in tmp:
+                shape.add(Part.makePolygon(section))
+            obj.Shape = shape
+
+        if prop == "Frames":
+            lf = []
+            for o in obj.Frames:
+                if not hasattr(o, "Proxy"):
+                    continue
+                if o.Proxy.Type == "Tracker":
+                    lf.append(obj)
+            obj.Frames = lf
+            obj.FramesNumber = len(obj.Frames)
+
+    def addFrame(self, frame):
+        list = self.obj.Frames.copy()
+        list.append(frame)
+        self.obj.Frames = sorted(list, key=lambda x: x.Name)
+
+    def execute(self, obj):
+        ''' execute '''
+        #_Area.execute(self, obj)
+
+        obj.FrameNumber = len(obj.Frames)
+
+
+class ViewProviderFrameArea(_ViewProviderArea):
+    def __init__(self, vobj):
+        ''' Set view properties. '''
+        self.Object = vobj.Object
+        vobj.Proxy = self
+
+    def getIcon(self):
+        ''' Return object treeview icon '''
+        return str(os.path.join(DirIcons, "FrameArea.svg"))
+
+    def claimChildren(self):
+        """ Provides object grouping """
+        children = []
+        if self.Object.Base:
+            children.append(self.Object.Base)
+        return children
+
+
+''' offsets '''
+
+
+def makeOffsetArea(base = None, val=None):
+    obj = FreeCAD.ActiveDocument.addObject("Part::FeaturePython", "OffsetArea")
+    OffsetArea(obj)
+    obj.Base = base
+    ViewProviderOffsetArea(obj.ViewObject)
+    if val:
+        obj.Distance = val
+
+    offsets = None
+    try:
+        offsetsgroup = FreeCAD.ActiveDocument.Offsets
+    except:
+        offsetsgroup = FreeCAD.ActiveDocument.addObject("App::DocumentObjectGroup", 'Offsets')
+        offsetsgroup.Label = "Offsets"
+    offsetsgroup.addObject(obj)
+
+    return obj
+
+
+class OffsetArea(_Area):
+    def __init__(self, obj):
+        _Area.__init__(self, obj)
+        self.setProperties(obj)
+
+    def setProperties(self, obj):
+        _Area.setProperties(self, obj)
+        pl = obj.PropertiesList
+        if not ("OffsetDistance" in pl):
+            obj.addProperty("App::PropertyDistance",
+                            "OffsetDistance",
+                            "OffsetArea",
+                            "Base wire"
+                            )
+
+        self.Type = obj.Type = "Area_Offset"
+
+    def onDocumentRestored(self, obj):
+        """Method run when the document is restored."""
+        self.setProperties(obj)
+
+    def execute(self, obj):
+        import Utils.PVPlantUtils as utils
+
+        base = obj.Base.Shape
+        land = PVPlantSite.get().Terrain.Mesh
+        vec = FreeCAD.Vector(0, 0, 1)
+        wire = utils.getProjected(base, vec)
+        wire = wire.makeOffset2D(obj.OffsetDistance.Value, 2, False, False, True)
+        tmp = mp.projectShapeOnMesh(wire, land, vec)
+        pts = []
+        for section in tmp:
+            pts.extend(section)
+        obj.Shape = Part.makePolygon(pts)
+
+
+class ViewProviderOffsetArea(_ViewProviderArea):
+    def getIcon(self):
+        ''' Return object treeview icon. '''
+        return str(os.path.join(DirIcons, "offset.svg"))
+
+    def claimChildren(self):
+        """ Provides object grouping """
+        children = []
+        if self.Object.Base:
+            children.append(self.Object.Base)
+        return children
+
+
+''' Forbidden Area: '''
+
+
+def makeProhibitedArea(base = None):
+    obj = FreeCAD.ActiveDocument.addObject("Part::FeaturePython", "ProhibitedArea")
+    ProhibitedArea(obj)
+    ViewProviderForbiddenArea(obj.ViewObject)
+    if base:
+        obj.Base = base
+    try:
+        group = FreeCAD.ActiveDocument.Exclusion
+    except:
+        group = FreeCAD.ActiveDocument.addObject("App::DocumentObjectGroup", 'Exclusion')
+        group.Label = "Exclusions"
+    group.addObject(obj)
+
+    return obj
+
+
+class ProhibitedArea(OffsetArea):
+    def __init__(self, obj):
+        OffsetArea.__init__(self, obj)
+        self.setProperties(obj)
+
+    def setProperties(self, obj):
+        OffsetArea.setProperties(self, obj)
+        self.Type = obj.Type = "ProhibitedArea"
+        obj.Proxy = self
+
+    def onDocumentRestored(self, obj):
+        """Method run when the document is restored."""
+        self.setProperties(obj)
+
+
+class ViewProviderForbiddenArea(_ViewProviderArea):
+    def getIcon(self):
+        ''' Return object treeview icon '''
+        return str(os.path.join(DirIcons, "area_forbidden.svg"))
+
+    def claimChildren(self):
+        """ Provides object grouping """
+        children = []
+        if self.Object.Base:
+            children.append(self.Object.Base)
+        return children
+
+
+''' PV Area: '''
+
+
+def makePVSubplant():
+    obj = FreeCAD.ActiveDocument.addObject("Part::FeaturePython", "PVSubplant")
+    PVSubplant(obj)
+    ViewProviderPVSubplant(obj.ViewObject)
+    return obj
+
+
+class PVSubplant:
+    def __init__(self, obj):
+        self.setProperties(obj)
+        self.Type = None
+        self.obj = None
+
+    def setProperties(self, obj):
+        pl = obj.PropertiesList
+
+        if not "Setup" in pl:
+            obj.addProperty("App::PropertyEnumeration",
+                            "Setup",
+                            "PVSubplant",
+                            "The facemaker type to use to build the profile of this object"
+                            ).Setup = ["String Inverter", "Central Inverter"]
+
+        if not ("Frames" in pl):
+            obj.addProperty("App::PropertyLinkList",
+                            "Frames",
+                            "PVSubplant",
+                            "List of frames"
+                            )
+
+        if not ("Inverters" in pl):
+            obj.addProperty("App::PropertyLinkList",
+                            "Inverters",
+                            "PVSubplant",
+                            "List of Inverters"
+                            )
+
+        if not ("Cables" in pl):
+            obj.addProperty("App::PropertyLinkList",
+                            "Cables",
+                            "PVSubplant",
+                            "List of Cables"
+                            )
+
+        if not "TotalPVModules" in pl:
+            obj.addProperty("App::PropertyQuantity",
+                            "TotalPVModules",
+                            "PVSubplant",
+                            "The facemaker type to use to build the profile of this object"
+                            )
+
+        if not "TotalPowerDC" in pl:
+            obj.addProperty("App::PropertyQuantity",
+                            "TotalPowerDC",
+                            "PVSubplant",
+                            "The facemaker type to use to build the profile of this object"
+                            )
+
+        if not "Color" in pl:
+            obj.addProperty("App::PropertyColor",
+                            "Color",
+                            "PVSubplant",
+                            "Color"
+                            )
+
+        if not "Type" in pl:
+            obj.addProperty("App::PropertyString",
+                            "Type",
+                            "Base",
+                            "The facemaker type to use to build the profile of this object"
+                            ).Type = "PVSubplant"
+        obj.setEditorMode("Type", 1)
+
+        self.Type = obj.Type
+        self.obj = obj
+        obj.Proxy = self
+
+    def onDocumentRestored(self, obj):
+        """Method run when the document is restored."""
+        self.setProperties(obj)
+
+    def onChanged(self, obj, prop):
+        if prop == "Color":
+            obj.ViewObject.LineColor = obj.Color
+            obj.ViewObject.PointColor = obj.Color
+
+        if prop == "Setup":
+            if obj.Setup == "Central Inverter":
+                if not ("StringBoxes" in obj.PropertiesList):
+                    obj.addProperty("App::PropertyLinkList",
+                                    "StringBoxes",
+                                    "PVSubplant",
+                                    "List of String-Boxes"
+                                    )
+            else:
+                if hasattr(obj, "StringBoxes"):
+                    obj.removeProperty("StringBoxes")
+
+        if prop == "Frames":
+            import numpy as np
+            # 1. Dibujar contorno:
+            maxdist = 6000
+            if len(obj.Frames) > 0:
+                onlyframes = []
+                for object in obj.Frames:
+                    if object.Name.startswith("Tracker"):
+                        onlyframes.append(object)
+                obj.Frames = onlyframes
+
+                pts = []
+                for frame in obj.Frames:
+                    for panel in frame.Shape.SubShapes[0].SubShapes[0].SubShapes:
+                        zm = panel.BoundBox.ZMax
+                        for i in range(8):
+                            pt = panel.BoundBox.getPoint(i)
+                            if pt.z == zm:
+                                pts.append(pt)
+                import MeshTools.Triangulation as Triangulation
+                import MeshTools.MeshGetBoundary as mgb
+                m = Triangulation.Triangulate(np.array(pts), MaxlengthLE=maxdist, use3d=False)
+                b = mgb.get_boundary(m)
+                obj.Shape = b
+
+                # 2. rellenar información
+                power = 0
+                modulenum = 0
+                for frame in obj.Frames:
+                    modules = frame.Setup.ModuleColumns * frame.Setup.ModuleRows
+                    power += frame.Setup.ModulePower.Value * modules
+                    modulenum += modules
+                obj.TotalPowerDC = power
+                obj.TotalPVModules = modulenum
+            obj.ViewObject.LineWidth = 5
+
+    def execute(self, obj):
+        '''  '''
+        pass
+
+
+class ViewProviderPVSubplant:
+    def __init__(self, vobj):
+        ''' Set view properties. '''
+        self.Object = None
+        vobj.Proxy = self
+
+    def attach(self, vobj):
+        ''' Create Object visuals in 3D view. '''
+        self.Object = vobj.Object
+        return
+
+    def getIcon(self):
+        ''' Return object treeview icon. '''
+        return str(os.path.join(DirIcons, "subplant.svg"))
+
+    def claimChildren(self):
+        """ Provides object grouping """
+        children = []
+        if self.Object.Frames:
+            children.extend(self.Object.Frames)
+        return children
+
+    def __getstate__(self):
+        return None
+
+    '''def onDelete(self, feature, subelements):
+        try:
+            for obj in self.claimChildren():
+                obj.ViewObject.show()
+        except Exception as err:
+            FreeCAD.Console.PrintError("Error in onDelete: " + str(err))
+        return True
+
+    def canDragObjects(self):
+        return True
+
+    def canDropObjects(self):
+        return True
+
+    def canDragObject(self, dragged_object):
+        return True
+
+    def canDropObject(self, incoming_object):
+        return hasattr(incoming_object, 'Shape')
+
+    def dragObject(self, selfvp, dragged_object):
+        objs = self.Object.Objects
+        objs.remove(dragged_object)
+        self.Object.Objects = objs
+
+    def dropObject(self, selfvp, incoming_object):
+        self.Object.Objects = self.Object.Objects + [incoming_object]
+
+    def setEdit(self, vobj, mode=0):
+        """
+        Enable edit
+        """
+        return True
+
+    def unsetEdit(self, vobj, mode=0):
+        """
+        Disable edit
+        """
+        return False
+
+    def doubleClicked(self, vobj):
+        """
+        Detect double click
+        """
+        pass
+
+    def setupContextMenu(self, obj, menu):
+        """
+        Context menu construction
+        """
+        pass
+
+    def edit(self):
+        """
+        Edit callback
+        """
+        pass
+
+    def __getstate__(self):
+        """
+        Save variables to file.
+        """
+        return None
+
+    def __setstate__(self,state):
+        """
+        Get variables from file.
+        """
+        return None'''
+
+# Comandos: -----------------------------------------------------------------------------------------------------------
+
+
+class CommandDivideArea:
+    def GetResources(self):
+        return {'Pixmap': str(os.path.join(PVPlantResources.DirIcons, "area.svg")),
+                'Accel': "A, D",
+                'MenuText': "Divide Area",
+                'ToolTip': "Allowed Area"}
+
+    def Activated(self):
+        sel = FreeCADGui.Selection.getSelection()[0]
+
+
+    def IsActive(self):
+        if FreeCAD.ActiveDocument:
+            return True
+        else:
+            return False
+
+
+class CommandBoundary:
+
+    def GetResources(self):
+        return {'Pixmap': str(os.path.join(PVPlantResources.DirIcons, "area.svg")),
+                'Accel': "A, B",
+                'MenuText': "Area",
+                'ToolTip': "Allowed Area"}
+
+    def Activated(self):
+        sel = FreeCADGui.Selection.getSelection()[0]
+        obj = makeArea([ver.Point for ver in sel.Shape.Vertexes])
+        #taskd = _PVPlantPlacementTaskPanel()
+        #FreeCADGui.Control.showDialog(taskd)
+
+    def IsActive(self):
+        if FreeCAD.ActiveDocument:
+            return True
+        else:
+            return False
+
+
+class CommandFrameArea:
+    def GetResources(self):
+        return {'Pixmap': str(os.path.join(PVPlantResources.DirIcons, "FrameArea.svg")),
+                'Accel': "A, F",
+                'MenuText': "Frame Area",
+                'ToolTip': "Frame Area"}
+
+    def Activated(self):
+        sel = FreeCADGui.Selection.getSelection()
+        makeFramedArea(None, sel)
+
+    def IsActive(self):
+        if FreeCAD.ActiveDocument:
+            return True
+        else:
+            return False
+
+
+class CommandProhibitedArea:
+    def GetResources(self):
+        return {'Pixmap': str(os.path.join(PVPlantResources.DirIcons, "area_forbidden.svg")),
+                'Accel': "A, F",
+                'MenuText': "Prohibited Area",
+                'ToolTip': "Prohibited Area"}
+
+    def Activated(self):
+        sel = FreeCADGui.Selection.getSelection()
+        makeProhibitedArea(sel[0])
+
+    def IsActive(self):
+        if FreeCAD.ActiveDocument:
+            return True
+        else:
+            return False
+
+
+class CommandPVSubplant:
+
+    def GetResources(self):
+        return {'Pixmap': str(os.path.join(PVPlantResources.DirIcons, "subplant.svg")),
+                'Accel': "A, P",
+                'MenuText': "PV Subplant",
+                'ToolTip': "PV Subplant"}
+
+    def Activated(self):
+        area = makePVSubplant()
+        sel = FreeCADGui.Selection.getSelection()
+        for obj in sel:
+            if obj.Name[:7] == "Tracker":
+                frame_list = area.Frames
+                frame_list.append(obj)
+                area.Frames = frame_list
+
+
+    def IsActive(self):
+        if FreeCAD.ActiveDocument:
+            return True
+        else:
+            return False
+
+
+class CommandOffsetArea:
+    def GetResources(self):
+        return {'Pixmap': str(os.path.join(PVPlantResources.DirIcons, "offset.svg")),
+                'Accel': "A, O",
+                'MenuText': "OffsetArea",
+                'ToolTip': "OffsetArea"}
+
+    def Activated(self):
+        sel = FreeCADGui.Selection.getSelection()
+        base = None
+        if sel:
+            base = sel[0]
+        obj = makeOffsetArea(base)
+
+    def IsActive(self):
+        if FreeCAD.ActiveDocument:
+            return True
+        else:
+            return False
+
+
+if FreeCAD.GuiUp:
+    class CommandAreaGroup:
+
+        def GetCommands(self):
+            return tuple([#'Area',
+                          'FrameArea',
+                          'ForbiddenArea',
+                          'PVSubplant',
+                          'OffsetArea'
+                          ])
+
+        def GetResources(self):
+            return {'MenuText': 'Areas',
+                    'ToolTip': 'Areas'
+                    }
+
+        def IsActive(self):
+            return not FreeCAD.ActiveDocument is None
+
+    #FreeCADGui.addCommand('Area', CommandBoundary())
+    FreeCADGui.addCommand('FrameArea', CommandFrameArea())
+    FreeCADGui.addCommand('ForbiddenArea', CommandProhibitedArea())
+    FreeCADGui.addCommand('PVSubplant', CommandPVSubplant())
+    FreeCADGui.addCommand('OffsetArea', CommandOffsetArea())
+    FreeCADGui.addCommand('PVPlantAreas', CommandAreaGroup())

Project/Area/PVPlantAreaUtils.py

@@ -0,0 +1,167 @@
+# /**********************************************************************
+# *                                                                     *
+# * Copyright (c) 2021 Javier Braña <javier.branagutierrez@gmail.com>  *
+# *                                                                     *
+# * This program is free software; you can redistribute it and/or modify*
+# * it under the terms of the GNU Lesser General Public License (LGPL)  *
+# * as published by the Free Software Foundation; either version 2 of   *
+# * the License, or (at your option) any later version.                 *
+# * for detail see the LICENCE text file.                               *
+# *                                                                     *
+# * This program is distributed in the hope that it will be useful,     *
+# * but WITHOUT ANY WARRANTY; without even the implied warranty of      *
+# * MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE.  See the       *
+# * GNU Library General Public License for more details.                *
+# *                                                                     *
+# * You should have received a copy of the GNU Library General Public   *
+# * License along with this program; if not, write to the Free Software *
+# * Foundation, Inc., 59 Temple Place, Suite 330, Boston, MA  02111-1307*
+# * USA                                                                 *
+# *                                                                     *
+# ***********************************************************************
+import FreeCAD
+
+if FreeCAD.GuiUp:
+    import FreeCADGui
+    import os
+else:
+    # \cond
+    def translate(ctxt, txt):
+        return txt
+
+
+    def QT_TRANSLATE_NOOP(ctxt, txt):
+        return txt
+    # \endcond
+
+__title__ = "PVPlant Area Utils"
+__author__ = "Javier Braña"
+__url__ = "http://www.sogos-solar.com"
+
+import PVPlantResources
+
+
+def splitArea(area, tool):
+    if (not area) or (not tool):
+        return None
+
+    import Part, TechDraw
+    import BOPTools.SplitAPI as splitter
+    tool = tool.Shape
+    if tool.BoundBox.ZMax != tool.BoundBox.ZMin:
+        tool = TechDraw.projectEx(tool, FreeCAD.Vector(0, 0, 1))[0]
+    tool = tool.extrude(FreeCAD.Vector(0, 0, 1000))
+    tool.Placement.Base.z -= 500
+
+    shape = area.Shape
+    if shape.BoundBox.ZMax != shape.BoundBox.ZMin:
+        shape = TechDraw.projectEx(shape, FreeCAD.Vector(0, 0, 1))[0]
+    face = Part.Face(Part.Wire(shape.Edges))
+
+    return splitter.slice(face, [tool, ], "Split")
+
+
+class splitAreaTaskPanel:
+    def __init__(self):
+        self.area = None
+        self.tool = None
+
+        self.form = FreeCADGui.PySideUic.loadUi(os.path.join(PVPlantResources.__dir__, "Project", "Area", "PVPlantSplitArea.ui"))
+        self.form.buttonAreaSel.clicked.connect(self.addArea)
+        self.form.buttonToolSel.clicked.connect(self.addTool)
+
+        #self.view = FreeCADGui.ActiveDocument.ActiveView
+        #self.call = self.view.addEventCallback("SoEvent", self.action)
+
+    def addArea(self):
+        self.area = FreeCADGui.Selection.getSelection()[0]
+        self.form.lineArea.setText(self.area.Name)
+
+    def addTool(self):
+        self.tool = FreeCADGui.Selection.getSelection()[0]
+        self.form.lineTool.setText(self.tool.Name)
+
+    def accept(self):
+        import Part
+        self.closeForm()
+        results = splitArea(self.area, self.tool)
+        if isinstance(results, Part.Compound):
+            for face in results.Faces:
+                Part.show(face.Wire, self.area.Label + "-split")
+        elif isinstance(results, list):
+            for face in results:
+                Part.show(face.Wire, self.area.Label + "-split")
+        else:
+            Part.show(results)
+
+
+        if self.form.checkBoxDeleteTool.isChecked():
+            FreeCAD.ActiveDocument.removeObject(self.tool.Name)
+        if self.form.checkBoxDeleteArea.isChecked():
+            FreeCAD.ActiveDocument.removeObject(self.area.Name)
+        return True
+
+    def reject(self):
+        print(" .. Rejecting .. ")
+        if self.new:
+            FreeCAD.ActiveDocument.removeObject(self.obj.Name)
+        self.closeForm()
+        return True
+
+    def closeForm(self):
+        print(" .. Closing .. ")
+        #self.view.removeEventCallback("SoEvent", self.call)
+        FreeCADGui.Control.closeDialog()
+
+def joinAreas(areas):
+    if len(areas) == 0:
+        return None
+
+    import TechDraw
+    shapes = []
+    for area in areas:
+        shape = area.Shape
+        if shape.BoundBox.ZMax != shape.BoundBox.ZMin:
+            shape = TechDraw.projectEx(shape, FreeCAD.Vector(0, 0, 1))[0]
+        shapes.append(shape)
+    shape = shapes.pop()
+    shape.fuse(shapes)
+    return shape
+
+class CommandSplitArea:
+    def GetResources(self):
+        return {'Pixmap': str(os.path.join(PVPlantResources.DirIcons, "split_area.svg")),
+                'Accel': "A, S",
+                'MenuText': "Split Area",
+                'ToolTip': "Split Area"}
+
+    def IsActive(self):
+        return (not FreeCAD.ActiveDocument is None and
+                not FreeCAD.ActiveDocument.findObjects(Name="ProhibitedArea") is None and
+                not FreeCAD.ActiveDocument.findObjects(Name="OffsetArea") is None)
+    def Activated(self):
+        self.TaskPanel = splitAreaTaskPanel()
+        FreeCADGui.Control.showDialog(self.TaskPanel)
+        return
+
+class CommandJoinAreas:
+    def GetResources(self):
+        return {'Pixmap': str(os.path.join(PVPlantResources.DirIcons, "split_area.svg")),
+                'Accel': "A, J",
+                'MenuText': "Join Areas",
+                'ToolTip': "Join Areas"}
+
+    def IsActive(self):
+        return (not FreeCAD.ActiveDocument is None and
+                not FreeCAD.ActiveDocument.findObjects(Name="ProhibitedArea") is None and
+                not FreeCAD.ActiveDocument.findObjects(Name="OffsetArea") is None)
+    def Activated(self):
+        self.TaskPanel = splitAreaTaskPanel()
+        FreeCADGui.Control.showDialog(self.TaskPanel)
+        return
+
+if FreeCAD.GuiUp:
+    FreeCADGui.addCommand('SplitArea', CommandSplitArea())
+    FreeCADGui.addCommand('JoinAreas', CommandJoinAreas())
+
+

Project/Area/PVPlantSplitArea.ui

@@ -0,0 +1,106 @@
+<?xml version="1.0" encoding="UTF-8"?>
+<ui version="4.0">
+ <class>formSplitArea</class>
+ <widget class="QWidget" name="formSplitArea">
+  <property name="geometry">
+   <rect>
+    <x>0</x>
+    <y>0</y>
+    <width>313</width>
+    <height>301</height>
+   </rect>
+  </property>
+  <property name="windowTitle">
+   <string>Split Area</string>
+  </property>
+  <layout class="QGridLayout" name="gridLayout">
+   <item row="1" column="0">
+    <widget class="QGroupBox" name="groupBox_2">
+     <property name="title">
+      <string>Herramienta de corte</string>
+     </property>
+     <layout class="QHBoxLayout" name="horizontalLayout">
+      <item>
+       <widget class="QLineEdit" name="lineTool">
+        <property name="readOnly">
+         <bool>true</bool>
+        </property>
+       </widget>
+      </item>
+      <item>
+       <widget class="QPushButton" name="buttonToolSel">
+        <property name="text">
+         <string>Seleccionar</string>
+        </property>
+       </widget>
+      </item>
+     </layout>
+    </widget>
+   </item>
+   <item row="4" column="0">
+    <spacer name="verticalSpacer">
+     <property name="orientation">
+      <enum>Qt::Vertical</enum>
+     </property>
+     <property name="sizeHint" stdset="0">
+      <size>
+       <width>20</width>
+       <height>40</height>
+      </size>
+     </property>
+    </spacer>
+   </item>
+   <item row="0" column="0">
+    <widget class="QGroupBox" name="groupBox">
+     <property name="title">
+      <string>Area</string>
+     </property>
+     <layout class="QGridLayout" name="gridLayout_2">
+      <item row="0" column="0">
+       <widget class="QLineEdit" name="lineArea">
+        <property name="readOnly">
+         <bool>true</bool>
+        </property>
+       </widget>
+      </item>
+      <item row="0" column="1">
+       <widget class="QPushButton" name="buttonAreaSel">
+        <property name="text">
+         <string>Seleccionar</string>
+        </property>
+       </widget>
+      </item>
+     </layout>
+    </widget>
+   </item>
+   <item row="2" column="0">
+    <widget class="QGroupBox" name="groupBox_3">
+     <property name="title">
+      <string>Resultado</string>
+     </property>
+     <layout class="QVBoxLayout" name="verticalLayout">
+      <item>
+       <widget class="QCheckBox" name="checkBoxDeleteTool">
+        <property name="text">
+         <string>Borrar herramienta de corte</string>
+        </property>
+        <property name="checked">
+         <bool>true</bool>
+        </property>
+       </widget>
+      </item>
+      <item>
+       <widget class="QCheckBox" name="checkBoxDeleteArea">
+        <property name="text">
+         <string>Borrar Area inicial</string>
+        </property>
+       </widget>
+      </item>
+     </layout>
+    </widget>
+   </item>
+  </layout>
+ </widget>
+ <resources/>
+ <connections/>
+</ui>

Project/ProjectSetup.py

@@ -0,0 +1,163 @@
+import FreeCAD
+
+if FreeCAD.GuiUp:
+    import FreeCADGui
+    from PySide import QtGui, QtCore
+    import os
+else:
+    # \cond
+    def translate(ctxt, txt):
+        return txt
+
+    def QT_TRANSLATE_NOOP(ctxt, txt):
+        return txt
+    # \endcond
+
+__title__ = "PVPlant Project Setup"
+__author__ = "Javier Braña"
+__url__ = "http://www.sogos-solar.com"
+
+from PVPlantResources import DirIcons as DirIcons
+
+
+class ProjectSetupDialog(QtGui.QWidget):
+    '''The editmode TaskPanel to select what you want to export'''
+
+    def __init__(self):
+        QtGui.QWidget.__init__(self)
+
+        import os
+        # self.form:
+        self.form = FreeCADGui.PySideUic.loadUi(
+            os.path.join(os.path.dirname(os.path.realpath(__file__)), "ProjectSetup.ui"))
+        #self.form.setWindowIcon(QtGui.QIcon(os.path.join(PVPlantResources.DirIcons, "convert.svg")))
+
+        self.bcnf = FreeCADGui.UiLoader().createWidget("Gui::ColorButton")
+        self.bcnf.setProperty('color', QtGui.QColor(255, 126, 126))
+        self.bcsf = FreeCADGui.UiLoader().createWidget("Gui::ColorButton")
+        self.bcsf.setProperty('color', QtGui.QColor(255, 126, 0))
+        gridLayout = self.form.tab1.layout()
+        gridLayout.addWidget(self.bcnf, 2, 1)
+        gridLayout.addWidget(self.bcsf, 2, 2)
+        self.setdefaultvalues()
+
+        self.layout = QtGui.QHBoxLayout(self)
+        self.layout.setContentsMargins(4, 4, 4, 4)
+        self.layout.addWidget(self.form)
+
+        self.form.buttonAccept.clicked.connect(self.onAcceptClick)
+        self.form.buttonCancel.clicked.connect(self.onCancelClick)
+
+    def setdefaultvalues(self):
+        doc = FreeCAD.ActiveDocument
+        pl = doc.PropertiesList
+        if "MaximumTiltPositive" in pl:
+            self.form.editNFTL.setValue(doc.MaximumTiltPositive)
+
+        if "MaximumTiltPositiveColor" in pl:
+            col = QtGui.QColor()
+            col.setRgbF(doc.MaximumTiltPositiveColor[0], doc.MaximumTiltPositiveColor[1],
+                        doc.MaximumTiltPositiveColor[2])
+            self.bcsf.setProperty('color', col)
+
+        if "MaximumTiltNegative" in pl:
+            self.form.editSFTL.setValue(-doc.MaximumTiltNegative)
+
+        if "MaximumTiltNegativeColor" in pl:
+            col = QtGui.QColor()
+            col.setRgbF(doc.MaximumTiltNegativeColor[0], doc.MaximumTiltNegativeColor[1],
+                        doc.MaximumTiltNegativeColor[2])
+            self.bcnf.setProperty('color', col)
+
+        if "MaximumWestEastSlope" in pl:
+            self.form.editWETL.setValue(doc.MaximumWestEastSlope)
+
+
+    def onAcceptClick(self):
+        doc = FreeCAD.ActiveDocument
+        pl = doc.PropertiesList
+        if not ("FramesChecking" in pl):
+            doc.addProperty("App::PropertyBool",
+                            "FramesChecking",
+                            "PVPlantProject",
+                            "All the frames inside this area."
+                            ).FramesChecking = False
+            doc.setEditorMode("FramesChecking", 1)  # no editable
+            doc.setEditorMode("FramesChecking", 2)  # no visible
+
+        if not ("MaximumTiltPositive" in pl):
+            doc.addProperty("App::PropertyAngle",
+                            "MaximumTiltPositive",
+                            "PVPlantProject",
+                            "All the frames inside this area."
+                            )
+
+        if not ("MaximumTiltPositiveColor" in pl):
+            doc.addProperty("App::PropertyColor",
+                            "MaximumTiltPositiveColor",
+                            "PVPlantProject",
+                            "All the frames inside this area."
+                            )
+
+        if not ("MaximumTiltNegative" in pl):
+            doc.addProperty("App::PropertyAngle",
+                            "MaximumTiltNegative",
+                            "PVPlantProject",
+                            "All the frames inside this area."
+                            )
+
+        if not ("MaximumTiltNegativeColor" in pl):
+            doc.addProperty("App::PropertyColor",
+                            "MaximumTiltNegativeColor",
+                            "PVPlantProject",
+                            "All the frames inside this area."
+                            )
+
+        if not ("MaximumWestEastSlope" in pl):
+            doc.addProperty("App::PropertyAngle",
+                            "MaximumWestEastSlope",
+                            "PVPlantProject",
+                            "All the frames inside this area."
+                            )
+
+        doc.MaximumTiltPositive = self.form.editNFTL.value()
+        col = self.bcsf.property('color')
+        doc.MaximumTiltPositiveColor = (col.redF(), col.greenF(), col.blueF())
+
+        doc.MaximumTiltNegative = -self.form.editSFTL.value()
+        col = self.bcnf.property('color')
+        doc.MaximumTiltNegativeColor = (col.redF(), col.greenF(), col.blueF())
+
+        doc.MaximumWestEastSlope = self.form.editWETL.value()
+
+        self.closeForm()
+
+    def onCancelClick(self):
+        self.closeForm()
+
+    def closeForm(self):
+        self.close()
+
+class CommandProjectSetup:
+    def GetResources(self):
+        return {'Pixmap': str(os.path.join(DirIcons, "flash.svg")),
+                'Accel': "P, S",
+                'MenuText': "Project Setup",
+                'ToolTip': "Setup all the variable for this project"}
+
+    def Activated(self):
+        taskd = ProjectSetupDialog()
+        taskd.setParent(FreeCADGui.getMainWindow())
+        taskd.setWindowFlags(QtCore.Qt.Window)
+        taskd.show()
+
+    def IsActive(self):
+        if FreeCAD.ActiveDocument:
+            return True
+        else:
+            return False
+
+
+if FreeCAD.GuiUp:
+    FreeCADGui.addCommand('ProjectSetup', CommandProjectSetup())
+

Project/ProjectSetup.ui

@@ -0,0 +1,201 @@
+<?xml version="1.0" encoding="UTF-8"?>
+<ui version="4.0">
+ <class>formProjectSetup</class>
+ <widget class="QDialog" name="formProjectSetup">
+  <property name="geometry">
+   <rect>
+    <x>0</x>
+    <y>0</y>
+    <width>485</width>
+    <height>384</height>
+   </rect>
+  </property>
+  <property name="windowTitle">
+   <string>Export to PVSyst</string>
+  </property>
+  <layout class="QVBoxLayout" name="verticalLayout">
+   <property name="leftMargin">
+    <number>5</number>
+   </property>
+   <property name="topMargin">
+    <number>5</number>
+   </property>
+   <property name="rightMargin">
+    <number>5</number>
+   </property>
+   <property name="bottomMargin">
+    <number>5</number>
+   </property>
+   <item>
+    <widget class="QTabWidget" name="tabWidget">
+     <property name="currentIndex">
+      <number>0</number>
+     </property>
+     <widget class="QWidget" name="tab1">
+      <attribute name="title">
+       <string>Frame Tolerances</string>
+      </attribute>
+      <layout class="QGridLayout" name="gridLayout">
+       <property name="spacing">
+        <number>9</number>
+       </property>
+       <item row="1" column="0">
+        <widget class="QLabel" name="label">
+         <property name="text">
+          <string>Maximum north-south slope:</string>
+         </property>
+        </widget>
+       </item>
+       <item row="2" column="0">
+        <widget class="QLabel" name="label_4">
+         <property name="text">
+          <string>Frame coloring:</string>
+         </property>
+        </widget>
+       </item>
+       <item row="5" column="0">
+        <spacer name="verticalSpacer">
+         <property name="orientation">
+          <enum>Qt::Vertical</enum>
+         </property>
+         <property name="sizeHint" stdset="0">
+          <size>
+           <width>20</width>
+           <height>40</height>
+          </size>
+         </property>
+        </spacer>
+       </item>
+       <item row="3" column="0">
+        <widget class="QLabel" name="label_5">
+         <property name="text">
+          <string>Maximum west-east slope:</string>
+         </property>
+        </widget>
+       </item>
+       <item row="3" column="1">
+        <widget class="QDoubleSpinBox" name="editWETL">
+         <property name="alignment">
+          <set>Qt::AlignRight|Qt::AlignTrailing|Qt::AlignVCenter</set>
+         </property>
+         <property name="buttonSymbols">
+          <enum>QAbstractSpinBox::NoButtons</enum>
+         </property>
+         <property name="suffix">
+          <string> º</string>
+         </property>
+         <property name="maximum">
+          <double>90.000000000000000</double>
+         </property>
+         <property name="value">
+          <double>8.000000000000000</double>
+         </property>
+        </widget>
+       </item>
+       <item row="1" column="2">
+        <widget class="QDoubleSpinBox" name="editSFTL">
+         <property name="alignment">
+          <set>Qt::AlignRight|Qt::AlignTrailing|Qt::AlignVCenter</set>
+         </property>
+         <property name="buttonSymbols">
+          <enum>QAbstractSpinBox::NoButtons</enum>
+         </property>
+         <property name="suffix">
+          <string> º</string>
+         </property>
+         <property name="maximum">
+          <double>90.000000000000000</double>
+         </property>
+         <property name="value">
+          <double>2.800000000000000</double>
+         </property>
+        </widget>
+       </item>
+       <item row="4" column="0">
+        <widget class="QWidget" name="widget_2" native="true"/>
+       </item>
+       <item row="0" column="2">
+        <widget class="QLabel" name="label_2">
+         <property name="text">
+          <string>South facing</string>
+         </property>
+         <property name="alignment">
+          <set>Qt::AlignCenter</set>
+         </property>
+        </widget>
+       </item>
+       <item row="1" column="1">
+        <widget class="QDoubleSpinBox" name="editNFTL">
+         <property name="alignment">
+          <set>Qt::AlignRight|Qt::AlignTrailing|Qt::AlignVCenter</set>
+         </property>
+         <property name="buttonSymbols">
+          <enum>QAbstractSpinBox::NoButtons</enum>
+         </property>
+         <property name="suffix">
+          <string> º</string>
+         </property>
+         <property name="maximum">
+          <double>90.000000000000000</double>
+         </property>
+         <property name="value">
+          <double>5.000000000000000</double>
+         </property>
+        </widget>
+       </item>
+       <item row="0" column="1">
+        <widget class="QLabel" name="label_3">
+         <property name="text">
+          <string>North Facing</string>
+         </property>
+         <property name="alignment">
+          <set>Qt::AlignCenter</set>
+         </property>
+        </widget>
+       </item>
+      </layout>
+     </widget>
+     <widget class="QWidget" name="tab2">
+      <attribute name="title">
+       <string>tab2</string>
+      </attribute>
+     </widget>
+     <widget class="QWidget" name="tab3">
+      <attribute name="title">
+       <string>Page</string>
+      </attribute>
+     </widget>
+    </widget>
+   </item>
+   <item>
+    <widget class="QWidget" name="widget" native="true">
+     <layout class="QHBoxLayout" name="horizontalLayout">
+      <item>
+       <widget class="QPushButton" name="buttonAccept">
+        <property name="text">
+         <string>Aceptar</string>
+        </property>
+        <property name="icon">
+         <iconset theme="Accept">
+          <normaloff>../../../../../.designer/backup</normaloff>../../../../../.designer/backup</iconset>
+        </property>
+        <property name="default">
+         <bool>true</bool>
+        </property>
+       </widget>
+      </item>
+      <item>
+       <widget class="QPushButton" name="buttonCancel">
+        <property name="text">
+         <string>Cancelar</string>
+        </property>
+       </widget>
+      </item>
+     </layout>
+    </widget>
+   </item>
+  </layout>
+ </widget>
+ <resources/>
+ <connections/>
+</ui>

Project/utils/renamer.py

@@ -0,0 +1,108 @@
+# /**********************************************************************
+# *                                                                     *
+# * Copyright (c) 2021 Javier Braña <javier.branagutierrez@gmail.com>  *
+# *                                                                     *
+# * This program is free software; you can redistribute it and/or modify*
+# * it under the terms of the GNU Lesser General Public License (LGPL)  *
+# * as published by the Free Software Foundation; either version 2 of   *
+# * the License, or (at your option) any later version.                 *
+# * for detail see the LICENCE text file.                               *
+# *                                                                     *
+# * This program is distributed in the hope that it will be useful,     *
+# * but WITHOUT ANY WARRANTY; without even the implied warranty of      *
+# * MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE.  See the       *
+# * GNU Library General Public License for more details.                *
+# *                                                                     *
+# * You should have received a copy of the GNU Library General Public   *
+# * License along with this program; if not, write to the Free Software *
+# * Foundation, Inc., 59 Temple Place, Suite 330, Boston, MA  02111-1307*
+# * USA                                                                 *
+# *                                                                     *
+# ***********************************************************************
+
+import FreeCAD
+
+if FreeCAD.GuiUp:
+    import FreeCADGui, os
+    from PySide import QtCore
+else:
+    # \cond
+    def translate(ctxt, txt):
+        return txt
+
+    def QT_TRANSLATE_NOOP(ctxt, txt):
+        return txt
+    # \endcond
+
+try:
+    _fromUtf8 = QtCore.QString.fromUtf8
+except AttributeError:
+    def _fromUtf8(s):
+        return s
+
+import PVPlantResources
+from PVPlantResources import DirIcons as DirIcons
+
+
+def rename(objects, mask, mode=0):
+    '''
+    mode = 0/1/2/3
+        0: izquierda a derecha - arriba a abajo
+        1: arriba a abajo - izquierda a derecha
+    '''
+
+    # sort:
+    tmp = sorted(objects, key=lambda x: (x.Placement.Base.x,
+                                         x.Placement.Base.y))
+
+    for idx, obj in tmp:
+        obj.Name = name
+
+class renamerTaskPanel:
+    def __init__(self, obj=None):
+        self.obj = obj
+
+        # -------------------------------------------------------------------------------------------------------------
+        # Module widget form
+        # -------------------------------------------------------------------------------------------------------------
+        self.formRack = FreeCADGui.PySideUic.loadUi(PVPlantResources.__dir__ + "/PVPlantFrame.ui")
+        self.formRack.widgetTracker.setVisible(False)
+        self.formRack.comboFrameType.currentIndexChanged.connect(self.selectionchange)
+
+        self.formPiling = FreeCADGui.PySideUic.loadUi(PVPlantResources.__dir__ + "/PVPlantRackFixedPiling.ui")
+        self.formPiling.editBreadthwaysNumOfPost.valueChanged.connect(self.editBreadthwaysNumOfPostChange)
+        self.formPiling.editAlongNumOfPost.valueChanged.connect(self.editAlongNumOfPostChange)
+
+        self.form = [self.formRack, self.formPiling]
+
+    def accept(self):
+        self.closeForm()
+        return True
+
+    def reject(self):
+        self.closeForm()
+        return False
+
+    def closeForm(self):
+        FreeCADGui.Control.closeDialog()
+
+
+class _CommandRenamer:
+    "the Arch Building command definition"
+
+    def GetResources(self):
+        return {'Pixmap': str(os.path.join(DirIcons, "trackersetup.svg")),
+                'MenuText': QtCore.QT_TRANSLATE_NOOP("PVPlantTracker", "TrackerSetup"),
+                'Accel': "R, F",
+                'ToolTip': QtCore.QT_TRANSLATE_NOOP("PVPlanTracker",
+                                                    "Creates a TrackerSetup object from setup dialog.")}
+
+    def IsActive(self):
+        return (not FreeCAD.ActiveDocument is None and
+                not FreeCAD.ActiveDocument.getObject("Site") is None)
+
+    def Activated(self):
+        self.TaskPanel = renamerTaskPanel()
+        FreeCADGui.Control.showDialog(self.TaskPanel)
+        return
+

Project/utils/renamer.ui

@@ -0,0 +1,90 @@
+<?xml version="1.0" encoding="UTF-8"?>
+<ui version="4.0">
+ <class>formRack</class>
+ <widget class="QDialog" name="formRack">
+  <property name="geometry">
+   <rect>
+    <x>0</x>
+    <y>0</y>
+    <width>255</width>
+    <height>337</height>
+   </rect>
+  </property>
+  <property name="windowTitle">
+   <string>Fixed Frame:</string>
+  </property>
+  <layout class="QVBoxLayout" name="verticalLayout_2">
+   <item>
+    <widget class="QLineEdit" name="lineEdit"/>
+   </item>
+   <item>
+    <widget class="QCheckBox" name="checkBox">
+     <property name="text">
+      <string>Renombrar por sub-planta</string>
+     </property>
+    </widget>
+   </item>
+   <item>
+    <widget class="QGroupBox" name="groupBox">
+     <property name="title">
+      <string>GroupBox</string>
+     </property>
+     <layout class="QVBoxLayout" name="verticalLayout">
+      <item>
+       <widget class="QComboBox" name="comboBox">
+        <item>
+         <property name="text">
+          <string>New Item</string>
+         </property>
+        </item>
+        <item>
+         <property name="text">
+          <string>New Item</string>
+         </property>
+        </item>
+        <item>
+         <property name="text">
+          <string>New Item</string>
+         </property>
+        </item>
+        <item>
+         <property name="text">
+          <string>New Item</string>
+         </property>
+        </item>
+       </widget>
+      </item>
+      <item alignment="Qt::AlignHCenter">
+       <widget class="QLabel" name="label">
+        <property name="sizePolicy">
+         <sizepolicy hsizetype="Fixed" vsizetype="Preferred">
+          <horstretch>0</horstretch>
+          <verstretch>0</verstretch>
+         </sizepolicy>
+        </property>
+        <property name="frameShape">
+         <enum>QFrame::Box</enum>
+        </property>
+        <property name="text">
+         <string/>
+        </property>
+        <property name="scaledContents">
+         <bool>false</bool>
+        </property>
+       </widget>
+      </item>
+     </layout>
+    </widget>
+   </item>
+   <item>
+    <widget class="QGroupBox" name="groupBox_2">
+     <property name="title">
+      <string>Leyenda</string>
+     </property>
+    </widget>
+   </item>
+  </layout>
+ </widget>
+ <resources/>
+ <connections/>
+</ui>

Resources/Cables database/1 kV/PVC Insulated/0.5mm2 Cu_1 core, 1kV V-90 insulated (unsheathed).xml

@@ -0,0 +1,820 @@
+<?xml version='1.0' standalone='yes' ?>
+<LVData xmlns="http://www.ni.com/LVData">
+<Version>12.0f3</Version>
+<Cluster>
+<Name>Cable Data</Name>
+<NumElts>11</NumElts>
+<Cluster>
+<Name>General</Name>
+<NumElts>9</NumElts>
+<String>
+<Name>Title</Name>
+<Val>0.5mm2 Cu_Single core, 1kV V-90 insulated (unsheathed)</Val>
+</String>
+<String>
+<Name>Description</Name>
+<Val>To AS/NZS 5000.1</Val>
+</String>
+<Path>
+<Name>Path</Name>
+<Val>C:\Users\User\Desktop\Cables\Olex LV Handbook\PVC Insulated\0.5mm2 Cu_Single core, 1kV V-90 insulated (unsheathed).xml</Val>
+</Path>
+<DBL>
+<Name>Frequency (Hz)</Name>
+<Val>50.00000000000000</Val>
+</DBL>
+<EL>
+<Name>Phases</Name>
+<Choice>DC</Choice>
+<Choice>Single phase</Choice>
+<Choice>Three phase</Choice>
+<Val>2</Val>
+</EL>
+<EL>
+<Name>Cores</Name>
+<Choice>Single core</Choice>
+<Choice>Multicore</Choice>
+<Val>0</Val>
+</EL>
+<DBL>
+<Name>Voltage, U (phase to phase)</Name>
+<Val>1000.00000000000000</Val>
+</DBL>
+<DBL>
+<Name>Daily load factor, L</Name>
+<Val>0.00000000000000</Val>
+</DBL>
+<DBL>
+<Name>Conductor temperature, theta (deg.C)</Name>
+<Val>0.00000000000000</Val>
+</DBL>
+</Cluster>
+<Cluster>
+<Name>Conductor</Name>
+<NumElts>10</NumElts>
+<EW>
+<Name>Conductor size (mm2)</Name>
+<Choice>0.5 mm2</Choice>
+<Choice>0.75 mm2</Choice>
+<Choice>1 mm2</Choice>
+<Choice>1.5 mm2</Choice>
+<Choice>2.5 mm2</Choice>
+<Choice>4 mm2</Choice>
+<Choice>6 mm2</Choice>
+<Choice>10 mm2</Choice>
+<Choice>16 mm2</Choice>
+<Choice>25 mm2</Choice>
+<Choice>35 mm2</Choice>
+<Choice>50 mm2</Choice>
+<Choice>70 mm2</Choice>
+<Choice>95 mm2</Choice>
+<Choice>120 mm2</Choice>
+<Choice>150 mm2</Choice>
+<Choice>185 mm2</Choice>
+<Choice>240 mm2</Choice>
+<Choice>300 mm2</Choice>
+<Choice>400 mm2</Choice>
+<Choice>500 mm2</Choice>
+<Choice>630 mm2</Choice>
+<Choice>800 mm2</Choice>
+<Choice>1000 mm2</Choice>
+<Choice>1200 mm2</Choice>
+<Choice>1600 mm2</Choice>
+<Choice>1800 mm2</Choice>
+<Choice>2000 mm2</Choice>
+<Choice>2500 mm2</Choice>
+<Val>0</Val>
+</EW>
+<EW>
+<Name>Conductor class</Name>
+<Choice>Class 1 solid conductors for single or multicore cables</Choice>
+<Choice>Class 2 stranded conductors for single or multicore cables</Choice>
+<Choice>Class 5 flexible copper conductors for single or multicore cables</Choice>
+<Choice>Class 6 flexible copper conductors for single or multicore cables</Choice>
+<Val>0</Val>
+</EW>
+<EW>
+<Name>Conductor material</Name>
+<Choice>Copper, plain wires</Choice>
+<Choice>Copper, metal-coated wires</Choice>
+<Choice>Aluminium wires</Choice>
+<Choice>Aluminium alloy wires</Choice>
+<Val>0</Val>
+</EW>
+<Boolean>
+<Name>Hard-drawn Cu? (aerial cable)</Name>
+<Val>0</Val>
+</Boolean>
+<EW>
+<Name>Conductor Type</Name>
+<Choice>Copper_Round, stranded_Dried &amp; impregnated</Choice>
+<Choice>Copper_Round, stranded_Not dried &amp; impregnated</Choice>
+<Choice>Copper_Round, 4 segment</Choice>
+<Choice>Copper_Hollow, helical stranded_Dried and impregnated</Choice>
+<Choice>Copper_Sector-shaped_Dried and impregnated</Choice>
+<Choice>Copper_Sector-shaped_Not dried and impregnated</Choice>
+<Choice>Aluminium_Round, stranded</Choice>
+<Choice>Aluminium_Round, 4 segment</Choice>
+<Choice>Aluminium_Round, 5 segment</Choice>
+<Choice>Aluminium_Round, 6 segment</Choice>
+<Choice>Aluminium, Segmental with peripheral strands</Choice>
+<Val>0</Val>
+</EW>
+<EW>
+<Name>Conductor shape (self inductance)</Name>
+<Choice>Circular</Choice>
+<Choice>Circular compacted</Choice>
+<Choice>Shaped</Choice>
+<Val>0</Val>
+</EW>
+<DBL>
+<Name>External diameter of cable, De (m)</Name>
+<Val>0.00000000000000</Val>
+</DBL>
+<Cluster>
+<Name>DC resistance</Name>
+<NumElts>3</NumElts>
+<EW>
+<Name>Calculation mode:</Name>
+<Choice>Standards</Choice>
+<Choice>Custom</Choice>
+<Val>0</Val>
+</EW>
+<Cluster>
+<Name>Standards</Name>
+<NumElts>3</NumElts>
+<EW>
+<Name>DC resistance calculation based on:</Name>
+<Choice>Insulation max. operating temperature, Theta (deg.C)</Choice>
+<Choice>Conductor operating temperature (deg.C)</Choice>
+<Val>0</Val>
+</EW>
+<DBL>
+<Name>Conductor operating temperature (deg.C)</Name>
+<Val>0.00000000000000</Val>
+</DBL>
+<EW>
+<Name>Standards</Name>
+<Choice>IEC 60228:2004</Choice>
+<Choice>AS/NZS 1125:2001</Choice>
+<Val>1</Val>
+</EW>
+</Cluster>
+<Cluster>
+<Name>Custom</Name>
+<NumElts>2</NumElts>
+<DBL>
+<Name>Resistivity (Rho) ohm.m at 20 deg.C.</Name>
+<Val>3.60000000000000E-2</Val>
+</DBL>
+<DBL>
+<Name>Electrical temp. coeff. of metal, a20 (per K at 20 deg.C)</Name>
+<Val>3.93000000000000E-3</Val>
+</DBL>
+</Cluster>
+</Cluster>
+<Cluster>
+<Name>Conductor No. of Wires</Name>
+<NumElts>2</NumElts>
+<EL>
+<Name>Mode</Name>
+<Choice>Based on conductor size (mm2) and IEC 60228</Choice>
+<Choice>Specify no. of conductors</Choice>
+<Val>0</Val>
+</EL>
+<I32>
+<Name>No. of conductor wires</Name>
+<Val>0</Val>
+</I32>
+</Cluster>
+<Cluster>
+<Name>Conductor diameter</Name>
+<NumElts>2</NumElts>
+<EL>
+<Name>Mode</Name>
+<Choice>Based on conductor size (mm2)</Choice>
+<Choice>Specify conductor diameter</Choice>
+<Val>0</Val>
+</EL>
+<DBL>
+<Name>Nominal conductor diameter, dc (m)</Name>
+<Val>8.00000000000000E-4</Val>
+</DBL>
+</Cluster>
+</Cluster>
+<Cluster>
+<Name>Conductor shield</Name>
+<NumElts>2</NumElts>
+<Boolean>
+<Name>Conductor shield?</Name>
+<Val>0</Val>
+</Boolean>
+<Cluster>
+<Name>Dimensions</Name>
+<NumElts>2</NumElts>
+<DBL>
+<Name>Thickness (m)</Name>
+<Val>3.60000000000000E-3</Val>
+</DBL>
+<DBL>
+<Name>Diameter (m)</Name>
+<Val>8.00000000000000E-3</Val>
+</DBL>
+</Cluster>
+</Cluster>
+<Cluster>
+<Name>Insulation</Name>
+<NumElts>5</NumElts>
+<EW>
+<Name>Type of cable insulation</Name>
+<Choice>Impregnated paper_Solid type, fully- pre- or mass-impregnated non-draining</Choice>
+<Choice>Impregnated paper_Oil-filled, self-contained_up to Uo = 36kV</Choice>
+<Choice>Impregnated paper_Oil-filled, self-contained_up to Uo = 87kV</Choice>
+<Choice>Impregnated paper_Oil-filled, self-contained_up to Uo = 160kV</Choice>
+<Choice>Impregnated paper_Oil-filled, self-contained_up to Uo = 220kV</Choice>
+<Choice>Impregnated paper_Oil-pressure pipe-type</Choice>
+<Choice>Impregnated paper_External gas pressure</Choice>
+<Choice>Impregnated paper_Internal gas pressure</Choice>
+<Choice>Butyl rubber</Choice>
+<Choice>EPR_up to and including 18/30 (36) kV</Choice>
+<Choice>EPR_greater than 18/30 (36) kV</Choice>
+<Choice>PVC</Choice>
+<Choice>PE (HD and LD)</Choice>
+<Choice>XLPE_Unfilled_up to and including 18/30 (36) kV</Choice>
+<Choice>XLPE_Unfilled_greater than 18/30 (36) kV</Choice>
+<Choice>XLPE_Filled_greater than 18/30 (36) kV</Choice>
+<Choice>PPL_equal to or greater than 63/110 kV</Choice>
+<Val>11</Val>
+</EW>
+<EW>
+<Name>Calculation mode:</Name>
+<Choice>Standards</Choice>
+<Choice>Custom</Choice>
+<Val>0</Val>
+</EW>
+<Cluster>
+<Name>Custom</Name>
+<NumElts>2</NumElts>
+<DBL>
+<Name>Epsilon</Name>
+<Val>8.00000000000000</Val>
+</DBL>
+<DBL>
+<Name>Tandelta</Name>
+<Val>0.10000000000000</Val>
+</DBL>
+</Cluster>
+<Cluster>
+<Name>Dimensions</Name>
+<NumElts>2</NumElts>
+<DBL>
+<Name>Thickness (m)</Name>
+<Val>8.00000000000000E-4</Val>
+</DBL>
+<DBL>
+<Name>Diameter (m)</Name>
+<Val>2.40000000000000E-3</Val>
+</DBL>
+</Cluster>
+<I32>
+<Name>Insulation. Max. operating temp., Theta (deg.C)</Name>
+<Val>90</Val>
+</I32>
+</Cluster>
+<Cluster>
+<Name>Insulation screen</Name>
+<NumElts>4</NumElts>
+<Boolean>
+<Name>Insulation screen?</Name>
+<Val>0</Val>
+</Boolean>
+<Cluster>
+<Name>Single core</Name>
+<NumElts>1</NumElts>
+<EW>
+<Name>Material</Name>
+<Choice>Semi-conductor screen</Choice>
+<Choice>Copper screen tape</Choice>
+<Choice>Aluminium screen tape</Choice>
+<Val>0</Val>
+</EW>
+</Cluster>
+<Cluster>
+<Name>Multi-core</Name>
+<NumElts>1</NumElts>
+<EW>
+<Name>Material</Name>
+<Choice>Belted (unscreened)-Multicore</Choice>
+<Choice>Semi-conductor screen</Choice>
+<Choice>Copper screen tape</Choice>
+<Choice>Aluminium screen tape</Choice>
+<Val>1</Val>
+</EW>
+</Cluster>
+<Cluster>
+<Name>Dimensions</Name>
+<NumElts>2</NumElts>
+<DBL>
+<Name>Thickness (m)</Name>
+<Val>2.80000000000000E-3</Val>
+</DBL>
+<DBL>
+<Name>Diameter (m)</Name>
+<Val>8.00000000000000E-3</Val>
+</DBL>
+</Cluster>
+</Cluster>
+<Cluster>
+<Name>Sheath</Name>
+<NumElts>4</NumElts>
+<Boolean>
+<Name>Cable sheath?</Name>
+<Val>0</Val>
+</Boolean>
+<EL>
+<Name>Multicore</Name>
+<Choice>Common</Choice>
+<Choice>Sheath per phase</Choice>
+<Val>0</Val>
+</EL>
+<Cluster>
+<Name>Type of sheath</Name>
+<NumElts>3</NumElts>
+<EW>
+<Name>Type of sheath</Name>
+<Choice>Aluminium</Choice>
+<Choice>Lead</Choice>
+<Choice>Lead with reinforcing tape</Choice>
+<Choice>Copper</Choice>
+<Val>0</Val>
+</EW>
+<EW>
+<Name>Calculation mode:</Name>
+<Choice>Standards</Choice>
+<Choice>Custom</Choice>
+<Val>0</Val>
+</EW>
+<Cluster>
+<Name>Custom</Name>
+<NumElts>2</NumElts>
+<DBL>
+<Name>Resistivity (Rho) ohm.m at 20 deg.C.</Name>
+<Val>0.00000000000000</Val>
+</DBL>
+<DBL>
+<Name>Electrical temp. coeff. of metal, a20 (per K at 20 deg.C)</Name>
+<Val>0.00000000000000</Val>
+</DBL>
+</Cluster>
+</Cluster>
+<Cluster>
+<Name>Construction and dimensions</Name>
+<NumElts>2</NumElts>
+<EW>
+<Name>Construction</Name>
+<Choice>Non-corrugated</Choice>
+<Choice>Corrugated</Choice>
+<Choice>Longitudinally corrugated</Choice>
+<Val>0</Val>
+</EW>
+<Cluster>
+<Name>Dimensions</Name>
+<NumElts>3</NumElts>
+<Cluster>
+<Name>Non-corrugated</Name>
+<NumElts>2</NumElts>
+<DBL>
+<Name>Thickness (m)</Name>
+<Val>2.80000000000000E-3</Val>
+</DBL>
+<DBL>
+<Name>Diameter (m)</Name>
+<Val>8.00000000000000E-3</Val>
+</DBL>
+</Cluster>
+<Cluster>
+<Name>Corrugated</Name>
+<NumElts>3</NumElts>
+<DBL>
+<Name>Thickness of corrugated sheath (m)</Name>
+<Val>0.00000000000000</Val>
+</DBL>
+<DBL>
+<Name>Inner diameter of corrugated sheath (m)</Name>
+<Val>2.40000000000000E-3</Val>
+</DBL>
+<DBL>
+<Name>Outer diameter of corrugated sheath (m)</Name>
+<Val>8.00000000000000E-3</Val>
+</DBL>
+</Cluster>
+<Cluster>
+<Name>Longitudinally corrugated</Name>
+<NumElts>4</NumElts>
+<DBL>
+<Name>Corrugation height</Name>
+<Val>0.00000000000000</Val>
+</DBL>
+<DBL>
+<Name>Inner radius of corrugated sheath (m)</Name>
+<Val>0.00000000000000</Val>
+</DBL>
+<DBL>
+<Name>Outer radius of corrugated sheath (m)</Name>
+<Val>0.00000000000000</Val>
+</DBL>
+<Cluster>
+<Name>Tape</Name>
+<NumElts>5</NumElts>
+<DBL>
+<Name>Overlap (m)</Name>
+<Val>0.00000000000000</Val>
+</DBL>
+<DBL>
+<Name>Width (m)</Name>
+<Val>0.00000000000000</Val>
+</DBL>
+<DBL>
+<Name>Thickness (m)</Name>
+<Val>0.00000000000000</Val>
+</DBL>
+<DBL>
+<Name>Accumulation factor</Name>
+<Val>0.00000000000000</Val>
+</DBL>
+<Cluster>
+<Name>Calculated properties</Name>
+<NumElts>2</NumElts>
+<DBL>
+<Name>Diameter over sheath (m)</Name>
+<Val>0.00000000000000</Val>
+</DBL>
+<DBL>
+<Name>DC resistance at 25 deg.C. (Ohm/m)</Name>
+<Val>0.00000000000000</Val>
+</DBL>
+</Cluster>
+</Cluster>
+</Cluster>
+</Cluster>
+</Cluster>
+</Cluster>
+<Cluster>
+<Name>Sheath reinforcing tape</Name>
+<NumElts>3</NumElts>
+<Boolean>
+<Name>Sheath reinforcing tape?</Name>
+<Val>0</Val>
+</Boolean>
+<Cluster>
+<Name>Material</Name>
+<NumElts>3</NumElts>
+<EW>
+<Name>Calculation mode:</Name>
+<Choice>Standards</Choice>
+<Choice>Custom</Choice>
+<Val>0</Val>
+</EW>
+<Cluster>
+<Name>Custom</Name>
+<NumElts>2</NumElts>
+<DBL>
+<Name>Resistivity (Rho) ohm.m at 20 deg.C.</Name>
+<Val>0.00000000000000</Val>
+</DBL>
+<DBL>
+<Name>Electrical temp. coeff. of metal, a20 (per K at 20 deg.C)</Name>
+<Val>0.00000000000000</Val>
+</DBL>
+</Cluster>
+<EW>
+<Name>Material</Name>
+<Choice>Copper</Choice>
+<Choice>Brass/bronze</Choice>
+<Choice>Zinc</Choice>
+<Choice>Stainless steel</Choice>
+<Choice>Steel</Choice>
+<Val>0</Val>
+</EW>
+</Cluster>
+<Cluster>
+<Name>Dimensions</Name>
+<NumElts>5</NumElts>
+<DBL>
+<Name>Thickness (m)</Name>
+<Val>0.00000000000000</Val>
+</DBL>
+<DBL>
+<Name>Diameter (m)</Name>
+<Val>8.00000000000000E-3</Val>
+</DBL>
+<DBL>
+<Name>Width (m)</Name>
+<Val>1.00000000000000</Val>
+</DBL>
+<DBL>
+<Name>Length of lay (m)</Name>
+<Val>1.00000000000000</Val>
+</DBL>
+<I32>
+<Name>No. of tapes</Name>
+<Val>1</Val>
+</I32>
+</Cluster>
+</Cluster>
+<Cluster>
+<Name>Concentric neutral</Name>
+<NumElts>6</NumElts>
+<Boolean>
+<Name>Concentric neutral?</Name>
+<Val>0</Val>
+</Boolean>
+<EL>
+<Name>Multicore</Name>
+<Choice>Common</Choice>
+<Choice>Around each core</Choice>
+<Val>0</Val>
+</EL>
+<EW>
+<Name>Material</Name>
+<Choice>Custom</Choice>
+<Choice>Copper</Choice>
+<Choice>Brass/bronze</Choice>
+<Choice>Zinc</Choice>
+<Choice>Stainless steel</Choice>
+<Val>1</Val>
+</EW>
+<EW>
+<Name>Construction</Name>
+<Choice>Round wires</Choice>
+<Choice>Flat straps</Choice>
+<Val>0</Val>
+</EW>
+<Cluster>
+<Name>Electrical and magnetic material properties</Name>
+<NumElts>1</NumElts>
+<Cluster>
+<Name>Electrical resistivity and temp. coefficient</Name>
+<NumElts>2</NumElts>
+<DBL>
+<Name>Resistivity (Rho) ohm.m at 20 deg.C.</Name>
+<Val>1.72410000000000E-8</Val>
+</DBL>
+<DBL>
+<Name>Electrical temp. coeff. of metal, a20 (per K at 20 deg.C)</Name>
+<Val>3.93000000000000E-3</Val>
+</DBL>
+</Cluster>
+</Cluster>
+<Cluster>
+<Name>Dimensions</Name>
+<NumElts>2</NumElts>
+<Cluster>
+<Name>Dimensions_Round Wire</Name>
+<NumElts>4</NumElts>
+<DBL>
+<Name>Thickness (m)</Name>
+<Val>2.80000000000000E-3</Val>
+</DBL>
+<DBL>
+<Name>Diameter (m)</Name>
+<Val>8.00000000000000E-3</Val>
+</DBL>
+<DBL>
+<Name>Length of lay (m)</Name>
+<Val>1.00000000000000</Val>
+</DBL>
+<I32>
+<Name>No. of wires</Name>
+<Val>1</Val>
+</I32>
+</Cluster>
+<Cluster>
+<Name>Dimensions_Flat straps</Name>
+<NumElts>5</NumElts>
+<DBL>
+<Name>Thickness (m)</Name>
+<Val>2.80000000000000E-3</Val>
+</DBL>
+<DBL>
+<Name>Diameter (m)</Name>
+<Val>8.00000000000000E-3</Val>
+</DBL>
+<DBL>
+<Name>Strap length (m)</Name>
+<Val>1.00000000000000</Val>
+</DBL>
+<DBL>
+<Name>Length of lay (m)</Name>
+<Val>1.00000000000000</Val>
+</DBL>
+<I32>
+<Name>No. of straps</Name>
+<Val>1</Val>
+</I32>
+</Cluster>
+</Cluster>
+</Cluster>
+<Cluster>
+<Name>Bedding</Name>
+<NumElts>5</NumElts>
+<Boolean>
+<Name>Armour bedding?</Name>
+<Val>0</Val>
+</Boolean>
+<EW>
+<Name>Material</Name>
+<Choice>Compounded jute and fibrous materials</Choice>
+<Choice>Rubber sandwich protection</Choice>
+<Choice>Polychloroprene</Choice>
+<Choice>PVC up to and including 35 kV</Choice>
+<Choice>PVC greater than 35 kV</Choice>
+<Choice>PVC/bitumen on corrugated aluminium sheaths</Choice>
+<Choice>PE</Choice>
+<Val>0</Val>
+</EW>
+<EW>
+<Name>Calculation mode:</Name>
+<Choice>Standards</Choice>
+<Choice>Custom</Choice>
+<Val>0</Val>
+</EW>
+<Cluster>
+<Name>Custom</Name>
+<NumElts>1</NumElts>
+<DBL>
+<Name>Thermal resistivity, rhoT (Cm/W)</Name>
+<Val>6.00000000000000</Val>
+</DBL>
+</Cluster>
+<Cluster>
+<Name>Dimensions</Name>
+<NumElts>2</NumElts>
+<DBL>
+<Name>Thickness (m)</Name>
+<Val>0.99880000000000</Val>
+</DBL>
+<DBL>
+<Name>Diameter (m)</Name>
+<Val>2.00000000000000</Val>
+</DBL>
+</Cluster>
+</Cluster>
+<Cluster>
+<Name>Armour/reinforcing tape</Name>
+<NumElts>4</NumElts>
+<Boolean>
+<Name>Armour/reinforcing tape?</Name>
+<Val>0</Val>
+</Boolean>
+<Cluster>
+<Name>Material</Name>
+<NumElts>1</NumElts>
+<EW>
+<Name>Material</Name>
+<Choice>Custom_non-magnetic tape</Choice>
+<Choice>Steel tape reinforcement</Choice>
+<Choice>Custom_non-magnetic wires</Choice>
+<Choice>Custom_magnetic wires</Choice>
+<Choice>Steel wires_touching</Choice>
+<Choice>Steel wires_not touching</Choice>
+<Choice>Copper armour wires</Choice>
+<Choice>Stainless steel wires</Choice>
+<Choice>TECK armour</Choice>
+<Val>4</Val>
+</EW>
+</Cluster>
+<Cluster>
+<Name>Electrical and magnetic material properties</Name>
+<NumElts>2</NumElts>
+<Cluster>
+<Name>Electrical resistivity and temp. coefficient</Name>
+<NumElts>2</NumElts>
+<DBL>
+<Name>Resistivity (Rho) ohm.m at 20 deg.C.</Name>
+<Val>1.38000000000000E-7</Val>
+</DBL>
+<DBL>
+<Name>Electrical temp. coeff. of metal, a20 (per K at 20 deg.C)</Name>
+<Val>4.50000000000000E-3</Val>
+</DBL>
+</Cluster>
+<Cluster>
+<Name>Magnetic properties (if applicable)</Name>
+<NumElts>4</NumElts>
+<EL>
+<Name>Magnetic properties</Name>
+<Choice>Standard</Choice>
+<Choice>Custom</Choice>
+<Val>0</Val>
+</EL>
+<DBL>
+<Name>Longitudinal relative permeability, Mue-e</Name>
+<Val>10.00000000000000</Val>
+</DBL>
+<DBL>
+<Name>Traverse relative permeability, Mue-t</Name>
+<Val>45.00000000000000</Val>
+</DBL>
+<DBL>
+<Name>Gamma angle (degrees)</Name>
+<Val>45.00000000000000</Val>
+</DBL>
+</Cluster>
+</Cluster>
+<Cluster>
+<Name>Dimensions</Name>
+<NumElts>2</NumElts>
+<Cluster>
+<Name>Dimensions_Wire</Name>
+<NumElts>4</NumElts>
+<DBL>
+<Name>Thickness (m)</Name>
+<Val>2.80000000000000E-3</Val>
+</DBL>
+<DBL>
+<Name>Diameter (m)</Name>
+<Val>8.00000000000000E-3</Val>
+</DBL>
+<DBL>
+<Name>Length of lay (m)</Name>
+<Val>1.00000000000000</Val>
+</DBL>
+<I32>
+<Name>No. of wires</Name>
+<Val>1</Val>
+</I32>
+</Cluster>
+<Cluster>
+<Name>Dimensions_Tape</Name>
+<NumElts>4</NumElts>
+<DBL>
+<Name>Thickness (m)</Name>
+<Val>2.80000000000000E-3</Val>
+</DBL>
+<DBL>
+<Name>Diameter (m)</Name>
+<Val>8.00000000000000E-3</Val>
+</DBL>
+<DBL>
+<Name>Cross-sectional area of tape armour (m2)</Name>
+<Val>1.00000000000000</Val>
+</DBL>
+<EW>
+<Name>Lay of tapes (reinforcement resistance)</Name>
+<Choice>Very long lay (longitudinal tapes)</Choice>
+<Choice>Wound at approximately 54 degrees</Choice>
+<Choice>Wound in very short lay (circumferential tapes)</Choice>
+<Choice>Layers of tapes in contact with each other having a very short lay</Choice>
+<Val>0</Val>
+</EW>
+</Cluster>
+</Cluster>
+</Cluster>
+<Cluster>
+<Name>Jacket/Serving</Name>
+<NumElts>5</NumElts>
+<Boolean>
+<Name>Jacket/Serving?</Name>
+<Val>0</Val>
+</Boolean>
+<EW>
+<Name>Material</Name>
+<Choice>Compounded jute and fibrous materials</Choice>
+<Choice>Rubber sandwich</Choice>
+<Choice>Polychropropene</Choice>
+<Choice>PVC up to and including 35 kV</Choice>
+<Choice>PVC above 35 kV</Choice>
+<Choice>Butyl rubber</Choice>
+<Choice>Coal tar wrapping</Choice>
+<Val>0</Val>
+</EW>
+<EW>
+<Name>Calculation mode:</Name>
+<Choice>Standards</Choice>
+<Choice>Custom</Choice>
+<Val>0</Val>
+</EW>
+<Cluster>
+<Name>Custom</Name>
+<NumElts>1</NumElts>
+<DBL>
+<Name>Thermal resistivity, rhoT (Cm/W)</Name>
+<Val>0.00000000000000</Val>
+</DBL>
+</Cluster>
+<Cluster>
+<Name>Dimensions</Name>
+<NumElts>2</NumElts>
+<DBL>
+<Name>Thickness (m)</Name>
+<Val>2.80000000000000E-3</Val>
+</DBL>
+<DBL>
+<Name>Diameter (m)</Name>
+<Val>8.00000000000000E-3</Val>
+</DBL>
+</Cluster>
+</Cluster>
+</Cluster>
+</LVData>

Resources/Cables database/1 kV/PVC Insulated/1.5mm2 Cu_1 core, 1kV V-90 insulated (unsheathed).xml

@@ -0,0 +1,820 @@
+<?xml version='1.0' standalone='yes' ?>
+<LVData xmlns="http://www.ni.com/LVData">
+<Version>12.0f3</Version>
+<Cluster>
+<Name>Cable Data</Name>
+<NumElts>11</NumElts>
+<Cluster>
+<Name>General</Name>
+<NumElts>9</NumElts>
+<String>
+<Name>Title</Name>
+<Val>1.5mm2 Cu_Single core, 1kV V-90 insulated (unsheathed)</Val>
+</String>
+<String>
+<Name>Description</Name>
+<Val>To AS/NZS 5000.1</Val>
+</String>
+<Path>
+<Name>Path</Name>
+<Val>C:\Users\User\Desktop\Cables\Olex LV Handbook\PVC Insulated\1.5mm2 Cu_Single core, 1kV V-90 insulated (unsheathed).xml</Val>
+</Path>
+<DBL>
+<Name>Frequency (Hz)</Name>
+<Val>50.00000000000000</Val>
+</DBL>
+<EL>
+<Name>Phases</Name>
+<Choice>DC</Choice>
+<Choice>Single phase</Choice>
+<Choice>Three phase</Choice>
+<Val>2</Val>
+</EL>
+<EL>
+<Name>Cores</Name>
+<Choice>Single core</Choice>
+<Choice>Multicore</Choice>
+<Val>0</Val>
+</EL>
+<DBL>
+<Name>Voltage, U (phase to phase)</Name>
+<Val>1000.00000000000000</Val>
+</DBL>
+<DBL>
+<Name>Daily load factor, L</Name>
+<Val>0.00000000000000</Val>
+</DBL>
+<DBL>
+<Name>Conductor temperature, theta (deg.C)</Name>
+<Val>0.00000000000000</Val>
+</DBL>
+</Cluster>
+<Cluster>
+<Name>Conductor</Name>
+<NumElts>10</NumElts>
+<EW>
+<Name>Conductor size (mm2)</Name>
+<Choice>0.5 mm2</Choice>
+<Choice>0.75 mm2</Choice>
+<Choice>1 mm2</Choice>
+<Choice>1.5 mm2</Choice>
+<Choice>2.5 mm2</Choice>
+<Choice>4 mm2</Choice>
+<Choice>6 mm2</Choice>
+<Choice>10 mm2</Choice>
+<Choice>16 mm2</Choice>
+<Choice>25 mm2</Choice>
+<Choice>35 mm2</Choice>
+<Choice>50 mm2</Choice>
+<Choice>70 mm2</Choice>
+<Choice>95 mm2</Choice>
+<Choice>120 mm2</Choice>
+<Choice>150 mm2</Choice>
+<Choice>185 mm2</Choice>
+<Choice>240 mm2</Choice>
+<Choice>300 mm2</Choice>
+<Choice>400 mm2</Choice>
+<Choice>500 mm2</Choice>
+<Choice>630 mm2</Choice>
+<Choice>800 mm2</Choice>
+<Choice>1000 mm2</Choice>
+<Choice>1200 mm2</Choice>
+<Choice>1600 mm2</Choice>
+<Choice>1800 mm2</Choice>
+<Choice>2000 mm2</Choice>
+<Choice>2500 mm2</Choice>
+<Val>3</Val>
+</EW>
+<EW>
+<Name>Conductor class</Name>
+<Choice>Class 1 solid conductors for single or multicore cables</Choice>
+<Choice>Class 2 stranded conductors for single or multicore cables</Choice>
+<Choice>Class 5 flexible copper conductors for single or multicore cables</Choice>
+<Choice>Class 6 flexible copper conductors for single or multicore cables</Choice>
+<Val>0</Val>
+</EW>
+<EW>
+<Name>Conductor material</Name>
+<Choice>Copper, plain wires</Choice>
+<Choice>Copper, metal-coated wires</Choice>
+<Choice>Aluminium wires</Choice>
+<Choice>Aluminium alloy wires</Choice>
+<Val>0</Val>
+</EW>
+<Boolean>
+<Name>Hard-drawn Cu? (aerial cable)</Name>
+<Val>0</Val>
+</Boolean>
+<EW>
+<Name>Conductor Type</Name>
+<Choice>Copper_Round, stranded_Dried &amp; impregnated</Choice>
+<Choice>Copper_Round, stranded_Not dried &amp; impregnated</Choice>
+<Choice>Copper_Round, 4 segment</Choice>
+<Choice>Copper_Hollow, helical stranded_Dried and impregnated</Choice>
+<Choice>Copper_Sector-shaped_Dried and impregnated</Choice>
+<Choice>Copper_Sector-shaped_Not dried and impregnated</Choice>
+<Choice>Aluminium_Round, stranded</Choice>
+<Choice>Aluminium_Round, 4 segment</Choice>
+<Choice>Aluminium_Round, 5 segment</Choice>
+<Choice>Aluminium_Round, 6 segment</Choice>
+<Choice>Aluminium, Segmental with peripheral strands</Choice>
+<Val>0</Val>
+</EW>
+<EW>
+<Name>Conductor shape (self inductance)</Name>
+<Choice>Circular</Choice>
+<Choice>Circular compacted</Choice>
+<Choice>Shaped</Choice>
+<Val>0</Val>
+</EW>
+<DBL>
+<Name>External diameter of cable, De (m)</Name>
+<Val>0.00000000000000</Val>
+</DBL>
+<Cluster>
+<Name>DC resistance</Name>
+<NumElts>3</NumElts>
+<EW>
+<Name>Calculation mode:</Name>
+<Choice>Standards</Choice>
+<Choice>Custom</Choice>
+<Val>0</Val>
+</EW>
+<Cluster>
+<Name>Standards</Name>
+<NumElts>3</NumElts>
+<EW>
+<Name>DC resistance calculation based on:</Name>
+<Choice>Insulation max. operating temperature, Theta (deg.C)</Choice>
+<Choice>Conductor operating temperature (deg.C)</Choice>
+<Val>0</Val>
+</EW>
+<DBL>
+<Name>Conductor operating temperature (deg.C)</Name>
+<Val>0.00000000000000</Val>
+</DBL>
+<EW>
+<Name>Standards</Name>
+<Choice>IEC 60228:2004</Choice>
+<Choice>AS/NZS 1125:2001</Choice>
+<Val>1</Val>
+</EW>
+</Cluster>
+<Cluster>
+<Name>Custom</Name>
+<NumElts>2</NumElts>
+<DBL>
+<Name>Resistivity (Rho) ohm.m at 20 deg.C.</Name>
+<Val>1.21000000000000E-2</Val>
+</DBL>
+<DBL>
+<Name>Electrical temp. coeff. of metal, a20 (per K at 20 deg.C)</Name>
+<Val>3.93000000000000E-3</Val>
+</DBL>
+</Cluster>
+</Cluster>
+<Cluster>
+<Name>Conductor No. of Wires</Name>
+<NumElts>2</NumElts>
+<EL>
+<Name>Mode</Name>
+<Choice>Based on conductor size (mm2) and IEC 60228</Choice>
+<Choice>Specify no. of conductors</Choice>
+<Val>0</Val>
+</EL>
+<I32>
+<Name>No. of conductor wires</Name>
+<Val>0</Val>
+</I32>
+</Cluster>
+<Cluster>
+<Name>Conductor diameter</Name>
+<NumElts>2</NumElts>
+<EL>
+<Name>Mode</Name>
+<Choice>Based on conductor size (mm2)</Choice>
+<Choice>Specify conductor diameter</Choice>
+<Val>0</Val>
+</EL>
+<DBL>
+<Name>Nominal conductor diameter, dc (m)</Name>
+<Val>1.50000000000000E-3</Val>
+</DBL>
+</Cluster>
+</Cluster>
+<Cluster>
+<Name>Conductor shield</Name>
+<NumElts>2</NumElts>
+<Boolean>
+<Name>Conductor shield?</Name>
+<Val>0</Val>
+</Boolean>
+<Cluster>
+<Name>Dimensions</Name>
+<NumElts>2</NumElts>
+<DBL>
+<Name>Thickness (m)</Name>
+<Val>3.25000000000000E-3</Val>
+</DBL>
+<DBL>
+<Name>Diameter (m)</Name>
+<Val>8.00000000000000E-3</Val>
+</DBL>
+</Cluster>
+</Cluster>
+<Cluster>
+<Name>Insulation</Name>
+<NumElts>5</NumElts>
+<EW>
+<Name>Type of cable insulation</Name>
+<Choice>Impregnated paper_Solid type, fully- pre- or mass-impregnated non-draining</Choice>
+<Choice>Impregnated paper_Oil-filled, self-contained_up to Uo = 36kV</Choice>
+<Choice>Impregnated paper_Oil-filled, self-contained_up to Uo = 87kV</Choice>
+<Choice>Impregnated paper_Oil-filled, self-contained_up to Uo = 160kV</Choice>
+<Choice>Impregnated paper_Oil-filled, self-contained_up to Uo = 220kV</Choice>
+<Choice>Impregnated paper_Oil-pressure pipe-type</Choice>
+<Choice>Impregnated paper_External gas pressure</Choice>
+<Choice>Impregnated paper_Internal gas pressure</Choice>
+<Choice>Butyl rubber</Choice>
+<Choice>EPR_up to and including 18/30 (36) kV</Choice>
+<Choice>EPR_greater than 18/30 (36) kV</Choice>
+<Choice>PVC</Choice>
+<Choice>PE (HD and LD)</Choice>
+<Choice>XLPE_Unfilled_up to and including 18/30 (36) kV</Choice>
+<Choice>XLPE_Unfilled_greater than 18/30 (36) kV</Choice>
+<Choice>XLPE_Filled_greater than 18/30 (36) kV</Choice>
+<Choice>PPL_equal to or greater than 63/110 kV</Choice>
+<Val>11</Val>
+</EW>
+<EW>
+<Name>Calculation mode:</Name>
+<Choice>Standards</Choice>
+<Choice>Custom</Choice>
+<Val>0</Val>
+</EW>
+<Cluster>
+<Name>Custom</Name>
+<NumElts>2</NumElts>
+<DBL>
+<Name>Epsilon</Name>
+<Val>8.00000000000000</Val>
+</DBL>
+<DBL>
+<Name>Tandelta</Name>
+<Val>0.10000000000000</Val>
+</DBL>
+</Cluster>
+<Cluster>
+<Name>Dimensions</Name>
+<NumElts>2</NumElts>
+<DBL>
+<Name>Thickness (m)</Name>
+<Val>8.00000000000000E-4</Val>
+</DBL>
+<DBL>
+<Name>Diameter (m)</Name>
+<Val>3.10000000000000E-3</Val>
+</DBL>
+</Cluster>
+<I32>
+<Name>Insulation. Max. operating temp., Theta (deg.C)</Name>
+<Val>90</Val>
+</I32>
+</Cluster>
+<Cluster>
+<Name>Insulation screen</Name>
+<NumElts>4</NumElts>
+<Boolean>
+<Name>Insulation screen?</Name>
+<Val>0</Val>
+</Boolean>
+<Cluster>
+<Name>Single core</Name>
+<NumElts>1</NumElts>
+<EW>
+<Name>Material</Name>
+<Choice>Semi-conductor screen</Choice>
+<Choice>Copper screen tape</Choice>
+<Choice>Aluminium screen tape</Choice>
+<Val>0</Val>
+</EW>
+</Cluster>
+<Cluster>
+<Name>Multi-core</Name>
+<NumElts>1</NumElts>
+<EW>
+<Name>Material</Name>
+<Choice>Belted (unscreened)-Multicore</Choice>
+<Choice>Semi-conductor screen</Choice>
+<Choice>Copper screen tape</Choice>
+<Choice>Aluminium screen tape</Choice>
+<Val>1</Val>
+</EW>
+</Cluster>
+<Cluster>
+<Name>Dimensions</Name>
+<NumElts>2</NumElts>
+<DBL>
+<Name>Thickness (m)</Name>
+<Val>2.45000000000000E-3</Val>
+</DBL>
+<DBL>
+<Name>Diameter (m)</Name>
+<Val>8.00000000000000E-3</Val>
+</DBL>
+</Cluster>
+</Cluster>
+<Cluster>
+<Name>Sheath</Name>
+<NumElts>4</NumElts>
+<Boolean>
+<Name>Cable sheath?</Name>
+<Val>0</Val>
+</Boolean>
+<EL>
+<Name>Multicore</Name>
+<Choice>Common</Choice>
+<Choice>Sheath per phase</Choice>
+<Val>0</Val>
+</EL>
+<Cluster>
+<Name>Type of sheath</Name>
+<NumElts>3</NumElts>
+<EW>
+<Name>Type of sheath</Name>
+<Choice>Aluminium</Choice>
+<Choice>Lead</Choice>
+<Choice>Lead with reinforcing tape</Choice>
+<Choice>Copper</Choice>
+<Val>0</Val>
+</EW>
+<EW>
+<Name>Calculation mode:</Name>
+<Choice>Standards</Choice>
+<Choice>Custom</Choice>
+<Val>0</Val>
+</EW>
+<Cluster>
+<Name>Custom</Name>
+<NumElts>2</NumElts>
+<DBL>
+<Name>Resistivity (Rho) ohm.m at 20 deg.C.</Name>
+<Val>0.00000000000000</Val>
+</DBL>
+<DBL>
+<Name>Electrical temp. coeff. of metal, a20 (per K at 20 deg.C)</Name>
+<Val>0.00000000000000</Val>
+</DBL>
+</Cluster>
+</Cluster>
+<Cluster>
+<Name>Construction and dimensions</Name>
+<NumElts>2</NumElts>
+<EW>
+<Name>Construction</Name>
+<Choice>Non-corrugated</Choice>
+<Choice>Corrugated</Choice>
+<Choice>Longitudinally corrugated</Choice>
+<Val>0</Val>
+</EW>
+<Cluster>
+<Name>Dimensions</Name>
+<NumElts>3</NumElts>
+<Cluster>
+<Name>Non-corrugated</Name>
+<NumElts>2</NumElts>
+<DBL>
+<Name>Thickness (m)</Name>
+<Val>2.45000000000000E-3</Val>
+</DBL>
+<DBL>
+<Name>Diameter (m)</Name>
+<Val>8.00000000000000E-3</Val>
+</DBL>
+</Cluster>
+<Cluster>
+<Name>Corrugated</Name>
+<NumElts>3</NumElts>
+<DBL>
+<Name>Thickness of corrugated sheath (m)</Name>
+<Val>0.00000000000000</Val>
+</DBL>
+<DBL>
+<Name>Inner diameter of corrugated sheath (m)</Name>
+<Val>3.10000000000000E-3</Val>
+</DBL>
+<DBL>
+<Name>Outer diameter of corrugated sheath (m)</Name>
+<Val>8.00000000000000E-3</Val>
+</DBL>
+</Cluster>
+<Cluster>
+<Name>Longitudinally corrugated</Name>
+<NumElts>4</NumElts>
+<DBL>
+<Name>Corrugation height</Name>
+<Val>0.00000000000000</Val>
+</DBL>
+<DBL>
+<Name>Inner radius of corrugated sheath (m)</Name>
+<Val>0.00000000000000</Val>
+</DBL>
+<DBL>
+<Name>Outer radius of corrugated sheath (m)</Name>
+<Val>0.00000000000000</Val>
+</DBL>
+<Cluster>
+<Name>Tape</Name>
+<NumElts>5</NumElts>
+<DBL>
+<Name>Overlap (m)</Name>
+<Val>0.00000000000000</Val>
+</DBL>
+<DBL>
+<Name>Width (m)</Name>
+<Val>0.00000000000000</Val>
+</DBL>
+<DBL>
+<Name>Thickness (m)</Name>
+<Val>0.00000000000000</Val>
+</DBL>
+<DBL>
+<Name>Accumulation factor</Name>
+<Val>0.00000000000000</Val>
+</DBL>
+<Cluster>
+<Name>Calculated properties</Name>
+<NumElts>2</NumElts>
+<DBL>
+<Name>Diameter over sheath (m)</Name>
+<Val>0.00000000000000</Val>
+</DBL>
+<DBL>
+<Name>DC resistance at 25 deg.C. (Ohm/m)</Name>
+<Val>0.00000000000000</Val>
+</DBL>
+</Cluster>
+</Cluster>
+</Cluster>
+</Cluster>
+</Cluster>
+</Cluster>
+<Cluster>
+<Name>Sheath reinforcing tape</Name>
+<NumElts>3</NumElts>
+<Boolean>
+<Name>Sheath reinforcing tape?</Name>
+<Val>0</Val>
+</Boolean>
+<Cluster>
+<Name>Material</Name>
+<NumElts>3</NumElts>
+<EW>
+<Name>Calculation mode:</Name>
+<Choice>Standards</Choice>
+<Choice>Custom</Choice>
+<Val>0</Val>
+</EW>
+<Cluster>
+<Name>Custom</Name>
+<NumElts>2</NumElts>
+<DBL>
+<Name>Resistivity (Rho) ohm.m at 20 deg.C.</Name>
+<Val>0.00000000000000</Val>
+</DBL>
+<DBL>
+<Name>Electrical temp. coeff. of metal, a20 (per K at 20 deg.C)</Name>
+<Val>0.00000000000000</Val>
+</DBL>
+</Cluster>
+<EW>
+<Name>Material</Name>
+<Choice>Copper</Choice>
+<Choice>Brass/bronze</Choice>
+<Choice>Zinc</Choice>
+<Choice>Stainless steel</Choice>
+<Choice>Steel</Choice>
+<Val>0</Val>
+</EW>
+</Cluster>
+<Cluster>
+<Name>Dimensions</Name>
+<NumElts>5</NumElts>
+<DBL>
+<Name>Thickness (m)</Name>
+<Val>0.00000000000000</Val>
+</DBL>
+<DBL>
+<Name>Diameter (m)</Name>
+<Val>8.00000000000000E-3</Val>
+</DBL>
+<DBL>
+<Name>Width (m)</Name>
+<Val>1.00000000000000</Val>
+</DBL>
+<DBL>
+<Name>Length of lay (m)</Name>
+<Val>1.00000000000000</Val>
+</DBL>
+<I32>
+<Name>No. of tapes</Name>
+<Val>1</Val>
+</I32>
+</Cluster>
+</Cluster>
+<Cluster>
+<Name>Concentric neutral</Name>
+<NumElts>6</NumElts>
+<Boolean>
+<Name>Concentric neutral?</Name>
+<Val>0</Val>
+</Boolean>
+<EL>
+<Name>Multicore</Name>
+<Choice>Common</Choice>
+<Choice>Around each core</Choice>
+<Val>0</Val>
+</EL>
+<EW>
+<Name>Material</Name>
+<Choice>Custom</Choice>
+<Choice>Copper</Choice>
+<Choice>Brass/bronze</Choice>
+<Choice>Zinc</Choice>
+<Choice>Stainless steel</Choice>
+<Val>1</Val>
+</EW>
+<EW>
+<Name>Construction</Name>
+<Choice>Round wires</Choice>
+<Choice>Flat straps</Choice>
+<Val>0</Val>
+</EW>
+<Cluster>
+<Name>Electrical and magnetic material properties</Name>
+<NumElts>1</NumElts>
+<Cluster>
+<Name>Electrical resistivity and temp. coefficient</Name>
+<NumElts>2</NumElts>
+<DBL>
+<Name>Resistivity (Rho) ohm.m at 20 deg.C.</Name>
+<Val>1.72410000000000E-8</Val>
+</DBL>
+<DBL>
+<Name>Electrical temp. coeff. of metal, a20 (per K at 20 deg.C)</Name>
+<Val>3.93000000000000E-3</Val>
+</DBL>
+</Cluster>
+</Cluster>
+<Cluster>
+<Name>Dimensions</Name>
+<NumElts>2</NumElts>
+<Cluster>
+<Name>Dimensions_Round Wire</Name>
+<NumElts>4</NumElts>
+<DBL>
+<Name>Thickness (m)</Name>
+<Val>2.45000000000000E-3</Val>
+</DBL>
+<DBL>
+<Name>Diameter (m)</Name>
+<Val>8.00000000000000E-3</Val>
+</DBL>
+<DBL>
+<Name>Length of lay (m)</Name>
+<Val>1.00000000000000</Val>
+</DBL>
+<I32>
+<Name>No. of wires</Name>
+<Val>1</Val>
+</I32>
+</Cluster>
+<Cluster>
+<Name>Dimensions_Flat straps</Name>
+<NumElts>5</NumElts>
+<DBL>
+<Name>Thickness (m)</Name>
+<Val>2.45000000000000E-3</Val>
+</DBL>
+<DBL>
+<Name>Diameter (m)</Name>
+<Val>8.00000000000000E-3</Val>
+</DBL>
+<DBL>
+<Name>Strap length (m)</Name>
+<Val>1.00000000000000</Val>
+</DBL>
+<DBL>
+<Name>Length of lay (m)</Name>
+<Val>1.00000000000000</Val>
+</DBL>
+<I32>
+<Name>No. of straps</Name>
+<Val>1</Val>
+</I32>
+</Cluster>
+</Cluster>
+</Cluster>
+<Cluster>
+<Name>Bedding</Name>
+<NumElts>5</NumElts>
+<Boolean>
+<Name>Armour bedding?</Name>
+<Val>0</Val>
+</Boolean>
+<EW>
+<Name>Material</Name>
+<Choice>Compounded jute and fibrous materials</Choice>
+<Choice>Rubber sandwich protection</Choice>
+<Choice>Polychloroprene</Choice>
+<Choice>PVC up to and including 35 kV</Choice>
+<Choice>PVC greater than 35 kV</Choice>
+<Choice>PVC/bitumen on corrugated aluminium sheaths</Choice>
+<Choice>PE</Choice>
+<Val>0</Val>
+</EW>
+<EW>
+<Name>Calculation mode:</Name>
+<Choice>Standards</Choice>
+<Choice>Custom</Choice>
+<Val>0</Val>
+</EW>
+<Cluster>
+<Name>Custom</Name>
+<NumElts>1</NumElts>
+<DBL>
+<Name>Thermal resistivity, rhoT (Cm/W)</Name>
+<Val>6.00000000000000</Val>
+</DBL>
+</Cluster>
+<Cluster>
+<Name>Dimensions</Name>
+<NumElts>2</NumElts>
+<DBL>
+<Name>Thickness (m)</Name>
+<Val>0.99845000000000</Val>
+</DBL>
+<DBL>
+<Name>Diameter (m)</Name>
+<Val>2.00000000000000</Val>
+</DBL>
+</Cluster>
+</Cluster>
+<Cluster>
+<Name>Armour/reinforcing tape</Name>
+<NumElts>4</NumElts>
+<Boolean>
+<Name>Armour/reinforcing tape?</Name>
+<Val>0</Val>
+</Boolean>
+<Cluster>
+<Name>Material</Name>
+<NumElts>1</NumElts>
+<EW>
+<Name>Material</Name>
+<Choice>Custom_non-magnetic tape</Choice>
+<Choice>Steel tape reinforcement</Choice>
+<Choice>Custom_non-magnetic wires</Choice>
+<Choice>Custom_magnetic wires</Choice>
+<Choice>Steel wires_touching</Choice>
+<Choice>Steel wires_not touching</Choice>
+<Choice>Copper armour wires</Choice>
+<Choice>Stainless steel wires</Choice>
+<Choice>TECK armour</Choice>
+<Val>4</Val>
+</EW>
+</Cluster>
+<Cluster>
+<Name>Electrical and magnetic material properties</Name>
+<NumElts>2</NumElts>
+<Cluster>
+<Name>Electrical resistivity and temp. coefficient</Name>
+<NumElts>2</NumElts>
+<DBL>
+<Name>Resistivity (Rho) ohm.m at 20 deg.C.</Name>
+<Val>1.38000000000000E-7</Val>
+</DBL>
+<DBL>
+<Name>Electrical temp. coeff. of metal, a20 (per K at 20 deg.C)</Name>
+<Val>4.50000000000000E-3</Val>
+</DBL>
+</Cluster>
+<Cluster>
+<Name>Magnetic properties (if applicable)</Name>
+<NumElts>4</NumElts>
+<EL>
+<Name>Magnetic properties</Name>
+<Choice>Standard</Choice>
+<Choice>Custom</Choice>
+<Val>0</Val>
+</EL>
+<DBL>
+<Name>Longitudinal relative permeability, Mue-e</Name>
+<Val>10.00000000000000</Val>
+</DBL>
+<DBL>
+<Name>Traverse relative permeability, Mue-t</Name>
+<Val>45.00000000000000</Val>
+</DBL>
+<DBL>
+<Name>Gamma angle (degrees)</Name>
+<Val>45.00000000000000</Val>
+</DBL>
+</Cluster>
+</Cluster>
+<Cluster>
+<Name>Dimensions</Name>
+<NumElts>2</NumElts>
+<Cluster>
+<Name>Dimensions_Wire</Name>
+<NumElts>4</NumElts>
+<DBL>
+<Name>Thickness (m)</Name>
+<Val>2.45000000000000E-3</Val>
+</DBL>
+<DBL>
+<Name>Diameter (m)</Name>
+<Val>8.00000000000000E-3</Val>
+</DBL>
+<DBL>
+<Name>Length of lay (m)</Name>
+<Val>1.00000000000000</Val>
+</DBL>
+<I32>
+<Name>No. of wires</Name>
+<Val>1</Val>
+</I32>
+</Cluster>
+<Cluster>
+<Name>Dimensions_Tape</Name>
+<NumElts>4</NumElts>
+<DBL>
+<Name>Thickness (m)</Name>
+<Val>2.45000000000000E-3</Val>
+</DBL>
+<DBL>
+<Name>Diameter (m)</Name>
+<Val>8.00000000000000E-3</Val>
+</DBL>
+<DBL>
+<Name>Cross-sectional area of tape armour (m2)</Name>
+<Val>1.00000000000000</Val>
+</DBL>
+<EW>
+<Name>Lay of tapes (reinforcement resistance)</Name>
+<Choice>Very long lay (longitudinal tapes)</Choice>
+<Choice>Wound at approximately 54 degrees</Choice>
+<Choice>Wound in very short lay (circumferential tapes)</Choice>
+<Choice>Layers of tapes in contact with each other having a very short lay</Choice>
+<Val>0</Val>
+</EW>
+</Cluster>
+</Cluster>
+</Cluster>
+<Cluster>
+<Name>Jacket/Serving</Name>
+<NumElts>5</NumElts>
+<Boolean>
+<Name>Jacket/Serving?</Name>
+<Val>0</Val>
+</Boolean>
+<EW>
+<Name>Material</Name>
+<Choice>Compounded jute and fibrous materials</Choice>
+<Choice>Rubber sandwich</Choice>
+<Choice>Polychropropene</Choice>
+<Choice>PVC up to and including 35 kV</Choice>
+<Choice>PVC above 35 kV</Choice>
+<Choice>Butyl rubber</Choice>
+<Choice>Coal tar wrapping</Choice>
+<Val>0</Val>
+</EW>
+<EW>
+<Name>Calculation mode:</Name>
+<Choice>Standards</Choice>
+<Choice>Custom</Choice>
+<Val>0</Val>
+</EW>
+<Cluster>
+<Name>Custom</Name>
+<NumElts>1</NumElts>
+<DBL>
+<Name>Thermal resistivity, rhoT (Cm/W)</Name>
+<Val>0.00000000000000</Val>
+</DBL>
+</Cluster>
+<Cluster>
+<Name>Dimensions</Name>
+<NumElts>2</NumElts>
+<DBL>
+<Name>Thickness (m)</Name>
+<Val>2.45000000000000E-3</Val>
+</DBL>
+<DBL>
+<Name>Diameter (m)</Name>
+<Val>8.00000000000000E-3</Val>
+</DBL>
+</Cluster>
+</Cluster>
+</Cluster>
+</LVData>